You are here:
Sampling Methods for All Parameters
March 09, 2026
AQS Reference Table
JavaScript must be enabled to view this page.
To sort on a column, click the column header. That column will be (subtly) highlighted. Particularly useful is the search box at the top of the table on the right. Separate mulitiple search terms with a space. Search looks across all columns in the table.
Downoad a csv version: methods_all.csv
| Parameter | Parameter Code | Method Code | Recording Mode | Collection Description | Analysis Description | Method Type | Reference Method ID | Equivalent Method | Federal MDL | Min Value | Max Value | Digits | Round Truncate Indicator | Units |
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| 1,1,1,2,2-Pentafluoroethane | 43834 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| 1,1,1,2-Tetrachloroethane | 43837 | 105 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.4 | -0.4 | 1 | R | Parts per billion Carbon | ||||
| 1,1,1,2-Tetrachloroethane | 43837 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.4 | -0.4 | 1 | R | Parts per billion Carbon | ||||
| 1,1,1,2-Tetrachloroethane | 43837 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | 1 | R | Parts per billion Carbon | |||||
| 1,1,1,2-Tetrachloroethane | 43837 | 116 | Intermittent | Mixed Sorbent Cartridge | GC/MS | 29.4 | -29.4 | 1 | R | Parts per billion Carbon | ||||
| 1,1,1,2-Tetrachloroethane | 43837 | 136 | Continuous | iNSTRUMENTAL | ENTECH 2000 W/MS/FID | 29.4 | -29.4 | 1 | R | Parts per billion Carbon | ||||
| 1,1,1,2-Tetrachloroethane | 43837 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.18 | -0.18 | 2 | R | Parts per billion Carbon | ||||
| 1,1,1-Trichloro-2,2-bis (p-chlorophenyl) ethane | 43162 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 1,1,1-Trichloro-2,2-bis (p-chlorophenyl) ethane | 43162 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.01 | -0.01 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 1,1,1-Trichloro-2,2-bis (p-chlorophenyl) ethane | 43162 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | -0.5 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 1.3 | -1.3 | 0 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.004 | -0.004 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.3 | -0.3 | 1 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 105 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.4 | -0.4 | 1 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.4 | -0.4 | 1 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.04 | -0.04 | 1 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 119 | Intermittent | PERSONAL PUMP MOLECULAR SIEVE | GC/MS | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.4 | -0.4 | 1 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.04 | -0.04 | 3 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.14 | -0.14 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2,2-Tetrachloroethane | 43818 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2,2-Tetrachloroethane | 43818 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2,2-Tetrachloroethane | 43818 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2,2-Tetrachloroethane | 43818 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2,2-Tetrachloroethane | 43818 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2,2-Tetrachloroethane | 43818 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2,2-Tetrachloroethane | 43818 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2,2-Tetrachloroethane | 43818 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2,2-Tetrachloroethane | 43818 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2,2-Tetrachloroethane | 43818 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2,2-Tetrachloroethane | 43818 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2,2-Tetrachloroethane | 43818 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2,2-Tetrachloroethane | 43818 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.18 | -0.18 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloro-1,2,2-trifluoroethane | 43821 | 101 | Intermittent | Canister Subambient Pressure | Multi Detector GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloro-1,2,2-trifluoroethane | 43821 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloro-1,2,2-trifluoroethane | 43821 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloro-1,2,2-trifluoroethane | 43821 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloro-1,2,2-trifluoroethane | 43821 | 176 | Intermittent | 6L Subatm SS Canister | Entech Precon GC/MS | 0.032 | -0.032 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloro-1,2,2-trifluoroethane | 43821 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloro-1,2,2-trifluoroethane | 43821 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloro-1,2,2-trifluoroethane | 43821 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloro-1,2,2-trifluoroethane | 43821 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloro-1,2,2-trifluoroethane | 43821 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloro-1,2,2-trifluoroethane | 43821 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloro-1,2,2-trifluoroethane | 43821 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloro-1,2,2-trifluoroethane | 43821 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloro-1,2,2-trifluoroethane | 43821 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloro-1,2,2-trifluoroethane | 43821 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloro-1,2,2-trifluoroethane | 43821 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloro-1,2,2-trifluoroethane | 43821 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloroethane | 43820 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 4.0 | -4.0 | 0 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.25 | -0.25 | 1 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 105 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.4 | -0.4 | 1 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.4 | -0.4 | 1 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.04 | -0.04 | 1 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.08 | -0.08 | 3 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 117 | Intermittent | TENAX SORBENT CARTRIDGE | GC/MS | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.04 | -0.04 | 3 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.14 | -0.14 | 2 | R | Parts per billion Carbon | ||||
| 1,1,2-Trichloroethane | 43820 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloroethane | 43820 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloroethane | 43820 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloroethane | 43820 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloroethane | 43820 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloroethane | 43820 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloroethane | 43820 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloroethane | 43820 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloroethane | 43820 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloroethane | 43820 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloroethane | 43820 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloroethane | 43820 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1,2-Trichloroethane | 43820 | 901 | Intermittent | SKC Pump Charcoal Tube | GC/FID NIOSH 1003 | 1.51 | -1.51 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Biphenyl, chloro (TSP) STP | 17809 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 2.0 | 0.0 | 0 | R | Pg/cubic meter(25 C) | ||||
| 1,1-Bis(4-chlorophenyl)-2,2-dichloroethane | 43134 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 1,1-Bis(4-chlorophenyl)-2,2-dichloroethane | 43134 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | -0.5 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 1,1-Dichloroethane | 43813 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 4.0 | -4.0 | 0 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 105 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.3 | -0.3 | 1 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 117 | Intermittent | TENAX SORBENT CARTRIDGE | GC/MS | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.05 | -0.05 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.04 | -0.04 | 3 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethane | 43813 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Dichloroethane | 43813 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Dichloroethane | 43813 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Dichloroethane | 43813 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Dichloroethane | 43813 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Dichloroethane | 43813 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Dichloroethane | 43813 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Dichloroethane | 43813 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Dichloroethane | 43813 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Dichloroethane | 43813 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Dichloroethane | 43813 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Dichloroethane | 43813 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Dichloroethane | 43813 | 901 | Intermittent | SKC Pump Charcoal Tube | GC/FID NIOSH 1003 | 1.8 | -1.8 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethenylidene bis(4-chlorobenzene) | 43166 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 1,1-Dichloroethenylidene bis(4-chlorobenzene) | 43166 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | -0.5 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 1,1-Dichloroethylene | 43826 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 226.0 | -226.0 | 0 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 2.0 | -2.0 | 0 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.02 | -0.02 | 1 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 105 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECRIV DET | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.04 | -0.04 | 3 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,1-Dichloroethylene | 43826 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Dichloroethylene | 43826 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Dichloroethylene | 43826 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Dichloroethylene | 43826 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Dichloroethylene | 43826 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Dichloroethylene | 43826 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Dichloroethylene | 43826 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Dichloroethylene | 43826 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Dichloroethylene | 43826 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Dichloroethylene | 43826 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Dichloroethylene | 43826 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Dichloroethylene | 43826 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,1-Difluoroethane | 43854 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| 1,2,3,4,5,6- Hexachlolocyclohexane, .beta.- | 43139 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 1,2,3,4,5,6- Hexachlolocyclohexane, .beta.- | 43139 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | -0.5 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 1,2,3,4,5,6- Hexachlorocyclohexane | 43138 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 1,2,3,4,5,6- Hexachlorocyclohexane | 43138 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | -0.5 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 1,2,3,4,5,6- Hexachlorocyclohexane, .delta.- | 43140 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 1,2,3,4,5,6- Hexachlorocyclohexane, .delta.- | 43140 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | -0.5 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 1,2,3,4,6,7,8-Heptachlorodibenzo-p-dioxin (TSP) STP | 16919 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 2.0 | 0.0 | 0 | R | Pg/cubic meter(25 C) | ||||
| 1,2,3,4,6,7,8-Heptachlorodibenzofuran (TSP) STP | 16926 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 2.0 | 0.0 | 0 | R | Pg/cubic meter(25 C) | ||||
| 1,2,3,4,7,8,9-Heptachlorodibenzofuran (TSP) STP | 16927 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 2.0 | 0.0 | 0 | R | Pg/cubic meter(25 C) | ||||
| 1,2,3,4,7,8-Hexachlorodibenzofuran (TSP) STP | 16922 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 2.0 | 0.0 | 0 | R | Pg/cubic meter(25 C) | ||||
| 1,2,3,6,7,8-Hexachlorodibenzo-p-dioxin (TSP) STP | 16917 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 2.0 | 0.0 | 0 | R | Pg/cubic meter(25 C) | ||||
| 1,2,3,6,7,8-Hexachlorodibenzofuran (TSP) STP | 16923 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 2.0 | 0.0 | 0 | R | Pg/cubic meter(25 C) | ||||
| 1,2,3,7,8,9-Hexachlorodibenzo-p-dioxin (TSP) STP | 16918 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 2.0 | 0.0 | 0 | R | Pg/cubic meter(25 C) | ||||
| 1,2,3,7,8,9-Hexachlorodibenzofuran (TSP) STP | 16925 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 2.0 | 0.0 | 0 | R | Pg/cubic meter(25 C) | ||||
| 1,2,3,7,8-Pentachlorodibenzofuran (TSP) STP | 16920 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 2.0 | 0.0 | 0 | R | Pg/cubic meter(25 C) | ||||
| 1,2,3-Trichloropropane | 43604 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | Parts per billion Carbon | |||||
| 1,2,3-Trimethylbenzene | 45225 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,3-Trimethylbenzene | 45225 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,3-Trimethylbenzene | 45225 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,2,3-Trimethylbenzene | 45225 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,3-Trimethylbenzene | 45225 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,3-Trimethylbenzene | 45225 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 1,2,3-Trimethylbenzene | 45225 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| 1,2,3-Trimethylbenzene | 45225 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,2,3-Trimethylbenzene | 45225 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,3-Trimethylbenzene | 45225 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1,2,3-Trimethylbenzene | 45225 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,3-Trimethylbenzene | 45225 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.63 | -0.63 | 2 | R | Parts per billion Carbon | ||||
| 1,2,3-Trimethylbenzene | 45225 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 2.06469 | -2.06469 | 4 | R | Parts per billion Carbon | ||||
| 1,2,3-Trimethylbenzene | 45225 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,3-Trimethylbenzene | 45225 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,3-Trimethylbenzene | 45225 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,3-Trimethylbenzene | 45225 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,3-Trimethylbenzene | 45225 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,3-Trimethylbenzene | 45225 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,2,3-Trimethylbenzene | 45225 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,3-Trimethylbenzene | 45225 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,3-Trimethylbenzene | 45225 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,3-Trimethylbenzene | 45225 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,3-Trimethylbenzene | 45225 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,3-Trimethylbenzene | 45225 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,3-Trimethylbenzene | 45225 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,3-Trimethylbenzene | 45225 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,3-Trimethylbenzene | 45225 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,3-Trimethylbenzene | 45225 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,3-Trimethylbenzene | 45225 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,3-Trimethylbenzene | 45225 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,3-Trimethylbenzene | 45225 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4,5-Tetrachlorobenzene (TSP) STP | 16724 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 30.0 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 1,2,4,5-Tetramethylbenzene | 45231 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,4,5-Tetramethylbenzene | 45231 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4,5-Tetramethylbenzene | 45231 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,4-Trichlorobenzene | 45810 | 101 | Intermittent | Canister Subambient Pressure | Multi Detector GC | 0.016 | -0.016 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trichlorobenzene | 45810 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trichlorobenzene | 45810 | 110 | Intermittent | SS-CANISTER PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| 1,2,4-Trichlorobenzene | 45810 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trichlorobenzene | 45810 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| 1,2,4-Trichlorobenzene | 45810 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 3 | R | Parts per billion Carbon | ||||
| 1,2,4-Trichlorobenzene | 45810 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 1,2,4-Trichlorobenzene | 45810 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trichlorobenzene | 45810 | 136 | Continuous | INSRUMENTAL | ENTECH 2000 W/MS/FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trichlorobenzene | 45810 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trichlorobenzene | 45810 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.016 | -0.016 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trichlorobenzene | 45810 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,4-Trichlorobenzene | 45810 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trichlorobenzene | 45810 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.24 | -0.24 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trichlorobenzene | 45810 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.12 | -0.12 | 3 | R | Parts per billion Carbon | ||||
| 1,2,4-Trichlorobenzene | 45810 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 1.32 | -1.32 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trichlorobenzene | 45810 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4-Trichlorobenzene | 45810 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4-Trichlorobenzene | 45810 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4-Trichlorobenzene | 45810 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4-Trichlorobenzene | 45810 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4-Trichlorobenzene | 45810 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4-Trichlorobenzene | 45810 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4-Trichlorobenzene | 45810 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4-Trichlorobenzene | 45810 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4-Trichlorobenzene | 45810 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4-Trichlorobenzene | 45810 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4-Trichlorobenzene | 45810 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.48 | -0.48 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trichlorobenzene (TSP) STP | 16725 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 27.4 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 1,2,4-Trimethylbenzene | 45208 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.9 | -0.9 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.54 | -0.54 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 3.67187 | -3.67187 | 4 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 1.42 | -1.42 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.18 | -0.18 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.18 | -0.18 | 3 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.63 | -0.63 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene | 45208 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4-Trimethylbenzene | 45208 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4-Trimethylbenzene | 45208 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4-Trimethylbenzene | 45208 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4-Trimethylbenzene | 45208 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4-Trimethylbenzene | 45208 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4-Trimethylbenzene | 45208 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4-Trimethylbenzene | 45208 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4-Trimethylbenzene | 45208 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4-Trimethylbenzene | 45208 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4-Trimethylbenzene | 45208 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4-Trimethylbenzene | 45208 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2,4-Trimethylbenzene & .beta.-pinene | 43364 | 101 | Intermittent | Canister Subambient Pressure | Multi Detector GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene & .beta.-pinene | 43364 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene & .beta.-pinene | 43364 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.42 | -0.42 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene & .beta.-pinene | 43364 | 152 | Continuous | PERKING ELMER DUAL FID | FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1,2,4-Trimethylbenzene & sec-butylbenzene | 43363 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2-Butadiene | 43223 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2-Butadiene | 43223 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 36.0 | -36.0 | 0 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 103 | Intermittent | TENAX/SPHERPCARB SORBENT-TRAP | HEAT DESORPTION GC-HECD | 1.02 | -1.02 | 1 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 1.2 | -1.2 | 1 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.6 | -0.6 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 1.2 | -1.2 | 1 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.12 | -0.12 | 3 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 117 | Intermittent | TENAX SORBENT CARTRIDGE | GC/MS | 0.12 | -0.12 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 3 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/MS/FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 151 | Intermittent | 6L PRESSURIZED CANISTER | CAPILLARY GC-ECD/PID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.6 | -0.6 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 168 | Intermittent | 6L PRESSURIZED CANISTER | PACKED COLUMN GC - ECD/PID | 0.6 | -0.6 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 169 | Intermittent | TEDLAR BAG | PACKED COLUMN GC - ECD/PID | 0.6 | -0.6 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.18 | -0.18 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.12 | -0.12 | 3 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.48 | -0.48 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichlorobenzene | 45805 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichlorobenzene | 45805 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichlorobenzene | 45805 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichlorobenzene | 45805 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichlorobenzene | 45805 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichlorobenzene | 45805 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichlorobenzene | 45805 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichlorobenzene | 45805 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichlorobenzene | 45805 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichlorobenzene | 45805 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichlorobenzene | 45805 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichlorobenzene | 45805 | 901 | Intermittent | SKC Pump Charcoal Tube | GC/FID NIOSH 1003 | 3.8 | -3.8 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene | 45805 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.45 | -0.45 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichlorobenzene (TSP) STP | 16726 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 30.8 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 1,2-Dichloroethene(total) | 43840 | 101 | Intermittent | Canister Subambient Pressure | Multi Detector GC | 0.05 | -0.05 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichloroethene(total) | 43840 | 105 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| 1,2-Dichloroethene(total) | 43840 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| 1,2-Dichloroethene(total) | 43840 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichloroethene(total) | 43840 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| 1,2-Dichloroethene(total) | 43840 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| 1,2-Dichloroethene(total) | 43840 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 1,2-Dichloroethene(total) | 43840 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichloroethene(total) | 43840 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 6.0 | -6.0 | 0 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.66 | -0.66 | 1 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.3 | -0.3 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.3 | -0.3 | 1 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.033 | -0.033 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.25 | -0.25 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.3 | -0.3 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 170 | Intermittent | Adsorption tube Carbotrap 300 (Supelco) | Thermal Desorption GC/MSD | 0.24 | -0.24 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.15 | -0.15 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.06 | -0.06 | 3 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.33 | -0.33 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dichloropropane | 43829 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichloropropane | 43829 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichloropropane | 43829 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichloropropane | 43829 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichloropropane | 43829 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichloropropane | 43829 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichloropropane | 43829 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichloropropane | 43829 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichloropropane | 43829 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichloropropane | 43829 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichloropropane | 43829 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichloropropane | 43829 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,2-Dichloropropane | 43829 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.59 | -0.59 | 2 | R | Parts per billion Carbon | ||||
| 1,2-Dimethylnaphthalene (TSP) STP | 17144 | 105 | Intermittent | Hi Vol/PUF | GC/MS TO-13A | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 1,2-Epoxybutane | 43566 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| 1,2-Epoxybutane (TSP)STP | 16601 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | 0.0 | 3 | Parts per billion | |||||
| 1,2-dimethylnaphthalene (TSP) STP | 17146 | 105 | Intermittent | Hi Vol/PUF | GC/MS TO-13A | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 1,3,5-Trichlorobenzene | 43605 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | Parts per billion Carbon | |||||
| 1,3,5-Trimethylbenzene | 45207 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.9 | -0.9 | 2 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARINA GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.54 | -0.54 | 2 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 3.16435 | -3.16435 | 4 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.86 | -0.86 | 2 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.18 | -0.18 | 2 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.18 | -0.18 | 3 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.72 | -0.72 | 2 | R | Parts per billion Carbon | ||||
| 1,3,5-Trimethylbenzene | 45207 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3,5-Trimethylbenzene | 45207 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3,5-Trimethylbenzene | 45207 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3,5-Trimethylbenzene | 45207 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3,5-Trimethylbenzene | 45207 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3,5-Trimethylbenzene | 45207 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3,5-Trimethylbenzene | 45207 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3,5-Trimethylbenzene | 45207 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3,5-Trimethylbenzene | 45207 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3,5-Trimethylbenzene | 45207 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3,5-Trimethylbenzene | 45207 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3,5-Trimethylbenzene | 45207 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3,5-Trimethylbenzene | 45207 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.93 | -0.93 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 2.0 | -2.0 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 108 | Intermittent | TEDLAR-BAG-24-HR-SAMPLE | GC PHOTOIONIZATION DETECTOR | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 133 | Continuous | SRI Model 8610 Auto GC | Multi Detector FID/PID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.09 | -0.09 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| 1,3-Butadiene | 43218 | 140 | Continuous | UV Spectrometer with URS methods | Spectra reference matching via PLS | 0.4 | -0.4 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 141 | Continuous | IR Spectrometer | Spectra reference matching with PLS | 2.8 | -2.8 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.66125 | -0.66125 | 4 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.63 | -0.63 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 150 | Intermittent | SS 6L - PRESSURIZED CANISTER | CRYOGENIC PRECON:GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 151 | Intermittent | 6L PRESSURIZED CANISTER | CAPILLARY GC-ECD/PID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.4 | -0.4 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 155 | Intermittent | Pressurized Canister | Capiullary GC-PID Multi Point CAL | 0.4 | -0.4 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 168 | Intermittent | 6L PRESSURIZED CANISTER | PACKED COLUMN GC - ECD/PID | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 169 | Intermittent | TEDLAR BAG | PACKED COLUMN GC - ECD/PID | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.12 | -0.12 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 204 | Continuous | Instrumental | Process Analyzer GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 205 | Continuous | Preconcentration trap | GC Dual FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.08 | -0.08 | 3 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.4 | -0.4 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Butadiene | 43218 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Butadiene | 43218 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Butadiene | 43218 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Butadiene | 43218 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Butadiene | 43218 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Butadiene | 43218 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Butadiene | 43218 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Butadiene | 43218 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Butadiene | 43218 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Butadiene | 43218 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Butadiene | 43218 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Butadiene | 43218 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Dichlorobenzene | 45806 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 36.0 | -36.0 | 0 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 1.02 | -1.02 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 1.02 | -1.02 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 109 | Intermittent | SS Canister Subambient pressure | Gas Chromatograph Mass Selective detector | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 1.2 | -1.2 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.12 | -0.12 | 3 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 117 | Intermittent | TENAX SORBENT CARTRIDGE | GC/MS | 0.12 | -0.12 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 3 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/MS/FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 151 | Intermittent | 6L PRESSURIZED CANISTER | CAPILLARY GC-ECD/PID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.6 | -0.6 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 168 | Intermittent | 6L PRESSURIZED CANISTER | PACKED COLUMN GC - ECD/PID | 1.0 | -1.0 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 169 | Intermittent | TEDLAR BAG | PACKED COLUMN GC - ECD/PID | 1.0 | -1.0 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.18 | -0.18 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.12 | -0.12 | 3 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.42 | -0.42 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene | 45806 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Dichlorobenzene | 45806 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Dichlorobenzene | 45806 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Dichlorobenzene | 45806 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Dichlorobenzene | 45806 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Dichlorobenzene | 45806 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Dichlorobenzene | 45806 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Dichlorobenzene | 45806 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Dichlorobenzene | 45806 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Dichlorobenzene | 45806 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Dichlorobenzene | 45806 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Dichlorobenzene | 45806 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,3-Dichlorobenzene | 45806 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.58 | -0.58 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Dichlorobenzene (TSP) STP | 16727 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 25.4 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 1,3-Dichloropropene(total) | 43841 | 105 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Dichloropropene(total) | 43841 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Dichloropropene(total) | 43841 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Dichloropropene(total) | 43841 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Dichloropropene(total) | 43841 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Dichloropropene(total) | 43841 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Dichloropropene(total) | 43841 | 150 | Intermittent | SS 6L - PRESSURIZED CANISTER | CRYOGENIC PRECON:GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Dichloropropene(total) | 43841 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| 1,3-Dinitrobenzene (TSP) STP | 16728 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 37.7 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 1,3-Hexadiene | 43229 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3-Hexadiene | 43229 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,3-dinitropyrene (TSP) STP | 17152 | 101 | Intermittent | HI-VOL/PUF-XAD | GC-MS-SIM | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 1,4-Dichlorobenzene | 45807 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 36.0 | -36.0 | 0 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 1.02 | -1.02 | 1 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 1.2 | -1.2 | 1 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.6 | -0.6 | 2 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 1.2 | -1.2 | 1 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.12 | -0.12 | 3 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 117 | Intermittent | TENAX SORBENT CARTRIDGE | GC/MS | 2.4 | -2.4 | 2 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 119 | Intermittent | PERSONAL PUMP MOLECULAR SIEVE | GC/MS | 3.21 | -3.21 | 0 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 3 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.4 | -0.4 | 1 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 151 | Intermittent | 6L PRESSURIZED CANISTER | CAPILLARY GC-ECD/PID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.6 | -0.6 | 2 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 168 | Intermittent | 6L PRESSURIZED CANISTER | PACKED COLUMN GC - ECD/PID | 1.2 | -1.2 | 2 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 169 | Intermittent | TEDLAR BAG | PACKED COLUMN GC - ECD/PID | 1.2 | -1.2 | 2 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.24 | -0.24 | 2 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.12 | -0.12 | 3 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 1.02 | -1.02 | 2 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,4-Dichlorobenzene | 45807 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,4-Dichlorobenzene | 45807 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,4-Dichlorobenzene | 45807 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,4-Dichlorobenzene | 45807 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,4-Dichlorobenzene | 45807 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,4-Dichlorobenzene | 45807 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,4-Dichlorobenzene | 45807 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,4-Dichlorobenzene | 45807 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,4-Dichlorobenzene | 45807 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,4-Dichlorobenzene | 45807 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,4-Dichlorobenzene | 45807 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,4-Dichlorobenzene | 45807 | 901 | Intermittent | SKC Pump Charcoal Tube | GC/FID NIOSH 1003 | 3.46 | -3.46 | 2 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene | 45807 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.42 | -0.42 | 2 | R | Parts per billion Carbon | ||||
| 1,4-Dichlorobenzene (TSP) STP | 16729 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 28.6 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 1,4-Dichlorobutane | 43847 | 102 | Intermittent | CARTRIDGE-DNPH-ON-SILICA | HPLC ULTRAVIOLET ABSORPTION | 4.0 | -4.0 | 2 | R | Parts per billion Carbon | ||||
| 1,4-Dioxane | 46201 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,4-Dioxane | 46201 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| 1,4-Dioxane | 46201 | 113 | Intermittent | SS-Canister_Pressurized | Capillary GC ITD Mass Spectro | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| 1,4-Dioxane | 46201 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| 1,4-Dioxane | 46201 | 128 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,4-Dioxane | 46201 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,4-Dioxane | 46201 | 150 | Intermittent | SS 6L - PRESSURIZED CANISTER | CRYOGENIC PRECON:GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1,4-Dioxane | 46201 | 176 | Intermittent | 6L Subatm SS Canister | Entech Precon GC/MS | 0.076 | -0.076 | 3 | R | Parts per billion Carbon | ||||
| 1,4-Dioxane | 46201 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1,4-Dioxane | 46201 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.75 | -0.75 | 2 | R | Parts per billion Carbon | ||||
| 1,4-Naphthoquinone (TSP) STP | 16730 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 29.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 1,7-dimethylnaphthalene (TSP) STP | 17143 | 105 | Intermittent | Hi Vol/PUF | GC/MS TO-13A | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 1-Bromopropane | 43853 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Butene | 43280 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Butene | 43280 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Butene | 43280 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Butene | 43280 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Butene | 43280 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 1-Butene | 43280 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| 1-Butene | 43280 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1-Butene | 43280 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Butene | 43280 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1-Butene | 43280 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Butene | 43280 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Butene | 43280 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Butene | 43280 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| 1-Butene | 43280 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.52076 | -0.52076 | 4 | R | Parts per billion Carbon | ||||
| 1-Butene | 43280 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Butene | 43280 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 2.56 | -2.56 | 2 | R | Parts per billion Carbon | ||||
| 1-Butene | 43280 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Butene | 43280 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Butene | 43280 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Butene | 43280 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Butene | 43280 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1-Butene | 43280 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Butene | 43280 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Butene | 43280 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Butene | 43280 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Butene | 43280 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Butene | 43280 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Butene | 43280 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Butene | 43280 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Butene | 43280 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Butene | 43280 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Butene | 43280 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Butene | 43280 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Butene | 43280 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Decene | 43298 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.57 | -0.57 | 2 | R | Parts per billion Carbon | ||||
| 1-Decene | 43298 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 1-Decene | 43298 | 124 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| 1-Decene | 43298 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1-Decene | 43298 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 1.17 | -1.17 | 2 | R | Parts per billion Carbon | ||||
| 1-Heptene | 43328 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.68 | -0.68 | 2 | R | Parts per billion Carbon | ||||
| 1-Heptene | 43328 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 1-Heptene | 43328 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1-Heptene | 43328 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Hexanol | 43344 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Hexanol | 43344 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1-Hexanol | 43344 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Hexanol | 43344 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Hexanol | 43344 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexanol | 43344 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexanol | 43344 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexanol | 43344 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexanol | 43344 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexanol | 43344 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexanol | 43344 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexanol | 43344 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexanol | 43344 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexanol | 43344 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexanol | 43344 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexanol | 43344 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexene | 43245 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.78 | -0.78 | 2 | R | Parts per billion Carbon | ||||
| 1-Hexene | 43245 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1-Hexene | 43245 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Hexene | 43245 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Hexene | 43245 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| 1-Hexene | 43245 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1-Hexene | 43245 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1-Hexene | 43245 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 1.7629 | -1.7629 | 4 | R | Parts per billion Carbon | ||||
| 1-Hexene | 43245 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.016 | -0.016 | 1 | R | Parts per billion Carbon | ||||
| 1-Hexene | 43245 | 149 | Intermittent | 6L Subatm CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.016 | 1 | R | Parts per billion Carbon | ||||
| 1-Hexene | 43245 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Hexene | 43245 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Hexene | 43245 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexene | 43245 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexene | 43245 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexene | 43245 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexene | 43245 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexene | 43245 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexene | 43245 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexene | 43245 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexene | 43245 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexene | 43245 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexene | 43245 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexene | 43245 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Hexene & 2-Methyl-1-pentene | 43173 | 149 | Intermittent | 6l Subatm Canister | Entech Precon- GC/FID/MSD | 1.2 | -1.2 | 1 | R | Parts per million Carbon | ||||
| 1-Hexene & 2-Methyl-1-pentene | 43173 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per million Carbon | ||||
| 1-Methylcyclohexene | 43378 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Methylcyclohexene | 43378 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Methylnaphthalene | 45851 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| 1-Methylnapthalene | 16938 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 1-Methylnapthalene | 16938 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 29.4 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 1-Methylnapthalene | 16938 | 909 | Intermittent | SKC Pump XAD-2 SORBENT Tube | GC/MS NIOSH 5515 REAC SOP 1817 | 4020.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| 1-Naphthylamine (TSP) STP | 16731 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 122.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 1-Nonene | 43279 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.69 | -0.69 | 2 | R | Parts per billion Carbon | ||||
| 1-Nonene | 43279 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 1-Nonene | 43279 | 124 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| 1-Nonene | 43279 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1-Nonene | 43279 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 1.1 | -1.1 | 2 | R | Parts per billion Carbon | ||||
| 1-Octene | 43145 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.86 | -0.86 | 2 | R | Parts per billion Carbon | ||||
| 1-Octene | 43145 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 1-Octene | 43145 | 124 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| 1-Octene | 43145 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1-Octene | 43145 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Pentene | 43224 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Pentene | 43224 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Pentene | 43224 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Pentene | 43224 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Pentene | 43224 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 1-Pentene | 43224 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| 1-Pentene | 43224 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1-Pentene | 43224 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Pentene | 43224 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 1-Pentene | 43224 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Pentene | 43224 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Pentene | 43224 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Pentene | 43224 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| 1-Pentene | 43224 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.56803 | -0.56803 | 4 | R | Parts per billion Carbon | ||||
| 1-Pentene | 43224 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Pentene | 43224 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.31 | -0.31 | 2 | R | Parts per billion Carbon | ||||
| 1-Pentene | 43224 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Pentene | 43224 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Pentene | 43224 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Pentene | 43224 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Pentene | 43224 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1-Pentene | 43224 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 1-Pentene | 43224 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Pentene | 43224 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Pentene | 43224 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Pentene | 43224 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Pentene | 43224 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Pentene | 43224 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Pentene | 43224 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Pentene | 43224 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Pentene | 43224 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Pentene | 43224 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Pentene | 43224 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Pentene | 43224 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 1-Undecene | 43299 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.85 | -0.85 | 2 | R | Parts per billion Carbon | ||||
| 1-Undecene | 43299 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 1-Undecene | 43299 | 124 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| 1-Undecene | 43299 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 1-Undecene | 43299 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.89 | -0.89 | 2 | R | Parts per billion Carbon | ||||
| 1-methylphenanthrene (TSP) STP | 17157 | 105 | Intermittent | Hi Vol/PUF | GC/MS TO-13A | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 1-methylphenanthrene (TSP) STP | 17157 | 106 | Intermittent | Hi-Vol/Puf & XAD-2 | TO-13-EPA610-EPA625 | 0.3 | 1 | R | Nanograms/cubic meter (25 C) | |||||
| 1-nitropyrene (TSP) STP | 17153 | 101 | Intermittent | HI-VOL/PUF-XAD | GC-MS-SIM | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 1-nitropyrene PM2.5 LC | 88393 | 900 | Intermittent | R & P Partisol 2025 Teflon | HPLC tandem MS | 0.01 | 2 | R | Nanograms/cubic meter (LC) | |||||
| 2,2',3,3',4,4',5,5',6-Nonachlorobiphenyl (TSP) STP | 17013 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,3',4,4',5,5'-Octachlorobiphenyl (TSP) STP | 17009 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,3',4,4',5-Heptachlorobiphenyl (TSP) STP | 16936 | 119 | Intermittent | Med Vol PUF/XAD-2 Resin Plug | TO-13A/SW-846 Method 8290 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,2',3,3',4,4',5-Heptachlorobiphenyl (TSP) STP | 16936 | 120 | Intermittent | Hi Vol XAD-2/PUF | TO-13A/SW-846 Method 1668 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,2',3,3',4,4'-Hexachlorobiphenyl (TSP) STP | 16989 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,3',4,5',6'-Heptachlorobiphenyl (TSP) STP | 17002 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,3',4,5',6,6'-Octachlorobiphenyl (TSP) STP | 17011 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,3',4,5'-Hexachlorobiphenyl (TSP) STP | 16990 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,3',4,5,5',6'-Octachlorobiphenyl (TSP) STP | 17010 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,3',4,5,5'-Heptachlorobiphenyl (TSP) STP | 17000 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,3',4,5,6'-Heptachlorobiphenyl (TSP) STP | 17001 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,3',4-Pentachlorobiphenyl (TSP) STP | 17044 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,3',5,5',6-Heptachlorobiphenyl (TSP) STP | 17003 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,3',5-Pentachlorobiphenyl (TSP) STP | 16978 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,3',6-Pentachlorobiphenyl (TSP) STP | 16979 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,3'-Tetrachlorobiphenyl (TSP) STP | 16964 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,4',5',6-Hexachlorobiphenyl (TSP) STP | 16995 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,4',5'-Pentachlorobiphenyl (TSP) STP | 16986 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,4',5,5',6-Heptachlorobiphenyl (TSP) STP | 17007 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,4',5,5'-Hexachlorobiphenyl (TSP) STP | 16994 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.0 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,4',6-Pentachlorobiphenyl (TSP) STP | 16983 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,4,4',5',6-Heptachlorobiphenyl (TSP) STP | 17005 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,4,4',5,5'-Heptachlorobiphenyl (TSP) STP | 16937 | 119 | Intermittent | Med Vol PUF/XAD-2 Resin Plug | TO-13A/SW-846 Method 8290 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,2',3,4,4',5,5'-Heptachlorobiphenyl (TSP) STP | 16937 | 120 | Intermittent | Hi Vol XAD-2/PUF | TO-13A/SW-846 Method 1668 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,2',3,4,4',5,5'-Heptachlorobiphenyl (TSP) STP | 16937 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.25 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,4,4'-Pentachlorobiphenyl (TSP) STP | 16980 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,4,5'-Pentachlorobiphenyl (TSP) STP | 16981 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,4,5,5',6-Heptachlorobiphenyl (TSP) STP | 17006 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,4,5,5'-Hexachlorobiphenyl (TSP) STP | 16993 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,4,6'-Pentachlorobiphenyl (TSP) STP | 16982 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,5',6-Pentachlorobiphenyl (TSP) STP | 16985 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.25 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,5'-Tetrachlorobiphenyl (TSP) STP | 16966 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.25 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,5,5',6-Hexachlorobiphenyl (TSP) STP | 16996 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,5,5'-Pentachlorobiphenyl (TSP) STP | 16984 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,6'-Tetrachlorobiphenyl (TSP) STP | 16968 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',3,6-Tetrachlorobiphenyl (TSP) STP | 16967 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',4,4',5-Pentachlorobiphenyl (TSP) STP | 16987 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',4,5'-Tetrachlorobiphenyl (TSP) STP | 16970 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',4,5,5'-Pentachlorobiphenyl (TSP) STP | 16988 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.0 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',5,5'-Tetrachlorobiphenyl (TSP) STP | 16971 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',5,6'-Tetrachlorobiphenyl (TSP) STP | 16972 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',5-Trichlorobiphenyl (TSP) STP | 16941 | 119 | Intermittent | Med Vol PUF/XAD-2 Resin Plug | TO-13A/SW-846 Method 8290 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,2',5-Trichlorobiphenyl (TSP) STP | 16941 | 120 | Intermittent | Hi Vol XAD-2/PUF | TO-13A/SW-846 Method 1668 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,2',5-Trichlorobiphenyl (TSP) STP | 16941 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2',6-Trichlorobiphenyl (TSP) STP | 16958 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,2,3-Trimethylbutane | 43392 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylhexane | 43376 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.48 | -0.48 | 2 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.74623 | -0.74623 | 4 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.34 | -0.34 | 2 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 176 | Intermittent | 6L Subatm SS Canister | Entech Precon GC/MS | 0.088 | -0.088 | 2 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2,4-Trimethylpentane | 43250 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2,4-Trimethylpentane | 43250 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2,4-Trimethylpentane | 43250 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2,4-Trimethylpentane | 43250 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2,4-Trimethylpentane | 43250 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2,4-Trimethylpentane | 43250 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2,4-Trimethylpentane | 43250 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2,4-Trimethylpentane | 43250 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2,4-Trimethylpentane | 43250 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2,4-Trimethylpentane | 43250 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2,4-Trimethylpentane | 43250 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2,4-Trimethylpentane | 43250 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2-Dichloro-1,1,1-trifluoroethane | 43825 | 116 | Intermittent | Mixed Sorbent Cartridge | GC/MS | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| 2,2-Dichloro-1,1,1-trifluoroethane | 43825 | 117 | Intermittent | TENAX SORBENT CARTRIDG | GC/MS | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylbutane | 43244 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylbutane | 43244 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylbutane | 43244 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylbutane | 43244 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylbutane | 43244 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylbutane | 43244 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylbutane | 43244 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylbutane | 43244 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylbutane | 43244 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylbutane | 43244 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylbutane | 43244 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylbutane | 43244 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylbutane | 43244 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.36 | -0.36 | 2 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylbutane | 43244 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.9081 | -0.9081 | 4 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylbutane | 43244 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylbutane | 43244 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.3 | -0.3 | 2 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylbutane | 43244 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylbutane | 43244 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylbutane | 43244 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylbutane | 43244 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylbutane | 43244 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylbutane | 43244 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylbutane | 43244 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2-Dimethylbutane | 43244 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2-Dimethylbutane | 43244 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2-Dimethylbutane | 43244 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2-Dimethylbutane | 43244 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2-Dimethylbutane | 43244 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2-Dimethylbutane | 43244 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2-Dimethylbutane | 43244 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2-Dimethylbutane | 43244 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2-Dimethylbutane | 43244 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2-Dimethylbutane | 43244 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2-Dimethylbutane | 43244 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,2-Dimethylheptane | 43375 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,2-Dimethylpropane | 43222 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3',4',5-Tetrachlorobiphenyl (TSP) STP | 16975 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.0 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,3',4'-Trichlorobiphenyl (TSP) STP | 16962 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,3',4,4',5'-Pentachlorobiphenyl (TSP) STP | 16946 | 119 | Intermittent | Med Vol PUF/XAD-2 Resin Plug | TO-13A/SW-846 Method 8290 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,3',4,4',5'-Pentachlorobiphenyl (TSP) STP | 16946 | 120 | Intermittent | Hi Vol XAD-2/PUF | TO-13A/SW-846 Method 1668 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,3',4,4',5,5',-Hexachlorobiphenyl (TSP) STP | 16950 | 119 | Intermittent | Med Vol PUF/XAD-2 Resin Plug | TO-13A/SW-846 Method 8290 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,3',4,4',5,5',-Hexachlorobiphenyl (TSP) STP | 16950 | 120 | Intermittent | Hi Vol XAD-2/PUF | TO-13A/SW-846 Method 1668 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,3',4,4',5,5',-Hexachlorobiphenyl (TSP) STP | 16950 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,3',4,4',5-Pentachlorobiphenyl (TSP) STP | 16933 | 119 | Intermittent | Med Vol PUF/XAD-2 Resin Plug | TO-13A/SW-846 Method 8290 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,3',4,4',5-Pentachlorobiphenyl (TSP) STP | 16933 | 120 | Intermittent | Hi Vol XAD-2/PUF | TO-13A/SW-846 Method 1668 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,3',4,4',5-Pentachlorobiphenyl (TSP) STP | 16933 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,3',4,4'-Tetrachlorobiphenyl (TSP) STP | 17043 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,3',4-Trichlorobiphenyl (TSP) STP | 17038 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.25 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,3',5-Trichlorobiphenyl (TSP) STP | 16960 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.25 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,3',6-Trichlorobiphenyl (TSP) STP | 16961 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,3'-Dichlorobiphenyl (TSP) STP | 16954 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,3,3',4',5,5',6-Heptachlorobiphenyl (TSP) STP | 17008 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,3,3',4,4',5'-Hexachlorobiphenyl (TSP) STP | 16949 | 119 | Intermittent | Med Vol PUF/XAD-2 Resin Plug | TO-13A/SW-846 Method 8290 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,3,3',4,4',5'-Hexachlorobiphenyl (TSP) STP | 16949 | 120 | Intermittent | Hi Vol XAD-2/PUF | TO-13A/SW-846 Method 1668 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,3,3',4,4',5,5'-Heptachlorobiphenyl | 16951 | 120 | Intermittent | Hi Vol XAD-2/PUF | TO-13A/SW-846 Method 1668 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,3,3',4,4',5-Hexachlorobiphenyl (TSP) STP | 16948 | 119 | Intermittent | Med Vol PUF/XAD-2 Resin Plug | TO-13A/SW-846 Method 8290 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,3,3',4,4',5-Hexachlorobiphenyl (TSP) STP | 16948 | 120 | Intermittent | Hi Vol XAD-2/PUF | TO-13A/SW-846 Method 1668 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,3,3',4,4',5-Hexachlorobiphenyl (TSP) STP | 16948 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,3,3',4,4',6-Hexachlorobiphenyl (TSP) STP | 16998 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,3,3',4,4'-Pentachlorobiphenyl (TSP) STP | 16934 | 119 | Intermittent | Med Vol PUF/XAD-2 Resin Plug | TO-13A/SW-846 Method 8290 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,3,3',4,4'-Pentachlorobiphenyl (TSP) STP | 16934 | 120 | Intermittent | Hi Vol XAD-2/PUF | TO-13A/SW-846 Method 1668 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,3,4',5-Tetrachlorobiphenyl (TSP) STP | 16974 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,3,4'-Trichlorobiphenyl (TSP) STP | 16959 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.25 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,3,4,4',5-Pentachlorobiphenyl (TSP) STP | 16945 | 119 | Intermittent | Med Vol PUF/XAD-2 Resin Plug | TO-13A/SW-846 Method 8290 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,3,4,4',5-Pentachlorobiphenyl (TSP) STP | 16945 | 120 | Intermittent | Hi Vol XAD-2/PUF | TO-13A/SW-846 Method 1668 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,3,4,6,7,8-Hexachlorodibenzofuran (TSP) STP | 16924 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 2.0 | 0.0 | 0 | R | Pg/cubic meter(25 C) | ||||
| 2,3,4,6-Tetrachlorophenol (TSP) STP | 16732 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 34.7 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 2,3,4,6-Tetrachlorophenol (TSP) STP | 16732 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 2,3,4,7,8-Pentachlorodibenzofuran (TSP) STP | 16921 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 2.0 | 0.0 | 0 | R | Pg/cubic meter(25 C) | ||||
| 2,3,4-Trimethylpentane | 43252 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3,4-Trimethylpentane | 43252 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3,4-Trimethylpentane | 43252 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3,4-Trimethylpentane | 43252 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3,4-Trimethylpentane | 43252 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 2,3,4-Trimethylpentane | 43252 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| 2,3,4-Trimethylpentane | 43252 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2,3,4-Trimethylpentane | 43252 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3,4-Trimethylpentane | 43252 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 2,3,4-Trimethylpentane | 43252 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3,4-Trimethylpentane | 43252 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3,4-Trimethylpentane | 43252 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3,4-Trimethylpentane | 43252 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.48 | -0.48 | 2 | R | Parts per billion Carbon | ||||
| 2,3,4-Trimethylpentane | 43252 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.61333 | -0.61333 | 4 | R | Parts per billion Carbon | ||||
| 2,3,4-Trimethylpentane | 43252 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3,4-Trimethylpentane | 43252 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.59 | -0.59 | 2 | R | Parts per billion Carbon | ||||
| 2,3,4-Trimethylpentane | 43252 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3,4-Trimethylpentane | 43252 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3,4-Trimethylpentane | 43252 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3,4-Trimethylpentane | 43252 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3,4-Trimethylpentane | 43252 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2,3,4-Trimethylpentane | 43252 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3,4-Trimethylpentane | 43252 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3,4-Trimethylpentane | 43252 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3,4-Trimethylpentane | 43252 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3,4-Trimethylpentane | 43252 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3,4-Trimethylpentane | 43252 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3,4-Trimethylpentane | 43252 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3,4-Trimethylpentane | 43252 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3,4-Trimethylpentane | 43252 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3,4-Trimethylpentane | 43252 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3,4-Trimethylpentane | 43252 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3,4-Trimethylpentane | 43252 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3,4-Trimethylpentane | 43252 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3,7,8-Tetrachlorodibenzofuran (TSP) STP | 17825 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 0.05 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,3-Dimethyl-2-pentene | 43241 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethyl-2-pentene | 43241 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylbutane | 43284 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylbutane | 43284 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylbutane | 43284 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylbutane | 43284 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylbutane | 43284 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylbutane | 43284 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylbutane | 43284 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylbutane | 43284 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylbutane | 43284 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylbutane | 43284 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylbutane | 43284 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylbutane | 43284 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| 2,3-Dimethylbutane | 43284 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.78538 | -0.78538 | 4 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylbutane | 43284 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylbutane | 43284 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.28 | -0.28 | 2 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylbutane | 43284 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylbutane | 43284 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylbutane | 43284 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylbutane | 43284 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylbutane | 43284 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylbutane | 43284 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylbutane | 43284 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-Dimethylbutane | 43284 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-Dimethylbutane | 43284 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-Dimethylbutane | 43284 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-Dimethylbutane | 43284 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-Dimethylbutane | 43284 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-Dimethylbutane | 43284 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-Dimethylbutane | 43284 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-Dimethylbutane | 43284 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-Dimethylbutane | 43284 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-Dimethylbutane | 43284 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-Dimethylbutane | 43284 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-Dimethylbutane & 2-Methylpentane | 43174 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylbutane & 2-Methylpentane | 43174 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylhexane | 43294 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylhexane | 43294 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylpentane | 43291 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylpentane | 43291 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylpentane | 43291 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylpentane | 43291 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylpentane | 43291 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylpentane | 43291 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylpentane | 43291 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylpentane | 43291 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylpentane | 43291 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylpentane | 43291 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylpentane | 43291 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylpentane | 43291 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylpentane | 43291 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| 2,3-Dimethylpentane | 43291 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.70544 | -0.70544 | 4 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylpentane | 43291 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylpentane | 43291 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.29 | -0.29 | 2 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylpentane | 43291 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylpentane | 43291 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylpentane | 43291 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylpentane | 43291 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylpentane | 43291 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylpentane | 43291 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,3-Dimethylpentane | 43291 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-Dimethylpentane | 43291 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-Dimethylpentane | 43291 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-Dimethylpentane | 43291 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-Dimethylpentane | 43291 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-Dimethylpentane | 43291 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-Dimethylpentane | 43291 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-Dimethylpentane | 43291 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-Dimethylpentane | 43291 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-Dimethylpentane | 43291 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-Dimethylpentane | 43291 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-Dimethylpentane | 43291 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,3-dimethylnaphthalene (TSP) STP | 17145 | 105 | Intermittent | Hi Vol/PUF | GC/MS TO-13A | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 2,4',5-Trichlorobiphenyl (TSP) STP | 16943 | 119 | Intermittent | Med Vol PUF/XAD-2 Resin Plug | TO-13A/SW-846 Method 8290 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,4',5-Trichlorobiphenyl (TSP) STP | 16943 | 120 | Intermittent | Hi Vol XAD-2/PUF | TO-13A/SW-846 Method 1668 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,4'-Dichlorobiphenyl (TSP) STP | 16939 | 119 | Intermittent | Med Vol PUF/XAD-2 Resin Plug | TO-13A/SW-846 Method 8290 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,4'-Dichlorobiphenyl (TSP) STP | 16939 | 120 | Intermittent | Hi Vol XAD-2/PUF | TO-13A/SW-846 Method 1668 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,4'-Dichlorobiphenyl (TSP) STP | 16939 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 8.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,4,4',5-Tetrachlorobiphenyl (TSP) STP | 16977 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.0 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 2,4,4'-Trichlorobiphenyl (TSP) STP | 16942 | 119 | Intermittent | Med Vol PUF/XAD-2 Resin Plug | TO-13A/SW-846 Method 8290 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,4,4'-Trichlorobiphenyl (TSP) STP | 16942 | 120 | Intermittent | Hi Vol XAD-2/PUF | TO-13A/SW-846 Method 1668 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 2,4,4'-Trichlorobiphenyl (TSP) STP | 16942 | 121 | Intermittent | Hi Vol Puf(PS-1) | High resolution GC-ECD(Electron CApture Detector) | 3.33 | 2 | R | Pg/cubic meter(25 C) | |||||
| 2,4,4-Trimethyl-1-pentene | 43274 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2,4,4-Trimethyl-1-pentene | 43274 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2,4,4-Trimethyl-2-pentene | 43275 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,4,5-Trichlorophenol (TSP) STP | 16733 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 32.7 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 2,4,5-Trichlorophenol (TSP) STP | 16733 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 2,4,6-Trichlorophenol (TSP) STP | 16734 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 24.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 2,4,6-Trichlorophenol (TSP) STP | 16734 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 2,4-Dichlorophenol (TSP) STP | 16735 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 28.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 2,4-Dichlorophenol (TSP) STP | 16735 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 2,4-Dichlorophenoxyacetic acid methyl ester | 43136 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 1.0 | -1.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 2,4-Dimethylhexane | 43293 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylhexane | 43293 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylpentane | 43247 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylpentane | 43247 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylpentane | 43247 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylpentane | 43247 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylpentane | 43247 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylpentane | 43247 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylpentane | 43247 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylpentane | 43247 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylpentane | 43247 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylpentane | 43247 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylpentane | 43247 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylpentane | 43247 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylpentane | 43247 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.42 | -0.42 | 2 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylpentane | 43247 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.63553 | -0.63553 | 4 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylpentane | 43247 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylpentane | 43247 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.19 | -0.19 | 2 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylpentane | 43247 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylpentane | 43247 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylpentane | 43247 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylpentane | 43247 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylpentane | 43247 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylpentane | 43247 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,4-Dimethylpentane | 43247 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,4-Dimethylpentane | 43247 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,4-Dimethylpentane | 43247 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,4-Dimethylpentane | 43247 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,4-Dimethylpentane | 43247 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,4-Dimethylpentane | 43247 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,4-Dimethylpentane | 43247 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,4-Dimethylpentane | 43247 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,4-Dimethylpentane | 43247 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,4-Dimethylpentane | 43247 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,4-Dimethylpentane | 43247 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,4-Dimethylpentane | 43247 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2,4-Dimethylphenol (TSP) STP | 16736 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 163.9 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 2,4-Dimethylphenol (TSP) STP | 16736 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 2,4-Dinitrophenol (TSP) STP | 16737 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 40.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 2,4-Dinitrophenol (TSP) STP | 16737 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 2,4-Dinitrotoluene (TSP) STP | 16738 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 32.7 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 2,4-Toluene Diisocyanate | 17906 | 180 | Intermittent | Lo-Vol/Glass Fiber Filter | OSHA No. 42 | 0.025 | 3 | Micrograms/cubic meter (LC) | ||||||
| 2,5-Dimethylbenzaldehyde | 45503 | 102 | Intermittent | DNPH-COATED CARTRIDGE | HPLC (TO-14) | 0.55 | -0.55 | 1 | R | Parts per billion Carbon | ||||
| 2,5-Dimethylbenzaldehyde | 45503 | 114 | Intermittent | CARTRIDGE-DNPH-SILICA-SEP-PAK | HPLC-PHOTODIODE ARRAY | 0.085 | -0.085 | 2 | R | Parts per billion Carbon | ||||
| 2,5-Dimethylbenzaldehyde | 45503 | 130 | Intermittent | DNPH-COATED CARTRIDGE | HPLC (TO-14) | 0.55 | -0.55 | 1 | R | Parts per billion Carbon | ||||
| 2,5-Dimethylbenzaldehyde | 45503 | 156 | Intermittent | Cartridge DNPH on Silica, Heated O3 Denuder | HPLC Photo Diode Array | 0.175 | -0.175 | 2 | R | Parts per billion Carbon | ||||
| 2,5-Dimethylbenzaldehyde | 45503 | 165 | Intermittent | ATEC 2400 W/Waters Silica DNPH | HP LC-1050 W/Diode Array Detector | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| 2,5-Dimethylbenzaldehyde | 45503 | 166 | Intermittent | ATEC 2400 W/Waters Silica DNPH | TO-11 Dionex DX-300 Ion Chrmtg | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| 2,5-Dimethylbenzaldehyde | 45503 | 179 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | Liquid Chromatography w/diode array detection | 0.09 | -0.09 | 2 | R | Parts per billion Carbon | ||||
| 2,5-Dimethylbenzaldehyde | 45503 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,5-Dimethylhexane | 43955 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2,5-Dimethylhexane | 43955 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2,6-Dichlorophenol (TSP) STP | 16739 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 28.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 2,6-Dichlorophenol (TSP) STP | 16739 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 2,6-Dinitrotoluene (TSP) STP | 16740 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 33.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 2,6-dimethylnaphthalene (TSP) STP | 17142 | 105 | Intermittent | Hi Vol/PUF | GC/MS TO-13A | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 2,6-dimethylnaphthalene (TSP) STP | 17142 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 2,6-dimethylnaphthalene (TSP) STP | 17142 | 909 | Intermittent | SKC Pump XAD-2 SORBENT Tube | GC/MS NIOSH 5515 REAC SOP 1817 | 4260.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| 2,7-dimethylnaphthalene (TSP) STP | 17140 | 106 | Intermittent | HI-VOL/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 2 | R | Nanograms/cubic meter (25 C) | |||||
| 2-2-3-Trimethylpentane | 43292 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.86 | -0.86 | 2 | R | Parts per billion Carbon | ||||
| 2-2-3-Trimethylpentane | 43292 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 2-2-3-Trimethylpentane | 43292 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2-6-TOLUENEDIISOCYANATE | 17911 | 180 | Intermittent | Lo-Vol/Glass Fiber Filter | OSHA No. 42 | 0.025 | 3 | Micrograms/cubic meter (LC) | ||||||
| 2-Acetylaminofluorene (TSP) STP | 16741 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 16.9 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 2-Chloroethyl vinyl ether | 43833 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 6.0 | -6.0 | 0 | R | Parts per billion Carbon | ||||
| 2-Chloroethyl vinyl ether | 43833 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Chloroethyl vinyl ether | 43833 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Chloronaphthalene (TSP) STP | 16742 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 20.5 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 2-Chloropentane | 43331 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Chloropentane | 43331 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.5 | -0.5 | 2 | R | Parts per billion Carbon | ||||
| 2-Chloropentane | 43331 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Chloropentane | 43331 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Chloropentane | 43331 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2-Chloropentane | 43331 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Chloropentane | 43331 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Chloropentane | 43331 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Chloropentane | 43331 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Chloropentane | 43331 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Chloropentane | 43331 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Chloropentane | 43331 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Chloropentane | 43331 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Chloropentane | 43331 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Chloropentane | 43331 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Chloropentane | 43331 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Chloropentane | 43331 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Chlorophenol (TSP) STP | 16743 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 38.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 2-Chlorophenol (TSP) STP | 16743 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 2-Ethyl-1-butene | 43236 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.78 | -0.78 | 2 | R | Parts per billion Carbon | ||||
| 2-Ethyl-1-butene | 43236 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 2-Ethyl-1-butene | 43236 | 124 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| 2-Ethyl-1-butene | 43236 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-butene | 43225 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.78 | -0.78 | 2 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-butene | 43225 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-butene | 43225 | 124 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-butene | 43225 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-butene | 43225 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-pentene | 43246 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-pentene | 43246 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-pentene | 43246 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-pentene | 43246 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-pentene | 43246 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-pentene | 43246 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-pentene | 43246 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-pentene | 43246 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-pentene | 43246 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-pentene | 43246 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-pentene | 43246 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-pentene | 43246 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-pentene | 43246 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-pentene | 43246 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.11 | -0.11 | 2 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-pentene | 43246 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-pentene | 43246 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-pentene | 43246 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-pentene | 43246 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-pentene | 43246 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2-Methyl-1-pentene | 43246 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-1-pentene | 43246 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-1-pentene | 43246 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-1-pentene | 43246 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-1-pentene | 43246 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-1-pentene | 43246 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-1-pentene | 43246 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-1-pentene | 43246 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-1-pentene | 43246 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-1-pentene | 43246 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-1-pentene | 43246 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-1-pentene | 43246 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-2-butene | 43228 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-2-butene | 43228 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-2-butene | 43228 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-2-butene | 43228 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-2-butene | 43228 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-2-butene | 43228 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 2 | R | Parts per billion Carbon | ||||
| 2-Methyl-2-butene | 43228 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2-Methyl-2-butene | 43228 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-2-butene | 43228 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 2-Methyl-2-butene | 43228 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-2-butene | 43228 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-2-butene | 43228 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-2-butene | 43228 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.4 | -0.4 | 2 | R | Parts per billion Carbon | ||||
| 2-Methyl-2-butene | 43228 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-2-butene | 43228 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-2-butene | 43228 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-2-butene | 43228 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-2-butene | 43228 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2-Methyl-2-butene | 43228 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-2-butene | 43228 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-2-butene | 43228 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-2-butene | 43228 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-2-butene | 43228 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-2-butene | 43228 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-2-butene | 43228 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-2-butene | 43228 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-2-butene | 43228 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-2-butene | 43228 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-2-butene | 43228 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-2-butene | 43228 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methyl-2-butene & 1-pentene | 43343 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2-Methyl-2-pentene | 43237 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2-Methyl-2-pentene | 43237 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-2-pentene | 43237 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methyl-3-hexanone | 43564 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2-Methylheptane | 43960 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylheptane | 43960 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylheptane | 43960 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylheptane | 43960 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylheptane | 43960 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylheptane | 43960 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| 2-Methylheptane | 43960 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2-Methylheptane | 43960 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylheptane | 43960 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 2-Methylheptane | 43960 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylheptane | 43960 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylheptane | 43960 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylheptane | 43960 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.48 | -0.48 | 2 | R | Parts per billion Carbon | ||||
| 2-Methylheptane | 43960 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.47558 | -0.47558 | 4 | R | Parts per billion Carbon | ||||
| 2-Methylheptane | 43960 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylheptane | 43960 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.89 | -0.89 | 2 | R | Parts per billion Carbon | ||||
| 2-Methylheptane | 43960 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylheptane | 43960 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylheptane | 43960 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylheptane | 43960 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylheptane | 43960 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2-Methylheptane | 43960 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylheptane | 43960 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylheptane | 43960 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylheptane | 43960 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylheptane | 43960 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylheptane | 43960 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylheptane | 43960 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylheptane | 43960 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylheptane | 43960 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylheptane | 43960 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylheptane | 43960 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylheptane | 43960 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylheptane | 43960 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylheptane & 3-Methylheptane | 43172 | 123 | Intermittent | 6L Pressurized Canister | Dual FID - PAMS | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylhexane | 43263 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylhexane | 43263 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylhexane | 43263 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylhexane | 43263 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylhexane | 43263 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylhexane | 43263 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylhexane | 43263 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2-Methylhexane | 43263 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylhexane | 43263 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 2-Methylhexane | 43263 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylhexane | 43263 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylhexane | 43263 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylhexane | 43263 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| 2-Methylhexane | 43263 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.52839 | -0.52839 | 4 | R | Parts per billion Carbon | ||||
| 2-Methylhexane | 43263 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylhexane | 43263 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.16 | -0.16 | 2 | R | Parts per billion Carbon | ||||
| 2-Methylhexane | 43263 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylhexane | 43263 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylhexane | 43263 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylhexane | 43263 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylhexane | 43263 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2-Methylhexane | 43263 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylhexane | 43263 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylhexane | 43263 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylhexane | 43263 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylhexane | 43263 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylhexane | 43263 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylhexane | 43263 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylhexane | 43263 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylhexane | 43263 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylhexane | 43263 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylhexane | 43263 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylhexane | 43263 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylhexane | 43263 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylhexane & 2,3-dimethylpentane | 43362 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2-Methylhexane & 2,3-dimethylpentane | 43362 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2-Methylhexane & 2,3-dimethylpentane | 43362 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.42 | -0.42 | 2 | R | Parts per billion Carbon | ||||
| 2-Methylhexane & cyclohexane | 43347 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylnaphthalene | 45852 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| 2-Methylnaphthalene (TSP) STP | 16915 | 096 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.002 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 2-Methylnaphthalene (TSP) STP | 16915 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 0.0089 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| 2-Methylnaphthalene (TSP) STP | 16915 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 2-Methylnaphthalene (TSP) STP | 16915 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 29.4 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 2-Methylnaphthalene (TSP) STP | 16915 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.0474 | 4 | R | Nanograms/cubic meter (25 C) | |||||
| 2-Methylnaphthalene (TSP) STP | 16915 | 909 | Intermittent | SKC Pump XAD-2 Sorbent Tubes | GC/MS NIOSH 5515 REAC SOP1817 | 4230.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| 2-Methylpentane | 43285 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylpentane | 43285 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylpentane | 43285 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylpentane | 43285 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylpentane | 43285 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylpentane | 43285 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylpentane | 43285 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2-Methylpentane | 43285 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylpentane | 43285 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 2-Methylpentane | 43285 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylpentane | 43285 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylpentane | 43285 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| 2-Methylpentane | 43285 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.82659 | -0.82659 | 4 | R | Parts per billion Carbon | ||||
| 2-Methylpentane | 43285 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylpentane | 43285 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.32 | -0.32 | 2 | R | Parts per billion Carbon | ||||
| 2-Methylpentane | 43285 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylpentane | 43285 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylpentane | 43285 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylpentane | 43285 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylpentane | 43285 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2-Methylpentane | 43285 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Methylpentane | 43285 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylpentane | 43285 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylpentane | 43285 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylpentane | 43285 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylpentane | 43285 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylpentane | 43285 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylpentane | 43285 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylpentane | 43285 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylpentane | 43285 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylpentane | 43285 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylpentane | 43285 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Methylpentane | 43285 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Naphthylamine (TSP) STP | 16744 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 120.5 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 2-Nitroaniline (TSP) STP | 16745 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 32.0 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 2-Nitrophenol (TSP) STP | 16746 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 46.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 2-Nitrophenol (TSP) STP | 16746 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 2-Nitropropane | 43756 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| 2-Nitropropane | 43756 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Nitropropane | 43756 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Pentanone | 43562 | 150 | Intermittent | SS 6L- Pressurized Canister | Cryogenic Precon: GC/MS | 0.1 | -0.1 | 1 | Parts per billion Carbon | |||||
| 2-Picoline (TSP) STP | 16747 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 161.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 2-Propanol | 43312 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2-Propanol | 43312 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Propanol | 43312 | 113 | Intermittent | SS-Canister_Pressurized | Capillary GC ITD Mass Spectro | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| 2-Propanol | 43312 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 29.4 | -29.4 | 1 | R | Parts per billion Carbon | ||||
| 2-Propanol | 43312 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 2-Propanol | 43312 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Propanol | 43312 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Propanol | 43312 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 5.04 | -5.04 | 2 | R | Parts per billion Carbon | ||||
| 2-Propanol | 43312 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Propanol | 43312 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Propanol | 43312 | 150 | Intermittent | SS 6L - PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 2-Propanol | 43312 | 176 | Intermittent | 6L Subatm SS Canister | Entech Precon GC/MS | 0.165 | -0.165 | 2 | R | Parts per billion Carbon | ||||
| 2-Propanol | 43312 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Propanol | 43312 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Propanol | 43312 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Propanol | 43312 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Propanol | 43312 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Propanol | 43312 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Propanol | 43312 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Propanol | 43312 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Propanol | 43312 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Propanol | 43312 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Propanol | 43312 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-Propanol | 43312 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 2-chlorotoluene | 45811 | 150 | Intermittent | SS 6-L Pressurized Canister | Cryogenic Precon: GC/MS | 0.105 | 3 | Parts per billion Carbon | ||||||
| 2-chlorotoluene | 45811 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.105 | -0.105 | 3 | Parts per billion Carbon | |||||
| 2-methylphenanthrene (TSP) STP | 17156 | 105 | Intermittent | Hi Vol/PUF | GC/MS TO-13A | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 3,3',4,4',5,5'-Hexachlorobiphenyl (TSP) STP | 16935 | 119 | Intermittent | Med Vol PUF/XAD-2 Resin Plug | TO-13A/SW-846 Method 8290 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 3,3',4,4',5,5'-Hexachlorobiphenyl (TSP) STP | 16935 | 120 | Intermittent | Hi Vol XAD-2/PUF | TO-13A/SW-846 Method 1668 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 3,3',4,4',5,5'-Hexachlorobiphenyl (TSP) STP | 16935 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 3,3',4,4',5-Pentachlorobiphenyl (TSP) STP | 16947 | 119 | Intermittent | Med Vol PUF/XAD-2 Resin Plug | TO-13A/SW-846 Method 8290 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 3,3',4,4',5-Pentachlorobiphenyl (TSP) STP | 16947 | 120 | Intermittent | Hi Vol XAD-2/PUF | TO-13A/SW-846 Method 1668 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 3,3',4,4',5-Pentachlorobiphenyl (TSP) STP | 16947 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.25 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 3,3',4,4'-Tetrachlorobiphenyl (TSP) STP | 16932 | 119 | Intermittent | Med Vol PUF/XAD-2 Resin Plug | TO-13A/SW-846 Method 8290 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 3,3',4,4'-Tetrachlorobiphenyl (TSP) STP | 16932 | 120 | Intermittent | Hi Vol XAD-2/PUF | TO-13A/SW-846 Method 1668 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 3,3'-Dichlorobenzidene (TSP) STP | 17716 | 091 | Intermittent | HI-VOL | LIQUID CHROMOTOGRAPHY | 0.0006 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| 3,3'-Dichlorobenzidene (TSP) STP | 17716 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 35.8 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| 3,3'-Dichlorobiphenyl (TSP) STP | 16956 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 10.0 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| 3,3'-Dimethoxybenzidine (TSP) STP | 16748 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 250.0 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 3,4,4',5-Tetrachlorobiphenyl (TSP) STP | 16944 | 119 | Intermittent | Med Vol PUF/XAD-2 Resin Plug | TO-13A/SW-846 Method 8290 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 3,4,4',5-Tetrachlorobiphenyl (TSP) STP | 16944 | 120 | Intermittent | Hi Vol XAD-2/PUF | TO-13A/SW-846 Method 1668 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 3-Bromopropene | 43863 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 3-Chloropropene | 43335 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 3-Chloropropene | 43335 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 3-Chloropropene | 43335 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| 3-Chloropropene | 43335 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 3-Chloropropene | 43335 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 3-Chloropropene | 43335 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 3-Chloropropene | 43335 | 150 | Intermittent | SS 6L - PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Chloropropene | 43335 | 176 | Intermittent | 6L Subatm SS Canister | Entech Precon GC/MS | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| 3-Chloropropene | 43335 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.21 | -0.21 | 2 | R | Parts per billion Carbon | ||||
| 3-Ethylhexane | 43295 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Ethylhexane | 43295 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Ethylhexane | 43295 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Ethylhexane | 43295 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Ethylhexane | 43295 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Ethylhexane | 43295 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Ethylhexane | 43295 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Ethylhexane | 43295 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Ethylhexane | 43295 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Ethylhexane | 43295 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Ethylhexane | 43295 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Ethylhexane | 43295 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Ethylhexane | 43295 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Ethylhexane | 43295 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Hexanone | 43557 | 150 | Intermittent | SS 6L - PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Hexanone | 43557 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 3-Methyl-1-butene | 43282 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methyl-1-butene | 43282 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methyl-1-butene | 43282 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methyl-1-butene | 43282 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methyl-1-butene | 43282 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 3-Methyl-1-butene | 43282 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| 3-Methyl-1-butene | 43282 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 3-Methyl-1-butene | 43282 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methyl-1-butene | 43282 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 3-Methyl-1-butene | 43282 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methyl-1-butene | 43282 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methyl-1-butene | 43282 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methyl-1-butene | 43282 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.52076 | -0.52076 | 4 | R | Parts per billion Carbon | ||||
| 3-Methyl-1-butene | 43282 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methyl-1-butene | 43282 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.72 | -0.72 | 2 | R | Parts per billion Carbon | ||||
| 3-Methyl-1-butene | 43282 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methyl-1-butene | 43282 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methyl-1-butene | 43282 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methyl-1-butene | 43282 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methyl-1-butene | 43282 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 3-Methyl-1-butene | 43282 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methyl-1-butene | 43282 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methyl-1-butene | 43282 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methyl-1-butene | 43282 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methyl-1-butene | 43282 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methyl-1-butene | 43282 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methyl-1-butene | 43282 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methyl-1-butene | 43282 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methyl-1-butene | 43282 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methyl-1-butene | 43282 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methyl-1-butene | 43282 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methyl-1-butene | 43282 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methyl-1-butene & cyclopentene | 43342 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methyl-1-butene & cyclopentene | 43342 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 3-Methyl-1-butene & cyclopentene | 43342 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.4 | -0.4 | 2 | R | Parts per billion Carbon | ||||
| 3-Methylcholanthrene (TSP) STP | 16749 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 32.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 3-Methylheptane | 43253 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylheptane | 43253 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylheptane | 43253 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylheptane | 43253 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylheptane | 43253 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylheptane | 43253 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylheptane | 43253 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 3-Methylheptane | 43253 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylheptane | 43253 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 3-Methylheptane | 43253 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylheptane | 43253 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylheptane | 43253 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylheptane | 43253 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.48 | -0.48 | 2 | R | Parts per billion Carbon | ||||
| 3-Methylheptane | 43253 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.58772 | -0.58772 | 4 | R | Parts per billion Carbon | ||||
| 3-Methylheptane | 43253 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylheptane | 43253 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.67 | -0.67 | 2 | R | Parts per billion Carbon | ||||
| 3-Methylheptane | 43253 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylheptane | 43253 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylheptane | 43253 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylheptane | 43253 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylheptane | 43253 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 3-Methylheptane | 43253 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylheptane | 43253 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylheptane | 43253 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylheptane | 43253 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylheptane | 43253 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylheptane | 43253 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylheptane | 43253 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylheptane | 43253 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylheptane | 43253 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylheptane | 43253 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylheptane | 43253 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylheptane | 43253 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylheptane | 43253 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylhexane | 43249 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylhexane | 43249 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylhexane | 43249 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylhexane | 43249 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylhexane | 43249 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylhexane | 43249 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| 3-Methylhexane | 43249 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 3-Methylhexane | 43249 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylhexane | 43249 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 3-Methylhexane | 43249 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylhexane | 43249 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylhexane | 43249 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylhexane | 43249 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.42 | -0.42 | 2 | R | Parts per billion Carbon | ||||
| 3-Methylhexane | 43249 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.70026 | -0.70026 | 4 | R | Parts per billion Carbon | ||||
| 3-Methylhexane | 43249 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylhexane | 43249 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.74 | -0.74 | 2 | R | Parts per billion Carbon | ||||
| 3-Methylhexane | 43249 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylhexane | 43249 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylhexane | 43249 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylhexane | 43249 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylhexane | 43249 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 3-Methylhexane | 43249 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylhexane | 43249 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylhexane | 43249 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylhexane | 43249 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylhexane | 43249 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylhexane | 43249 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylhexane | 43249 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylhexane | 43249 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylhexane | 43249 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylhexane | 43249 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylhexane | 43249 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylhexane | 43249 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylhexane | 43249 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylpentane | 43230 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylpentane | 43230 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylpentane | 43230 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylpentane | 43230 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylpentane | 43230 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylpentane | 43230 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylpentane | 43230 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 3-Methylpentane | 43230 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylpentane | 43230 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 3-Methylpentane | 43230 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylpentane | 43230 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylpentane | 43230 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylpentane | 43230 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| 3-Methylpentane | 43230 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.8509 | -0.8509 | 4 | R | Parts per billion Carbon | ||||
| 3-Methylpentane | 43230 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylpentane | 43230 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.34 | -0.34 | 2 | R | Parts per billion Carbon | ||||
| 3-Methylpentane | 43230 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylpentane | 43230 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylpentane | 43230 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylpentane | 43230 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylpentane | 43230 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 3-Methylpentane | 43230 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Methylpentane | 43230 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylpentane | 43230 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylpentane | 43230 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylpentane | 43230 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylpentane | 43230 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylpentane | 43230 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylpentane | 43230 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylpentane | 43230 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylpentane | 43230 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylpentane | 43230 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylpentane | 43230 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Methylpentane | 43230 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 3-Nitroaniline (TSP) STP | 16750 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 24.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 3-Pentanone | 43553 | 150 | Intermittent | SS 6L - PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 3-Pentanone | 43553 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 3-nitrofluoranthene (TSP) STP | 17155 | 101 | Intermittent | HI-VOL/PUF-XAD | GC-MS-SIM | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 4,4'-Dichlorobiphenyl (TSP) STP | 16940 | 119 | Intermittent | Med Vol PUF/XAD-2 Resin Plug | TO-13A/SW-846 Method 8290 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 4,4'-Dichlorobiphenyl (TSP) STP | 16940 | 120 | Intermittent | Hi Vol XAD-2/PUF | TO-13A/SW-846 Method 1668 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| 4,4-Methylenedianiline | 45704 | 181 | Intermittent | Lo-Vol/Acid Treated Glass Fiber Filter | NIOSH No. 5029 | 0.025 | -0.025 | 3 | Micrograms/cubic meter (25 C) | |||||
| 4,4-Methylenediphenyl Diisocyanate (MDI) | 45732 | 180 | Intermittent | Lo-Vol/Glass Fiber Filter | OSHA No. 42 | 0.0223 | -0.0223 | 3 | Micrograms/cubic meter (LC) | |||||
| 4,6-Dinitro-2-methylphenol (TSP) STP | 16751 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 32.4 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 4,6-Dinitro-2-methylphenol (TSP) STP | 16751 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 4-Aminobiphenyl (TSP) STP | 16752 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 131.9 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 4-Bromophenyl phenyl ether (TSP) STP | 16753 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 30.5 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 4-Chloro-3-methylphenol (TSP) STP | 16754 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 34.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 4-Chloro-3-methylphenol (TSP) STP | 16754 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 4-Chloroaniline (TSP) STP | 16755 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 47.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 4-Chlorophenyl-phenyl ether (TSP) STP | 16756 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 24.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 4-Dimethylaminoazobenzene (TSP) STP | 16757 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 21.8 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 4-Dimethylaminoazobenzene (TSP) STP | 16757 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00052 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| 4-Methyl-1-pentene | 43234 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 4-Methyl-1-pentene | 43234 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 4-Methyl-1-pentene | 43234 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 4-Methyl-1-pentene | 43234 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 4-Methyl-1-pentene | 43234 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| 4-Methyl-1-pentene | 43234 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| 4-Methyl-1-pentene | 43234 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 4-Methyl-1-pentene | 43234 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 4-Methyl-1-pentene | 43234 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| 4-Methyl-1-pentene | 43234 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 4-Methyl-1-pentene | 43234 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 4-Methyl-1-pentene | 43234 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 4-Methyl-1-pentene | 43234 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.69788 | -0.69788 | 4 | R | Parts per billion Carbon | ||||
| 4-Methyl-1-pentene | 43234 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.5 | -0.5 | 2 | R | Parts per billion Carbon | ||||
| 4-Methyl-1-pentene | 43234 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 4-Methyl-1-pentene | 43234 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 4-Methyl-1-pentene | 43234 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 4-Methyl-1-pentene | 43234 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 4-Methyl-1-pentene | 43234 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 4-Methyl-1-pentene | 43234 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 4-Methyl-1-pentene | 43234 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 4-Methyl-1-pentene | 43234 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 4-Methyl-1-pentene | 43234 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 4-Methyl-1-pentene | 43234 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 4-Methyl-1-pentene | 43234 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 4-Methyl-1-pentene | 43234 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 4-Methyl-1-pentene | 43234 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 4-Methyl-1-pentene | 43234 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 4-Methyl-1-pentene | 43234 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 4-Methyl-1-pentene | 43234 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 4-Methyl-1-pentene | 43234 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| 4-Methylheptane | 43395 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 4-Methylheptane | 43395 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 4-Methylheptane | 43395 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 4-Methylpentene & 3-methylpentene | 43391 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| 4-Methylpentene & 3-methylpentene | 43391 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| 4-Nitroaniline (TSP) STP | 16758 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 30.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 4-Nitrophenol (TSP) STP | 16759 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 34.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 4-Nitrophenol (TSP) STP | 16759 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| 4-Phenylcyclohexene | 16212 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.5 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| 5-Nitro-o-toluidine (TSP) STP | 16760 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 26.4 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 7,12-Dimethylbenz[a]anthracene (TSP) STP | 16761 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 27.8 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| 7,12-Dimethylbenz[a]anthracene (TSP) STP | 16761 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00016 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| 9-fluorenone (TSP) STP | 17159 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.0472 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| 9-fluorenone (TSP) STP | 17159 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.0557 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| 9-fluorenone (TSP) STP | 17159 | 119 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS-SIM Modified TO-13A | 0.05 | 4 | R | Nanograms/cubic meter (25 C) | |||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 116 | Intermittent | BGI MODEL PQ200 PM2.5 SAMPLER | GRAVIMETRIC | 2.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 117 | Intermittent | R&P Model 2000 PM2.5 Sampler w/WINS | Gravimetric | 2.0 | 1 | T | Micrograms/cubic meter (LC) | |||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 118 | Intermittent | R & P MODEL 2025 PM2.5 SEQUNTL | GRAVIMETRIC | 2.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 142 | Intermittent | BGI Models PQ200-VSCC or PQ200A-VSCC | Gravimetric | 2.0 | 1 | T | Micrograms/cubic meter (LC) | |||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 143 | Intermittent | R & P Model 2000 PM-2.5 Air Sampler w/VSCC | Gravimetric | FEM | EQPM-0202-143 or RFPS-0498-117 | R & P Model 2000 Air Sampler with BGI VSCC | 2.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 145 | Intermittent | R & P Model 2025 PM-2.5 Sequential Air Sampler w/VSCC | Gravimetric | 2.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 170 | Continuous | Met-one BAM-1020 W/PM2.5 SCC | Beta Attenuation | 5.0 | 975.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 171 | Continuous | Met-one BAM-1022 W/PM2.5 SCC | Beta Attenuation | 5.0 | 975.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 178 | Continuous | Thermo Scientific 1405 TEOM | Gravimetric | 2.0 | 1 | T | Micrograms/cubic meter (LC) | |||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 181 | Continuous | PM2.5 VSCC | FDMS-Gravimetric | 2.0 | 1 | T | Micrograms/cubic meter (LC) | |||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 182 | Continuous | Thermo Scientific TEOM | FDMS | 2.0 | 2 | T | Micrograms/cubic meter (LC) | |||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 183 | Continuous | Thermo Scientific 1405-F FDMS w/SCC | FDMS | 2.0 | 2 | T | Micrograms/cubic meter (LC) | |||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 184 | Continuous | Thermo Scientific Model 5030 SHARP w/VSCC | Beta Attenuation | FEM | EQPM-0609-184 | Thermo Scientific Model 5030 SHARP w/VSCC | 5.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 195 | Continuous | GRIMM EDM Model 180 with naphion dryer | Laser Light Scattering | FEM | EQPM-0311-195 | GRIMM EDM Model 180 for FEM | 0.1 | 0.0 | 1500.0 | 1 | T | Micrograms/cubic meter (LC) |
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 196 | Continuous | GRIMM EDM Model 264 with heated inlet | Laser Light Scattering | 0.1 | 0.0 | 1500.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 203 | Continuous | Opsis SM200-Dust Monitor w/VSCC | Beta Attenuation | FEM | EQPM-0812-203 | Opsis SM200-Dust Monitor VSCC FEM | 2.0 | -10.0 | 1000.0 | 1 | T | Micrograms/cubic meter (LC) |
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 204 | Continuous | Teledyne Model 602 Beta plus w/VSCC | Beta Attenuation | FEM | EQPM-0912-204 | Teledyne Model 602 Beta plus VSCC FEM | 2.0 | -10.0 | 1500.0 | 1 | T | Micrograms/cubic meter (LC) |
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 236 | Continuous | Teledyne T640 at 5.0 LPM | Broadband spectroscopy | FEM | EQPM-0516-236 | T-API T640 at 5.0 LPM | 0.1 | 0.0 | 10000.0 | 1 | T | Micrograms/cubic meter (LC) |
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 238 | Continuous | Teledyne T640X at 16.67 LPM | Broadband spectroscopy | FEM | EQPM-0516-238 | T-API T640X at 16.67 LPM | 0.1 | 0.0 | 10000.0 | 1 | T | Micrograms/cubic meter (LC) |
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 636 | Continuous | Teledyne T640 at 5.0 LPM w/Network Data Alignment enabled | Broadband spectroscopy | FEM | EQPM-0516-236 | T-API T640 at 5.0 LPM w/Network Data Alignment enabled | 1.0 | 0.0 | 10000.0 | 1 | T | Micrograms/cubic meter (LC) |
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 638 | Continuous | Teledyne T640X at 16.67 LPM w/Network Data Alignment enabled | Broadband spectroscopy | FEM | EQPM-0516-238 | T-API T640X at 16.67 LPM w/Network Data Alignment enabled | 1.0 | 0.0 | 10000.0 | 1 | T | Micrograms/cubic meter (LC) |
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 701 | Continuous | PM2.5 SCC w/No Correction Factor | TEOM Gravimetric 50 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 702 | Continuous | PM2.5 SCC w/Correction Factor | TEOM Gravimetric 50 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 703 | Continuous | PM2.5 SCC w/No Correction Factor | TEOM Gravimetric 30 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 704 | Continuous | PM2.5 SCC w/Correction Factor | TEOM Gravimetric 30 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 705 | Continuous | PM2.5 SCC w/Correction Factor | TEOM Gravimetric 40 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 706 | Continuous | PM2.5 SCC w/No Correction Factor | TEOM Gravimetric 40 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 707 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | GRAVIMETRIC | 2.0 | -10.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 711 | Continuous | PM2.5 SSI w/No Correction Factor | TEOM Gravimetric 50 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 712 | Continuous | PM2.5 SSI w/Correction Factor | TEOM Gravimetric 50 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 713 | Continuous | PM2.5 SSI w/Correction Factor | TEOM Gravimetric 30 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 715 | Continuous | PM2.5 VSCC w/No Correction Factor | TEOM Gravimetric 30 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 716 | Continuous | PM2.5 VSCC w/No Correction Factor | TEOM Gravimetric 50 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 717 | Continuous | PM2.5 VSCC w/Correction Factor | TEOM Gravimetric 50 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 718 | Continuous | PM2.5 VSCC w/Correction Factor | TEOM Gravimetric 30 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 721 | Continuous | PM2.5 WINS w/No Correction Factor | TEOM Gravimetric 50 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 722 | Continuous | PM2.5 WINS w/Correction Factor | TEOM Gravimetric 50 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 723 | Continuous | PM2.5 WINS w/No Correction Factor | TEOM Gravimetric 30 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 724 | Continuous | PM2.5 WINS w/Correction Factor | TEOM Gravimetric 30 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 731 | Continuous | Met-One BAM-1020 W/PM2.5 SCC | Beta Attenuation | 5.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 732 | Continuous | Met-One BAM W/PM2.5 WINS | Beta Attenuation | 5.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 733 | Continuous | Met-One BAM W/PM2.5 VSCC | Beta Attenuation | 5.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 734 | Continuous | Met-One E- BAM W/PM2.5 SCC | Beta Attenuation | 6.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 740 | Continuous | PM2.5 SCC | CAMMS Mass pressure drop | 3.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 741 | Continuous | PM2.5 WINS | CAMMS Mass pressure drop | 3.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 750 | Continuous | Andersen BAM w/PM2.5 SCC | Beta Attenuation | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 751 | Continuous | Andersen BAM w/PM2.5 SSI | Beta Attenuation | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 752 | Continuous | Andersen BAM w/PM2.5 WINS | Beta Attenuation | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 753 | Continuous | Andersen BAM w/PM2.5 VSCC | Beta Attenuation | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 760 | Continuous | PM2.5 SCC | FDMS-Gravimetric | 0.06 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 761 | Continuous | PM2.5 VSCC | FDMS-Gravimetric | 0.06 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 771 | Continuous | Correlated Radiance Research M903 With Heated Inlet | Nephelometry | 0.4 | -0.4 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 781 | Intermittent | SINGLE-FILTR WINS 2.5UM IMPACT | GRAVIMETRIC | 2.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 783 | Intermittent | SEQUENT SAMPLR WINS 2.5UM IMP | GRAVIMETRIC | 2.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 785 | Intermittent | DICHOTOMOUS APPROVED PM10 REFR | GRAVIMETRIC | 2.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 787 | Continuous | AUTOMATED WINS 2.5UM IMPACTOR | BETA GUAGE | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 789 | Continuous | AUTOMATED WINS 2.5UM IMPACTOR | TEOM-GRAVIMETRIC | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 790 | Continuous | Virtual Impactor | FDMS-Gravimetric 1405-DF | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 791 | Continuous | OTHR AUTOMATD 2.5 MASS CONCENT | SURROGATE MEASURE | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 792 | Continuous | Virtual Impactor | Gravimetric 1405-D | -10.0 | 1 | T | Micrograms/cubic meter (LC) | |||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 793 | Intermittent | OTHER 24HR FILTER BASED SAMPLER | GRAVIMETRIC | 2.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 802 | Continuous | Correlated Ambilabs 2-WIN (Wavelength Integrating Nephelometer) | Nephelometry | 0.7 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 810 | Intermittent | Met One SASS/SuperSASS Teflon | Gravimetric | 0.104 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 812 | Continuous | Correlated Ecotech M9003/ Aurora | Nephelometry | 0.4 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 820 | Intermittent | Andersen RAAS Teflon | Gravimetric | 0.04 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 830 | Intermittent | URG MASS400 Teflon WINS | Gravimetric | 0.04 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 850 | Intermittent | R&P MDL2300 PM2.5 SEQ SPEC | GRAVIMETRIC | 0.04 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 870 | Intermittent | URG MASS400 Teflon VSCC | Gravimetric | 0.04 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| Acceptable PM2.5 AQI & Speciation Mass | 88502 | 899 | Intermittent | No Method-None | None | 0.002 | 1 | T | Micrograms/cubic meter (LC) | |||||
| Acenaphthene (TSP) STP | 17147 | 101 | Intermittent | HI-VOL/PUF-XAD | GC-MS-SIM | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Acenaphthene (TSP) STP | 17147 | 102 | Intermittent | HI-VOL/PUF CARTRIDGE | TO-13- EPA610- EPA625 | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Acenaphthene (TSP) STP | 17147 | 105 | Intermittent | Hi Vol/PUF | GC/MS TO-13A | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Acenaphthene (TSP) STP | 17147 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Acenaphthene (TSP) STP | 17147 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 23.4 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Acenaphthene (TSP) STP | 17147 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.0001 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Acenaphthene (TSP) STP | 17147 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.0429 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| Acenaphthene (TSP) STP | 17147 | 119 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS-SIM Modified TO-13A | 0.0429 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| Acenaphthene (TSP) STP | 17147 | 904 | Intermittent | SKC Pump XAD-2 SORBENT Tube | HPLC Fluorescence/UV NIOSH 5506 | 1390.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Acenaphthene (TSP) STP | 17147 | 909 | Intermittent | SKC Pump XAD-2 SORBENT Tube | GC/MS NIOSH 5515 REAC SOP 1817 | 4200.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Acenaphthylene (TSP) STP | 17148 | 101 | Intermittent | HI-VOL/PUF-XAD | GC-MS-SIM | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Acenaphthylene (TSP) STP | 17148 | 102 | Intermittent | HI-VOL/PUF CARTRIDGE | TO-13- EPA610- EPA625 | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Acenaphthylene (TSP) STP | 17148 | 105 | Intermittent | Hi Vol/PUF | GC/MS TO-13A | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Acenaphthylene (TSP) STP | 17148 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Acenaphthylene (TSP) STP | 17148 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 21.6 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Acenaphthylene (TSP) STP | 17148 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00063 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Acenaphthylene (TSP) STP | 17148 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.0383 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| Acenaphthylene (TSP) STP | 17148 | 119 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS-SIM Modified TO-13A | 0.0383 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| Acenaphthylene (TSP) STP | 17148 | 904 | Intermittent | SKC Pump XAD-2 SORBENT Tube | HPLC Fluorescence/UV NIOSH 5506 | 1740.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Acenaphthylene (TSP) STP | 17148 | 909 | Intermittent | SKC Pump XAD-2 SORBENT Tube | GC/MS NIOSH 5515 REAC SOP 1817 | 4200.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Acetaldehyde | 43503 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 102 | Intermittent | CARTRIDGE-DNPH-ON-SILICA | HPLC ULTRAVIOLET ABSORPTION | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 114 | Intermittent | CARTRIDGE-DNPH-SILICA-SEP-PAK | HPLC-PHOTODIODE ARRAY | 0.085 | -0.085 | 2 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 29.4 | -29.4 | 1 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 140 | Continuous | UV Spectrometer with URS methods | Spectra reference matching via PLS | 20.0 | -20.0 | 0 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 141 | Continuous | IR Spectrometer | Spectra reference matching with PLS | 11.2 | -11.2 | 1 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 156 | Intermittent | Cartridge DNPH on Silica, Heated O3 Denuder | HPLC Photo Diode Array | 0.208 | -0.208 | 1 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 157 | Continuous | Instrumental Open Path | UV OPSIS Model AR 500 | 2.0 | -2.0 | 1 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 165 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | HP LC-1050 W/DIODE ARRAY DETECTOR | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 166 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | TO-11 DIONEX DX-300 ION CHRMTGRAPH | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 179 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | Liquid Chromatography w/diode array detection | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetaldehyde | 43503 | 203 | Intermittent | C18-DNPH-CARTRIDGE | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 102 | Intermittent | DNPH-COATED CARTRIDGES | HPLC (TO-14) | 0.042 | -0.042 | 1 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 113 | Intermittent | SS-Canister_Pressurized | Capillary GC ITD Mass Spectro | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 114 | Intermittent | CARTRIDGE-DNPH-SILICA-SEP-PAK | HPLC-PHOTODIODE ARRAY | 0.085 | -0.085 | 2 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 119 | Intermittent | PERSONAL PUMP MOLECULAR SIEVE | GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 2 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 130 | Intermittent | DNPH-COATED CARTRIDGE | HPLC (TO-14) | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 4.21 | -4.21 | 2 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 156 | Intermittent | Cartridge DNPH on Silica, Heated O3 Denuder | HPLC Photo Diode Array | 0.243 | -0.243 | 1 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 165 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | HP LC-1050 W/DIODE ARRAY DETECTOR | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 166 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | TO-11 DIONEX DX-300 ION CHRMTGRAPH | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 176 | Intermittent | 6L Subatm SS Canister | Entech Precon GC/MS | 0.195 | -0.195 | 3 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 179 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | Liquid Chromatography w/diode array detection | 0.42 | -0.42 | 2 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 203 | Intermittent | C18 DNPH CARTRIDGE | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.02 | -0.02 | 3 | R | Parts per billion Carbon | ||||
| Acetone | 43551 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetonitrile | 43702 | 101 | Intermittent | Canister Subambient Pressure | Multi Detector GC | 0.21 | -0.21 | 2 | R | Parts per billion Carbon | ||||
| Acetonitrile | 43702 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acetonitrile | 43702 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acetonitrile | 43702 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Acetonitrile | 43702 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetonitrile | 43702 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetonitrile | 43702 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetonitrile | 43702 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.21 | -0.21 | 2 | R | Parts per billion Carbon | ||||
| Acetonitrile | 43702 | 150 | Intermittent | SS 6L - PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetonitrile | 43702 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Acetonitrile | 43702 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acetonitrile | 43702 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acetonitrile | 43702 | 176 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acetonitrile | 43702 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.08 | -0.08 | 3 | R | Parts per billion Carbon | ||||
| Acetonitrile | 43702 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.5 | -0.5 | 2 | R | Parts per billion Carbon | ||||
| Acetonitrile | 43702 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetonitrile | 43702 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetonitrile | 43702 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetonitrile | 43702 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetonitrile | 43702 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetonitrile | 43702 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetonitrile | 43702 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetonitrile | 43702 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetonitrile | 43702 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetonitrile | 43702 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetonitrile | 43702 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetonitrile | 43702 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetophenone | 43565 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 34.3 | -34.3 | 1 | R | Parts per billion Carbon | ||||
| Acetophenone (TSP) STP | 16762 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 34.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Acetophenone (TSP) STP | 16762 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00014 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Acetylene | 43206 | 011 | Continuous | INSTRUMENTAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 091 | Continuous | MANUAL | FLAME IONIZAITON | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| Acetylene | 43206 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.07337 | -0.07337 | 4 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 174 | Continuous | Passivated Canister | Cryogenic Preconcentration GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Acetylene | 43206 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetylene | 43206 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetylene | 43206 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetylene | 43206 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetylene | 43206 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetylene | 43206 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetylene | 43206 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetylene | 43206 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetylene | 43206 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetylene | 43206 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetylene | 43206 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acetylene | 43206 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acidity (precip) | 65330 | 013 | Intermittent | ANDERSON RAINFALL BUCKET | TITRATION | 0.5 | 0.0 | 2 | R | Milligrams/liter as CACO3 | ||||
| Acidity (precip) | 65330 | 081 | Intermittent | PRECIP | ALKALINE TITRATION | 0.01 | 0.0 | 2 | R | Milligrams/liter as CACO3 | ||||
| Acrolein | 99999 | 001 | Intermittent | Test Method | Test Analysis | 0.1 | 1 | Micrograms/cubic meter (25 C) | ||||||
| Acrolein - Unverified | 43505 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 102 | Intermittent | CARTRIDGE-DNPH-ON-SILICA | HPLC ULTRAVIOLET ABSORPTION | 0.6 | -0.6 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 1.2 | -1.2 | 1 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 113 | Intermittent | SS-Canister_Pressurized | Capillary GC ITD Mass Spectro | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 114 | Intermittent | CARTRIDGE-DNPH-SILICA-SEP-PAK | HPLC-PHOTODIODE ARRAY | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 136 | Intermittent | 6L Pressurized Canister | Entech Precon w/Agilent GC/MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 3.0 | -3.0 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 156 | Intermittent | Cartridge DNPH on Silica, Heated O3 Denuder | HPLC Photo Diode Array | 0.243 | -0.243 | 1 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 165 | Intermittent | ATEC2400 W/Waters Silica DNPH | HP LC-1050 W/Diode Array Detector | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 166 | Intermittent | ATEC 2400 W/Waters Silica DNPH | TO-11 Dionex DX-300 Ion Chrmtg | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.24 | -0.24 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 179 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | Liquid Chromatography w/diode array detection | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.06 | -0.06 | 3 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.48 | -0.48 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Unverified | 43505 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrolein - Unverified | 43505 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrolein - Unverified | 43505 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrolein - Unverified | 43505 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrolein - Unverified | 43505 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrolein - Unverified | 43505 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrolein - Unverified | 43505 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrolein - Unverified | 43505 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrolein - Unverified | 43505 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrolein - Unverified | 43505 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrolein - Unverified | 43505 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrolein - Unverified | 43505 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrolein - Verified | 43509 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acrolein - Verified | 43509 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Verified | 43509 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Verified | 43509 | 113 | Intermittent | SS-Canister_Pressurized | Capillary GC ITD Mass Spectro | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Verified | 43509 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acrolein - Verified | 43509 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acrolein - Verified | 43509 | 136 | Intermittent | 6L Pressurized Canister | Entech Precon w/Agilent GC/MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acrolein - Verified | 43509 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Verified | 43509 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Verified | 43509 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acrolein - Verified | 43509 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acrolein - Verified | 43509 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acrolein - Verified | 43509 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 3.0 | -3.0 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Verified | 43509 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Verified | 43509 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Verified | 43509 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Verified | 43509 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.24 | -0.24 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Verified | 43509 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.06 | -0.06 | 3 | R | Parts per billion Carbon | ||||
| Acrolein - Verified | 43509 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.48 | -0.48 | 2 | R | Parts per billion Carbon | ||||
| Acrolein - Verified | 43509 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrolein - Verified | 43509 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrolein - Verified | 43509 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrolein - Verified | 43509 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrolein - Verified | 43509 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrolein - Verified | 43509 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrolein - Verified | 43509 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrolein - Verified | 43509 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrolein - Verified | 43509 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrolein - Verified | 43509 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrolein - Verified | 43509 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrolein - Verified | 43509 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrylonitrile | 43704 | 101 | Intermittent | Canister Subambient Pressure | Multi Detector GC | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| Acrylonitrile | 43704 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acrylonitrile | 43704 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Acrylonitrile | 43704 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Acrylonitrile | 43704 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Acrylonitrile | 43704 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acrylonitrile | 43704 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acrylonitrile | 43704 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acrylonitrile | 43704 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acrylonitrile | 43704 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acrylonitrile | 43704 | 150 | Intermittent | SS 6L - PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Acrylonitrile | 43704 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.3 | -0.3 | 2 | R | Parts per billion Carbon | ||||
| Acrylonitrile | 43704 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acrylonitrile | 43704 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Acrylonitrile | 43704 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.24 | -0.24 | 2 | R | Parts per billion Carbon | ||||
| Acrylonitrile | 43704 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.06 | -0.06 | 3 | R | Parts per billion Carbon | ||||
| Acrylonitrile | 43704 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.42 | -0.42 | 2 | R | Parts per billion Carbon | ||||
| Acrylonitrile | 43704 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrylonitrile | 43704 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrylonitrile | 43704 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrylonitrile | 43704 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrylonitrile | 43704 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrylonitrile | 43704 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrylonitrile | 43704 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrylonitrile | 43704 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrylonitrile | 43704 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrylonitrile | 43704 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrylonitrile | 43704 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Acrylonitrile | 43704 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Aerosol Extinction PM2.5 LC | 88341 | 899 | Intermittent | Unknown-Unknown | # | 0.002 | 3 | Inverse Megameters | ||||||
| Aldehydes | 43501 | 011 | Continuous | INSTRUMENTAL | COLORIMETRIC | 8.0 | -8.0 | 0 | R | Parts per billion Carbon | ||||
| Aldehydes | 43501 | 081 | Intermittent | GAS-BUBBLER | COLORIMETRIC | 1.6 | -1.6 | 1 | R | Parts per billion Carbon | ||||
| Aldehydes | 43501 | 091 | Intermittent | GAS-BUBBLER | MBTH | 8.0 | -8.0 | 0 | R | Parts per billion Carbon | ||||
| Aldehydes | 43501 | 092 | Intermittent | GAS-BUBBLER | PARAROSANILINE | 8.0 | -8.0 | 0 | R | Parts per billion Carbon | ||||
| Aldehydes | 43501 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Aldrin | 43159 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Aldrin | 43159 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | -0.5 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Alkalinity (precip) | 65331 | 081 | Intermittent | PRECIP | ACID TITRATION | 0.01 | 0.0 | 2 | R | Microequivalence/liter | ||||
| Alpha radiation (TSP) | 11301 | 091 | Intermittent | HI-VOL | PROPORTIONAL COUNTER | 0.0002 | 0.0 | 4 | R | Picocuries/cubic meter | ||||
| Alpha-terpinene (TSP) STP | 17835 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 10.4 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Aluminum (TSP) LC | 14101 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0047 | 0.0 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Aluminum (TSP) LC | 14101 | 090 | Intermittent | HI-VOL | Emission Spectra ICAP | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Aluminum (TSP) LC | 14101 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 3.0e-05 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Aluminum (TSP) STP | 12101 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0047 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Aluminum (TSP) STP | 12101 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Aluminum (TSP) STP | 12101 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Aluminum (TSP) STP | 12101 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.5 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Aluminum (TSP) STP | 12101 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 2.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Aluminum (TSP) STP | 12101 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Aluminum (TSP) STP | 12101 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Aluminum (TSP) STP | 12101 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Aluminum (TSP) STP | 12101 | 905 | Intermittent | SKC Pump Filter | ICP/AES NIOSH 7300 | 1.74 | 2 | R | Micrograms/cubic meter (25 C) | |||||
| Aluminum (TSP) STP | 12101 | 910 | Intermittent | SKC Pump Filter | MOd NISH 7300/6010B SOP 1813 | 0.1861 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Aluminum (precip) | 65342 | 082 | Intermittent | PRECIP | ATOMIC ABSORPTION | 0.005 | 0.0 | 1 | R | Milligrams/liter | ||||
| Aluminum (precip) | 65342 | 085 | Intermittent | ANDERSON RAINFALL BUCKET | EMISSION SPECTRA ICAP | 0.05 | 0.0 | 3 | R | Milligrams/liter | ||||
| Aluminum PM10 LC | 85104 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 4.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Aluminum PM10 LC | 85104 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 4.36 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Aluminum PM10 LC | 85104 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 64.0 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Aluminum PM10 STP | 82101 | 069 | Intermittent | HIVOL-SA/GMW-321-B | EMISSION SPECTRA ICAP | 10.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Aluminum PM10 STP | 82101 | 085 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 10.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Aluminum PM10 STP | 82101 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | |||||
| Aluminum PM10 STP | 82101 | 101 | Intermittent | HI-VOL-SA321A | ATOMIC ABSORPTION | 10.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Aluminum PM10 STP | 82101 | 102 | Intermittent | HI-VOL-SA/GMW1200 | ATOMIC ABSORPTION | 10.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Aluminum PM10 STP | 82101 | 103 | Intermittent | HI-VOL-WEDDING-INLET | ATOMIC ABSORPTION | 10.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Aluminum PM10 STP | 82101 | 106 | Intermittent | HI-VOL Wedding Inlet | Emission Spectra ICAP | 27.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Aluminum PM10 STP | 82101 | 107 | Intermittent | HI-VOL-SA/GMW-321-B | Emission Spectra ICAP | 14.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Aluminum PM10 STP | 82101 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 4.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Aluminum PM10 STP | 82101 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 5.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Aluminum PM10-2.5 LC | 86104 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00436 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Aluminum PM10-2.5 STP | 83101 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.004 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Aluminum PM2.5 LC | 88104 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Aluminum PM2.5 LC | 88104 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Aluminum PM2.5 LC | 88104 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Aluminum PM2.5 LC | 88104 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy dispersive XRF | 0.01088 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Aluminum PM2.5 LC | 88104 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00436 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Aluminum PM2.5 LC | 88104 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00436 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Aluminum PM2.5 LC | 88104 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00436 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Aluminum PM2.5 LC | 88104 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00436 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Aluminum PM2.5 LC | 88104 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00436 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Aluminum PM2.5 LC | 88104 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00436 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Aluminum PM2.5 LC | 88104 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00436 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Aluminum PM2.5 LC | 88104 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Aluminum PM2.5 LC | 88104 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.0006 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Aluminum PM2.5 LC | 88104 | 908 | Intermittent | R & P Partisol 2000 | X-Ray Fluorescence | 0.0004 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Aluminum PM2.5 STP | 84101 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.004 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Ambient Max Temperature | 68104 | 116 | Intermittent | BGI Model PQ200 PM2.5 Sampler | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 117 | Intermittent | R & P Model 2000 PM2.5 Sampler | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 118 | Intermittent | R & P Model 2025 PM2.5 Sequent | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 119 | Intermittent | Anderson RAAS2.5-100 Sampler | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 120 | Intermittent | Anderson RAAS2.5-300 PM2.5 Seq | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 123 | Intermittent | Thermo Env Model 605 CAPS | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 126 | Intermittent | R - P Co Partisol Model 2000 | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 127 | Intermittent | R - P Co Partisol Model 2025 | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 128 | Intermittent | Andersen RAAS2.5-200 PM2.5 Aud | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 129 | Intermittent | R & P Co Model 2000 PM-2.5 Audit | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 135 | Intermittent | URG-MASS100 Single PM2.5 Sampler | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 136 | Intermittent | URG-MASS300 Sequential PM2.5 Sampler | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 142 | Intermittent | BGI Models PQ200-VSCC or PQ200A-VSCC | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 143 | Intermittent | R & P Model 2000 PM-2.5 FEM Air Sampler | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 144 | Intermittent | R & P Model 2000 PM-2.5 FEM Audit Sampler | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 145 | Intermittent | R & P Model 2025 PM-2.5 FEM Sequential Air Sampler | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 153 | Intermittent | Thermo Electron Model RAAS2.5-100 w/VSCC | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 154 | Intermittent | Thermo Electron Model RAAS2.5-200 Audit w/VSCC | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 155 | Intermittent | Thermo Electron Model RAAS2.5-300 Sequential w/VSCC | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 780 | Continuous | INSTRUMENTAL | ELECTRONIC | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 810 | Intermittent | Met One SASS/SuperSASS | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 820 | Intermittent | Andersen RAAS | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 830 | Intermittent | URG MASS400 WINS | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 850 | Intermittent | R&P MDL2300 PM2.5 SEQ SPEC | CALCULATION | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 870 | Intermittent | URG MASS400 VSCC | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Max Temperature | 68104 | 901 | Intermittent | BGI Inc. frmOMNI | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 116 | Intermittent | BGI Model PQ200 PM2.5 Sampler | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 117 | Intermittent | R & P Model 2000 PM2.5 Sampler | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 118 | Intermittent | R & P Model 2025 PM2.5 Sequent | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 119 | Intermittent | Anderson RAAS2.5-100 Sampler | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 120 | Intermittent | Anderson RAAS2.5-300 PM2.5 Seq | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 123 | Intermittent | Thermo Env Model 605 CAPS | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 126 | Intermittent | R - P Co Partisol Model 2000 | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 127 | Intermittent | R - P Co Partisol Model 2025 | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 128 | Intermittent | Andersen RAAS2.5-200 PM2.5 Aud | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 129 | Intermittent | R & P Co Model 2000 PM-2.5 Audit | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 135 | Intermittent | URG-MASS100 Single PM2.5 Sampler | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 136 | Intermittent | URG-MASS300 Sequential PM2.5 Sampler | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 142 | Intermittent | BGI Models PQ200-VSCC or PQ200A-VSCC | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 143 | Intermittent | R & P Model 2000 PM-2.5 FEM Air Sampler | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 144 | Intermittent | R & P Model 2000 PM-2.5 FEM Audit Sampler | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 145 | Intermittent | R & P Model 2025 PM-2.5 FEM Sequential Air Sampler | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 153 | Intermittent | Thermo Electron Model RAAS2.5-100 w/VSCC | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 154 | Intermittent | Thermo Electron Model RAAS2.5-200 Audit w/VSCC | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 155 | Intermittent | Thermo Electron Model RAAS2.5-300 Sequential w/VSCC | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 780 | Continuous | INSTRUMENTAL | ELECTRONIC | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 810 | Intermittent | Met One SASS/SuperSASS | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 820 | Intermittent | Andersen RAAS | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 830 | Intermittent | URG MASS400 WINS | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 850 | Intermittent | R&P MDL2300 PM2.5 SEQ SPEC | CALCULATION | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 870 | Intermittent | URG MASS400 VSCC | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ambient Min Temperature | 68103 | 901 | Intermittent | BGI Inc. frmOMNI | Electronic | -40.0 | -100.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Ammonia | 42604 | 010 | Intermittent | Integrated Passive Monitor | Ion Chromatography | 0.0001 | -0.0001 | 4 | R | Parts per million | ||||
| Ammonia | 42604 | 050 | Intermittent | ANNULAR DIFUSSION DENUDER | ION CHROMATOGRAPH | 3.0e-05 | -3.0e-05 | 5 | R | Parts per million | ||||
| Ammonia | 42604 | 051 | Continuous | INSTRUMENTAL | TECO 17 CHEMILUMINESCENCE | 0.001 | -0.001 | 3 | R | Parts per million | ||||
| Ammonia | 42604 | 082 | Continuous | INSTRUMENTAL API 201E | Chemiluminescence | 0.001 | -0.001 | 3 | R | Parts per million | ||||
| Ammonia | 42604 | 091 | Intermittent | GAS-BUBBLER | NESSLER REAGENT 50ML TUBE+ORIFICE | 0.0072 | -0.0072 | 3 | R | Parts per million | ||||
| Ammonia | 42604 | 092 | Intermittent | GAS-BUBBLER | SODIUM PHENOLATE | 0.0072 | -0.0072 | 3 | R | Parts per million | ||||
| Ammonia | 42604 | 093 | Continuous | INSTRUMENTAL | MEMBRANE DIFFUSION ELECTROCHEMICAL | 1.0 | -1.0 | 0 | R | Parts per million | ||||
| Ammonia | 42604 | 101 | Continuous | Instrument Nitrolux | Infrared light/laser based detection | 0.0002 | -0.0002 | 4 | R | Parts per million | ||||
| Ammonia | 42604 | 121 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0798-121 | DDK CORP MODEL GLN-114E | 0.005 | -0.005 | 3 | R | Parts per million | |
| Ammonia | 42604 | 400 | Continuous | Instrumental Pranalytica Mdl # 200 | Laser Photo Acoustic Spectrograph | 0.0002 | -0.0002 | 4 | R | Parts per million | ||||
| Ammonia | 42604 | 592 | Continuous | Instrumental | Chemiluminescence Ecotech EC9842T | 0.0002 | -0.0002 | 4 | R | Parts per million | ||||
| Ammonia (SP) | 22604 | 050 | Intermittent | ANNULAR DIFFUSION DENUDER | ION CHROMATOGRAPH | 0.02 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Ammonia (precip) | 62604 | 017 | Intermittent | ANDERSON RAINFALL BUCKET | AUTOMATED PHENATE VIA TRAACS 800 | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Ammonia (precip) | 62604 | 018 | Intermittent | AEROCHEM RAINFALL BUCKET (MOD) | FLOW INJECTION (COLORIMETRIC) | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Ammonium (SP) | 22301 | 071 | Intermittent | BUCKET | SODIUM PHENOLATE (APCA) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Ammonium (SP) | 22301 | 072 | Intermittent | BUCKET | NESSLER (APCA) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Ammonium (SP) | 22301 | 081 | Intermittent | BUCKET | SODIUM PHENOLATE (ASTM) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Ammonium (SP) | 22301 | 082 | Intermittent | BUCKET | NESSLER (ASTM) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Ammonium (TSP) LC | 12303 | 900 | Intermittent | Teflon CASTNET-style 3-stage filter pack | Automated Colorimetry EPA Modified Method 350.1 | 0.007 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Ammonium (TSP) STP | 12301 | 091 | Intermittent | HI-VOL | NESSLER | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Ammonium (TSP) STP | 12301 | 092 | Intermittent | HI-VOL | SODIUM PHENOLATE | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Ammonium (TSP) STP | 12301 | 093 | Intermittent | HI-VOL | POTENTIOMETRIC ION SELEC. ELECTRODE | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Ammonium (TSP) STP | 12301 | 900 | Intermittent | Teflon CASTNET-style 3-stage filter pack | Automated Colorimetry EPA Method 350.1 | 0.017 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Ammonium (precip) | 65318 | 081 | Intermittent | Precipitation | Nessler's reagent | 0.01 | 0.0 | 1 | R | Milligrams/liter | ||||
| Ammonium (precip) | 65318 | 082 | Intermittent | PRECIP | SODIUM PHENOLATE/HYPOCHIORITE | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Ammonium (precip) | 65318 | 083 | Intermittent | PRECIP | COLORIMETRIC | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Ammonium (precip) | 65318 | 086 | Intermittent | ANDERSON RAINFALL BUCKET | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Ammonium Ion PM10 LC | 85301 | 890 | Intermittent | Model 2025 PM10 Sequential Teflon | Ion Chromatography | 0.014 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Ammonium Ion PM10-2.5 LC | 86301 | 885 | Intermittent | Model 2025 Dichot Sequential Teflon | Ion Chromatography | 0.014 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Ammonium Ion PM2.5 LC | 88301 | 803 | Intermittent | IMPROVE Module B with Cyclone Inlet and Glycerin-Nylon Filter, 4.9 sq. cm. | Ion Chromatography | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Ammonium Ion PM2.5 LC | 88301 | 812 | Intermittent | Met One SASS/SuperSASS Nylon | Ion Chromatography | 0.017 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Ammonium Ion PM2.5 LC | 88301 | 822 | Intermittent | Andersen RAAS Nylon | Ion Chromatography | 0.015 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Ammonium Ion PM2.5 LC | 88301 | 834 | Intermittent | URG MASS400 Teflon WINS | Ion Chromatography | 0.007 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Ammonium Ion PM2.5 LC | 88301 | 844 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | Ion Chromatography | 0.014 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Ammonium Ion PM2.5 LC | 88301 | 845 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | ION CHROMATOGRAPHY | 0.014 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Ammonium Ion PM2.5 LC | 88301 | 849 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | ION CHROMATOGRAPHY | 0.014 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Ammonium Ion PM2.5 LC | 88301 | 850 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | Automated Colorimetry | 0.0125 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Ammonium Ion PM2.5 LC | 88301 | 852 | Intermittent | R&P MDL2300 PM2.5 SEQ SPEC NYL | ION CHROMATOGRAPHY | 0.01095 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Ammonium Ion PM2.5 LC | 88301 | 853 | Intermittent | RP Partisol Model 2300 PM2.5 Seq SSampler - Quartz-# | Thermal Optical Reflectance | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Ammonium Ion PM2.5 LC | 88301 | 874 | Intermittent | URG MASS400 Teflon VSCC | Ion Chromatography | 0.007 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Ammonium Ion PM2.5 LC | 88301 | 879 | Intermittent | Andersen RAAS Quartz | Automated Colorimetry | 0.0625 | 50.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Ammonium Ion PM2.5 LC | 88301 | 885 | Intermittent | Model 2025 Dichot Sequential Teflon | Ion Chromatography | 0.014 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Ammonium Ion PM2.5 LC | 88301 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Ammonium Nitrate Extinction PM2.5 LC | 88345 | 899 | Intermittent | Unknown-Unknown | # | 0.002 | 3 | Inverse Megameters | ||||||
| Ammonium Nitrate PM2.5 LC | 88344 | 805 | Intermittent | IMPROVE Calculation for Ammonium Nitrate | 1.29*[NO3] | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Ammonium Nitrate PM2.5 LC | 88344 | 899 | Intermittent | Unknown-Unknown | # | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Ammonium PM10 STP | 82301 | 062 | Intermittent | HI-VOL-WEDDING-INLET | GRAVIMETRIC | 4.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Ammonium PM10 STP | 82301 | 097 | Intermittent | QUARTZ FILTER | SPECIFIC ION ELECTRODE | 0.5 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Ammonium PM10 STP | 82301 | 102 | Intermittent | HI-VOL-SA/GMW1200 | ION CHROMATOCHRPH CONDUCTIMETRIC | 0.1 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Ammonium Sulfate Extinction PM2.5 LC | 88340 | 899 | Intermittent | Unknown-Unknown | # | 0.002 | 3 | Inverse Megameters | ||||||
| Ammonium Sulfate PM2.5 LC | 88339 | 805 | Intermittent | IMPROVE Calculation of Ammonium Sulfate (ammSO4f) | ;4.125*[S] | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Ammonium Sulfate PM2.5 LC | 88339 | 899 | Intermittent | Unknown-Unknown | # | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Aniline (TSP) STP | 16763 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 65.8 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Anthanthrene (TSP) STP | 17210 | 092 | Intermittent | HI-VOL | THIN LAYER CHROMATOGRAPHY | 0.2 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Anthracene (TSP) STP | 17151 | 101 | Intermittent | HI-VOL/PUF-XAD | GC-MS-SIM | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Anthracene (TSP) STP | 17151 | 102 | Intermittent | HI-VOL/PUF CARTRIDGE | TO-13- EPA610- EPA625 | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Anthracene (TSP) STP | 17151 | 103 | Intermittent | Hi-Vol/PUF Cartridge | Micro Wave Extraction GC/MS | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Anthracene (TSP) STP | 17151 | 104 | Intermittent | Hi-Vol/PUF Cartridge | Accelerated solvent extraction GC-MS | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Anthracene (TSP) STP | 17151 | 105 | Intermittent | Hi Vol/PUF | GC/MS TO-13A | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Anthracene (TSP) STP | 17151 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Anthracene (TSP) STP | 17151 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 30.8 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Anthracene (TSP) STP | 17151 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00037 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Anthracene (TSP) STP | 17151 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.0322 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| Anthracene (TSP) STP | 17151 | 119 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS-SIM Modified TO-13A | 0.0322 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| Anthracene (TSP) STP | 17151 | 904 | Intermittent | SKC Pump XAD-2 SORBENT Tube | HPLC Fluorescence/UV NIOSH 5506 | 170.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Anthracene (TSP) STP | 17151 | 909 | Intermittent | SKC Pump XAD-2 SORBENT Tube | GC/MS NIOSH 5515 REAC SOP 1817 | 4060.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Antimony (SP) | 22102 | 101 | Intermittent | NADP BUCKET: DRY SIDE | ATOMIC ABSORPTION | 6.0e-05 | 0.0 | 5 | R | Grams/sq meter/month | ||||
| Antimony (TSP) LC | 14102 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0054 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Antimony (TSP) LC | 14102 | 310 | Intermittent | LO-VOL | ICP-MS | 0.01 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Antimony (TSP) LC | 14102 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.663 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Antimony (TSP) LC | 14102 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0006 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Antimony (TSP) STP | 12102 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0054 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Antimony (TSP) STP | 12102 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.02 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Antimony (TSP) STP | 12102 | 091 | Intermittent | HI-VOL | EMISSION SPECTRA MUFFLE FURNACE | 0.02 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Antimony (TSP) STP | 12102 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.0002 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Antimony (TSP) STP | 12102 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.02 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Antimony (TSP) STP | 12102 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.06 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Antimony (TSP) STP | 12102 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 2.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Antimony (TSP) STP | 12102 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Antimony (TSP) STP | 12102 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Antimony (TSP) STP | 12102 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Antimony (TSP) STP | 12102 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.01 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Antimony (TSP) STP | 12102 | 905 | Intermittent | SKC Pump Filter | ICP/AES NIOSH 7300 | 1.74 | 2 | R | Micrograms/cubic meter (25 C) | |||||
| Antimony (TSP) STP | 12102 | 910 | Intermittent | SKC Pump Filter | MOd NISH 7300/6010B SOP 1813 | 0.0547 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Antimony (precip) | 65344 | 085 | Intermittent | ANDERSON RAINFALL BUCKET | EMISSION SPECTRA ICAP | 0.05 | 0.0 | 2 | R | Milligrams/liter | ||||
| Antimony - 121 (TSP) | 11343 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.01 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Antimony PM10 LC | 85102 | 110 | Intermittent | Hi-Vol SA/GMW1200 | ICP/MS | 53.3 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Antimony PM10 LC | 85102 | 202 | Intermittent | R&P Model 2000 PM10 Teflon | ICP/MS | 0.282 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Antimony PM10 LC | 85102 | 204 | Intermittent | Wedding & Ass. Model 600 PM10 HiVol | ICP-MS | 0.01 | 0.0 | 10000.0 | 2 | R | Nanograms/cubic meter (LC) | |||
| Antimony PM10 LC | 85102 | 216 | Intermittent | Tisch Model TE-Wilbur10 Low-Volume Sampler | ICP-MS | 0.6 | 5 | R | Nanograms/cubic meter (LC) | |||||
| Antimony PM10 LC | 85102 | 501 | Intermittent | Tisch Environmental 6000 Series | ICP-MS | 0.01 | 0.0 | 2 | R | Nanograms/cubic meter (LC) | ||||
| Antimony PM10 LC | 85102 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 4.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Antimony PM10 LC | 85102 | 820 | Continuous | Cooper Environmental Services model Xact 620 | X-ray fluorescence (XRF) | 0.665 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Antimony PM10 LC | 85102 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 5.92 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Antimony PM10 LC | 85102 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 2.1 | 0.0 | 99999.99999 | 1 | R | Nanograms/cubic meter (LC) | |||
| Antimony PM10 LC | 85102 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.6 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Antimony PM10 LC | 85102 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.6 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Antimony PM10 LC | 85102 | 907 | Intermittent | R & P Partisol 2025 Teflon | ICPMS | 0.26 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Antimony PM10 LC | 85102 | 908 | Intermittent | MET ONE E-SEQ-FRM | ICP-MS | 0.0733 | 4 | R | Nanograms/cubic meter (LC) | |||||
| Antimony PM10 LC | 85102 | 911 | Intermittent | ARA low-volume sampler | ICP-MS | 0.6 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Antimony PM10 STP | 82102 | 069 | Intermittent | HIVOL-SA/GMW-321-B | EMISSION SPECTRA ICAP | 20.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Antimony PM10 STP | 82102 | 085 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 20.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Antimony PM10 STP | 82102 | 096 | Intermittent | Med-Vol SA254 TFE | X-ray fluorescence | 100.0 | 0.0 | -2 | R | Nanograms/cubic meter (25 C) | ||||
| Antimony PM10 STP | 82102 | 105 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 10.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Antimony PM10 STP | 82102 | 106 | Intermittent | HI-VOL-WEDDING-INLET | EMISSION SPECTRA ICAP | 40.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Antimony PM10 STP | 82102 | 107 | Intermittent | HI-VOL-SA/GMW-321-B | Emission Spectra ICAP | 17.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Antimony PM10 STP | 82102 | 110 | Intermittent | Hi-Vol SA/GMW1200 Quartz | ICP/MS | 0.13 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Antimony PM10 STP | 82102 | 113 | Intermittent | Hi Vol Anderson IP1076 | ICP/MS | 0.01 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Antimony PM10 STP | 82102 | 201 | Intermittent | R&P Model 2000 PM10 Quartz | ICP/MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Antimony PM10 STP | 82102 | 202 | Intermittent | R&P Model 2000 PM10 Teflon | ICP/MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Antimony PM10 STP | 82102 | 203 | Intermittent | R&P Model 2025 PM10 Teflon | ICP/MS | 1.0 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Antimony PM10 STP | 82102 | 204 | Intermittent | Wedding & Ass. Model 600 PM10 HiVol | ICP-MS | 0.29 | 0.0 | 10000.0 | 2 | R | Nanograms/cubic meter (25 C) | |||
| Antimony PM10 STP | 82102 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 4.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Antimony PM10 STP | 82102 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 15.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Antimony PM10 STP | 82102 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 15.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Antimony PM10 STP | 82102 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 15.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Antimony PM10 STP | 82102 | 908 | Intermittent | MET ONE E-SEQ-FRM | ICP-MS | 0.0733 | 4 | R | Nanograms/cubic meter (25 C) | |||||
| Antimony PM10-2.5 LC | 86102 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00592 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Antimony PM10-2.5 STP | 83102 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.004 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Antimony PM2.5 LC | 88102 | 118 | Intermittent | R & P Model 2025 PM2.5 Sequential w/WINS | ICP/MS | 2.0e-05 | 5.0 | 5 | R | Micrograms/cubic meter (LC) | ||||
| Antimony PM2.5 LC | 88102 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy dispersive XRF | 0.01476 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Antimony PM2.5 LC | 88102 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 0.663 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Antimony PM2.5 LC | 88102 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00592 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Antimony PM2.5 LC | 88102 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00592 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Antimony PM2.5 LC | 88102 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00592 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Antimony PM2.5 LC | 88102 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00592 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Antimony PM2.5 LC | 88102 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00592 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Antimony PM2.5 LC | 88102 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00592 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Antimony PM2.5 LC | 88102 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00592 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Antimony PM2.5 LC | 88102 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 0.0021 | 5000.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Antimony PM2.5 LC | 88102 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0006 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Antimony PM2.5 LC | 88102 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.0006 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Antimony PM2.5 STP | 84102 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.004 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Arsenic (SP) | 22103 | 101 | Intermittent | NADP BUCKET: DRY SIDE | ATOMIC ABSORPTION | 6.0e-05 | 0.0 | 5 | R | Grams/sq meter/month | ||||
| Arsenic (TSP) LC | 14103 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0109 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Arsenic (TSP) LC | 14103 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Arsenic (TSP) LC | 14103 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.02 | 0.0 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Arsenic (TSP) LC | 14103 | 107 | Intermittent | HI-VOL | Flameless Atomic absorption | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Arsenic (TSP) LC | 14103 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 3.0e-05 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Arsenic (TSP) LC | 14103 | 310 | Intermittent | LO-VOL | ICP-MS | 0.005 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Arsenic (TSP) LC | 14103 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.114 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Arsenic (TSP) LC | 14103 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.00023 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Arsenic (TSP) STP | 12103 | 045 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Arsenic (TSP) STP | 12103 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0109 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Arsenic (TSP) STP | 12103 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Arsenic (TSP) STP | 12103 | 091 | Intermittent | HI-VOL | EMISSION SPECTRA MUFFLE FURNACE | 0.1 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Arsenic (TSP) STP | 12103 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.02 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Arsenic (TSP) STP | 12103 | 093 | Intermittent | HI-VOL | NASN ARSINE-COLORIMETRIC | 0.02 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Arsenic (TSP) STP | 12103 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.1 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Arsenic (TSP) STP | 12103 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Arsenic (TSP) STP | 12103 | 097 | Intermittent | HI-VOL | FLAMELESS ATOMIC ABSORPTION | 0.02 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Arsenic (TSP) STP | 12103 | 098 | Intermittent | HI-VOL | NEUTRON ACTIVATION ANALYZER | 0.0055 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Arsenic (TSP) STP | 12103 | 107 | Intermittent | HI-VOL | Flameless Atomic absorption | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Arsenic (TSP) STP | 12103 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 2.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Arsenic (TSP) STP | 12103 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Arsenic (TSP) STP | 12103 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Arsenic (TSP) STP | 12103 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Arsenic (TSP) STP | 12103 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.005 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Arsenic (TSP) STP | 12103 | 905 | Intermittent | SKC Pump Filter | ICP/AES NIOSH 7300 | 1.74 | 2 | R | Micrograms/cubic meter (25 C) | |||||
| Arsenic (TSP) STP | 12103 | 910 | Intermittent | SKC Pump Filter | MOd NISH 7300/6010B SOP 1813 | 0.023 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Arsenic (precip) | 65339 | 101 | Intermittent | NADP BUCKET: WET SIDE | ATOMIC ABSORPTION | 0.089 | 0.0 | 4 | R | Ug/sq meter/hour | ||||
| Arsenic - 75 (TSP) | 11344 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Arsenic PM10 LC | 85103 | 110 | Intermittent | Hi-Vol SA/GMW1200 | ICP/MS | 34.4 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Arsenic PM10 LC | 85103 | 202 | Intermittent | R&P Model 2000 PM10 Teflon | ICP/MS | 0.171 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Arsenic PM10 LC | 85103 | 204 | Intermittent | Wedding & Ass. Model 600 PM10 HiVol | ICP-MS | 0.01 | 0.0 | 10000.0 | 2 | R | Nanograms/cubic meter (LC) | |||
| Arsenic PM10 LC | 85103 | 216 | Intermittent | Tisch Model TE-Wilbur10 Low-Volume Sampler | ICP-MS | 0.6 | 5 | R | Nanograms/cubic meter (LC) | |||||
| Arsenic PM10 LC | 85103 | 501 | Intermittent | Tisch Environmental 6000 Series | ICP-MS | 0.01 | 0.0 | 2 | R | Nanograms/cubic meter (LC) | ||||
| Arsenic PM10 LC | 85103 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Arsenic PM10 LC | 85103 | 820 | Continuous | Cooper Environmental Services model Xact 620 | X-ray fluorescence (XRF) | 0.027 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Arsenic PM10 LC | 85103 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 0.99 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Arsenic PM10 LC | 85103 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 2.1 | 0.0 | 99999.99999 | 1 | R | Nanograms/cubic meter (LC) | |||
| Arsenic PM10 LC | 85103 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.6 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Arsenic PM10 LC | 85103 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.6 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Arsenic PM10 LC | 85103 | 907 | Intermittent | R & P Partisol 2025 Teflon | ICPMS | 0.52 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Arsenic PM10 LC | 85103 | 908 | Intermittent | MET ONE E-SEQ-FRM | ICP-MS | 0.0246 | 4 | R | Nanograms/cubic meter (LC) | |||||
| Arsenic PM10 LC | 85103 | 911 | Intermittent | ARA low-volume sampler | ICP-MS | 0.6 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Arsenic PM10 STP | 82103 | 069 | Intermittent | HIVOL-SA/GMW-321-B | Emission Spectra ICAP | 15.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Arsenic PM10 STP | 82103 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | |||||
| Arsenic PM10 STP | 82103 | 092 | Intermittent | HI-VOL-SA/GMW-321-B | ATOMIC ABSORPTION | 20.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Arsenic PM10 STP | 82103 | 096 | Intermittent | Med-Vol SA254 TFE | X-ray fluorescence | 100.0 | 0.0 | -2 | R | Nanograms/cubic meter (25 C) | ||||
| Arsenic PM10 STP | 82103 | 101 | Intermittent | HI-VOL-SA321A | ATOMIC ABSORPTION | 20.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Arsenic PM10 STP | 82103 | 102 | Intermittent | HI-VOL-SA/GMW1200 | ATOMIC ABSORPTION | 20.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Arsenic PM10 STP | 82103 | 103 | Intermittent | HI-VOL-WEDDING-INLET | ATOMIC ABSORPTION | 20.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Arsenic PM10 STP | 82103 | 104 | Intermittent | HI-VOL-SA321A | EMISSION SPECTRA ICAP | 10.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Arsenic PM10 STP | 82103 | 105 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 10.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Arsenic PM10 STP | 82103 | 106 | Intermittent | HI-VOL-WEDDING-INLET | EMISSION SPECTRA ICAP | 10.0 | 0.0 | -2 | R | Nanograms/cubic meter (25 C) | ||||
| Arsenic PM10 STP | 82103 | 107 | Intermittent | HI-VOL-SA/GMW-321-B | Emission Spectra ICAP | 22.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Arsenic PM10 STP | 82103 | 109 | Intermittent | Hi Vol SA/GMW 321B | ICP/MS | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Arsenic PM10 STP | 82103 | 110 | Intermittent | Hi-Vol SA/GMW1200 Quartz | ICP/MS | 0.13 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Arsenic PM10 STP | 82103 | 112 | Intermittent | Hi Vol Wedding Inlet | ICP/MS | 0.01 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Arsenic PM10 STP | 82103 | 113 | Intermittent | Hi Vol Anderson IP1076 | ICP/MS | 0.09 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Arsenic PM10 STP | 82103 | 141 | Intermittent | Tisch Environ Model-6070 PM10 Hi-Vol | ICP - AES | 0.3 | 0.0 | 99999.99999 | 1 | R | Nanograms/cubic meter (25 C) | |||
| Arsenic PM10 STP | 82103 | 201 | Intermittent | R&P Model 2000 PM10 Quartz | ICP/MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Arsenic PM10 STP | 82103 | 202 | Intermittent | R&P Model 2000 PM10 Teflon | ICP/MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Arsenic PM10 STP | 82103 | 203 | Intermittent | R&P Model 2025 PM10 Teflon | ICP/MS | 4.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Arsenic PM10 STP | 82103 | 204 | Intermittent | Wedding & Ass. Model 600 PM10 HiVol | ICP-MS | 0.22 | 0.0 | 10000.0 | 2 | R | Nanograms/cubic meter (25 C) | |||
| Arsenic PM10 STP | 82103 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Arsenic PM10 STP | 82103 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 5.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Arsenic PM10 STP | 82103 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 5.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Arsenic PM10 STP | 82103 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 5.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Arsenic PM10 STP | 82103 | 501 | Intermittent | Tisch Environmental 6000 Series | ICP-MS | 34.4 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Arsenic PM10 STP | 82103 | 908 | Intermittent | MET ONE E-SEQ-FRM | ICP-MS | 0.0246 | 4 | R | Nanograms/cubic meter (25 C) | |||||
| Arsenic PM10-2.5 LC | 86103 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00099 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Arsenic PM10-2.5 STP | 83103 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Arsenic PM2.5 LC | 88103 | 118 | Intermittent | R & P Model 2025 PM2.5 Sequential w/WINS | ICP/MS | 0.0001 | 5.0 | 5 | R | Micrograms/cubic meter (LC) | ||||
| Arsenic PM2.5 LC | 88103 | 180 | Intermittent | Thermo Dichot Partisol-Plus Model 2025-D Seq | PAired Gravinite Difference | 3.0 | 1 | R | Micrograms/cubic meter (LC) | |||||
| Arsenic PM2.5 LC | 88103 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Arsenic PM2.5 LC | 88103 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Arsenic PM2.5 LC | 88103 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Arsenic PM2.5 LC | 88103 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy dispersive XRF | 0.00247 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Arsenic PM2.5 LC | 88103 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 0.114 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Arsenic PM2.5 LC | 88103 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00099 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Arsenic PM2.5 LC | 88103 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00099 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Arsenic PM2.5 LC | 88103 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00099 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Arsenic PM2.5 LC | 88103 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00099 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Arsenic PM2.5 LC | 88103 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00099 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Arsenic PM2.5 LC | 88103 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00099 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Arsenic PM2.5 LC | 88103 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00099 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Arsenic PM2.5 LC | 88103 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Arsenic PM2.5 LC | 88103 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 0.0021 | 5000.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Arsenic PM2.5 LC | 88103 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0006 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Arsenic PM2.5 LC | 88103 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.0006 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Arsenic PM2.5 LC | 88103 | 908 | Intermittent | R & P Partisol 2000 | X-Ray Fluorescence | 0.0004 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Arsenic PM2.5 STP | 84103 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Asbestos > 0.5um | 11124 | 907 | Intermittent | MCE Filter | Modified TEM AHERA | 0.005 | 0.0 | 3 | R | Structures/Cu Cm | ||||
| Asbestos > 5um | 11123 | 907 | Intermittent | MCE Filter | Modified TEM AHERA | 0.005 | 0.0 | 3 | R | Structures/Cu Cm | ||||
| Asbestos amphibole (TSP) | 12803 | 092 | Intermittent | MEMBRANE-SAMPLER | X-RAY DIFFRACTION | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Atmospheric Stability | 61120 | 101 | Continuous | INSTRUMENTAL | ELECTRONIC OR MACHINE AVERAGE | 1.0 | 0.0 | 0 | R | Pasquill-Gifford stability class | ||||
| Atmospheric Stability | 61120 | 102 | Continuous | INSTRUMENTAL | Standard Deviation of wind direction | 1.0 | 0.0 | 0 | R | Pasquill-Gifford stability class | ||||
| Atmospheric Stability | 61120 | 103 | Continuous | INSTRUMENTAL | Delta temperature | 1.0 | 0.0 | 0 | R | Pasquill-Gifford stability class | ||||
| Atrazine | 43155 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Average Ambient Pressure | 68108 | 116 | Intermittent | BGI Model PQ200 PM2.5 Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 117 | Intermittent | R & P Model 2000 PM2.5 Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 118 | Intermittent | R & P Model 2025 PM2.5 Sequent | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 119 | Intermittent | Anderson RAAS2.5-100 Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 120 | Intermittent | Anderson RAAS2.5-300 PM2.5 Seq | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 123 | Intermittent | Thermo Env Model 605 CAPS | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 125 | Intermittent | BGI Inc. Model PQ200 PM10 | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 126 | Intermittent | R - P Co Partisol Model 2000 | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 127 | Intermittent | R - P Co Partisol Model 2025 | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 128 | Intermittent | Andersen RAAS2.5-200 PM2.5 Aud | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 129 | Intermittent | R&P CO Model 2000 PM-2.5 Audit | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 135 | Intermittent | URG-MASS100 Single PM2.5 Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 136 | Intermittent | URG-MASS300 Sequential PM2.5 Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 142 | Intermittent | BGI Models PQ200-VSCC or PQ200A-VSCC | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 143 | Intermittent | R & P Model 2000 PM-2.5 FEM Air Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 144 | Intermittent | R & P Model 2000 PM-2.5 FEM Audit Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 145 | Intermittent | R & P Model 2025 PM-2.5 FEM Sequential Air Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 153 | Intermittent | Thermo Electron Model RAAS2.5-100 w/VSCC | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 154 | Intermittent | Thermo Electron Model RAAS2.5-200 Audit w/VSCC | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 155 | Intermittent | Thermo Electron Model RAAS2.5-300 Sequential w/VSCC | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 170 | Continuous | Met One BAM-1020 Mass Monitor | Barometric Sensor | FEM | EQPM-0308-170 | Met One BAM-1020 PM2.5 FEM | 2.0 | -10.0 | 1000.0 | 1 | R | Millimeters (mercury) |
| Average Ambient Pressure | 68108 | 179 | Intermittent | Thermo Scientific Dichot, Partisol-Plus Model 2025-D | Barometric Sensor | 2.0 | 1 | R | Millimeters (mercury) | |||||
| Average Ambient Pressure | 68108 | 545 | Intermittent | Met One E-SEQ-FRM with VSCC | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 780 | Continuous | INSTRUMENTAL | BAROMETRIC SENSOR | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 803 | Intermittent | Instrumental | Off Site Avg. pressure | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 810 | Intermittent | Met One SASS/SuperSASS | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 820 | Intermittent | Andersen RAAS | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 830 | Intermittent | URG MASS400 WINS | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 838 | Intermittent | URG 3000N | Barometric Sensor | 450.0 | 450.0 | 1000.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 850 | Intermittent | R&P MDL2300 PM2.5 SEQ SPEC | BAROMETRIC SENSOR | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 870 | Intermittent | URG MASS400 VSCC | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure | 68108 | 901 | Intermittent | BGI Inc. frmOMNI | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure for URG3000N | 68118 | 810 | Intermittent | MET ONE SASS/SUPERSASS | Barometric Sensor | 450.0 | 450.0 | 1000.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Pressure for URG3000N | 68118 | 838 | Intermittent | URG 3000N | Barometric Sensor | 450.0 | 450.0 | 1000.0 | 0 | R | Millimeters (mercury) | |||
| Average Ambient Temperature | 68105 | 116 | Intermittent | BGI Model PQ200 PM2.5 Sampler | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 117 | Intermittent | R & P Model 2000 PM2.5 Sampler | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 118 | Intermittent | R & P Model 2025 PM2.5 Sequent | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 119 | Intermittent | Anderson RAAS2.5-100 Sampler | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 120 | Intermittent | Anderson RAAS2.5-300 PM2.5 Seq | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 123 | Intermittent | Thermo Env Model 605 CAPS | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 125 | Intermittent | BGI Inc. Model PQ200 PM10 | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 126 | Intermittent | R - P Co Partisol Model 2000 | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 127 | Intermittent | R - P Co Partisol Model 2025 | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 128 | Intermittent | Andersen RAAS2.5-200 PM2.5 Aud | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 129 | Intermittent | R & P Co Model 2000 PM-2.5 Audit | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 135 | Intermittent | URG-MASS100 Single PM2.5 Sampler | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 136 | Intermittent | URG-MASS300 Sequential PM2.5 Sampler | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 142 | Intermittent | BGI Models PQ200-VSCC or PQ200A-VSCC | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 143 | Intermittent | R & P Model 2000 PM-2.5 FEM Air Sampler | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 144 | Intermittent | R & P Model 2000 PM-2.5 FEM Audit Sampler | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 145 | Intermittent | R & P Model 2025 PM-2.5 FEM Sequential Air Sampler | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 153 | Intermittent | Thermo Electron Model RAAS2.5-100 w/VSCC | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 154 | Intermittent | Thermo Electron Model RAAS2.5-200 Audit w/VSCC | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 155 | Intermittent | Thermo Electron Model RAAS2.5-300 Sequential w/VSCC | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 170 | Continuous | Met One BAM-1020 Mass Monitor | Electronic | FEM | EQPM-0308-170 | Met One BAM-1020 PM2.5 FEM | 2.0 | -10.0 | 1000.0 | 1 | R | Degrees Centigrade |
| Average Ambient Temperature | 68105 | 179 | Intermittent | Thermo Scientific Dichot, PArtisol-Plus Model 2025-D Seq | Electronic | 2.0 | 1 | R | Degrees Centigrade | |||||
| Average Ambient Temperature | 68105 | 545 | Intermittent | Met One E-SEQ-FRM with VSCC | Electronic | FRM | RFPS-0717-245 | Met One E-SEQ-FRM PM2.5 with VSCC | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade |
| Average Ambient Temperature | 68105 | 780 | Continuous | INSTRUMENTAL | ELECTRONIC | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 803 | Intermittent | Instrumental | Off Site Avg.Temperature | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 810 | Intermittent | Met One SASS/SuperSASS | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 820 | Intermittent | Andersen RAAS | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 830 | Intermittent | URG MASS400 WINS | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 838 | Intermittent | URG 3000N | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 850 | Intermittent | R&P MDL2300 PM2.5 SEQ SPEC | CALCULATION | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 870 | Intermittent | URG MASS400 VSCC | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature | 68105 | 901 | Intermittent | BGI Inc. frmOMNI | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature for URG3000N | 68117 | 810 | Intermittent | MET ONE SASS/SUPERSASS | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Average Ambient Temperature for URG3000N | 68117 | 838 | Intermittent | URG 3000N | Electronic | -40.0 | -40.0 | 55.0 | 1 | R | Degrees Centigrade | |||
| Azobenzene (TSP) STP | 16764 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 30.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Azobenzene (TSP) STP | 16764 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00057 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Barium (TSP) LC | 14107 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0018 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Barium (TSP) LC | 14107 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 3.0e-05 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Barium (TSP) LC | 14107 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.945 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Barium (TSP) STP | 12107 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Barium (TSP) STP | 12107 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.003 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Barium (TSP) STP | 12107 | 091 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.02 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Barium (TSP) STP | 12107 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.02 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Barium (TSP) STP | 12107 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.08 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Barium (TSP) STP | 12107 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 2.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Barium (TSP) STP | 12107 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Barium (TSP) STP | 12107 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Barium (TSP) STP | 12107 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.025 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Barium (TSP) STP | 12107 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Barium (TSP) STP | 12107 | 905 | Intermittent | SKC Pump Filter | ICP/AES NIOSH 7300 | 0.35 | 2 | R | Micrograms/cubic meter (25 C) | |||||
| Barium (TSP) STP | 12107 | 910 | Intermittent | SKC Pump Filter | MOd NISH 7300/6010B SOP 1813 | 0.0123 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Barium (precip) | 65107 | 085 | Intermittent | ANDERSON RAINFALL BUCKET | EMISSION SPECTRA ICAP | 0.005 | 0.0 | 3 | R | Milligrams/liter | ||||
| Barium PM10 LC | 85107 | 110 | Intermittent | Hi-Vol SA/GMW1200 | ICP/MS | 30.0 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Barium PM10 LC | 85107 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 21.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Barium PM10 LC | 85107 | 820 | Continuous | Cooper Environmental Services model Xact 620 | X-ray fluorescence (XRF) | 0.397 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Barium PM10 LC | 85107 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 23.6 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Barium PM10 LC | 85107 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.28 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Barium PM10 LC | 85107 | 907 | Intermittent | R & P Partisol 2025 Teflon | ICPMS | 0.28 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Barium PM10 STP | 82107 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | |||||
| Barium PM10 STP | 82107 | 092 | Intermittent | HI-VOL-SA/GMW-321-B | ATOMIC ABSORPTION | 20.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Barium PM10 STP | 82107 | 102 | Intermittent | HI-VOL-SA/GMW1200 | ATOMIC ABSORPTION | 20.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Barium PM10 STP | 82107 | 105 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 20.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Barium PM10 STP | 82107 | 106 | Intermittent | HI-VOL-WEDDING-INLET | EMISSION SPECTRA ICAP | 20.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Barium PM10 STP | 82107 | 107 | Intermittent | HI-VOL-SA/GMW-321B | EMISSION SPECTRA ICAP | 20.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Barium PM10 STP | 82107 | 109 | Intermittent | Hi Vol SA/GMW 321B | ICP/MS | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Barium PM10 STP | 82107 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 21.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Barium PM10 STP | 82107 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 33.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Barium PM10 STP | 82107 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 33.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Barium PM10 STP | 82107 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 33.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Barium PM10-2.5 LC | 86107 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.0236 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Barium PM10-2.5 STP | 83107 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.021 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Barium PM2.5 LC | 88107 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy dispersive XRF | 0.05876 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Barium PM2.5 LC | 88107 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 0.945 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Barium PM2.5 LC | 88107 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.0236 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Barium PM2.5 LC | 88107 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.0236 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Barium PM2.5 LC | 88107 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.0236 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Barium PM2.5 LC | 88107 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.0236 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Barium PM2.5 LC | 88107 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.0236 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Barium PM2.5 LC | 88107 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.0236 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Barium PM2.5 LC | 88107 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.0236 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Barium PM2.5 LC | 88107 | 908 | Intermittent | R & P Partisol 2000 | X-Ray Fluorescence | 0.0002 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Barium PM2.5 STP | 84107 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.021 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Barometric pressure | 64101 | 011 | Continuous | INSTRUMENTAL | ANEROID | 1.0 | 0.0 | 0 | R | Millibars | ||||
| Barometric pressure | 64101 | 012 | Continuous | INSTRUMENTAL | TVA MERCURIAL AVG. 5 MIN. READINGS | 1.0 | 0.0 | 0 | R | Millibars | ||||
| Barometric pressure | 64101 | 013 | Continuous | INSTRUMENTAL | MERCURIAL | 1.0 | 0.0 | 0 | R | Millibars | ||||
| Barometric pressure | 64101 | 014 | Continuous | INSTRUMENTAL | BAROMETRIC SENSOR | 0.7 | 0.0 | 1 | R | Millibars | ||||
| Barometric pressure | 64101 | 015 | Continuous | INSTRUMENTAL | BAROMETRIC PRESSURE TRANSDUCER | 1.0 | 0.0 | 0 | R | Millibars | ||||
| Barometric pressure | 64101 | 060 | Continuous | Instrumental | Vaisala 555B Pressure Sensor | 0.5 | 0.0 | 1 | R | Millibars | ||||
| Barometric pressure | 64101 | 069 | Continuous | Instrumental | Met One AIO2 Sonic Weather Sensor | 1.0 | 0 | R | Millibars | |||||
| Barometric pressure | 64101 | 130 | Continuous | Instrumental | RM Young | 500.0 | 500.0 | 1100.0 | 0 | R | Millibars | |||
| Barometric pressure | 64101 | 803 | Continuous | Instrumental | Off site baro pressure | 0.5 | 0.0 | 1 | R | Millibars | ||||
| Benzaldehyde | 45501 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzaldehyde | 45501 | 102 | Intermittent | DNPH-COATED CARTRIDGE | HPLC (TO-14) | 0.6 | -0.6 | 2 | R | Parts per billion Carbon | ||||
| Benzaldehyde | 45501 | 114 | Intermittent | CARTRIDGE-DNPH-SILICA-SEP-PAK | HPLC-PHOTODIODE ARRAY | 0.085 | -0.085 | 2 | R | Parts per billion Carbon | ||||
| Benzaldehyde | 45501 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Benzaldehyde | 45501 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzaldehyde | 45501 | 130 | Intermittent | DNPH-COATED CARTRIDGE | HPLC (TO-14) | 0.57 | -0.57 | 1 | R | Parts per billion Carbon | ||||
| Benzaldehyde | 45501 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzaldehyde | 45501 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Benzaldehyde | 45501 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzaldehyde | 45501 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon - GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzaldehyde | 45501 | 156 | Intermittent | Cartridge DNPH on Silica, Heated O3 Denuder | HPLC Photo Diode Array | 0.343 | -0.343 | 1 | R | Parts per billion Carbon | ||||
| Benzaldehyde | 45501 | 165 | Intermittent | ATEC 2400 W/Waters Silica DNPH | HP LC-1050 W/Diode Array Detector | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| Benzaldehyde | 45501 | 166 | Intermittent | ATEC 2400 W/Waters Silica DNPH | TO-11 Dionex DX-300 Ion Chrmtg | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| Benzaldehyde | 45501 | 179 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | Liquid Chromatography w/diode array detection | 0.07 | -0.07 | 2 | R | Parts per billion Carbon | ||||
| Benzaldehyde | 45501 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzanthrone (TSP) STP | 17502 | 091 | Intermittent | HI-VOL | THIN LAYER CHROMATOGRAPHY | 0.2 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Benzene | 45201 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 36.0 | -36.0 | 0 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 092 | Continuous | Tenax GR/Trap | Thermal Desorber GC/PID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 102 | Intermittent | TENAX GR/TRAP | Thermal Desorber GC/PID | 1.86 | -1.86 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 1.86 | -1.86 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 104 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-FID | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 1.8 | -1.8 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 108 | Intermittent | TEDLAR-BAG-24-HR-SAMPLE | GC PHOTOIONIZATION DETECTOR | 3.0 | -3.0 | 3 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.6 | -0.6 | 2 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 111 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-FID | 0.06 | -0.06 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 115 | Intermittent | TENAX TRAP AC PUMP | HEAT DESORPTION GC MASS SPEC | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 1.2 | -1.2 | 3 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 117 | Intermittent | TENAX SORBENT CARTRIDGE | GC/MS | 0.78 | -0.78 | 2 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 118 | Intermittent | TENAX SORBENT CARTRIDGE | GC-FID/ECD | 0.06 | -0.06 | 3 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 119 | Intermittent | PERSONAL PUMP MOLECULAR SIEVE | GC/MS | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 132 | Continuous | GC SRI Model #8610 | Thermal Desorber GC/FID/PID | 0.3 | -0.3 | 2 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 134 | Continuous | Semi-Continuous Analyzer | GC/PID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.3 | -0.3 | 2 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 140 | Continuous | UV Spectrometer with URS methods | Spectra reference matching via PLS | 1.8 | -1.8 | 2 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 141 | Continuous | IR Spectrometer | Spectra reference matching with PLS | 48.0 | -48.0 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.67186 | -0.67186 | 4 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 144 | Intermittent | 3 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.53 | -0.53 | 2 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 151 | Intermittent | 6L PRESSURIZED CANISTER | CAPILLARY GC-ECD/PID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.3 | -0.3 | 2 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 155 | Intermittent | Pressurized Canister | Capiullary GC-PID Multi Point CAL | 0.6 | -0.6 | 2 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 157 | Continuous | Instrumental Open Path | UV OPSIS Model AR 500 | 6.0 | -6.0 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 168 | Intermittent | 6L PRESSURIZED CANISTER | PACKED COLUMN GC - ECD/PID | 3.0 | -3.0 | 2 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 169 | Intermittent | TEDLAR BAG | PACKED COLUMN GC - ECD/PID | 3.0 | -3.0 | 2 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.24 | -0.24 | 3 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.12 | -0.12 | 3 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.6 | -0.6 | 2 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Benzene | 45201 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Benzene | 45201 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Benzene | 45201 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Benzene | 45201 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Benzene | 45201 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Benzene | 45201 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Benzene | 45201 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Benzene | 45201 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Benzene | 45201 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Benzene | 45201 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Benzene | 45201 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Benzene | 45201 | 903 | Intermittent | SKC Pump Charcoal Tube | GC/FID NIOSH 1501 | 4.84 | -4.84 | 2 | R | Parts per billion Carbon | ||||
| Benzene | 45201 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 1.18 | -1.18 | 2 | R | Parts per billion Carbon | ||||
| Benzene & 1,2-dichloroethane | 45115 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzene Sol Org (SP) | 21103 | 071 | Intermittent | BUCKET | SOXHLET (APCA) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Benzene Sol Org (SP) | 21103 | 081 | Intermittent | BUCKET | SOXHLET (ASTM) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Benzene soluble organics (TSP) | 11103 | 091 | Intermittent | HI-VOL | BENZENE EXTRACTION-SOXHLET | 0.2 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Benzene, 1,2,3-trichloro- | 45815 | 169 | Intermittent | Tedlar bag | Packed Column GC- ECD/PID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzene, 1-ethenyl-4-methyl | 45228 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.69 | -0.69 | 2 | R | Parts per billion Carbon | ||||
| Benzene, 1-ethenyl-4-methyl | 45228 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.8 | -0.8 | 2 | R | Parts per billion Carbon | ||||
| Benzene, 1-ethenyl-4-methyl | 45228 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Benzene, 1-ethenyl-4-methyl | 45228 | 113 | Intermittent | SS-Canister_Pressurized | Capillary GC ITD Mass Spectro | 0.297 | -0.297 | 3 | R | Parts per billion Carbon | ||||
| Benzene, 1-ethenyl-4-methyl | 45228 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Benzene, 1-ethenyl-4-methyl | 45228 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Benzene, 1-ethenyl-4-methyl | 45228 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzene, 1-ethenyl-4-methyl | 45228 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzene,(1-methylethenyl)- | 45221 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.9 | -0.9 | 2 | R | Parts per billion Carbon | ||||
| Benzene,(1-methylethenyl)- | 45221 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Benzene,(1-methylethenyl)- | 45221 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Benzene,(1-methylethenyl)- | 45221 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzene,(1-methylethenyl)- | 45221 | 176 | Intermittent | 6L SUBAMBIENT SS-CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzene,(1-methylethenyl)- | 45221 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 6.36 | -6.36 | 2 | R | Parts per billion Carbon | ||||
| Benzidine (TSP) STP | 16765 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 250.0 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo(a)Pyrene PM10 STP | 82242 | 063 | Intermittent | HI-VOL-SA/GMW1200 | HPLC SCANNING FLUORESCENCE | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Benzo(b)Fluranthene PM10 STP | 82220 | 063 | Intermittent | HI-VOL-SA/GMW1200 | HPLC SCANNING FLUORESCENCE | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Benzo(g,h,i)Perylene PM10 STP | 82237 | 063 | Intermittent | HI-VOL-SA/GMW1200 | HPLC SCANNING FLUORESCENCE | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Benzo(k)Fluoranthene PM10 STP | 82223 | 063 | Intermittent | HI-VOL-SA/GMW1200 | HPLC SCANNING FLUORESCENCE | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Benzo[a]anthracene (TSP) STP | 17215 | 092 | Intermittent | HI-VOL | THIN LAYER CHROMATOGRAPHY | 0.2 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[a]anthracene (TSP) STP | 17215 | 101 | Intermittent | HI-VOL/PUF-XAD | GC-MS-SIM | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[a]anthracene (TSP) STP | 17215 | 102 | Intermittent | HI-VOL/PUF CARTRIDGE | TO-13- EPA610- EPA625 | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[a]anthracene (TSP) STP | 17215 | 103 | Intermittent | Hi-Vol/PUF Cartridge | Micro Wave Extraction GC/MS | 0.27 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[a]anthracene (TSP) STP | 17215 | 104 | Intermittent | Hi-Vol/PUF Cartridge | Accelerated solvent extraction GC-MS | 0.34 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[a]anthracene (TSP) STP | 17215 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[a]anthracene (TSP) STP | 17215 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 19.4 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[a]anthracene (TSP) STP | 17215 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.0002 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[a]anthracene (TSP) STP | 17215 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.0642 | 0.0 | 3 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[a]anthracene (TSP) STP | 17215 | 119 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS-SIM Modified TO-13A | 0.0642 | 0.0 | 3 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[a]anthracene (TSP) STP | 17215 | 904 | Intermittent | SKC Pump XAD-2 SORBENT Tube | HPLC Fluorescence/UV NIOSH 5506 | 170.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Benzo[a]anthracene (TSP) STP | 17215 | 909 | Intermittent | SKC Pump XAD-2 SORBENT Tube | GC/MS NIOSH 5515 REAC SOP 1817 | 4260.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Benzo[a]pyrene (TSP) STP | 17242 | 091 | Intermittent | HI-VOL | THIN LAYER CHROMATOGRAPHY | 0.2 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[a]pyrene (TSP) STP | 17242 | 101 | Intermittent | HI-VOL/PUF-XAD | GC-MS-SIM | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[a]pyrene (TSP) STP | 17242 | 102 | Intermittent | HI-VOL/PUF CARTRIDGE | TO-13- EPA610- EPA625 | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[a]pyrene (TSP) STP | 17242 | 103 | Intermittent | Hi-Vol/PUF Cartridge | Micro Wave Extraction GC/MS | 0.37 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[a]pyrene (TSP) STP | 17242 | 104 | Intermittent | Hi-Vol/PUF Cartridge | Accelerated solvent extraction GC-MS | 0.55 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[a]pyrene (TSP) STP | 17242 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[a]pyrene (TSP) STP | 17242 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 17.9 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[a]pyrene (TSP) STP | 17242 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00036 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[a]pyrene (TSP) STP | 17242 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.0734 | 0.0 | 3 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[a]pyrene (TSP) STP | 17242 | 119 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS-SIM Modified TO-13A | 0.0734 | 0.0 | 3 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[a]pyrene (TSP) STP | 17242 | 904 | Intermittent | SKC Pump XAD-2 SORBENT Tube | HPLC Fluorescence/UV NIOSH 5506 | 170.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Benzo[a]pyrene (TSP) STP | 17242 | 909 | Intermittent | SKC Pump XAD-2 SORBENT Tube | GC/MS NIOSH 5515 REAC SOP 1817 | 4490.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Benzo[b,k]fluoranthene (TSP) STP | 17225 | 101 | Intermittent | HI-VOL/PUF-XAD | GC-MS-SIM | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[b,k]fluoranthene (TSP) STP | 17225 | 102 | Intermittent | HI-VOL/PUF CARTRIDGE | TO-13- EPA610- EPA625 | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[b,k]fluoranthene (TSP) STP | 17225 | 103 | Intermittent | Hi-Vol/PUF Cartridge | Micro Wave Extraction GC/MS | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[b,k]fluoranthene (TSP) STP | 17225 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 28.0 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[b]fluoranthene (TSP) STP | 17220 | 101 | Intermittent | HI-VOL/PUF-XAD | GC-MS-SIM | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[b]fluoranthene (TSP) STP | 17220 | 102 | Intermittent | HI-VOL/PUF CARTRIDGE | TO-13- EPA610- EPA625 | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[b]fluoranthene (TSP) STP | 17220 | 103 | Intermittent | Hi-Vol/PUF Cartridge | Micro Wave Extraction GC/MS | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[b]fluoranthene (TSP) STP | 17220 | 104 | Intermittent | Hi-Vol/PUF Cartridge | Accelerated solvent extraction GC-MS | 0.52 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[b]fluoranthene (TSP) STP | 17220 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[b]fluoranthene (TSP) STP | 17220 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 34.8 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[b]fluoranthene (TSP) STP | 17220 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00021 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[b]fluoranthene (TSP) STP | 17220 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.0912 | 0.0 | 3 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[b]fluoranthene (TSP) STP | 17220 | 119 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS-SIM Modified TO-13A | 0.0912 | 0.0 | 3 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[b]fluoranthene (TSP) STP | 17220 | 904 | Intermittent | SKC Pump XAD-2 SORBENT Tube | HPLC Fluorescence/UV NIOSH 5506 | 350.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Benzo[b]fluoranthene (TSP) STP | 17220 | 909 | Intermittent | SKC Pump XAD-2 SORBENT Tube | GC/MS NIOSH 5515 REAC SOP 1817 | 4860.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Benzo[e]pyrene (TSP) STP | 17224 | 092 | Intermittent | HI-VOL | THIN LAYER CHROMATOGRAPHY | 0.2 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[e]pyrene (TSP) STP | 17224 | 102 | Intermittent | HI-VOL/PUF CARTRIDGE | TO-13- EPA610- EPA625 | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[e]pyrene (TSP) STP | 17224 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[e]pyrene (TSP) STP | 17224 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00017 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[e]pyrene (TSP) STP | 17224 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.113 | 0.0 | 3 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[e]pyrene (TSP) STP | 17224 | 119 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS-SIM Modified TO-13A | 0.113 | 0.0 | 3 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[e]pyrene (TSP) STP | 17224 | 909 | Intermittent | SKC Pump XAD-2 SORBENT Tube | GC/MS NIOSH 5515 REAC SOP 1817 | 4380.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Benzo[g,h,i]perylene (TSP) STP | 17237 | 092 | Intermittent | HI-VOL | THIN LAYER CHROMATOGRAPHY | 0.2 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[g,h,i]perylene (TSP) STP | 17237 | 101 | Intermittent | HI-VOL/PUF-XAD | GC-MS-SIM | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[g,h,i]perylene (TSP) STP | 17237 | 102 | Intermittent | HI-VOL/PUF CARTRIDGE | TO-13- EPA610- EPA625 | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[g,h,i]perylene (TSP) STP | 17237 | 103 | Intermittent | Hi-Vol/PUF Cartridge | Micro Wave extraction GC/MS | 0.4 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[g,h,i]perylene (TSP) STP | 17237 | 104 | Intermittent | Hi-Vol/PUF Cartridge | Accelerated solvent extraction GC-MS | 0.32 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[g,h,i]perylene (TSP) STP | 17237 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[g,h,i]perylene (TSP) STP | 17237 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 28.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[g,h,i]perylene (TSP) STP | 17237 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00014 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[g,h,i]perylene (TSP) STP | 17237 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.104 | 0.0 | 3 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[g,h,i]perylene (TSP) STP | 17237 | 119 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS-SIM Modified TO-13A | 0.104 | 0.0 | 3 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[g,h,i]perylene (TSP) STP | 17237 | 904 | Intermittent | SKC Pump XAD-2 SORBENT Tube | HPLC Fluorescence/UV NIOSH 5506 | 350.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Benzo[g,h,i]perylene (TSP) STP | 17237 | 909 | Intermittent | SKC Pump XAD-2 SORBENT Tube | GC/MS NIOSH 5515 REAC SOP 1817 | 4480.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Benzo[k]fluoranthene (TSP) STP | 17223 | 101 | Intermittent | HI-VOL/PUF-XAD | GC-MS-SIM | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[k]fluoranthene (TSP) STP | 17223 | 102 | Intermittent | HI-VOL/PUF CARTRIDGE | TO-13- EPA610- EPA625 | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[k]fluoranthene (TSP) STP | 17223 | 103 | Intermittent | Hi-Vol/PUF Cartridge | Micro Wave Extraction GC/MS | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[k]fluoranthene (TSP) STP | 17223 | 104 | Intermittent | Hi-Vol/PUF Cartridge | Accelerated solvent extraction GC-MS | 0.27 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[k]fluoranthene (TSP) STP | 17223 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[k]fluoranthene (TSP) STP | 17223 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 28.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[k]fluoranthene (TSP) STP | 17223 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00014 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[k]fluoranthene (TSP) STP | 17223 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.0513 | 0.0 | 3 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[k]fluoranthene (TSP) STP | 17223 | 119 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS-SIM Modified TO-13A | 0.0513 | 0.0 | 3 | R | Nanograms/cubic meter (25 C) | ||||
| Benzo[k]fluoranthene (TSP) STP | 17223 | 904 | Intermittent | SKC Pump XAD-2 SORBENT Tube | HPLC Fluorescence/UV NIOSH 5506 | 170.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Benzo[k]fluoranthene (TSP) STP | 17223 | 909 | Intermittent | SKC Pump XAD-2 SORBENT Tube | GC/MS NIOSH 5515 REAC SOP 1817 | 5300.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Benzyl alcohol (TSP) STP | 16766 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 41.7 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Benzyl chloride | 45809 | 101 | Intermittent | Canister Subambient Pressure | Multi Detector GC | 0.014 | -0.014 | 2 | R | Parts per billion Carbon | ||||
| Benzyl chloride | 45809 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.07 | -0.07 | 1 | R | Parts per billion Carbon | ||||
| Benzyl chloride | 45809 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzyl chloride | 45809 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Benzyl chloride | 45809 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Benzyl chloride | 45809 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Benzyl chloride | 45809 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Benzyl chloride | 45809 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Benzyl chloride | 45809 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Benzyl chloride | 45809 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Benzyl chloride | 45809 | 176 | Intermittent | 6L subatm SS Canister | Entech Precon GC/MS | 0.609 | -0.609 | 2 | R | Parts per billion Carbon | ||||
| Benzyl chloride | 45809 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.14 | -0.14 | 3 | R | Parts per billion Carbon | ||||
| Benzyl chloride | 45809 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.98 | -0.98 | 2 | R | Parts per billion Carbon | ||||
| Benzyl chloride | 45809 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Benzyl chloride | 45809 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 1.05 | -1.05 | 2 | R | Parts per billion Carbon | ||||
| Beryllium (TSP) LC | 14105 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0022 | 0.0 | 3 | R | Nanograms/cubic meter (LC) | ||||
| Beryllium (TSP) LC | 14105 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.06 | 0.0 | 2 | R | Nanograms/cubic meter (LC) | ||||
| Beryllium (TSP) LC | 14105 | 107 | Intermittent | HI-VOL | Flameless Atomic absorption | 0.01 | 0.0 | 2 | R | Nanograms/cubic meter (LC) | ||||
| Beryllium (TSP) LC | 14105 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 3.0e-05 | 5 | R | Nanograms/cubic meter (LC) | |||||
| Beryllium (TSP) LC | 14105 | 310 | Intermittent | LO-VOL | ICP-MS | 0.6 | 5 | R | Nanograms/cubic meter (LC) | |||||
| Beryllium (TSP) LC | 14105 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.00042 | 5 | R | Nanograms/cubic meter (LC) | |||||
| Beryllium (TSP) STP | 12105 | 045 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.0006 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium (TSP) STP | 12105 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0022 | 0.0 | 3 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium (TSP) STP | 12105 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.06 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium (TSP) STP | 12105 | 091 | Intermittent | HI-VOL | EMISSION SPECTRA MUFFLE FURNACE | 0.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium (TSP) STP | 12105 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium (TSP) STP | 12105 | 093 | Intermittent | HI-VOL | MORIN METHOD | 0.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium (TSP) STP | 12105 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium (TSP) STP | 12105 | 107 | Intermittent | HI-VOL | Flameless Atomic absorption | 0.01 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium (TSP) STP | 12105 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 2.0e-05 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium (TSP) STP | 12105 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium (TSP) STP | 12105 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.6 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium (TSP) STP | 12105 | 905 | Intermittent | SKC Pump Filter | ICP/AES NIOSH 7300 | 30.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Beryllium (TSP) STP | 12105 | 910 | Intermittent | SKC Pump Filter | MOd NISH 7300/6010B SOP 1813 | 11.2 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium (precip) | 65105 | 085 | Intermittent | ANDERSON RAINFALL BUCKET | EMISSION SPECTRA ICAP | 0.001 | 0.0 | 3 | R | Milligrams/liter | ||||
| Beryllium PM10 LC | 85105 | 110 | Intermittent | Hi-Vol SA/GMW1200 | ICP/MS | 46.7 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Beryllium PM10 LC | 85105 | 202 | Intermittent | R&P Model 2000 PM10 Teflon | ICP/MS | 0.0159 | 4 | R | Nanograms/cubic meter (LC) | |||||
| Beryllium PM10 LC | 85105 | 204 | Intermittent | Wedding & Ass. Model 600 PM10 HiVol | ICP-MS | 0.01 | 10000.0 | 2 | R | Nanograms/cubic meter (LC) | ||||
| Beryllium PM10 LC | 85105 | 216 | Intermittent | Tisch Model TE-Wilbur10 Low-Volume Sampler | ICP-MS | 0.6 | 5 | R | Nanograms/cubic meter (LC) | |||||
| Beryllium PM10 LC | 85105 | 501 | Intermittent | Tisch Environmental 6000 Series | ICP-MS | 0.01 | 0.0 | 2 | R | Nanograms/cubic meter (LC) | ||||
| Beryllium PM10 LC | 85105 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 2.1 | 0.0 | 99999.99999 | 1 | R | Nanograms/cubic meter (LC) | |||
| Beryllium PM10 LC | 85105 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.6 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Beryllium PM10 LC | 85105 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.6 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Beryllium PM10 LC | 85105 | 907 | Intermittent | R & P Partisol 2025 Teflon | ICPMS | 0.26 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Beryllium PM10 LC | 85105 | 908 | Intermittent | MET ONE E-SEQ-FRM | ICP-MS | 0.00647 | 5 | R | Nanograms/cubic meter (LC) | |||||
| Beryllium PM10 LC | 85105 | 911 | Intermittent | ARA low-volume sampler | ICP-MS | 0.6 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Beryllium PM10 STP | 82105 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | |||||
| Beryllium PM10 STP | 82105 | 092 | Intermittent | HI-VOL-SA/GMW-321-B | ATOMIC ABSORPTION | 0.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium PM10 STP | 82105 | 102 | Intermittent | HI-VOL-SA/GMW1200 | ATOMIC ABSORPTION | 0.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium PM10 STP | 82105 | 105 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 0.6 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium PM10 STP | 82105 | 106 | Intermittent | HI-VOL-WEDDING-INLET | EMISSION SPECTRA ICAP | 0.6 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium PM10 STP | 82105 | 107 | Intermittent | HI-VOL-SA/GMW-321B | EMISSION SPECTRA ICAP | 0.6 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium PM10 STP | 82105 | 109 | Intermittent | Hi Vol SA/GMW 321B | ICP/MS | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium PM10 STP | 82105 | 110 | Intermittent | Hi-Vol SA/GMW1200 Quartz | ICP/MS | 0.04 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium PM10 STP | 82105 | 113 | Intermittent | Hi Vol Anderson IP1076 | ICP/MS | 0.05 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium PM10 STP | 82105 | 201 | Intermittent | R&P Model 2000 PM10 Quartz | ICP/MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium PM10 STP | 82105 | 202 | Intermittent | R&P Model 2000 PM10 Teflon | ICP/MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium PM10 STP | 82105 | 203 | Intermittent | R&P Model 2025 PM10 Teflon | ICP/MS | 2.0 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium PM10 STP | 82105 | 204 | Intermittent | Wedding & Ass. Model 600 PM10 HiVol | ICP-MS | 0.24 | 0.0 | 10000.0 | 2 | R | Nanograms/cubic meter (25 C) | |||
| Beryllium PM10 STP | 82105 | 501 | Intermittent | Tisch Environmental 6000 Series | ICP-MS | 0.01 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Beryllium PM10 STP | 82105 | 908 | Intermittent | MET ONE E-SEQ-FRM | ICP-MS | 0.00647 | 5 | R | Nanograms/cubic meter (25 C) | |||||
| Beryllium PM2.5 LC | 88105 | 118 | Intermittent | R & P Model 2025 PM2.5 Sequential w/WINS | ICP/MS | 1.0e-05 | 5.0 | 5 | R | Micrograms/cubic meter (LC) | ||||
| Beryllium PM2.5 LC | 88105 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 0.0021 | 5000.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Beryllium PM2.5 LC | 88105 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0006 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Beryllium PM2.5 LC | 88105 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.0006 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Beta radiation (TSP) | 11302 | 091 | Intermittent | HI-VOL | PROPORTIONAL COUNTER | 0.01 | 0.0 | 2 | R | Picocuries/cubic meter | ||||
| Beta radiation (TSP) | 11302 | 092 | Intermittent | HI-VOL | SCINTILLATION COUNTER | 0.01 | 0.0 | 2 | R | Picocuries/cubic meter | ||||
| Biphenyl | 45301 | 909 | Intermittent | SKC Pump XAD-2 SORBENT Tube | GC/MS NIOSH 5515 REAC SOP 1817 | 4070.0 | -4070.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Bismuth | 88129 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 0.238 | 3 | Micrograms/cubic meter (LC) | ||||||
| Bismuth (TSP) LC | 14130 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.238 | 3 | Micrograms/cubic meter (LC) | ||||||
| Bismuth (TSP) STP | 12106 | 091 | Intermittent | HI-VOL | EMISSION SPECTRA MUFFLE FURNACE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Bismuth (TSP) STP | 12106 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Bismuth (TSP) STP | 12106 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Bismuth PM10 LC | 85130 | 820 | Continuous | Cooper Environmental Services (CES) XACT 625 | X-ray fluorescence (XRF) | 0.238 | 3 | Nanograms/cubic meter (LC) | ||||||
| Black Carbon PM2.5 Corrected | 88317 | 861 | Continuous | Magee Scientific AE2100 Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | Micrograms/cubic meter (LC) | |||||
| Black Carbon PM2.5 Corrected | 88317 | 862 | Continuous | Anderson RTAA_800 Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | Micrograms/cubic meter (LC) | |||||
| Black Carbon PM2.5 Corrected | 88317 | 863 | Continuous | Thermo-Anderson RTAA_900 Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | Micrograms/cubic meter (LC) | |||||
| Black Carbon PM2.5 Corrected | 88317 | 864 | Continuous | Magee Scientific AE1600 Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | Micrograms/cubic meter (LC) | |||||
| Black Carbon PM2.5 Corrected | 88317 | 865 | Continuous | Magee Scientific AE16ER Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | Micrograms/cubic meter (LC) | |||||
| Black Carbon PM2.5 Corrected | 88317 | 866 | Continuous | Magee Scientific AE21ER Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | Micrograms/cubic meter (LC) | |||||
| Black Carbon PM2.5 Corrected | 88317 | 867 | Continuous | Magee Scientific AE21HS Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | Micrograms/cubic meter (LC) | |||||
| Black Carbon PM2.5 Corrected | 88317 | 868 | Continuous | TEOM with Magee Scientific AE16 Aethalometer | Optical absorption | 0.1 | -1.9 | 2 | Micrograms/cubic meter (LC) | |||||
| Black Carbon PM2.5 Corrected | 88317 | 869 | Continuous | Magee Scientific AE14 Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | Micrograms/cubic meter (LC) | |||||
| Black Carbon PM2.5 Corrected | 88317 | 870 | Continuous | ThermoFisher Model 5012 | MAAP (Multi Angle Absorption Photometer) | 0.2 | -1.9 | 2 | Micrograms/cubic meter (LC) | |||||
| Black Carbon PM2.5 Corrected | 88317 | 876 | Continuous | Magee Scientific AE22ER Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | Micrograms/cubic meter (LC) | |||||
| Black Carbon PM2.5 Corrected | 88317 | 877 | Continuous | Magee Scientific AE22HS Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | Micrograms/cubic meter (LC) | |||||
| Black Carbon PM2.5 Corrected | 88317 | 894 | Continuous | Magee AE33/ TAPI M633 Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | Micrograms/cubic meter (LC) | |||||
| Black Carbon PM10 LC | 85313 | 870 | Continuous | ThermoFisher Model 5012 | MAAP (Multi Angle Absorption Photometer) | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Black Carbon PM2.5 at 880 nm | 88313 | 861 | Continuous | Magee Scientific AE2100 Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Black Carbon PM2.5 at 880 nm | 88313 | 862 | Continuous | Anderson RTAA_800 Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Black Carbon PM2.5 at 880 nm | 88313 | 863 | Continuous | Thermo-Anderson RTAA_900 Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Black Carbon PM2.5 at 880 nm | 88313 | 864 | Continuous | Magee Scientific AE1600 Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Black Carbon PM2.5 at 880 nm | 88313 | 865 | Continuous | Magee Scientific AE16ER Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Black Carbon PM2.5 at 880 nm | 88313 | 866 | Continuous | Magee Scientific AE21ER Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Black Carbon PM2.5 at 880 nm | 88313 | 867 | Continuous | Magee Scientific AE21HS Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Black Carbon PM2.5 at 880 nm | 88313 | 868 | Continuous | TEOM with Magee Scientific AE16 Aethalometer | Optical absorption | 0.1 | -1.9 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Black Carbon PM2.5 at 880 nm | 88313 | 869 | Continuous | Magee Scientific AE14 Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Black Carbon PM2.5 at 880 nm | 88313 | 870 | Continuous | ThermoFisher Model 5012 | MAAP (Multi Angle Absorption Photometer) | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Black Carbon PM2.5 at 880 nm | 88313 | 875 | Continuous | Met One BC-1050 Black Carbon Monitor | Optical Absorption | 2.0 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Black Carbon PM2.5 at 880 nm | 88313 | 876 | Continuous | Magee Scientific AE22ER Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Black Carbon PM2.5 at 880 nm | 88313 | 877 | Continuous | Magee Scientific AE22HS Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Black Carbon PM2.5 at 880 nm | 88313 | 878 | Continuous | Met One BC-1054 Black Carbon Monitor | Optical Absorption | 0.1 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Black Carbon PM2.5 at 880 nm | 88313 | 879 | Continuous | Met One BC-1060 Portable | Optical Absorption | 0.1 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Black Carbon PM2.5 at 880 nm | 88313 | 894 | Continuous | Magee AE33/AE36 TAPI M633 Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Black Carbon at 880 nm (TSP) | 14313 | 880 | Continuous | Met One C-12 at 1Lpm | Optical Absorption | 0.1 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Black carbon PM2.5 STP | 84313 | 861 | Continuous | Magee Scientific AE2100 Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Black carbon PM2.5 STP | 84313 | 862 | Continuous | Anderson RTAA_800 Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Black carbon PM2.5 STP | 84313 | 863 | Continuous | Thermo-Anderson RTAA_900 Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Black carbon PM2.5 STP | 84313 | 864 | Continuous | Magee Scientific AE1600 Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Black carbon PM2.5 STP | 84313 | 865 | Continuous | Magee Scientific AE16ER Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Black carbon PM2.5 STP | 84313 | 866 | Continuous | Magee Scientific AE21ER Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Black carbon PM2.5 STP | 84313 | 867 | Continuous | Magee Scientific AE21HS Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Black carbon PM2.5 STP | 84313 | 869 | Continuous | Magee Scientific AE14 Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Black carbon PM2.5 STP | 84313 | 876 | Continuous | Magee Scientific AE22ER Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Black carbon PM2.5 STP | 84313 | 877 | Continuous | Magee Scientific AE22HS Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Black carbon PM2.5 STP | 84313 | 894 | Continuous | Magee Scientific TAPI M633 Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Boron (TSP) STP | 12190 | 045 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.0017 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Boron (precip) | 65190 | 085 | Intermittent | ANDERSON RAINFALL BUCKET | EMISSION SPECTRA ICAP | 0.01 | 0.0 | 3 | R | Milligrams/liter | ||||
| Boron PM10 STP | 82190 | 069 | Intermittent | HIVOL-SA/GMW-321-B | EMISSION SPECTRA ICAP | 0.0017 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Boron PM10 STP | 82190 | 085 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 0.0017 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Bromide (TSP) STP | 12201 | 091 | Intermittent | HI-VOL | PHENOL-RED | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Bromide (TSP) STP | 12201 | 094 | Intermittent | HI-VOL | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Bromide (TSP) STP | 12201 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.03 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Bromide PM10 STP | 82109 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Bromide PM10 STP | 82109 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Bromide PM10 STP | 82109 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Bromide PM10 STP | 82109 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Bromine (TSP) LC | 14109 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.185 | 3 | Micrograms/cubic meter (LC) | ||||||
| Bromine (TSP) STP | 12109 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Bromine (TSP) STP | 12109 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Bromine (TSP) STP | 12109 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Bromine PM10 LC | 85109 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Bromine PM10 LC | 85109 | 820 | Continuous | Cooper Environmental Services model Xact 620 | X-ray fluorescence (XRF) | 0.04 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Bromine PM10 LC | 85109 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 0.0008 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Bromine PM10-2.5 LC | 86109 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.0008 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Bromine PM10-2.5 STP | 83109 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Bromine PM2.5 LC | 88109 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Bromine PM2.5 LC | 88109 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Bromine PM2.5 LC | 88109 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Bromine PM2.5 LC | 88109 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy dispersive XRF | 0.00199 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Bromine PM2.5 LC | 88109 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 0.185 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Bromine PM2.5 LC | 88109 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.0008 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Bromine PM2.5 LC | 88109 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.0008 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Bromine PM2.5 LC | 88109 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.0008 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Bromine PM2.5 LC | 88109 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.0008 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Bromine PM2.5 LC | 88109 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.0008 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Bromine PM2.5 LC | 88109 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.0008 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Bromine PM2.5 LC | 88109 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.0008 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Bromine PM2.5 LC | 88109 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Bromine PM2.5 STP | 84109 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Bromochloromethane | 43836 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Bromochloromethane | 43836 | 105 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Bromochloromethane | 43836 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Bromochloromethane | 43836 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Bromochloromethane | 43836 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Bromochloromethane | 43836 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Bromochloromethane | 43836 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Bromochloromethane | 43836 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Bromochloromethane | 43836 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.18 | -0.18 | 2 | R | Parts per billion Carbon | ||||
| Bromochloromethane | 43836 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromochloromethane | 43836 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromochloromethane | 43836 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromochloromethane | 43836 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromochloromethane | 43836 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromochloromethane | 43836 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromochloromethane | 43836 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromochloromethane | 43836 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromochloromethane | 43836 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromochloromethane | 43836 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromochloromethane | 43836 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromochloromethane | 43836 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromodichloromethane | 43828 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 1.0 | -1.0 | 0 | R | Parts per billion Carbon | ||||
| Bromodichloromethane | 43828 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.001 | -0.001 | 2 | R | Parts per billion Carbon | ||||
| Bromodichloromethane | 43828 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.15 | -0.15 | 1 | R | Parts per billion Carbon | ||||
| Bromodichloromethane | 43828 | 105 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Bromodichloromethane | 43828 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Bromodichloromethane | 43828 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Bromodichloromethane | 43828 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Bromodichloromethane | 43828 | 113 | Intermittent | SS-Canister_Pressurized | Capillary GC ITD Mass Spectro | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Bromodichloromethane | 43828 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Bromodichloromethane | 43828 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Bromodichloromethane | 43828 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Bromodichloromethane | 43828 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Bromodichloromethane | 43828 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.001 | -0.001 | 2 | R | Parts per billion Carbon | ||||
| Bromodichloromethane | 43828 | 150 | Intermittent | SS 6L - PRESSURIZED CANISTER | CRYOGENIC PRECON:GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Bromodichloromethane | 43828 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Bromodichloromethane | 43828 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.24 | -0.24 | 2 | R | Parts per billion Carbon | ||||
| Bromodichloromethane | 43828 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Bromodichloromethane | 43828 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromodichloromethane | 43828 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromodichloromethane | 43828 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromodichloromethane | 43828 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromodichloromethane | 43828 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromodichloromethane | 43828 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromodichloromethane | 43828 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromodichloromethane | 43828 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromodichloromethane | 43828 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromodichloromethane | 43828 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromodichloromethane | 43828 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromodichloromethane | 43828 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromofluorobenzene | 45808 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 6.0 | -6.0 | 1 | R | Parts per billion Carbon | ||||
| Bromofluorobenzene | 45808 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.24 | -0.24 | 2 | R | Parts per billion Carbon | ||||
| Bromoform | 43806 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 0.9 | -0.9 | 1 | R | Parts per billion Carbon | ||||
| Bromoform | 43806 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Bromoform | 43806 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Bromoform | 43806 | 105 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Bromoform | 43806 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Bromoform | 43806 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Bromoform | 43806 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Bromoform | 43806 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Bromoform | 43806 | 113 | Intermittent | SS-Canister_Pressurized | Capillary GC ITD Mass Spectro | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Bromoform | 43806 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Bromoform | 43806 | 117 | Intermittent | TENAX SORBENT CARTRIDGE | GC/MS | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Bromoform | 43806 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Bromoform | 43806 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Bromoform | 43806 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/MS/FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Bromoform | 43806 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Bromoform | 43806 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Bromoform | 43806 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Bromoform | 43806 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Bromoform | 43806 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.24 | -0.24 | 2 | R | Parts per billion Carbon | ||||
| Bromoform | 43806 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.02 | -0.02 | 3 | R | Parts per billion Carbon | ||||
| Bromoform | 43806 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.11 | -0.11 | 2 | R | Parts per billion Carbon | ||||
| Bromoform | 43806 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromoform | 43806 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromoform | 43806 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromoform | 43806 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromoform | 43806 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromoform | 43806 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromoform | 43806 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromoform | 43806 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromoform | 43806 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromoform | 43806 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromoform | 43806 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromoform | 43806 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromoform | 43806 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 051 | Intermittent | PERSONAL PUMPS | TENAX DESORPTION GC/MS | 21.0 | -21.0 | 0 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.26 | -0.26 | 1 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 105 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.3 | -0.3 | 1 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.3 | -0.3 | 1 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.03 | -0.03 | 1 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.033 | -0.033 | 2 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.62 | -0.62 | 2 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.02 | -0.02 | 3 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.09 | -0.09 | 2 | R | Parts per billion Carbon | ||||
| Bromomethane | 43819 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromomethane | 43819 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromomethane | 43819 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromomethane | 43819 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromomethane | 43819 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromomethane | 43819 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromomethane | 43819 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromomethane | 43819 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromomethane | 43819 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromomethane | 43819 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromomethane | 43819 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Bromomethane | 43819 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Butryl-aldehyde & Methyl Ethyl Ketone | 43339 | 102 | Intermittent | CARTRIDGE-DNPH-ON-SILICA | HPLC ULTRAVIOLET ABSORPTION | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| Butryl-aldehyde & Methyl Ethyl Ketone | 43339 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Butryl-aldehyde & Methyl Ethyl Ketone | 43339 | 176 | Intermittent | 6L Subatm SS Canister | Entech Precon GC/MS | 0.011 | -0.011 | 2 | R | Parts per billion Carbon | ||||
| Butryl-aldehyde & Methyl Ethyl Ketone | 43339 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.0001 | -0.0001 | 2 | R | Parts per billion Carbon | ||||
| Butyl acetate | 43514 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Butyl acetate | 43514 | 130 | Intermittent | DNPH-COATED CARTRIDGE | HPLC (TO-14) | 3.6 | -3.6 | 1 | R | Parts per billion Carbon | ||||
| Butyl acetate | 43514 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 7.46 | -7.46 | 2 | R | Parts per billion Carbon | ||||
| Butyl acetate | 43514 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Butyl acetate | 43514 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Butyl acetate | 43514 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Butyl acetate | 43514 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Butyl acetate | 43514 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Butyl acetate | 43514 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Butyl acetate | 43514 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Butyl acetate | 43514 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Butyl acetate | 43514 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Butyl acetate | 43514 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Butyl acetate | 43514 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Butyl acetate | 43514 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Butyl acetate | 43514 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Butyl acetate | 43514 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Butyl acetate | 43514 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Butyl benzene | 45233 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Butyl benzene | 45233 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Butyl benzyl phthalate (TSP) STP | 16771 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 28.0 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Butylbenzene | 45232 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Butylbenzene | 45232 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Butyraldehyde | 43510 | 102 | Intermittent | CARTRIDGE-DNPH-ON-SILICA | HPLC ULTRAVIOLET ABSORPTION | 0.6 | -0.6 | 2 | R | Parts per billion Carbon | ||||
| Butyraldehyde | 43510 | 114 | Intermittent | CARTRIDGE-DNPH-SILICA-SEP-PAK | HPLC-PHOTODIODE ARRAY | 0.085 | -0.085 | 2 | R | Parts per billion Carbon | ||||
| Butyraldehyde | 43510 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Butyraldehyde | 43510 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Butyraldehyde | 43510 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Butyraldehyde | 43510 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Butyraldehyde | 43510 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Butyraldehyde | 43510 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Butyraldehyde | 43510 | 156 | Intermittent | Cartridge DNPH on Silica, Heated O3 Denuder | HPLC Photo Diode Array | 0.288 | -0.288 | 1 | R | Parts per billion Carbon | ||||
| Butyraldehyde | 43510 | 165 | Intermittent | ATEC2400 W/Waters Silica DNPH | HP LC-1050 W/Dode Array Detector | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| Butyraldehyde | 43510 | 166 | Intermittent | ATEC 2400 W/Waters Silica DNPH | TO-11 Dionex DX-300 Ion Chrmtg | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| Butyraldehyde | 43510 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Butyraldehyde | 43510 | 179 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | Liquid Chromatography w/diode array detection | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Butyraldehyde | 43510 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.06 | -0.06 | 3 | R | Parts per billion Carbon | ||||
| Butyraldehyde & isobutyraldehyde | 43329 | 130 | Intermittent | DNPH-COATED CARTRIDGE | HPLC (TO-14) | 2.28 | -2.28 | 2 | R | Parts per billion Carbon | ||||
| Butyraldehyde & isobutyraldehyde | 43329 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| C2 Alkylbenzenes | 17131 | 096 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.002 | 0.0 | 2 | R | Picocuries/cubic meter | ||||
| Cadmium (SP) | 22110 | 101 | Intermittent | NADP BUCKET:DRY SIDE | ATOMIC ABSORPTION | 6.0e-05 | 0.0 | 5 | R | Grams/sq meter/month | ||||
| Cadmium (TSP) LC | 14110 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0054 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Cadmium (TSP) LC | 14110 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.003 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Cadmium (TSP) LC | 14110 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.0002 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Cadmium (TSP) LC | 14110 | 107 | Intermittent | HI-VOL | Flameless Atomic absorption | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Cadmium (TSP) LC | 14110 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 3.0e-05 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Cadmium (TSP) LC | 14110 | 310 | Intermittent | LO-VOL | ICP-MS | 0.005 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Cadmium (TSP) LC | 14110 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 5.748 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cadmium (TSP) LC | 14110 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0001 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Cadmium (TSP) STP | 12110 | 045 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Cadmium (TSP) STP | 12110 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0054 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Cadmium (TSP) STP | 12110 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.003 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Cadmium (TSP) STP | 12110 | 091 | Intermittent | HI-VOL | EMISSION SPECTRA MUFFLE FURNACE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Cadmium (TSP) STP | 12110 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.0002 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Cadmium (TSP) STP | 12110 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Cadmium (TSP) STP | 12110 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.06 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Cadmium (TSP) STP | 12110 | 101 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.00029 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Cadmium (TSP) STP | 12110 | 107 | Intermittent | HI-VOL | Flameless Atomic absorption | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Cadmium (TSP) STP | 12110 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 2.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Cadmium (TSP) STP | 12110 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Cadmium (TSP) STP | 12110 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Cadmium (TSP) STP | 12110 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Cadmium (TSP) STP | 12110 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.005 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Cadmium (TSP) STP | 12110 | 905 | Intermittent | SKC Pump Filter | ICP/AES NIOSH 7300 | 0.03 | 2 | R | Micrograms/cubic meter (25 C) | |||||
| Cadmium (TSP) STP | 12110 | 910 | Intermittent | SKC Pump Filter | MOd NISH 7300/6010B SOP 1813 | 0.0127 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Cadmium (precip) | 65332 | 101 | Intermittent | NADP BUCKET: WET SIDE | ATOMIC ABSORPTION | 0.0089 | 0.0 | 4 | R | Ug/sq meter/hour | ||||
| Cadmium PM10 LC | 85110 | 110 | Intermittent | Hi-Vol SA/GMW1200 | ICP/MS | 35.9 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Cadmium PM10 LC | 85110 | 202 | Intermittent | R&P Model 2000 PM10 Teflon | ICP/MS | 0.0123 | 4 | R | Nanograms/cubic meter (LC) | |||||
| Cadmium PM10 LC | 85110 | 204 | Intermittent | Wedding & Ass. Model 600 PM10 HiVol | ICP-MS | 0.01 | 0.0 | 10000.0 | 2 | R | Nanograms/cubic meter (LC) | |||
| Cadmium PM10 LC | 85110 | 216 | Intermittent | Tisch Model TE-Wilbur10 Low-Volume Sampler | ICP-MS | 0.1 | 5 | R | Nanograms/cubic meter (LC) | |||||
| Cadmium PM10 LC | 85110 | 501 | Intermittent | Tisch Environmental 6000 Series | ICP-MS | 0.01 | 0.0 | 2 | R | Nanograms/cubic meter (LC) | ||||
| Cadmium PM10 LC | 85110 | 820 | Continuous | Cooper Environmental Services model Xact 620 | X-ray fluorescence (XRF) | 1.353 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Cadmium PM10 LC | 85110 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 4.21 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Cadmium PM10 LC | 85110 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 0.3 | 0.0 | 99999.99999 | 1 | R | Nanograms/cubic meter (LC) | |||
| Cadmium PM10 LC | 85110 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Cadmium PM10 LC | 85110 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.1 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Cadmium PM10 LC | 85110 | 907 | Intermittent | R & P Partisol 2025 Teflon | ICPMS | 0.26 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Cadmium PM10 LC | 85110 | 908 | Intermittent | MET ONE E-SEQ-FRM | ICP-MS | 0.00667 | 5 | R | Nanograms/cubic meter (LC) | |||||
| Cadmium PM10 LC | 85110 | 911 | Intermittent | ARA low-volume sampler | ICP-MS | 0.1 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Cadmium PM10 STP | 82110 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | |||||
| Cadmium PM10 STP | 82110 | 092 | Intermittent | HI-VOL-SA/GMW-321-B | ATOMIC ABSORPTION | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Cadmium PM10 STP | 82110 | 096 | Intermittent | Med-Vol SA254 TFE | X-ray fluorescence | 100.0 | 0.0 | -2 | R | Nanograms/cubic meter (25 C) | ||||
| Cadmium PM10 STP | 82110 | 101 | Intermittent | HI-VOL-SA321A | ATOMIC ABSORPTION | 0.2 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Cadmium PM10 STP | 82110 | 102 | Intermittent | HI-VOL-SA/GMW1200 | ATOMIC ABSORPTION | 0.2 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Cadmium PM10 STP | 82110 | 103 | Intermittent | HI-VOL-WEDDING-INLET | ATOMIC ABSORPTION | 0.2 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Cadmium PM10 STP | 82110 | 104 | Intermittent | HI-VOL-SA321A | EMISSION SPECTRA ICAP | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Cadmium PM10 STP | 82110 | 105 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Cadmium PM10 STP | 82110 | 106 | Intermittent | HI-VOL-WEDDING-INLET | EMISSION SPECTRA ICAP | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Cadmium PM10 STP | 82110 | 107 | Intermittent | HI-VOL-SA/GMW-321B | EMISSION SPECTRA ICAP | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Cadmium PM10 STP | 82110 | 109 | Intermittent | Hi Vol SA/GMW 321B | ICP/MS | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Cadmium PM10 STP | 82110 | 110 | Intermittent | Hi-Vol SA/GMW1200 Quartz | ICP/MS | 0.01 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Cadmium PM10 STP | 82110 | 113 | Intermittent | Hi Vol Anderson IP1076 | ICP/MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Cadmium PM10 STP | 82110 | 201 | Intermittent | R&P Model 2000 PM10 Quartz | ICP/MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Cadmium PM10 STP | 82110 | 202 | Intermittent | R&P Model 2000 PM10 Teflon | ICP/MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Cadmium PM10 STP | 82110 | 203 | Intermittent | R&P Model 2025 PM10 Teflon | ICP/MS | 0.7 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Cadmium PM10 STP | 82110 | 204 | Intermittent | Wedding & Ass. Model 600 PM10 HiVol | ICP-MS | 0.18 | 0.0 | 10000.0 | 2 | R | Nanograms/cubic meter (25 C) | |||
| Cadmium PM10 STP | 82110 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Cadmium PM10 STP | 82110 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 16.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Cadmium PM10 STP | 82110 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 16.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Cadmium PM10 STP | 82110 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 16.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Cadmium PM10 STP | 82110 | 501 | Intermittent | Tisch Environmental 6000 Series | ICP-MS | 0.01 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Cadmium PM10 STP | 82110 | 908 | Intermittent | MET ONE E-SEQ-FRM | ICP-MS | 0.00667 | 5 | R | Nanograms/cubic meter (25 C) | |||||
| Cadmium PM10-2.5 LC | 86110 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00421 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Cadmium PM10-2.5 STP | 83110 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Cadmium PM2.5 LC | 88110 | 118 | Intermittent | R & P Model 2025 PM2.5 Sequential w/WINS | ICP/MS | 2.0e-05 | 5.0 | 5 | R | Micrograms/cubic meter (LC) | ||||
| Cadmium PM2.5 LC | 88110 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy dispersive XRF | 0.0105 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cadmium PM2.5 LC | 88110 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 5.748 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cadmium PM2.5 LC | 88110 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00421 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cadmium PM2.5 LC | 88110 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00421 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cadmium PM2.5 LC | 88110 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00421 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cadmium PM2.5 LC | 88110 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00421 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cadmium PM2.5 LC | 88110 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00421 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cadmium PM2.5 LC | 88110 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00421 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cadmium PM2.5 LC | 88110 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00421 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Cadmium PM2.5 LC | 88110 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 0.0003 | 5000.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Cadmium PM2.5 LC | 88110 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0001 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Cadmium PM2.5 LC | 88110 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.0001 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Cadmium PM2.5 LC | 88110 | 908 | Intermittent | R & P Partisol 2000 | X-Ray Fluorescence | 0.0001 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Cadmium PM2.5 STP | 84110 | 303 | Intermittent | L0-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Calcium (SP) | 22111 | 051 | Intermittent | BUCKET | ATOMIC ABSORPTION | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Calcium (TSP) LC | 14111 | 090 | Intermittent | HI-VOL | Emission Spectra ICAP | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Calcium (TSP) LC | 14111 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 2.366 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Calcium (TSP) LC | 14111 | 900 | Intermittent | Teflon CASTNET-style 3-stage filter pack | Inductively Coupled Plasma - Optical Emission Spectrometry (ICP-OES) EPA Modified Method 6010B | 0.002 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Calcium (TSP) STP | 12111 | 045 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.0072 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Calcium (TSP) STP | 12111 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.0002 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Calcium (TSP) STP | 12111 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.008 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Calcium (TSP) STP | 12111 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Calcium (TSP) STP | 12111 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Calcium (TSP) STP | 12111 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Calcium (TSP) STP | 12111 | 905 | Intermittent | SKC Pump Filter | ICP/AES NIOSH 7300 | 13.89 | 2 | R | Micrograms/cubic meter (25 C) | |||||
| Calcium (TSP) STP | 12111 | 910 | Intermittent | SKC Pump Filter | MOd NISH 7300/6010B SOP 1813 | 1.1111 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Calcium (precip) | 65314 | 082 | Intermittent | PRECIP | ATOMIC ABSORPTION | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Calcium (precip) | 65314 | 083 | Intermittent | PRECIP | FLAME EMISSION | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Calcium (precip) | 65314 | 084 | Intermittent | PRECIP | COLORIMETRIC | 0.2 | 0.0 | 1 | R | Milligrams/liter | ||||
| Calcium (precip) | 65314 | 085 | Intermittent | PRECIP | X-RAY FLUORESCENCE | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Calcium (precip) | 65314 | 086 | Intermittent | ANDERSON RAINFALL BUCKET | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.03 | 0.0 | 2 | R | Milligrams/liter | ||||
| Calcium PM10 LC | 85111 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 3.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Calcium PM10 LC | 85111 | 820 | Continuous | Cooper Environmental Services model Xact 620 | X-ray fluorescence (XRF) | 0.321 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Calcium PM10 LC | 85111 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 1.39 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Calcium PM10 LC | 85111 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 90.8 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Calcium PM10 STP | 82111 | 069 | Intermittent | HIVOL-SA/GMW-321-B | EMISSION SPECTRA ICAP | 7.2 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Calcium PM10 STP | 82111 | 085 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 7.2 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Calcium PM10 STP | 82111 | 106 | Intermittent | HI-VOL Wedding Inlet | Emission Spectra ICAP | 220.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Calcium PM10 STP | 82111 | 107 | Intermittent | HI-VOL-SA/GMW-321-B | Emission Spectra ICAP | 276.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Calcium PM10 STP | 82111 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 3.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Calcium PM10 STP | 82111 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Calcium PM10 STP | 82111 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Calcium PM10 STP | 82111 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Calcium PM10-2.5 LC | 86111 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00139 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Calcium PM10-2.5 STP | 83111 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Calcium PM2.5 LC | 88111 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Calcium PM2.5 LC | 88111 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Calcium PM2.5 LC | 88111 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Calcium PM2.5 LC | 88111 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy dispersive XRF | 0.00347 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Calcium PM2.5 LC | 88111 | 820 | Continuous | Cooper Environmental Services(CES) XACT 625 | X-ray Fluorescence (XRF) Instrumentation | 0.902 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Calcium PM2.5 LC | 88111 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00139 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Calcium PM2.5 LC | 88111 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00139 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Calcium PM2.5 LC | 88111 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00139 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Calcium PM2.5 LC | 88111 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00139 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Calcium PM2.5 LC | 88111 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00139 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Calcium PM2.5 LC | 88111 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00139 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Calcium PM2.5 LC | 88111 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00139 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Calcium PM2.5 LC | 88111 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Calcium PM2.5 STP | 84111 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Carbazole (TSP) STP | 16772 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 28.7 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Carbazole (TSP) STP | 16772 | 909 | Intermittent | SKC Pump XAD-2 SORBENT Tube | GC/MS NIOSH 5515 REAC SOP 1817 | 4280.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Carbon Tetrafluoride | 43827 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Carbon black (TSP) | 16111 | 011 | Continuous | INSTRUMENTAL MAGEE SCIEN | MODEL AE20 OPTICAL ABSORPTION | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Carbon dioxide | 42102 | 011 | Continuous | INSTRUMENTAL | INFRARED ABSORPTION | 1.0 | -1.0 | 0 | R | Parts per million | ||||
| Carbon dioxide | 42102 | 012 | Continuous | INSTRUMENTAL | Non Dispersive Infrared Photometry | AP model T360 | 1.0 | 0 | R | Parts per million | ||||
| Carbon dioxide | 42102 | 091 | Intermittent | GAS-BUBBLER | PHENOLPHTHALEIN(100ML TUBE+ORIFICE) | 1.0 | -1.0 | 0 | R | Parts per million | ||||
| Carbon dioxide | 42102 | 561 | Continuous | INSTRUMENTAL | Wavelength-Scanned Cavity Ringdown Spectroscopy - Picarro G1301 | 1.5 | -1.5 | 70000.0 | 2 | R | Parts per million | |||
| Carbon disulfide | 42153 | 016 | Continuous | Instrumental | Flame Photometric | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Carbon disulfide | 42153 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Carbon disulfide | 42153 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 4.0 | -4.0 | 1 | R | Parts per billion Carbon | ||||
| Carbon disulfide | 42153 | 113 | Intermittent | SS-Canister_Pressurized | Capillary GC ITD Mass Spectro | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Carbon disulfide | 42153 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Carbon disulfide | 42153 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Carbon disulfide | 42153 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Carbon disulfide | 42153 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Carbon disulfide | 42153 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Carbon disulfide | 42153 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Carbon disulfide | 42153 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Carbon disulfide | 42153 | 176 | Intermittent | 6L Subatm SS Canister | Entech Precon GC/MS | 0.014 | -0.014 | 2 | R | Parts per billion Carbon | ||||
| Carbon disulfide | 42153 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Carbon disulfide | 42153 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon disulfide | 42153 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon disulfide | 42153 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon disulfide | 42153 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon disulfide | 42153 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon disulfide | 42153 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon disulfide | 42153 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon disulfide | 42153 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon disulfide | 42153 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon disulfide | 42153 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon disulfide | 42153 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon disulfide | 42153 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon monoxide | 42101 | 008 | Continuous | INSTRUMENTAL | NONDISPERSIVE INFRARED | FRM | RFCA-0276-008 | BENDIX 8501-5CA | 0.5 | -0.4 | 50.0 | 1 | R | Parts per million |
| Carbon monoxide | 42101 | 011 | Continuous | INSTRUMENTAL | NONDISPERSIVE INFRARED | 0.5 | -0.4 | 50.0 | 1 | R | Parts per million | |||
| Carbon monoxide | 42101 | 012 | Continuous | INSTRUMENTAL | NONDISPERSIVE INFRARED | FRM | RFCA-0876-012 | BECKMAN 866 | 0.5 | -0.4 | 50.0 | 1 | R | Parts per million |
| Carbon monoxide | 42101 | 013 | Continuous | INSTRUMENTAL | DETECTION TUBE | 5.0 | -0.4 | 50.0 | 0 | R | Parts per million | |||
| Carbon monoxide | 42101 | 014 | Continuous | INSTRUMENTAL | DUAL ISOTOPE FLORESCENCE | 0.4 | -0.4 | 50.0 | 1 | R | Parts per million | |||
| Carbon monoxide | 42101 | 018 | Continuous | INSTRUMENTAL | NONDISPERSIVE INFRARED | FRM | RFCA-0177-018 | MSA 202S | 0.5 | -0.4 | 50.0 | 1 | R | Parts per million |
| Carbon monoxide | 42101 | 021 | Continuous | INSTRUMENTAL | GAS CHROMATOGRAPHIC | 0.5 | -0.4 | 50.0 | 1 | R | Parts per million | |||
| Carbon monoxide | 42101 | 033 | Continuous | INSTRUMENTAL | NONDISPERSIVE INFRARED | FRM | RFCA-1278-033 | HORIBA AQM-10--11--12 | 0.5 | -0.4 | 50.0 | 1 | R | Parts per million |
| Carbon monoxide | 42101 | 041 | Continuous | INSTRUMENTAL | NONDISPERSIVE INFRARED | FRM | RFCA-0979-041 | MONITOR LABS 8310 | 0.5 | -0.4 | 50.0 | 1 | R | Parts per million |
| Carbon monoxide | 42101 | 048 | Continuous | INSTRUMENTAL | NONDISPERSIVE INFRARED | FRM | RFCA-1180-048 | HORIBA 300E/300SE | 0.5 | -0.4 | 50.0 | 1 | R | Parts per million |
| Carbon monoxide | 42101 | 050 | Continuous | INSTRUMENTAL | NONDISPERSIVE INFRARED | FRM | RFCA-1280-050 | MASS-CO 1 (MASSACHUSETTS) | 0.5 | -0.4 | 50.0 | 1 | R | Parts per million |
| Carbon monoxide | 42101 | 051 | Continuous | INSTRUMENTAL | NONDISPERSIVE INFRARED | FRM | RFCA-0381-051 | DASIBI 3003 | 0.5 | -0.4 | 50.0 | 1 | R | Parts per million |
| Carbon monoxide | 42101 | 054 | Continuous | INSTRUMENTAL | NONDISPERSIVE INFRARED | FRM | RFCA-0981-054 | THERMO ELECTRON 48, 48C, 48i | 0.5 | -0.4 | 50.0 | 1 | R | Parts per million |
| Carbon monoxide | 42101 | 055 | Continuous | INSTRUMENTAL | Gas Filter Correlation Thermo Electron 48C-TL | 0.02 | -0.4 | 50.0 | 3 | R | Parts per million | |||
| Carbon monoxide | 42101 | 066 | Continuous | INSTRUMENTAL | NONDISPERSIVE INFRARED | FRM | RFCA-0388-066 | MONITOR LABS 8830 | 0.5 | -0.4 | 50.0 | 1 | R | Parts per million |
| Carbon monoxide | 42101 | 067 | Continuous | INSTRUMENTAL | NONDISPERSIVE INFRARED | FRM | RFCA-0488-067 | DASIBI 3008 | 0.5 | -0.4 | 50.0 | 1 | R | Parts per million |
| Carbon monoxide | 42101 | 088 | Continuous | INSTRUMENTAL | NONDISPERSIVE INFRARED PHOTOMETRY | FRM | RFCA-0992-088 | LEAR SIEGLER MODEL ML 9830 | 0.5 | -0.4 | 50.0 | 1 | R | Parts per million |
| Carbon monoxide | 42101 | 093 | Continuous | INSTRUMENTAL | GAS FILTER CORRELATION CO ANALYZER | FRM | RFCA-1093-093 | API MODEL 300 GAS FILTER | 0.5 | -0.4 | 50.0 | 1 | R | Parts per million |
| Carbon monoxide | 42101 | 106 | Continuous | INSTRUMENTAL | NONDISPERSIVE INFRARED PHOTOMETRY | FRM | RFCA-0895-106 | HORIBA INSTR. MODEL APMA-360 | 0.5 | -0.4 | 50.0 | 1 | R | Parts per million |
| Carbon monoxide | 42101 | 108 | Continuous | INSTRUMENTAL | ENVIORNMENT SA MODEL CO11M | FRM | RFCA-0995-108 | ENVIRONMENT SA MODEL CO11M | 0.5 | -0.4 | 50.0 | 1 | R | Parts per million |
| Carbon monoxide | 42101 | 130 | Continuous | LGR (Los GAtos Research | Off-Axis ICOS Cavity Ringdown Spectroscopy | 5.0e-05 | -0.4 | 1 | R | Parts per million | ||||
| Carbon monoxide | 42101 | 147 | Continuous | INSTRUMENTAL | NONDISPERSIVE INFRARED PHOTOMETRY | FRM | RFCA-0206-147 | Environnement S.A. Model CO12M Co Analyzer | 0.5 | -0.4 | 50.0 | 1 | R | Parts per million |
| Carbon monoxide | 42101 | 158 | Continuous | INSTRUMENTAL | NONDISPERSIVE INFRARED PHOTOMETRY | FRM | RFCA-0506-158 | HORIBA INSTR. MODEL APMA-370 | 0.5 | -0.4 | 50.0 | 1 | R | Parts per million |
| Carbon monoxide | 42101 | 167 | Continuous | Instrumental | Nondispersive Infrered Photometry | FRM | RFCA-0907-167 | DKK-TOA Cork Mode GFC-311E | 0.5 | -0.4 | 50.0 | 1 | R | Parts per million |
| Carbon monoxide | 42101 | 172 | Continuous | Instrumental | Nondispersive Infrered Photometry | FRM | RFCA-0708-172 | SIR S.A. Model S-5006 | 0.5 | -0.4 | 50.0 | 1 | R | Parts per million |
| Carbon monoxide | 42101 | 174 | Continuous | Instrumental | Nondispersive Infrered Photometry | FRM | RFCA-0509-174 | Ecotech Serinus 30 | 0.5 | -0.4 | 50.0 | 1 | R | Parts per million |
| Carbon monoxide | 42101 | 548 | Continuous | INSTRUMENTAL | Nondispersive infrared/gas correlation | FRM | RFCA-0817-248 | Sutron or Sabio 6050T | 0.02 | -0.4 | 50.0 | 3 | R | Parts per million |
| Carbon monoxide | 42101 | 554 | Continuous | INSTRUMENTAL | Gas Filter Correlation Thermo Electron 48i-TLE | FRM | RFCA-0981-054 | Thermo 48i TLE | 0.04 | -0.4 | 50.0 | 3 | R | Parts per million |
| Carbon monoxide | 42101 | 562 | Continuous | INSTRUMENTAL | LOS GANTOS RESEARCH | 5.0e-05 | -0.4 | 3 | R | Parts per million | ||||
| Carbon monoxide | 42101 | 588 | Continuous | INSTRUMENTAL | Gas Filter Correlation Ecotech EC9830T | FRM | RFCA-0992-088 | Ecotech EC9830T | 0.02 | -0.4 | 50.0 | 3 | R | Parts per million |
| Carbon monoxide | 42101 | 593 | Continuous | INSTRUMENTAL | Gas Filter Correlation Teledyne API 300 EU / T300U | FRM | RFCA-1093-093 | API Model 300 EU | 0.02 | -0.4 | 50.0 | 3 | R | Parts per million |
| Carbon monoxide | 42101 | 594 | Continuous | INSTRUMENTAL | Nondispersive Infrared Photometry | FRM | RFCA-1093-093 | API Model 300 EU | 0.02 | -0.4 | 50.0 | 3 | R | Parts per million |
| Carbon monoxide | 42101 | FBA | Continuous | Gas calibrator with independent flow rate transfer standards | Audit using challenge gas standard | 0.0 | 0.0 | 90.0 | 4 | R | Parts per million | |||
| Carbon tetrachloride | 43804 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 107.0 | -107.0 | 0 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 105 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 107 | Intermittent | TEDLAR-BAG-24-HR-SAMPLE | GC - ELECTRON CAPTURE DETECTOR | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.04 | -0.04 | 1 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 115 | Intermittent | TENAX TRAP AC PUMP | HEAT DESORPTION GC MASS SPEC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 117 | Intermittent | TENAX SORBENT CARTRIDGE | GC/MS | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 118 | Intermittent | TENAX SORBENT CARTRIDGE | GC-FID/ECD | 0.1 | -0.1 | 3 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 121 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/ELECTRON;GC ECD | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.033 | -0.033 | 2 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.05 | -0.05 | 2 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| Carbon tetrachloride | 43804 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.45 | -0.45 | 2 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 151 | Intermittent | 6L PRESSURIZED CANISTER | CAPILLARY GC-ECD/PID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 168 | Intermittent | 6L PRESSURIZED CANISTER | PACKED COLUMN GC - ECD/PID | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 169 | Intermittent | TEDLAR BAG | PACKED COLUMN GC - ECD/PID | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.02 | -0.02 | 3 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| Carbon tetrachloride | 43804 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon tetrachloride | 43804 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon tetrachloride | 43804 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon tetrachloride | 43804 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon tetrachloride | 43804 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon tetrachloride | 43804 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon tetrachloride | 43804 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon tetrachloride | 43804 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon tetrachloride | 43804 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon tetrachloride | 43804 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon tetrachloride | 43804 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon tetrachloride | 43804 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Carbon tetrachloride | 43804 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.11 | -0.11 | 2 | R | Parts per billion Carbon | ||||
| Cellulose (TSP) | 16320 | 091 | Intermittent | HI-VOL | MODIFIED ANTHRONE | 0.1 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Cerium (TSP) STP | 12117 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Cerium (TSP) STP | 12117 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Cerium PM10-2.5 LC | 86117 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.0345 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Cerium PM2.5 LC | 88117 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.08603 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cerium PM2.5 LC | 88117 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.0345 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cerium PM2.5 LC | 88117 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.0345 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cerium PM2.5 LC | 88117 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.0345 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cerium PM2.5 LC | 88117 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.0345 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cerium PM2.5 LC | 88117 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.0345 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cerium PM2.5 LC | 88117 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.0345 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cerium PM2.5 LC | 88117 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.0345 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Cerium Pm10 Lc | 85117 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 34.5 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Cesium (TSP) STP | 12118 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Cesium (TSP) STP | 12118 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Cesium PM10-2.5 LC | 86118 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.0148 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Cesium PM2.5 LC | 88118 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.03689 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cesium PM2.5 LC | 88118 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.0148 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cesium PM2.5 LC | 88118 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.0148 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cesium PM2.5 LC | 88118 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.0148 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cesium PM2.5 LC | 88118 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.0148 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cesium PM2.5 LC | 88118 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.0148 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cesium PM2.5 LC | 88118 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.0148 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cesium PM2.5 LC | 88118 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.0148 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Cesium Pm10 Lc | 85118 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 14.8 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Chloride (TSP) LC | 12205 | 900 | Intermittent | Teflon CASTNET-style 3-stage filter pack | Ion Chromatography EPA Modified Method 300.0 | 0.006 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chloride (TSP) STP | 12203 | 091 | Intermittent | HI-VOL | THIOCYANATE | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Chloride (TSP) STP | 12203 | 092 | Intermittent | HI-VOL | ARGENTOMETRIC | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Chloride (TSP) STP | 12203 | 093 | Intermittent | HI-VOL | MERCURIC NITRATE | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Chloride (TSP) STP | 12203 | 094 | Intermittent | HI-VOL | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.11 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Chloride (TSP) STP | 12203 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.02 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Chloride (TSP) STP | 12203 | 900 | Intermittent | Teflon CASTNET-style 3-stage filter pack | Ion Chromatography EPA Mehtod 300.0 | 0.017 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Chloride (precip) | 65316 | 014 | Intermittent | ANDERSON RAINFALL BUCKET | AUTO FERRICYANIDE VIA TRAACS 800 | 1.0 | 0.0 | 1 | R | Milligrams/liter | ||||
| Chloride (precip) | 65316 | 081 | Intermittent | PRECIP | COLORIMETRIC | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Chloride (precip) | 65316 | 082 | Intermittent | PRECIP | PHOTOMETRIC TITRATION | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Chloride (precip) | 65316 | 083 | Intermittent | PRECIP | CONDUCTIMETRIC TITRATION | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Chloride (precip) | 65316 | 084 | Intermittent | PRECIP | NEPHELOMETRIC | 0.2 | 0.0 | 2 | R | Milligrams/liter | ||||
| Chloride (precip) | 65316 | 085 | Intermittent | PRECIP | X-RAY FLUORESCENCE | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Chloride (precip) | 65316 | 086 | Intermittent | ANDERSON RAINFALL BUCKET | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.03 | 0.0 | 2 | R | Milligrams/liter | ||||
| Chloride PM10 STP | 82203 | 062 | Intermittent | HI-VOL-WEDDING-INLET | GRAVIMETRIC | 4.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Chloride PM10 STP | 82203 | 092 | Intermittent | HI-VOL-SA/GMW-321-B | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.11 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Chloride PM10 STP | 82203 | 102 | Intermittent | HI-VOL-SA/GMW1200 | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.11 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Chloride PM2.5 LC | 88203 | 803 | Intermittent | IMPROVE Module B with Cyclone Inlet and Glycerin-Nylon Filter, 4.9 sq. cm. | Ion Chromatography | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Chloride PM2.5 LC | 88203 | 805 | Intermittent | IMPROVE Module B with Cyclone Inlet and Na2CO3-Nylon Filter, 17.4 sq. cm. | Ion Chromatography | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Chloride PM2.5 LC | 88203 | 806 | Intermittent | IMPROVE Module B with Cyclone Inlet and Na2CO3-Nylon Filter, 4.9 sq. cm. | Ion Chromatography | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Chloride PM2.5 LC | 88203 | 807 | Intermittent | IMPROVE Module B with Cyclone Inlet and Glycerin/Na2CO3-Nylon Filter, 10.8 sq. cm. | Ion Chromatography | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Chloride PM2.5 LC | 88203 | 812 | Intermittent | Met One SASS/SuperSASS Nylon | Ion Chromatography | 0.008 | 2 | Micrograms/cubic meter (LC) | ||||||
| Chloride PM2.5 LC | 88203 | 848 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | R & P Model 2025 PM2.5 Sequential Quartz VSCC | 0.025 | 5 | Micrograms/cubic meter (LC) | ||||||
| Chloride PM2.5 LC | 88203 | 849 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Ion Chromatography | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Chloride PM2.5 LC | 88203 | 853 | Intermittent | RP Partisol Model 2300 PM2.5 Seq SSampler - Quartz-# | Thermal Optical Reflectance | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Chloride PM2.5 LC | 88203 | 878 | Intermittent | Andersen RAAS Quartz | Ion Chromatography | 0.0625 | 50.0 | 4 | Micrograms/cubic meter (LC) | |||||
| Chloride PM2.5 LC | 88203 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Chloride(SP) | 22203 | 071 | Intermittent | BUCKET | MERCURIC NITRATE (APCA) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Chloride(SP) | 22203 | 072 | Intermittent | BUCKET | MOHR (APCA) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Chloride(SP) | 22203 | 073 | Intermittent | BUCKET | VOLHARD (APCA) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Chloride(SP) | 22203 | 074 | Intermittent | BUCKET | AUTOMATED THIOCYANATE (APCA) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Chloride(SP) | 22203 | 081 | Intermittent | BUCKET | MERCURIC NITRATE (ASTM) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Chloride(SP) | 22203 | 082 | Intermittent | BUCKET | MOHR (ASTM) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Chloride(SP) | 22203 | 083 | Intermittent | BUCKET | VOLHARD (ASTM) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Chloride(SP) | 22203 | 084 | Intermittent | BUCKET | AUTOMATED THIOCYANATE (ASTM) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Chlorine | 42215 | 100 | Intermittent | MINI IMPINGERS OSHA MTH101 | SPECIFIC ION ELECTRODE | 0.1 | -0.1 | 1 | R | Parts per million | ||||
| Chlorine (TSP) | 13115 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.006 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Chlorine (TSP) STP | 12191 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Chlorine (TSP) STP | 12191 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Chlorine (TSP) STP | 12191 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.109 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Chlorine PM10 LC | 85115 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Chlorine PM10 LC | 85115 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 0.00232 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Chlorine PM10 LC | 85115 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0002 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Chlorine PM10 STP | 82115 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Chlorine PM10 STP | 82115 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Chlorine PM10 STP | 82115 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Chlorine PM10 STP | 82115 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Chlorine PM10-2.5 LC | 86115 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00232 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Chlorine PM10-2.5 STP | 83115 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Chlorine PM2.5 LC | 88115 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chlorine PM2.5 LC | 88115 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chlorine PM2.5 LC | 88115 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chlorine PM2.5 LC | 88115 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.00578 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chlorine PM2.5 LC | 88115 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00232 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chlorine PM2.5 LC | 88115 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00232 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chlorine PM2.5 LC | 88115 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00232 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chlorine PM2.5 LC | 88115 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00232 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chlorine PM2.5 LC | 88115 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00232 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chlorine PM2.5 LC | 88115 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00232 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chlorine PM2.5 LC | 88115 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00232 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Chlorine PM2.5 LC | 88115 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chlorine PM2.5 STP | 84115 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Chlorobenzene | 45801 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 12.0 | -12.0 | 0 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 103 | Intermittent | TENAX/SPHEROCARB SORBENT TRAP | HEAT DESORPTION GC-HECD | 0.06 | -0.06 | 1 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 1.2 | -1.2 | 1 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.6 | -0.6 | 2 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 1.2 | -1.2 | 1 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.12 | -0.12 | 3 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 117 | Intermittent | TENAX SORBENT CARTRIDGE | GC/MS | 0.12 | -0.12 | 2 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.033 | -0.033 | 3 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.74 | -0.74 | 2 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 151 | Intermittent | 6L PRESSURIZED CANISTER | CAPILLARY GC-ECD/PID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.3 | -0.3 | 2 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.12 | -0.12 | 2 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.12 | -0.12 | 3 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.42 | -0.42 | 2 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chlorobenzene | 45801 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chlorobenzene | 45801 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chlorobenzene | 45801 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chlorobenzene | 45801 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chlorobenzene | 45801 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chlorobenzene | 45801 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chlorobenzene | 45801 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chlorobenzene | 45801 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chlorobenzene | 45801 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chlorobenzene | 45801 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chlorobenzene | 45801 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chlorobenzene | 45801 | 901 | Intermittent | SKC Pump Charcoal Tube | GC/FID NIOSH 1003 | 4.43 | -4.43 | 2 | R | Parts per billion Carbon | ||||
| Chlorobenzene | 45801 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.89 | -0.89 | 2 | R | Parts per billion Carbon | ||||
| Chlorobenzilate (TSP) STP | 16773 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 16.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Chlorodifluoromethane | 43359 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chlorodifluoromethane | 43359 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 29.4 | -29.4 | 1 | R | Parts per billion Carbon | ||||
| Chlorodifluoromethane | 43359 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chlorodifluoromethane | 43359 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chlorodifluoromethane | 43359 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Chlorodifluoromethane | 43359 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Chlorodifluoromethane | 43359 | 150 | Intermittent | SS 6L - PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Chlorodifluoromethane | 43359 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Chlorodifluoromethane | 43359 | 176 | Intermittent | 6L Subatm SS Canister | Entech Precon GC/MS | 0.011 | -0.011 | 2 | R | Parts per billion Carbon | ||||
| Chloroethane | 43812 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 6.0 | -6.0 | 0 | R | Parts per billion Carbon | ||||
| Chloroethane | 43812 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chloroethane | 43812 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.4 | -0.4 | 1 | R | Parts per billion Carbon | ||||
| Chloroethane | 43812 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.4 | -0.4 | 1 | R | Parts per billion Carbon | ||||
| Chloroethane | 43812 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chloroethane | 43812 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Chloroethane | 43812 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.4 | -0.4 | 1 | R | Parts per billion Carbon | ||||
| Chloroethane | 43812 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 1 | R | Parts per billion Carbon | ||||
| Chloroethane | 43812 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Chloroethane | 43812 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chloroethane | 43812 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Chloroethane | 43812 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Chloroethane | 43812 | 136 | Continuous | Instrumental | Entech 2000 W/MS/FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Chloroethane | 43812 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chloroethane | 43812 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chloroethane | 43812 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Chloroethane | 43812 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Chloroethane | 43812 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chloroethane | 43812 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Chloroethane | 43812 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.04 | -0.04 | 3 | R | Parts per billion Carbon | ||||
| Chloroethane | 43812 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.22 | -0.22 | 2 | R | Parts per billion Carbon | ||||
| Chloroethane | 43812 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroethane | 43812 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroethane | 43812 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroethane | 43812 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroethane | 43812 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroethane | 43812 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroethane | 43812 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroethane | 43812 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroethane | 43812 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroethane | 43812 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroethane | 43812 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroethane | 43812 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroform | 43803 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 1.8 | -1.8 | 0 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 105 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 107 | Intermittent | TEDLAR-BAG-24-HR-SAMPLE | GC - ELECTRON CAPTURE DETECTOR | 0.02 | -0.02 | 3 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 117 | Intermittent | TENAX SORBENT CARTRIDGE | GC/MS | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 118 | Intermittent | TENAX SORBENT CARTRIDGE | GC-FID/ECD | 0.01 | -0.01 | 3 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 121 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/ELECTRON;GC ECD | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.033 | -0.033 | 2 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.05 | -0.05 | 2 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.64 | -0.64 | 2 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 151 | Intermittent | 6L PRESSURIZED CANISTER | CAPILLARY GC-ECD/PID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 168 | Intermittent | 6L PRESSURIZED CANISTER | PACKED COLUMN GC - ECD/PID | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 169 | Intermittent | TEDLAR BAG | PACKED COLUMN GC - ECD/PID | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.02 | -0.02 | 3 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| Chloroform | 43803 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroform | 43803 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroform | 43803 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroform | 43803 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroform | 43803 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroform | 43803 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroform | 43803 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroform | 43803 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroform | 43803 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroform | 43803 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroform | 43803 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroform | 43803 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloromethane | 43801 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 13.0 | -13.0 | 0 | R | Parts per billion Carbon | ||||
| Chloromethane | 43801 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chloromethane | 43801 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.3 | -0.3 | 1 | R | Parts per billion Carbon | ||||
| Chloromethane | 43801 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.48 | -0.48 | 1 | R | Parts per billion Carbon | ||||
| Chloromethane | 43801 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chloromethane | 43801 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Chloromethane | 43801 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.48 | -0.48 | 1 | R | Parts per billion Carbon | ||||
| Chloromethane | 43801 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Chloromethane | 43801 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Chloromethane | 43801 | 121 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/ELECTRON;GC ECD | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Chloromethane | 43801 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chloromethane | 43801 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Chloromethane | 43801 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Chloromethane | 43801 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| Chloromethane | 43801 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chloromethane | 43801 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Chloromethane | 43801 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Chloromethane | 43801 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.3 | -0.3 | 2 | R | Parts per billion Carbon | ||||
| Chloromethane | 43801 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chloromethane | 43801 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chloromethane | 43801 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.05 | -0.05 | 2 | R | Parts per billion Carbon | ||||
| Chloromethane | 43801 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.02 | -0.02 | 3 | R | Parts per billion Carbon | ||||
| Chloromethane | 43801 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.14 | -0.14 | 2 | R | Parts per billion Carbon | ||||
| Chloromethane | 43801 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloromethane | 43801 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloromethane | 43801 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloromethane | 43801 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloromethane | 43801 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloromethane | 43801 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloromethane | 43801 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloromethane | 43801 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloromethane | 43801 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloromethane | 43801 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloromethane | 43801 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloromethane | 43801 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroprene | 43835 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chloroprene | 43835 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chloroprene | 43835 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.4 | -0.4 | 1 | R | Parts per billion Carbon | ||||
| Chloroprene | 43835 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Chloroprene | 43835 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Chloroprene | 43835 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Chloroprene | 43835 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chloroprene | 43835 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Chloroprene | 43835 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Chloroprene | 43835 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Chloroprene | 43835 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.4 | -0.4 | 2 | R | Parts per billion Carbon | ||||
| Chloroprene | 43835 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Chloroprene | 43835 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Chloroprene | 43835 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroprene | 43835 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroprene | 43835 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroprene | 43835 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroprene | 43835 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroprene | 43835 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroprene | 43835 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroprene | 43835 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroprene | 43835 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroprene | 43835 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroprene | 43835 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chloroprene | 43835 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Chromium (Precip) | 65112 | 085 | Intermittent | ANDERSON RAINFALL BUCKET | EMISSION SPECTRA ICAP | 0.01 | 0.0 | 3 | R | Milligrams/liter | ||||
| Chromium (SP) | 22112 | 101 | Intermittent | NADP BUCKET: DRY SIDE | ATOMIC ABSORPTION | 0.0001 | 0.0 | 5 | R | Grams/sq meter/month | ||||
| Chromium (TSP) LC | 14112 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0328 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Chromium (TSP) LC | 14112 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Chromium (TSP) LC | 14112 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Chromium (TSP) LC | 14112 | 107 | Intermittent | HI-VOL | Flameless Atomic absorption | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Chromium (TSP) LC | 14112 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 3.0e-05 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Chromium (TSP) LC | 14112 | 310 | Intermittent | LO-VOL | ICP-MS | 0.003 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Chromium (TSP) LC | 14112 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.288 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chromium (TSP) LC | 14112 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 8.0e-05 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Chromium (TSP) STP | 12112 | 045 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Chromium (TSP) STP | 12112 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0328 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Chromium (TSP) STP | 12112 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Chromium (TSP) STP | 12112 | 091 | Intermittent | HI-VOL | EMISSION SPECTRA MUFFLE FURNACE | 0.006 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Chromium (TSP) STP | 12112 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Chromium (TSP) STP | 12112 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.006 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Chromium (TSP) STP | 12112 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Chromium (TSP) STP | 12112 | 098 | Intermittent | HI-VOL | NEUTRON ACTIVATION ANALYZER | 0.0104 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Chromium (TSP) STP | 12112 | 107 | Intermittent | HI-VOL | Flameless Atomic absorption | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Chromium (TSP) STP | 12112 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Chromium (TSP) STP | 12112 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Chromium (TSP) STP | 12112 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Chromium (TSP) STP | 12112 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Chromium (TSP) STP | 12112 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.003 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Chromium (TSP) STP | 12112 | 905 | Intermittent | SKC Pump Filter | ICP/AES NIOSH 7300 | 1.74 | 2 | R | Micrograms/cubic meter (25 C) | |||||
| Chromium (TSP) STP | 12112 | 910 | Intermittent | SKC Pump Filter | MOd NISH 7300/6010B SOP 1813 | 0.1049 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Chromium - 50 (TSP) | 11345 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Chromium - 52 (TSP) | 11346 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Chromium - 53 (TSP) | 11347 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Chromium PM10 LC | 85112 | 110 | Intermittent | Hi-Vol SA/GMW1200 | ICP/MS | 344.4 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Chromium PM10 LC | 85112 | 202 | Intermittent | R&P Model 2000 PM10 Teflon | ICP/MS | 24.2 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Chromium PM10 LC | 85112 | 204 | Intermittent | Wedding & Ass. Model 600 PM10 HiVol | ICP-MS | 0.18 | 0.0 | 10000.0 | 2 | R | Nanograms/cubic meter (LC) | |||
| Chromium PM10 LC | 85112 | 216 | Intermittent | Tisch Model TE-Wilbur10 Low-Volume Sampler | ICP-MS | 0.4 | 5 | R | Nanograms/cubic meter (LC) | |||||
| Chromium PM10 LC | 85112 | 501 | Intermittent | Tisch Environmental 6000 Series | ICP-MS | 344.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Chromium PM10 LC | 85112 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Chromium PM10 LC | 85112 | 820 | Continuous | Cooper Environmental Services model Xact 620 | X-ray fluorescence (XRF) | 0.109 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Chromium PM10 LC | 85112 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 0.63 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Chromium PM10 LC | 85112 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 1.4 | 0.0 | 99999.99999 | 1 | R | Nanograms/cubic meter (LC) | |||
| Chromium PM10 LC | 85112 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.4 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Chromium PM10 LC | 85112 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.4 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Chromium PM10 LC | 85112 | 907 | Intermittent | R & P Partisol 2025 Teflon | ICPMS | 0.26 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Chromium PM10 LC | 85112 | 908 | Intermittent | MET ONE E-SEQ-FRM | ICP-MS | 6.4 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Chromium PM10 LC | 85112 | 911 | Intermittent | ARA low-volume sampler | ICP-MS | 0.4 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Chromium PM10 STP | 82112 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | |||||
| Chromium PM10 STP | 82112 | 092 | Intermittent | HI-VOL-SA/GMW-321-B | ATOMIC ABSORPTION | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Chromium PM10 STP | 82112 | 096 | Intermittent | Med-Vol SA254 TFE | X-ray fluorescence | 100.0 | 0.0 | -2 | R | Nanograms/cubic meter (25 C) | ||||
| Chromium PM10 STP | 82112 | 101 | Intermittent | HI-VOL-SA321A | ATOMIC ABSORPTION | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Chromium PM10 STP | 82112 | 102 | Intermittent | HI-VOL-SA/GMW1200 | ATOMIC ABSORPTION | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Chromium PM10 STP | 82112 | 103 | Intermittent | HI-VOL-WEDDING-INLET | ATOMIC ABSORPTION | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Chromium PM10 STP | 82112 | 105 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Chromium PM10 STP | 82112 | 106 | Intermittent | HI-VOL-WEDDING-INLET | EMISSION SPECTRA ICAP | 10.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Chromium PM10 STP | 82112 | 107 | Intermittent | HI-VOL-SA/GMW-321B | EMISSION SPECTRA ICAP | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Chromium PM10 STP | 82112 | 109 | Intermittent | Hi Vol SA/GMW 321B | ICP/MS | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Chromium PM10 STP | 82112 | 110 | Intermittent | Hi-Vol SA/GMW1200 Quartz | ICP/MS | 0.04 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Chromium PM10 STP | 82112 | 113 | Intermittent | Hi Vol Anderson IP1076 | ICP/MS | 0.6 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Chromium PM10 STP | 82112 | 141 | Intermittent | Tisch Environ Model-6070 PM10 Hi-Vol | ICP - AES | 5.0 | 0.0 | 99999.99999 | 1 | R | Nanograms/cubic meter (25 C) | |||
| Chromium PM10 STP | 82112 | 201 | Intermittent | R&P Model 2000 PM10 Quartz | ICP/MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Chromium PM10 STP | 82112 | 202 | Intermittent | R&P Model 2000 PM10 Teflon | ICP/MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Chromium PM10 STP | 82112 | 203 | Intermittent | R&P Model 2025 PM10 Teflon | ICP/MS | 3.6 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Chromium PM10 STP | 82112 | 204 | Intermittent | Wedding & Ass. Model 600 PM10 HiVol | ICP-MS | 4.96 | 0.0 | 10000.0 | 2 | R | Nanograms/cubic meter (25 C) | |||
| Chromium PM10 STP | 82112 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Chromium PM10 STP | 82112 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Chromium PM10 STP | 82112 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Chromium PM10 STP | 82112 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Chromium PM10 STP | 82112 | 908 | Intermittent | MET ONE E-SEQ FRM | ICP-MS | 6.4 | 2 | R | Nanograms/cubic meter (25 C) | |||||
| Chromium PM10-2.5 LC | 86112 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00063 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Chromium PM10-2.5 STP | 83112 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Chromium PM2.5 LC | 88112 | 118 | Intermittent | R & P Model 2025 PM2.5 Sequential w/WINS | ICP/MS | 0.00012 | 5.0 | 5 | R | Micrograms/cubic meter (LC) | ||||
| Chromium PM2.5 LC | 88112 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chromium PM2.5 LC | 88112 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chromium PM2.5 LC | 88112 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chromium PM2.5 LC | 88112 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy dispersive XRF | 0.00159 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chromium PM2.5 LC | 88112 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES XACT 625 | X RAY FLUORESCENCE XRF INSTRUMENTATION | 0.288 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chromium PM2.5 LC | 88112 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00063 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chromium PM2.5 LC | 88112 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00063 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chromium PM2.5 LC | 88112 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00063 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chromium PM2.5 LC | 88112 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00063 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chromium PM2.5 LC | 88112 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00063 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chromium PM2.5 LC | 88112 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00063 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chromium PM2.5 LC | 88112 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00063 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Chromium PM2.5 LC | 88112 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Chromium PM2.5 LC | 88112 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 0.0014 | 5000.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Chromium PM2.5 LC | 88112 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0004 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Chromium PM2.5 LC | 88112 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.0004 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Chromium PM2.5 LC | 88112 | 908 | Intermittent | R & P Partisol 2000 | X-Ray Fluorescence | 0.0004 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Chromium PM2.5 STP | 84112 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Chromium VI (TSP) LC | 14115 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0002 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Chromium VI (TSP) LC | 14115 | 920 | Intermittent | LO-VOL-XONTECH 920 or 924 | ION CHROMATOGRAPH UV VISIBLE | 0.2 | 0.0 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Chromium VI (TSP) LC | 14115 | 921 | Intermittent | ERG Chromium VI sampler | ION CHROMATOGRAPH UV VISIBLE | 3.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (LC) | ||||
| Chromium VI (TSP) LC | 14115 | 922 | Intermittent | RM Environmental Model 024 Toxic Sampler | Ion Chromatograph | 0.00011 | 0.0 | 5 | R | Micrograms/cubic meter (LC) | ||||
| Chromium VI (TSP) LC | 14115 | 925 | Intermittent | LO-VOL | ION CHROMATOGRAPH UV VISIBLE | 0.003 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Chromium VI (TSP) STP | 12115 | 920 | Intermittent | LO-VOL-XONTECH 920 or 924 | ION CHROMATOGRAPH UV VISIBLE | 0.2 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Chromium VI (TSP) STP | 12115 | 921 | Intermittent | ERG Chromium VI sampler | ION CHROMATOGRAPH UV VISIBLE | 3.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Chromium VI (TSP) STP | 12115 | 922 | Intermittent | RM Environmental Model 024 Toxic Sampler | Ion Chromatograph | 0.00011 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Chromium VI (TSP) STP | 12115 | 923 | Intermittent | ATEC 3400 | ION CHROMATOGRAPH UV VISIBLE | 3.0e-05 | 5 | R | Micrograms/cubic meter (25 C) | |||||
| Chromium VI (TSP) STP | 12115 | 924 | Intermittent | BGI PQ100 | Ion Chromatograph UV/Visible | 0.2 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Chrysene (TSP) STP | 17208 | 092 | Intermittent | HI-VOL | THIN LAYER CHROMATOGRAPHY | 0.2 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Chrysene (TSP) STP | 17208 | 101 | Intermittent | HI-VOL/PUF-XAD | GC-MS-SIM | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Chrysene (TSP) STP | 17208 | 102 | Intermittent | HI-VOL/PUF CARTRIDGE | TO-13- EPA610- EPA625 | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Chrysene (TSP) STP | 17208 | 103 | Intermittent | Hi-Vol/PUF Cartridge | Micro Wave Extraction GC/MS | 0.27 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Chrysene (TSP) STP | 17208 | 104 | Intermittent | Hi-Vol/PUF Cartridge | Accelerated solvent extraction GC-MS | 0.34 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Chrysene (TSP) STP | 17208 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Chrysene (TSP) STP | 17208 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 29.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Chrysene (TSP) STP | 17208 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.0001 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Chrysene (TSP) STP | 17208 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.0653 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| Chrysene (TSP) STP | 17208 | 119 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS-SIM Modified TO-13A | 0.0653 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| Chrysene (TSP) STP | 17208 | 904 | Intermittent | SKC Pump XAD-2 SORBENT Tube | HPLC Fluorescence/UV NIOSH 5506 | 170.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Chrysene (TSP) STP | 17208 | 909 | Intermittent | SKC Pump XAD-2 SORBENT Tube | GC/MS NIOSH 5515 REAC SOP 1817 | 4130.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Cloud cover | 66101 | 011 | Intermittent | MANUAL | VISUAL | 0.0 | 0.0 | 1 | R | Tenths of sky cover | ||||
| Coarse Mass Extinction PM2.5 LC | 88342 | 899 | Intermittent | Unknown-Unknown | # | 0.002 | 3 | Inverse Megameters | ||||||
| Cobalt (TSP) LC | 14113 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0109 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Cobalt (TSP) LC | 14113 | 310 | Intermittent | LO-VOL | ICP-MS | 0.005 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Cobalt (TSP) LC | 14113 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.317 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cobalt (TSP) LC | 14113 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0002 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Cobalt (TSP) STP | 12113 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0109 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Cobalt (TSP) STP | 12113 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.0039 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Cobalt (TSP) STP | 12113 | 091 | Intermittent | HI-VOL | EMISSION SPECTRA MUFFLE FURNACE | 0.004 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Cobalt (TSP) STP | 12113 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.004 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Cobalt (TSP) STP | 12113 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.004 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Cobalt (TSP) STP | 12113 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.03 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Cobalt (TSP) STP | 12113 | 098 | Intermittent | HI-VOL | NEUTRON ACTIVATION ANALYZER | 0.0018 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Cobalt (TSP) STP | 12113 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 2.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Cobalt (TSP) STP | 12113 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Cobalt (TSP) STP | 12113 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Cobalt (TSP) STP | 12113 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.016 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Cobalt (TSP) STP | 12113 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.005 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Cobalt (TSP) STP | 12113 | 905 | Intermittent | SKC Pump Filter | ICP/AES NIOSH 7300 | 0.35 | 2 | R | Micrograms/cubic meter (25 C) | |||||
| Cobalt (TSP) STP | 12113 | 910 | Intermittent | SKC Pump Filter | MOd NISH 7300/6010B SOP 1813 | 0.0339 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Cobalt (precip) | 65113 | 085 | Intermittent | ANDERSON RAINFALL BUCKET | EMISSION SPECTRA ICAP | 0.01 | 0.0 | 3 | R | Milligrams/liter | ||||
| Cobalt - 59 (TSP) | 11348 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Cobalt PM10 LC | 85113 | 110 | Intermittent | Hi-Vol SA/GMW1200 | ICP/MS | 49.2 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Cobalt PM10 LC | 85113 | 202 | Intermittent | R&P Model 2000 PM10 Teflon | ICP/MS | 0.0333 | 4 | R | Nanograms/cubic meter (LC) | |||||
| Cobalt PM10 LC | 85113 | 204 | Intermittent | Wedding & Ass. Model 600 PM10 HiVol | ICP-MS | 0.01 | 0.0 | 10000.0 | 2 | R | Nanograms/cubic meter (LC) | |||
| Cobalt PM10 LC | 85113 | 216 | Intermittent | Tisch Model TE-Wilbur10 Low-Volume Sampler | ICP-MS | 0.2 | 5 | R | Nanograms/cubic meter (LC) | |||||
| Cobalt PM10 LC | 85113 | 501 | Intermittent | Tisch Environmental 6000 Series | ICP-MS | 0.01 | 0.0 | 2 | R | Nanograms/cubic meter (LC) | ||||
| Cobalt PM10 LC | 85113 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 6.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Cobalt PM10 LC | 85113 | 820 | Continuous | Cooper Environmental Services model Xact 620 | X-ray fluorescence (XRF) | 0.047 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Cobalt PM10 LC | 85113 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 0.56 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Cobalt PM10 LC | 85113 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 0.7 | 0.0 | 99999.99999 | 1 | R | Nanograms/cubic meter (LC) | |||
| Cobalt PM10 LC | 85113 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.2 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Cobalt PM10 LC | 85113 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.2 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Cobalt PM10 LC | 85113 | 907 | Intermittent | R & P Partisol 2025 Teflon | ICPMS | 0.26 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Cobalt PM10 LC | 85113 | 908 | Intermittent | MET ONE E-SEQ-FRM | ICP-MS | 0.0172 | 4 | R | Nanograms/cubic meter (LC) | |||||
| Cobalt PM10 LC | 85113 | 911 | Intermittent | ARA low-volume sampler | ICP-MS | 0.2 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Cobalt PM10 STP | 82113 | 092 | Intermittent | HI-VOL-SA/GMW-321-B | ATOMIC ABSORPTION | 4.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Cobalt PM10 STP | 82113 | 102 | Intermittent | HI-VOL-SA/GMW1200 | ATOMIC ABSORPTION | 4.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Cobalt PM10 STP | 82113 | 105 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 4.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Cobalt PM10 STP | 82113 | 106 | Intermittent | HI-VOL-WEDDING-INLET | EMISSION SPECTRA ICAP | 20.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Cobalt PM10 STP | 82113 | 107 | Intermittent | HI-VOL-SA/GMW-321B | EMISSION SPECTRA ICAP | 4.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Cobalt PM10 STP | 82113 | 109 | Intermittent | Hi Vol SA/GMW 321B | ICP/MS | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Cobalt PM10 STP | 82113 | 110 | Intermittent | Hi-Vol SA/GMW1200 Quartz | ICP/MS | 0.04 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Cobalt PM10 STP | 82113 | 113 | Intermittent | Hi Vol Anderson IP1076 | ICP/MS | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Cobalt PM10 STP | 82113 | 201 | Intermittent | R&P Model 2000 PM10 Quartz | ICP/MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Cobalt PM10 STP | 82113 | 202 | Intermittent | R&P Model 2000 PM10 Teflon | ICP/MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Cobalt PM10 STP | 82113 | 203 | Intermittent | R&P Model 2025 PM10 Teflon | ICP/MS | 1.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Cobalt PM10 STP | 82113 | 204 | Intermittent | Wedding & Ass. Model 600 PM10 HiVol | ICP-MS | 0.22 | 0.0 | 10000.0 | 2 | R | Nanograms/cubic meter (25 C) | |||
| Cobalt PM10 STP | 82113 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 6.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Cobalt PM10 STP | 82113 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 0.03 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Cobalt PM10 STP | 82113 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 0.03 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Cobalt PM10 STP | 82113 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 0.03 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Cobalt PM10 STP | 82113 | 908 | Intermittent | MET ONE E-SEQ-FRM | ICP-MS | 0.0172 | 4 | R | Nanograms/cubic meter (25 C) | |||||
| Cobalt PM10-2.5 LC | 86113 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00056 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Cobalt PM10-2.5 STP | 83113 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.006 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Cobalt PM2.5 LC | 88113 | 118 | Intermittent | R & P Model 2025 PM2.5 Sequential w/WINS | ICP/MS | 5.0e-05 | 5.0 | 5 | R | Micrograms/cubic meter (LC) | ||||
| Cobalt PM2.5 LC | 88113 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.00141 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cobalt PM2.5 LC | 88113 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESENCE (XRF) | 0.317 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cobalt PM2.5 LC | 88113 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00056 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cobalt PM2.5 LC | 88113 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00056 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cobalt PM2.5 LC | 88113 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00056 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cobalt PM2.5 LC | 88113 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00056 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cobalt PM2.5 LC | 88113 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00056 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cobalt PM2.5 LC | 88113 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00056 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Cobalt PM2.5 LC | 88113 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00056 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Cobalt PM2.5 LC | 88113 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 0.0007 | 5000.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Cobalt PM2.5 LC | 88113 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0002 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Cobalt PM2.5 LC | 88113 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.0002 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Cobalt PM2.5 STP | 84113 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.006 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Conductance (SP) | 25303 | 081 | Intermittent | EMISSION SPECTRA ICAP | CONDUCTIVITY CELL | 0.01 | 0.0 | 2 | R | Microsiemens/centimeter | ||||
| Conductivity (precip) | 65303 | 081 | Intermittent | PRECIP | CONDUCTIVITY CELL | 0.01 | 0.0 | 2 | R | Microsiemens/centimeter | ||||
| Conductivity (precip) | 65303 | 082 | Intermittent | PRECIP | FIELD TEST | 0.01 | 0.0 | 2 | R | Microsiemens/centimeter | ||||
| Copper (SP) | 22114 | 092 | Intermittent | BUCKET | ATOMIC ABSORPTION | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Copper (SP) | 22114 | 101 | Intermittent | NADP BUCKET: DRY SIDE | ATOMIC ABSORPTION | 8.0e-05 | 0.0 | 5 | R | Grams/sq meter/month | ||||
| Copper (TSP) STP | 12114 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.4374 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Copper (TSP) STP | 12114 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Copper (TSP) STP | 12114 | 091 | Intermittent | HI-VOL | EMISSION SPECTRA MUFFLE FURNACE | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Copper (TSP) STP | 12114 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Copper (TSP) STP | 12114 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Copper (TSP) STP | 12114 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Copper (TSP) STP | 12114 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 2.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Copper (TSP) STP | 12114 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Copper (TSP) STP | 12114 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Copper (TSP) STP | 12114 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Copper (TSP) STP | 12114 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Copper (TSP) STP | 12114 | 905 | Intermittent | SKC Pump Filter | ICP/AES NIOSH 7300 | 0.35 | 2 | R | Micrograms/cubic meter (25 C) | |||||
| Copper (TSP) STP | 12114 | 910 | Intermittent | SKC Pump Filter | MOd NISH 7300/6010B SOP 1813 | 0.0259 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Copper (TSP) STP | 12114 | 920 | Intermittent | LO-VOL-XONTECH 920 or 924 | ION CHROMATOGRAPH UV VISIBLE | 0.2 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Copper - 63 (TSP) | 11349 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Copper PM10 LC | 85114 | 110 | Intermittent | Hi-Vol SA/GMW1200 | ICP/MS | 30.0 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Copper PM10 LC | 85114 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Copper PM10 LC | 85114 | 820 | Continuous | Cooper Environmental Services model Xact 620 | X-ray fluorescence (XRF) | 0.064 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Copper PM10 LC | 85114 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 0.54 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Copper PM10 LC | 85114 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.72 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Copper PM10 STP | 82114 | 092 | Intermittent | HI-VOL-SA/GMW-321-B | ATOMIC ABSORPTION | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Copper PM10 STP | 82114 | 096 | Intermittent | Med-Vol SA254 TFE | X-ray fluorescence | 100.0 | 0.0 | -2 | R | Nanograms/cubic meter (25 C) | ||||
| Copper PM10 STP | 82114 | 101 | Intermittent | HI-VOL-SA321A | ATOMIC ABSORPTION | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Copper PM10 STP | 82114 | 102 | Intermittent | HI-VOL-SA/GMW1200 | ATOMIC ABSORPTION | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Copper PM10 STP | 82114 | 103 | Intermittent | HI-VOL-WEDDING-INLET | ATOMIC ABSORPTION | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Copper PM10 STP | 82114 | 104 | Intermittent | HI-VOL-SA321A | EMISSION SPECTRA ICAP | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Copper PM10 STP | 82114 | 105 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Copper PM10 STP | 82114 | 106 | Intermittent | HI-VOL-WEDDING-INLET | EMISSION SPECTRA ICAP | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Copper PM10 STP | 82114 | 107 | Intermittent | HI-VOL-SA/GMW-321B | EMISSION SPECTRA ICAP | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Copper PM10 STP | 82114 | 109 | Intermittent | Hi Vol SA/GMW 321B | ICP/MS | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Copper PM10 STP | 82114 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Copper PM10 STP | 82114 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Copper PM10 STP | 82114 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Copper PM10 STP | 82114 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Copper PM10-2.5 LC | 86114 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00054 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Copper PM10-2.5 STP | 83114 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Copper PM2.5 LC | 88114 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Copper PM2.5 LC | 88114 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Copper PM2.5 LC | 88114 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Copper PM2.5 LC | 88114 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy dispersive XRF | 0.00135 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Copper PM2.5 LC | 88114 | 820 | Continuous | COOOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE (XRF) | 0.267 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Copper PM2.5 LC | 88114 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00054 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Copper PM2.5 LC | 88114 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00054 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Copper PM2.5 LC | 88114 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00054 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Copper PM2.5 LC | 88114 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00054 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Copper PM2.5 LC | 88114 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00054 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Copper PM2.5 LC | 88114 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00054 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Copper PM2.5 LC | 88114 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00054 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Copper PM2.5 LC | 88114 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Copper PM2.5 STP | 84114 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Copper(TSP) LC | 14114 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.4374 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Copper(TSP) LC | 14114 | 090 | Intermittent | HI-VOL | Emission Spectra ICAP | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Copper(TSP) LC | 14114 | 310 | Intermittent | LO-VOL | ICP-MS | 0.005 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Copper(TSP) LC | 14114 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.267 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Copper(precip) | 65333 | 082 | Intermittent | PRECIP | ATOMIC ABSORPTION | 0.03 | 0.0 | 2 | R | Milligrams/liter | ||||
| Copper(precip) | 65333 | 085 | Intermittent | ANDERSON RAINFALL BUCKET | EMISSION SPECTRA ICAP | 0.01 | 0.0 | 3 | R | Milligrams/liter | ||||
| Coronene (TSP) STP | 17211 | 092 | Intermittent | HI-VOL | THIN LAYER CHROMATOGRAPHY | 0.2 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Coronene (TSP) STP | 17211 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00017 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Coronene (TSP) STP | 17211 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.125 | 0.0 | 3 | R | Nanograms/cubic meter (25 C) | ||||
| Coronene (TSP) STP | 17211 | 119 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS-SIM Modified TO-13A | 0.125 | 3 | R | Nanograms/cubic meter (25 C) | |||||
| Cristabalite | 11122 | 096 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.002 | 0.0 | 2 | R | Picocuries/cubic meter | ||||
| Crotonaldehyde | 43528 | 102 | Intermittent | Cartridge-DNPH-on silica | HPLC Ultraviolet Absorption | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Crotonaldehyde | 43528 | 114 | Intermittent | CARTRIDGE-DNPH-SILICA-SEP-PAK | HPLC-PHOTODIODE ARRAY | 0.085 | -0.085 | 3 | R | Parts per billion Carbon | ||||
| Crotonaldehyde | 43528 | 156 | Intermittent | Cartridge DNPH on Silica, Heated O3 Denuder | HPLC Photo Diode Array | 0.175 | -0.175 | 1 | R | Parts per billion Carbon | ||||
| Crotonaldehyde | 43528 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Crystalline quartz | 11121 | 096 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.002 | 0.0 | 2 | R | Picocuries/cubic meter | ||||
| Cyclohexane | 43248 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 113 | Intermittent | SS-Canister_Pressurized | Capillary GC ITD Mass Spectro | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 29.4 | -29.4 | 1 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.36 | -0.36 | 2 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.49327 | -0.49327 | 4 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 1.06 | -1.06 | 2 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.24 | -0.24 | 2 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclohexane | 43248 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclohexane | 43248 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclohexane | 43248 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclohexane | 43248 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclohexane | 43248 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclohexane | 43248 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclohexane | 43248 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclohexane | 43248 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclohexane | 43248 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclohexane | 43248 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclohexane | 43248 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclohexane | 43248 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclohexane | 43248 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 1.43 | -1.43 | 2 | R | Parts per billion Carbon | ||||
| Cyclohexene | 43269 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclohexene | 43269 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclohexene | 43269 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclohexene | 43269 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclohexene | 43269 | 902 | Intermittent | SKC Pump Charcoal Tube | GC/FID NIOSH 1500 | 3.89 | -3.89 | 2 | R | Parts per billion Carbon | ||||
| Cyclohexene | 43269 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 1.07 | -1.07 | 2 | R | Parts per billion Carbon | ||||
| Cyclopenta[cd]pyrene (TSP) STP | 17160 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Cyclopenta[cd]pyrene (TSP) STP | 17160 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.112 | 0.0 | 3 | R | Nanograms/cubic meter (25 C) | ||||
| Cyclopenta[cd]pyrene (TSP) STP | 17160 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.132 | 0.0 | 3 | R | Nanograms/cubic meter (25 C) | ||||
| Cyclopentane | 43242 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentane | 43242 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentane | 43242 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentane | 43242 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentane | 43242 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentane | 43242 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentane | 43242 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Cyclopentane | 43242 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentane | 43242 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Cyclopentane | 43242 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentane | 43242 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentane | 43242 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| Cyclopentane | 43242 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.66799 | -0.66799 | 4 | R | Parts per billion Carbon | ||||
| Cyclopentane | 43242 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentane | 43242 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Cyclopentane | 43242 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentane | 43242 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentane | 43242 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentane | 43242 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentane | 43242 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Cyclopentane | 43242 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentane | 43242 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopentane | 43242 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopentane | 43242 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopentane | 43242 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopentane | 43242 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopentane | 43242 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopentane | 43242 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopentane | 43242 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopentane | 43242 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopentane | 43242 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopentane | 43242 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopentane | 43242 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopentane & 2,3-dimethylbutane | 43171 | 123 | Intermittent | 6L Pressurized Canister | Dual FID - PAMS | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentene | 43283 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentene | 43283 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentene | 43283 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentene | 43283 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentene | 43283 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentene | 43283 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentene | 43283 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Cyclopentene | 43283 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentene | 43283 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Cyclopentene | 43283 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentene | 43283 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentene | 43283 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentene | 43283 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.39 | -0.39 | 2 | R | Parts per billion Carbon | ||||
| Cyclopentene | 43283 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentene | 43283 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentene | 43283 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentene | 43283 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopentene | 43283 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Cyclopentene | 43283 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopentene | 43283 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopentene | 43283 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopentene | 43283 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopentene | 43283 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopentene | 43283 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopentene | 43283 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopentene | 43283 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopentene | 43283 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopentene | 43283 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopentene | 43283 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopentene | 43283 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Cyclopropane | 43251 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Cyclopropane | 43251 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| D-limonene | 17907 | 091 | Intermittent | MANUAL | FLAME IONIZATION | 0.1 | 0.0 | 1 | R | Parts per billion Carbon | ||||
| D-limonene | 17907 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | 0.0 | 1 | R | Parts per billion Carbon | ||||
| D-limonene | 17907 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.01 | 0.0 | 2 | R | Parts per billion Carbon | ||||
| D-limonene | 17907 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 1.27 | 0.0 | 2 | R | Parts per billion Carbon | ||||
| DIMETHYL SULFIDE | 43915 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | Parts per billion Carbon | |||||
| Dacthal | 43156 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Decachlorobiphenyl (TSP) STP | 17818 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 2.0 | 0.0 | 0 | R | Pg/cubic meter(25 C) | ||||
| Decanal | 43521 | 102 | Continuous | Cartridge-DNPH-on silica | HPLC Ultraviolet Absorption | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Decanal | 43521 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Deciview | 11208 | 804 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Hybrid Integrating Plate Method | 0.002 | 3 | No Units | ||||||
| Deciview | 11208 | 807 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Laser Integratig Plate Method | 0.002 | 3 | No Units | ||||||
| Deciview | 11208 | 888 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | LRNC Method | 0.002 | 3 | No Units | ||||||
| Dew Point | 62103 | 020 | Continuous | INSTRUMENTAL | SPOT READING | 0.1 | -40.0 | 0 | R | Degrees Fahrenheit | ||||
| Dew Point | 62103 | 021 | Continuous | INSTRUMENTAL | SPOT READING LEVEL 1 | 0.1 | -40.0 | 0 | R | Degrees Fahrenheit | ||||
| Dew Point | 62103 | 022 | Continuous | INSTRUMENTAL | SPOT READING LEVEL 2 | 0.1 | -40.0 | 0 | R | Degrees Fahrenheit | ||||
| Dew Point | 62103 | 023 | Continuous | INSTRUMENTAL | SPOT READING LEVEL 3 | 0.1 | -40.0 | 0 | R | Degrees Fahrenheit | ||||
| Dew Point | 62103 | 030 | Continuous | Instrumental | TVA Last 5-min. average | 0.1 | -40.0 | 1 | R | Degrees Fahrenheit | ||||
| Dew Point | 62103 | 031 | Continuous | Instrumental | TVA Last 5-min. average level 1 | 0.1 | -40.0 | 1 | R | Degrees Fahrenheit | ||||
| Dew Point | 62103 | 032 | Continuous | Instrumental | TVA Last 5-min. average level 2 | 0.1 | -40.0 | 1 | R | Degrees Fahrenheit | ||||
| Dew Point | 62103 | 033 | Continuous | Instrumental | TVA Last 5-min. average level 3 | 0.1 | -40.0 | 1 | R | Degrees Fahrenheit | ||||
| Dew Point | 62103 | 034 | Continuous | Instrumental | TVA Last 5-min. average level 4 | 0.1 | -40.0 | 1 | R | Degrees Fahrenheit | ||||
| Dew Point | 62103 | 040 | Continuous | INSTRUMENTAL | ELECTRONIC OR MACHINE AVG. | -20.0 | -40.0 | 0 | R | Degrees Fahrenheit | ||||
| Dew Point | 62103 | 041 | Continuous | INSTRUMENTAL | ELEC. OR MACH. AVG. LEVEL 1 | 0.1 | -40.0 | 0 | R | Degrees Fahrenheit | ||||
| Dew Point | 62103 | 042 | Continuous | INSTRUMENTAL | ELEC. OR MACH. AVG. LEVEL 2 | 0.1 | -40.0 | 0 | R | Degrees Fahrenheit | ||||
| Dew Point | 62103 | 043 | Continuous | INSTRUMENTAL | ELEC. OR MACH. AVG. LEVEL 3 | 0.1 | -40.0 | 0 | R | Degrees Fahrenheit | ||||
| Dew Point | 62103 | 070 | Continuous | Instrumental | Yankee Systems Model MET-2010 | 0.1 | -40.0 | 1 | R | Degrees Fahrenheit | ||||
| Di-n-butyl phthalate (TSP) STP | 16777 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 23.6 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Di-n-octyl phthalate (TSP) STP | 16778 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 21.7 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Diallate (TSP) STP | 16774 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 23.5 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Dibenz(A-H)Anthracene PM10 STP | 82151 | 063 | Intermittent | HI-VOL-SA/GMW1200 | HPLC SCANNING FLUORESCENCE | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Dibenzo[a,h]anthracene (TSP) STP | 17231 | 101 | Intermittent | HI-VOL/PUF-XAD | GC-MS-SIM | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Dibenzo[a,h]anthracene (TSP) STP | 17231 | 102 | Intermittent | HI-VOL/PUF CARTRIDGE | TO-13- EPA610- EPA625 | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Dibenzo[a,h]anthracene (TSP) STP | 17231 | 103 | Intermittent | Hi-Vol/PUF Cartridge | Micro Wave Extraction GC/MS | 0.4 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Dibenzo[a,h]anthracene (TSP) STP | 17231 | 104 | Intermittent | Hi-Vol/PUF Cartridge | Accelerated solvent extraction GC-MS | 0.45 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Dibenzo[a,h]anthracene (TSP) STP | 17231 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Dibenzo[a,h]anthracene (TSP) STP | 17231 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 25.7 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Dibenzo[a,h]anthracene (TSP) STP | 17231 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00015 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Dibenzo[a,h]anthracene (TSP) STP | 17231 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.0901 | 0.0 | 3 | R | Nanograms/cubic meter (25 C) | ||||
| Dibenzo[a,h]anthracene (TSP) STP | 17231 | 119 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS-SIM Modified TO-13A | 0.0901 | 0.0 | 3 | R | Nanograms/cubic meter (25 C) | ||||
| Dibenzo[a,h]anthracene (TSP) STP | 17231 | 904 | Intermittent | SKC Pump XAD-2 SORBENT Tube | HPLC Fluorescence/UV NIOSH 5506 | 350.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Dibenzo[a,h]anthracene (TSP) STP | 17231 | 909 | Intermittent | SKC Pump XAD-2 SORBENT Tube | GC/MS NIOSH 5515 REAC SOP 1817 | 4960.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Dibenzo[b,e][1,4]dioxin,2,3,7,8-tetrachloro (TSP) STP | 17902 | 101 | Intermittent | Hi Vol/PUF | GC/MS | 0.05 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Dibenzofuran (TSP) STP | 18202 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 0.05 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Dibenzofuran (TSP) STP | 18202 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 16.5 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Dibenzofuran (TSP) STP | 18202 | 909 | Intermittent | SKC Pump XAD-2 SORBENT Tube | GC/MS NIOSH 5515 REAC SOP 1817 | 4100.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Dibromochloromethane | 43832 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 1.0 | -1.0 | 0 | R | Parts per billion Carbon | ||||
| Dibromochloromethane | 43832 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.001 | -0.001 | 2 | R | Parts per billion Carbon | ||||
| Dibromochloromethane | 43832 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.11 | -0.11 | 1 | R | Parts per billion Carbon | ||||
| Dibromochloromethane | 43832 | 105 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Dibromochloromethane | 43832 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Dibromochloromethane | 43832 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Dibromochloromethane | 43832 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Dibromochloromethane | 43832 | 113 | Intermittent | SS-Canister_Pressurized | Capillary GC ITD Mass Spectro | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Dibromochloromethane | 43832 | 116 | Intermittent | Mixed Sorbent Cartridge | GC/MS | 29.4 | -29.4 | 1 | R | Parts per billion Carbon | ||||
| Dibromochloromethane | 43832 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Dibromochloromethane | 43832 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Dibromochloromethane | 43832 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Dibromochloromethane | 43832 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.001 | -0.001 | 2 | R | Parts per billion Carbon | ||||
| Dibromochloromethane | 43832 | 150 | Intermittent | SS 6L - PRESSURIZED CANISTER | CRYOGENIC PRECON:GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Dibromochloromethane | 43832 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Dibromochloromethane | 43832 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| Dibromochloromethane | 43832 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.11 | -0.11 | 2 | R | Parts per billion Carbon | ||||
| Dibromochloromethane | 43832 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dibromochloromethane | 43832 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dibromochloromethane | 43832 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dibromochloromethane | 43832 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dibromochloromethane | 43832 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dibromochloromethane | 43832 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dibromochloromethane | 43832 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dibromochloromethane | 43832 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dibromochloromethane | 43832 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dibromochloromethane | 43832 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dibromochloromethane | 43832 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dibromochloromethane | 43832 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dibromomethane | 43805 | 102 | Intermittent | CARTRIDGE-DNPH-ON-SILICA | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Dibromomethane | 43805 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Dibromomethane | 43805 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Dibromomethane | 43805 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Dibromomethane | 43805 | 176 | Intermittent | 6L SUBAMBIENT SS-CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Dichlorobiphenyl (TSP) STP | 17810 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 2.0 | 0.0 | 0 | R | Pg/cubic meter(25 C) | ||||
| Dichlorodifluoromethane | 43823 | 091 | Intermittent | HI-VOL | GC/MS | 0.001 | -0.001 | 3 | R | Parts per billion Carbon | ||||
| Dichlorodifluoromethane | 43823 | 101 | Intermittent | Canister Subambient Pressure | Multi Detector GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Dichlorodifluoromethane | 43823 | 105 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.02 | -0.02 | 1 | R | Parts per billion Carbon | ||||
| Dichlorodifluoromethane | 43823 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Dichlorodifluoromethane | 43823 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Dichlorodifluoromethane | 43823 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Dichlorodifluoromethane | 43823 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Dichlorodifluoromethane | 43823 | 121 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/ELECTRON;GC ECD | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Dichlorodifluoromethane | 43823 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Dichlorodifluoromethane | 43823 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Dichlorodifluoromethane | 43823 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Dichlorodifluoromethane | 43823 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Dichlorodifluoromethane | 43823 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Dichlorodifluoromethane | 43823 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Dichlorodifluoromethane | 43823 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Dichlorodifluoromethane | 43823 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Dichlorodifluoromethane | 43823 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| Dichlorodifluoromethane | 43823 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.02 | -0.02 | 3 | R | Parts per billion Carbon | ||||
| Dichlorodifluoromethane | 43823 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Dichlorodifluoromethane | 43823 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichlorodifluoromethane | 43823 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichlorodifluoromethane | 43823 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichlorodifluoromethane | 43823 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichlorodifluoromethane | 43823 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichlorodifluoromethane | 43823 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichlorodifluoromethane | 43823 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichlorodifluoromethane | 43823 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichlorodifluoromethane | 43823 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichlorodifluoromethane | 43823 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichlorodifluoromethane | 43823 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichlorodifluoromethane | 43823 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichloroethyl ether | 43352 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Dichloroethyl ether | 43352 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Dichloroethyl ether | 43352 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Dichloroethyl ether | 43352 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 115.0 | -115.0 | 0 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.3 | -0.3 | 1 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 107 | Intermittent | TEDLAR-BAG-24-HR-SAMPLE | GC - ELECTRON CAPTURE DETECTOR | 1.0 | -1.0 | 3 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.3 | -0.3 | 1 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.2 | -0.2 | 3 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 117 | Intermittent | TENAX SORBENT CARTRIDGE | GC/MS | 0.4 | -0.4 | 2 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 118 | Intermittent | TENAX SORBENT CARTRIDGE | GC-FID/ECD | 0.01 | -0.01 | 3 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 119 | Intermittent | PERSONAL PUMP MOLECULAR SIEVE | GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.033 | -0.033 | 2 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.4 | -0.4 | 2 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 151 | Intermittent | 6L PRESSURIZED CANISTER | CAPILLARY GC-ECD/PID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 168 | Intermittent | 6L PRESSURIZED CANISTER | PACKED COLUMN GC - ECD/PID | 1.0 | -1.0 | 2 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 169 | Intermittent | TEDLAR BAG | PACKED COLUMN GC - ECD/PID | 1.0 | -1.0 | 2 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.02 | -0.02 | 3 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.07 | -0.07 | 2 | R | Parts per billion Carbon | ||||
| Dichloromethane | 43802 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichloromethane | 43802 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichloromethane | 43802 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichloromethane | 43802 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichloromethane | 43802 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichloromethane | 43802 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichloromethane | 43802 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichloromethane | 43802 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichloromethane | 43802 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichloromethane | 43802 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichloromethane | 43802 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichloromethane | 43802 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Dichlorophenol (TSP) STP | 17805 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 10.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Dichlorotetrafluoroethane | 43852 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.028 | -0.028 | 3 | R | Parts per billion Carbon | ||||
| Dieldrin | 43165 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Dieldrin | 43165 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | -0.5 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Diethyl phthalate (TSP) STP | 16775 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 22.6 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Diethyl phthalate (TSP) STP | 16775 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.0474 | 4 | R | Nanograms/cubic meter (25 C) | |||||
| Diethylene glycol | 43356 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| Dimethyl phthalate (TSP) STP | 16776 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 21.9 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Dinoseb (TSP) STP | 16779 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 31.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Dinoseb (TSP) STP | 16779 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Diphenylamine (TSP) STP | 16780 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 131.9 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Dodecanal | 43522 | 102 | Continuous | Cartridge-DNPH-on silica | HPLC Ultraviolet Absorption | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Dodecanal | 43522 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Dodecene | 43330 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.85 | -0.85 | 2 | R | Parts per billion Carbon | ||||
| Dodecene | 43330 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Dodecene | 43330 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Dry deposition | 65401 | 001 | Continuous | INSTRUMENTAL | DRI SENSOR | 1.0 | 0.0 | 0 | R | Percent hours with precip | ||||
| Dursban | 43158 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Dustfall Combustible (SP) | 25101 | 081 | Intermittent | BUCKET | GRAVIMETRIC-500 DEG.C.LOSS (ASTM) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Dyed fabric #1 | 72301 | 091 | Intermittent | COTTON MUSLIN1 | COLOR DIFFERENCE METER | 0.1 | 0.0 | 1 | R | NBS color difference units | ||||
| Dyed fabric #2 | 72302 | 091 | Intermittent | ORLON | COLOR DIFFERENCE METER | 0.1 | 0.0 | 1 | R | NBS color difference units | ||||
| Dyed fabric #3 | 72303 | 091 | Intermittent | ACETATE 1 | COLOR DIFFERENCE METER | 0.1 | 0.0 | 1 | R | NBS color difference units | ||||
| Dyed fabric #4 | 72304 | 091 | Intermittent | ACETATE 2 | COLOR DIFFERENCE METER | 0.1 | 0.0 | 1 | R | NBS color difference units | ||||
| Dyed fabric #5 | 72305 | 091 | Intermittent | TRIACETATE | COLOR DIFFERENCE METER | 0.1 | 0.0 | 1 | R | NBS color difference units | ||||
| Dyed fabric #6 | 72306 | 091 | Intermittent | MUSLIN-BLEACH | COLOR DIFFERENCE METER | 0.1 | 0.0 | 1 | R | NBS color difference units | ||||
| Dyed fabric #7 | 72307 | 091 | Intermittent | WOOL FLANNEL | COLOR DIFFERENCE METER | 0.1 | 0.0 | 1 | R | NBS color difference units | ||||
| Dyed fabric #8 | 72308 | 091 | Intermittent | COTTON MUSLIN2 | COLOR DIFFERENCE METER | 0.1 | 0.0 | 1 | R | NBS color difference units | ||||
| Dyed fabric #9 | 72309 | 091 | Intermittent | NYLON TAFFETA | COLOR DIFFERENCE METER | 0.1 | 0.0 | 1 | R | NBS color difference units | ||||
| EC CSN PM2.5 LC TOT | 88307 | 803 | Intermittent | IMPROVE | STN TOT | 0.021 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN PM2.5 LC TOT | 88307 | 813 | Intermittent | Met One SASS Quartz | STN TOT | 0.245 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN PM2.5 LC TOT | 88307 | 823 | Intermittent | Andersen RAAS Quartz | STN TOT | 0.224 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN PM2.5 LC TOT | 88307 | 833 | Intermittent | URG MASS450 Quartz WINS | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN PM2.5 LC TOT | 88307 | 843 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN PM2.5 LC TOT | 88307 | 847 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN PM2.5 LC TOT | 88307 | 853 | Intermittent | R&P MDL2300 PM2.5 Seq Spec Quartz | STN TOT | 0.163 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN PM2.5 LC TOT | 88307 | 860 | Continuous | R&P MODEL 5400 | STN TOT | 0.2 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN PM2.5 LC TOT | 88307 | 867 | Continuous | Sunset Labs | TOT | 0.2 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN PM2.5 LC TOT | 88307 | 873 | Intermittent | URG MASS450 Quartz VSCC | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN PM2.5 LC TOT | 88307 | 899 | Intermittent | Unknown-Unknown | STN TOT | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN PM2.5 STP TOT | 84307 | 867 | Continuous | Sunset Labs | TOT | 0.2 | 0.0 | 2 | Micrograms/cubic meter (20 C) | |||||
| EC CSN_Rev Unadjusted PM2.5 LC TOR | 88380 | 816 | Intermittent | Met One SASS/SuperSASS Quartz | IMPROVE_A | 0.03 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN_Rev Unadjusted PM2.5 LC TOR | 88380 | 831 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | EC1+EC2+EC3-(OP(TOR))=(88383+88384+88385-88378)) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN_Rev Unadjusted PM2.5 LC TOR | 88380 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | EC1+EC2+EC3-(OP(TOR))=(88383+88384+88385-88378)) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN_Rev Unadjusted PM2.5 LC TOR | 88380 | 843 | Intermittent | Met One SASS 22 LPM Quartz | EC1+EC2+EC3-(OP(TOR))=(88383+88384+88385-88378)) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN_Rev Unadjusted PM2.5 LC TOR | 88380 | 851 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | EC1+EC2+EC3-(OP(TOR)) = (88383+88384+88385-88378) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN_Rev Unadjusted PM2.5 LC TOR | 88380 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN_Rev Unadjusted PM2.5 LC TOR | 88380 | 892 | Intermittent | Model 2025 PM2.5 Sequential Quartz VSCC | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN_Rev Unadjusted PM2.5 LC TOT | 88357 | 816 | Intermittent | Met One SASS Quartz | EC1+EC2+EC3-OP (88329+88330+88331-88388) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN_Rev Unadjusted PM2.5 LC TOT | 88357 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | EC1+EC2+EC3-OP (88329+88330+88331-88388) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN_Rev Unadjusted PM2.5 LC TOT | 88357 | 840 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | EC1+EC2+EC3-(OP(TOT))=(88383+88384+88385-88388)) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN_Rev Unadjusted PM2.5 LC TOT | 88357 | 843 | Intermittent | Met One SASS 22 LPM Quartz | EC1+EC2+EC3-(OP(TOT))=(88383+88384+88385-88388)) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN_Rev Unadjusted PM2.5 LC TOT | 88357 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN_Rev Unadjusted PM2.5 LC TOT | 88357 | 892 | Intermittent | Model 2025 PM2.5 Sequential Quartz VSCC | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC CSN_rev Unadjusted PM10 LC TOR | 85380 | 888 | Intermittent | Model 2025 PM10 Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| EC CSN_rev Unadjusted PM10 LC TOT | 85357 | 888 | Intermittent | Model 2025 PM10 Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| EC CSN_rev Unadjusted PM10-2.5 LC TOR | 86380 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| EC CSN_rev Unadjusted PM10-2.5 LC TOT | 86357 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| EC PM2.5 LC TOR | 88321 | 805 | Intermittent | IMPROVE | EC1+EC2+EC3-OP | 0.02 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC PM2.5 LC TOR | 88321 | 809 | Intermittent | IMPROVE Module C with Cyclone Inlet-Quartz Filter | EC1+EC2+EC3-OP (88329+88330+88331-88336) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC PM2.5 LC TOR | 88321 | 815 | Intermittent | Met One SASS Quartz | EC1+EC2+EC3-OP | 0.233 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC PM2.5 LC TOR | 88321 | 816 | Intermittent | Met One SASS/SuperSASS Quartz | EC1+EC2+EC3-(OP(TOR)=(88329+88330+88331-88328) | 0.002 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC PM2.5 LC TOR | 88321 | 825 | Intermittent | Andersen RAAS Quartz | EC1+EC2+EC3-OP | 0.213 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC PM2.5 LC TOR | 88321 | 829 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | EC1+EC2+EC3-(OP(TOR))=(88329+88330+88331-88328) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC PM2.5 LC TOR | 88321 | 837 | Intermittent | URG MASS450 Quartz WINS | EC1+EC2+EC3-OP | 0.025 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC PM2.5 LC TOR | 88321 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | EC1+EC2+EC3-OP (88329+88330+88331-88336) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC PM2.5 LC TOR | 88321 | 855 | Intermittent | R&P MDL2300 PM2.5 Seq Spec Quartz | EC1+EC2+EC3-OP | 0.155 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC PM2.5 LC TOR | 88321 | 857 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | EC1+EC2+EC3-OP | 0.093 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC PM2.5 LC TOR | 88321 | 859 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | EC1+EC2+EC3-OP | 0.093 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC PM2.5 LC TOR | 88321 | 877 | Intermittent | URG MASS450 Quartz VSCC | EC1+EC2+EC3-OP | 0.025 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC PM2.5 LC TOT | 88381 | 814 | Intermittent | MET ONE SASS QUARTZ | EC1+EC2+EC3-(OP(TOT))=(88329+88330+88331-88379) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC PM2.5 LC TOT | 88381 | 815 | Intermittent | MET ONE SASS QUARTZ | EC1+EC2+EC3-(OP(TOT))=(88329+88330+88331-88379) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC PM2.5 LC TOT | 88381 | 816 | Intermittent | MET ONE SASS QUARTZ | EC1+EC2+EC3-(OP(TOT))=(88329+88330+88331-88379) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC PM2.5 LC TOT | 88381 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | EC1+EC2+EC3-(OP(TOT))=(88329+88330+88331-88379) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC PM2.5 LC TOT | 88381 | 850 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | EC1+EC2+EC3-(OP(TOT))=(88329+88330+88331-88379)) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC1 CSN_Rev Unadjusted PM2.5 LC | 88383 | 816 | Intermittent | Met One SASS/SuperSASS Quartz | IMPROVE_A | 0.03 | 3 | Micrograms/cubic meter (LC) | ||||||
| EC1 CSN_Rev Unadjusted PM2.5 LC | 88383 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE_A | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| EC1 CSN_Rev Unadjusted PM2.5 LC | 88383 | 841 | Intermittent | URG 3000N w/Pall Quartz filter adn Cyclone Inlet | IMPROVE_A | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| EC1 CSN_Rev Unadjusted PM2.5 LC | 88383 | 843 | Intermittent | Met One SASS 22 LPM Quartz | IMPROVE_A | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| EC1 CSN_Rev Unadjusted PM2.5 LC | 88383 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| EC1 CSN_Rev Unadjusted PM2.5 LC | 88383 | 892 | Intermittent | Model 2025 PM2.5 Sequential Quartz VSCC | IMPROVE_A | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| EC1 CSN_rev Unadjusted PM10 LC | 85383 | 888 | Intermittent | Model 2025 PM10 Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| EC1 CSN_rev Unadjusted PM10-2.5 LC | 86383 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| EC1 PM2.5 LC | 88329 | 145 | Intermittent | RP Partisol Model 2000 PM2.5 FRM Air Sampler-# | IMPROVE TOR | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC1 PM2.5 LC | 88329 | 804 | Intermittent | IMPROVE | IMPROVE TOR | 0.013 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC1 PM2.5 LC | 88329 | 809 | Intermittent | IMPROVE Module C with Cyclone Inlet-Quartz Filter | IMPROVE TOR | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC1 PM2.5 LC | 88329 | 814 | Intermittent | Met One SASS Quartz | IMPROVE TOR | 0.147 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC1 PM2.5 LC | 88329 | 816 | Intermittent | Met One SASS/SuperSASS Quartz | IMPROVE_A TOR | 0.002 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC1 PM2.5 LC | 88329 | 824 | Intermittent | Andersen RAAS Quartz | IMPROVE TOR | 0.134 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC1 PM2.5 LC | 88329 | 836 | Intermittent | URG MASS450 Quartz WINS | IMPROVE TOR | 0.059 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC1 PM2.5 LC | 88329 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE TOR | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC1 PM2.5 LC | 88329 | 841 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC1 PM2.5 LC | 88329 | 846 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE_A w/CSN urban adjustment | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC1 PM2.5 LC | 88329 | 854 | Intermittent | R&P MDL2300 PM2.5 Seq Spec Quartz | IMPROVE TOR | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC1 PM2.5 LC | 88329 | 856 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | IMPROVE TOR | 0.059 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC1 PM2.5 LC | 88329 | 858 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | IMPROVE TOR | 0.059 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC1 PM2.5 LC | 88329 | 876 | Intermittent | URG MASS450 Quartz VSCC | IMPROVE TOR | 0.059 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC1 PM2.5 LC | 88329 | 899 | Intermittent | No Method-None | IMPROVE TOR | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC2 CSN_Rev Unadjusted PM2.5 LC | 88384 | 816 | Intermittent | Met One SASS/SuperSASS Quartz | IMPROVE_A | 0.03 | 3 | Micrograms/cubic meter (LC) | ||||||
| EC2 CSN_Rev Unadjusted PM2.5 LC | 88384 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE_A | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| EC2 CSN_Rev Unadjusted PM2.5 LC | 88384 | 841 | Intermittent | URG 3000N w/Pall Quartz filter adn Cyclone Inlet | IMPROVE_A | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| EC2 CSN_Rev Unadjusted PM2.5 LC | 88384 | 843 | Intermittent | Met One SASS 22 LPM Quartz | IMPROVE_A | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| EC2 CSN_Rev Unadjusted PM2.5 LC | 88384 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| EC2 CSN_Rev Unadjusted PM2.5 LC | 88384 | 892 | Intermittent | Model 2025 PM2.5 Sequential Quartz VSCC | IMPROVE_A | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| EC2 CSN_rev Unadjusted PM10 LC | 85384 | 888 | Intermittent | Model 2025 PM10 Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| EC2 CSN_rev Unadjusted PM10-2.5 LC | 86384 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| EC2 PM2.5 LC | 88330 | 145 | Intermittent | RP Partisol Model 2000 PM2.5 FRM Air Sampler-# | IMPROVE TOR | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC2 PM2.5 LC | 88330 | 804 | Intermittent | IMPROVE | IMPROVE TOR | 0.016 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC2 PM2.5 LC | 88330 | 809 | Intermittent | IMPROVE Module C with Cyclone Inlet-Quartz Filter | IMPROVE TOR | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC2 PM2.5 LC | 88330 | 814 | Intermittent | Met One SASS Quartz | IMPROVE TOR | 0.184 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC2 PM2.5 LC | 88330 | 816 | Intermittent | Met One SASS/SuperSASS Quartz | IMPROVE_A TOR | 0.002 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC2 PM2.5 LC | 88330 | 824 | Intermittent | Andersen RAAS Quartz | IMPROVE TOR | 0.168 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC2 PM2.5 LC | 88330 | 836 | Intermittent | URG MASS450 Quartz WINS | IMPROVE TOR | 0.074 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC2 PM2.5 LC | 88330 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE TOR | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC2 PM2.5 LC | 88330 | 841 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC2 PM2.5 LC | 88330 | 846 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE_A w/CSN urban adjustment | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC2 PM2.5 LC | 88330 | 854 | Intermittent | R&P MDL2300 PM2.5 Seq Spec Quartz | IMPROVE TOR | 0.123 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC2 PM2.5 LC | 88330 | 856 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | IMPROVE TOR | 0.074 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC2 PM2.5 LC | 88330 | 858 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | IMPROVE TOR | 0.074 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC2 PM2.5 LC | 88330 | 876 | Intermittent | URG MASS450 Quartz VSCC | IMPROVE TOR | 0.074 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC2 PM2.5 LC | 88330 | 899 | Intermittent | No Method-None | IMPROVE TOR | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC3 CSN_Rev Unadjusted PM2.5 LC | 88385 | 816 | Intermittent | Met One SASS/SuperSASS Quartz | IMPROVE_A | 0.03 | 3 | Micrograms/cubic meter (LC) | ||||||
| EC3 CSN_Rev Unadjusted PM2.5 LC | 88385 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE_A | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| EC3 CSN_Rev Unadjusted PM2.5 LC | 88385 | 841 | Intermittent | URG 3000N w/Pall Quartz filter adn Cyclone Inlet | IMPROVE_A | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| EC3 CSN_Rev Unadjusted PM2.5 LC | 88385 | 843 | Intermittent | Met One SASS 22 LPM Quartz | IMPROVE_A | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| EC3 CSN_Rev Unadjusted PM2.5 LC | 88385 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| EC3 CSN_Rev Unadjusted PM2.5 LC | 88385 | 892 | Intermittent | Model 2025 PM2.5 Sequential Quartz VSCC | IMPROVE_A | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| EC3 CSN_rev Unadjusted PM10 LC | 85385 | 888 | Intermittent | Model 2025 PM10 Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| EC3 CSN_rev Unadjusted PM10-2.5 LC | 86385 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| EC3 PM2.5 LC | 88331 | 145 | Intermittent | RP Partisol Model 2000 PM2.5 FRM Air Sampler-# | IMPROVE TOR | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC3 PM2.5 LC | 88331 | 804 | Intermittent | IMPROVE | IMPROVE TOR | 0.005 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC3 PM2.5 LC | 88331 | 809 | Intermittent | IMPROVE Module C with Cyclone Inlet-Quartz Filter | IMPROVE TOR | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC3 PM2.5 LC | 88331 | 814 | Intermittent | Met One SASS Quartz | IMPROVE TOR | 0.061 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC3 PM2.5 LC | 88331 | 816 | Intermittent | Met One SASS/SuperSASS Quartz | IMPROVE_A TOR | 0.002 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC3 PM2.5 LC | 88331 | 824 | Intermittent | Andersen RAAS Quartz | IMPROVE TOR | 0.056 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC3 PM2.5 LC | 88331 | 836 | Intermittent | URG MASS450 Quartz WINS | IMPROVE TOR | 0.025 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC3 PM2.5 LC | 88331 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE TOR | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC3 PM2.5 LC | 88331 | 841 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC3 PM2.5 LC | 88331 | 846 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE_A w/CSN urban adjustment | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EC3 PM2.5 LC | 88331 | 854 | Intermittent | R&P MDL2300 PM2.5 Seq Spec Quartz | IMPROVE TOR | 0.041 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC3 PM2.5 LC | 88331 | 856 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | IMPROVE TOR | 0.025 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC3 PM2.5 LC | 88331 | 858 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | IMPROVE TOR | 0.025 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC3 PM2.5 LC | 88331 | 876 | Intermittent | URG MASS450 Quartz VSCC | IMPROVE TOR | 0.025 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EC3 PM2.5 LC | 88331 | 899 | Intermittent | No Method-None | IMPROVE TOR | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| EH IMPROVE PM2.5 LC | 88323 | 804 | Intermittent | IMPROVE | Thermal Optical Reflectance | 0.013 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EH IMPROVE PM2.5 LC | 88323 | 814 | Intermittent | Met One SASS Quartz | Thermal Optical Reflectance | 0.147 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EH IMPROVE PM2.5 LC | 88323 | 824 | Intermittent | Andersen RAAS Quartz | Thermal Optical Reflectance | 0.134 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EH IMPROVE PM2.5 LC | 88323 | 836 | Intermittent | URG MASS450 Quartz WINS | Thermal Optical Reflectance | 0.059 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EH IMPROVE PM2.5 LC | 88323 | 854 | Intermittent | R&P MDL2300 PM2.5 Seq Spec Quartz | Thermal Optical Reflectance | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EH IMPROVE PM2.5 LC | 88323 | 856 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | Thermal Optical Reflectance | 0.059 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EH IMPROVE PM2.5 LC | 88323 | 858 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | Thermal Optical Reflectance | 0.059 | 2 | R | Micrograms/cubic meter (LC) | |||||
| EH IMPROVE PM2.5 LC | 88323 | 876 | Intermittent | URG MASS450 Quartz VSCC | Thermal Optical Reflectance | 0.059 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Elapsed Sample Time | 68109 | 116 | Intermittent | BGI Model PQ200 PM2.5 Sampler | Calculation | 480.0 | 480.0 | 1500.0 | 0 | R | Minutes | |||
| Elapsed Sample Time | 68109 | 117 | Intermittent | R & P Model 2000 PM2.5 Sampler | Calculation | 480.0 | 480.0 | 1500.0 | 0 | R | Minutes | |||
| Elapsed Sample Time | 68109 | 118 | Intermittent | R & P Model 2025 PM2.5 Sequent | Calculation | 200.0 | 200.0 | 1500.0 | 0 | R | Minutes | |||
| Elapsed Sample Time | 68109 | 119 | Intermittent | Anderson RAAS2.5-100 Sampler | Calculation | 480.0 | 480.0 | 1500.0 | 0 | R | Minutes | |||
| Elapsed Sample Time | 68109 | 120 | Intermittent | Anderson RAAS2.5-300 PM2.5 Seq | Calculation | 480.0 | 480.0 | 1500.0 | 0 | R | Minutes | |||
| Elapsed Sample Time | 68109 | 123 | Intermittent | Thermo Env Model 605 CAPS | Calculation | 480.0 | 480.0 | 1500.0 | 0 | R | Minutes | |||
| Elapsed Sample Time | 68109 | 126 | Intermittent | R - P Co Partisol Model 2000 | Calculation | 480.0 | 480.0 | 1500.0 | 0 | R | Minutes | |||
| Elapsed Sample Time | 68109 | 127 | Intermittent | R - P Co Partisol Model 2025 | Calculation | 480.0 | 480.0 | 1500.0 | 0 | R | Minutes | |||
| Elapsed Sample Time | 68109 | 128 | Intermittent | Andersen RAAS2.5-200 PM2.5 Aud | Calculation | 480.0 | 480.0 | 1500.0 | 0 | R | Minutes | |||
| Elapsed Sample Time | 68109 | 129 | Intermittent | R&P CO Model 2000 PM-2.5 Audit | Calculation | 480.0 | 480.0 | 1500.0 | 0 | R | Minutes | |||
| Elapsed Sample Time | 68109 | 135 | Intermittent | URG-MASS100 Single PM2.5 Sampler | Calculation | 480.0 | 480.0 | 1500.0 | 0 | R | Minutes | |||
| Elapsed Sample Time | 68109 | 136 | Intermittent | URG-MASS300 Sequential PM2.5 Sampler | Calculation | 480.0 | 480.0 | 1500.0 | 0 | R | Minutes | |||
| Elapsed Sample Time | 68109 | 142 | Intermittent | BGI Models PQ200-VSCC or PQ200A-VSCC | Calculation | 480.0 | 480.0 | 1500.0 | 0 | R | Minutes | |||
| Elapsed Sample Time | 68109 | 143 | Intermittent | R & P Model 2000 PM-2.5 FEM Air Sampler | Calculation | 480.0 | 480.0 | 1500.0 | 0 | R | Minutes | |||
| Elapsed Sample Time | 68109 | 144 | Intermittent | R & P Model 2000 PM-2.5 FEM Audit Sampler | Calculation | 480.0 | 480.0 | 1500.0 | 0 | R | Minutes | |||
| Elapsed Sample Time | 68109 | 145 | Intermittent | R & P Model 2025 PM-2.5 FEM Sequential AIr Sampler | Calculation | 480.0 | 480.0 | 1500.0 | 0 | R | Minutes | |||
| Elapsed Sample Time | 68109 | 153 | Intermittent | Thermo Electron Model RAAS2.5-100 w/VSCC | Calculation | 480.0 | 480.0 | 1500.0 | 0 | R | Minutes | |||
| Elapsed Sample Time | 68109 | 154 | Intermittent | Thermo Electron Model RAAS2.5-200 Audit w/VSCC | Calculation | 480.0 | 480.0 | 1500.0 | 0 | R | Minutes | |||
| Elapsed Sample Time | 68109 | 155 | Intermittent | Thermo Electron Model RAAS2.5-300 Sequential w/VSCC | Calculation | 480.0 | 480.0 | 1500.0 | 0 | R | Minutes | |||
| Elapsed Sample Time | 68109 | 545 | Intermittent | Met One E-SEQ-FRM with VSCC | Calculation | 480.0 | 480.0 | 1500.0 | 0 | R | Minutes | |||
| Elapsed Sample Time | 68109 | 780 | Continuous | INSTRUMENTAL | CALCULATION | 480.0 | 480.0 | 1500.0 | 0 | R | Minutes | |||
| Elapsed Sample Time | 68109 | 850 | Intermittent | R&P MDL2300 PM2.5 SEQ SPEC | CALCULATION | 480.0 | 480.0 | 1500.0 | 0 | R | Minutes | |||
| Elapsed Sample Time | 68109 | 901 | Intermittent | BGI Inc. frmOMNI | CALCULATION | 480.0 | 480.0 | 1500.0 | 0 | R | Minutes | |||
| Elemental Carbon Extinction PM2.5 LC | 88343 | 899 | Intermittent | Unknown-Unknown | # | 0.002 | 3 | Inverse Megameters | ||||||
| Elemental Carbon PM10 STP | 82307 | 108 | Intermittent | Hi Vol SA/GMW-1200 | TOR (DRI Thermal-optical reflectance) | 1.0 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Elemental Carbon PM10 STP | 82307 | 111 | Intermittent | Hi Vol SA/GMW-1200 | Thermal Optical Transmittance | 1.0 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Endosulfan | 43157 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Endosulfan 1 (alpha) | 43175 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | -0.5 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Endosulfan 2 | 43163 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Endosulfan 2 | 43163 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | -0.5 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Endosulfan sulfate | 43168 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Endosulfan sulfate | 43168 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | -0.5 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Endrin | 43164 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Endrin | 43164 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | -0.5 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Endrin aldehyde | 43161 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Endrin aldehyde | 43161 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | -0.5 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Endrin ketone | 43152 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Endrin ketone | 43152 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | -0.5 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Epichlorohydrin | 43607 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Epichlorohydrin(DUP) | 16901 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | 0.0 | 3 | Parts per billion | |||||
| Ethane | 43202 | 091 | Intermittent | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethane | 43202 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethane | 43202 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethane | 43202 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethane | 43202 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Ethane | 43202 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| Ethane | 43202 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethane | 43202 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethane | 43202 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Ethane | 43202 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethane | 43202 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethane | 43202 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethane | 43202 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| Ethane | 43202 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.31806 | -0.31806 | 4 | R | Parts per billion Carbon | ||||
| Ethane | 43202 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethane | 43202 | 148 | Intermittent | 6L Pressurized Canister | Entech Precon - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethane | 43202 | 149 | Intermittent | 6L Subatm Canister | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethane | 43202 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethane | 43202 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethane | 43202 | 174 | Continuous | Passivated Canister | Cryogenic Preconcentration GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethane | 43202 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethane | 43202 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethane | 43202 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethane | 43202 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethane | 43202 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethane | 43202 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethane | 43202 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethane | 43202 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethane | 43202 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethane | 43202 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethane | 43202 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethane | 43202 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethane | 43202 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethane & acetylene | 43599 | 120 | Intermittent | SORBANT TUBE CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethane & acetylene | 43599 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethane & acetylene | 43599 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethyl acetate | 43209 | 101 | Intermittent | Canister Subambient Pressure | Multi Detector GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethyl acetate | 43209 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethyl acetate | 43209 | 113 | Intermittent | SS-Canister_Pressurized | Capillary GC ITD Mass Spectro | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Ethyl acetate | 43209 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 29.4 | -29.4 | 1 | R | Parts per billion Carbon | ||||
| Ethyl acetate | 43209 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethyl acetate | 43209 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethyl acetate | 43209 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 5.85 | -5.85 | 2 | R | Parts per billion Carbon | ||||
| Ethyl acetate | 43209 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethyl acetate | 43209 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethyl acetate | 43209 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON:GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethyl acetate | 43209 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethyl acetate | 43209 | 176 | Intermittent | 6L Subatm SS Canister | Entech Precon GC/MS | 0.044 | -0.044 | 3 | R | Parts per billion Carbon | ||||
| Ethyl acetate | 43209 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.04 | -0.04 | 3 | R | Parts per billion Carbon | ||||
| Ethyl acetate | 43209 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl acetate | 43209 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl acetate | 43209 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl acetate | 43209 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl acetate | 43209 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl acetate | 43209 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl acetate | 43209 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl acetate | 43209 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl acetate | 43209 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl acetate | 43209 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl acetate | 43209 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl acetate | 43209 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl acrylate | 43438 | 101 | Intermittent | Canister Subambient Pressure | Multi Detector GC | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Ethyl acrylate | 43438 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethyl acrylate | 43438 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Ethyl acrylate | 43438 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.5 | -0.5 | 1 | R | Parts per billion Carbon | ||||
| Ethyl acrylate | 43438 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethyl acrylate | 43438 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethyl acrylate | 43438 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Ethyl acrylate | 43438 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | Entech Precon- GC/FID/MSD | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Ethyl acrylate | 43438 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.5 | -0.5 | 2 | R | Parts per billion Carbon | ||||
| Ethyl acrylate | 43438 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl acrylate | 43438 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl acrylate | 43438 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl acrylate | 43438 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl acrylate | 43438 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl acrylate | 43438 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl acrylate | 43438 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl acrylate | 43438 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl acrylate | 43438 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl acrylate | 43438 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl acrylate | 43438 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl acrylate | 43438 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl alcohol | 43302 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethyl alcohol | 43302 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethyl alcohol | 43302 | 113 | Intermittent | SS-Canister_Pressurized | Capillary GC ITD Mass Spectro | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Ethyl alcohol | 43302 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 29.4 | -29.4 | 1 | R | Parts per billion Carbon | ||||
| Ethyl alcohol | 43302 | 126 | Intermittent | SS Canister Pressurized | Cryogenic Preconcentration GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethyl alcohol | 43302 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethyl alcohol | 43302 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethyl alcohol | 43302 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| Ethyl alcohol | 43302 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethyl alcohol | 43302 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethyl alcohol | 43302 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethyl alcohol | 43302 | 150 | Intermittent | SS 6L - PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethyl alcohol | 43302 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Ethyl alcohol | 43302 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethyl alcohol | 43302 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethyl alcohol | 43302 | 176 | Intermittent | 6L Subatm SS Canister | Entech Precon GC/MS | 0.12 | -0.12 | 2 | R | Parts per billion Carbon | ||||
| Ethyl alcohol | 43302 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.462 | -0.462 | 3 | R | Parts per billion Carbon | ||||
| Ethyl alcohol | 43302 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl alcohol | 43302 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl alcohol | 43302 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl alcohol | 43302 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl alcohol | 43302 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl alcohol | 43302 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl alcohol | 43302 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl alcohol | 43302 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl alcohol | 43302 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl alcohol | 43302 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl alcohol | 43302 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl alcohol | 43302 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyl bromide | 43862 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethyl methacrylate | 43442 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethyl methacrylate | 43442 | 176 | Intermittent | 6L SUBATM SS CANISTER | Entech Precon GC/MS | 0.24 | -0.24 | 2 | R | Parts per billion Carbon | ||||
| Ethyl methanesulfonate (TSP) STP | 16781 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 35.4 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Ethylbenzene | 45203 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 16.0 | -16.0 | 0 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 092 | Continuous | Tenax/GR/Trap | Thermal Desorber GC/PID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 1.84 | -1.84 | 1 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 104 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-FID | 0.8 | -0.8 | 1 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 1.6 | -1.6 | 1 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.8 | -0.8 | 2 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 111 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-FID | 1.6 | -1.6 | 1 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 115 | Intermittent | TENAX TRAP AC PUMP | HEAT DESORPTION GC MASS SPEC | 0.8 | -0.8 | 1 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 117 | Intermittent | TENAX SORBENT CARTRIDGE | GC/MS | 1.6 | -1.6 | 2 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 119 | Intermittent | PERSONAL PUMP MOLECULAR SIEVE | GC/MS | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 134 | Continuous | Semi-Continuous Analyzer | GC/PID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.56 | -0.56 | 2 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.9744 | -0.9744 | 4 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 144 | Intermittent | 3 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.66 | -0.66 | 2 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 151 | Intermittent | 6L PRESSURIZED CANISTER | CAPILLARY GC-ECD/PID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 168 | Intermittent | 6L PRESSURIZED CANISTER | PACKED COLUMN GC - ECD/PID | 4.8 | -4.8 | 2 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 169 | Intermittent | TEDLAR BAG | PACKED COLUMN GC - ECD/PID | 4.8 | -4.8 | 2 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.24 | -0.24 | 2 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.16 | -0.16 | 3 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.88 | -0.88 | 2 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylbenzene | 45203 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylbenzene | 45203 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylbenzene | 45203 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylbenzene | 45203 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylbenzene | 45203 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylbenzene | 45203 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylbenzene | 45203 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylbenzene | 45203 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylbenzene | 45203 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylbenzene | 45203 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylbenzene | 45203 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylbenzene | 45203 | 903 | Intermittent | SKC Pump Charcoal Tube | GC/FID NIOSH 1501 | 4.14 | -4.14 | 2 | R | Parts per billion Carbon | ||||
| Ethylbenzene | 45203 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.96 | -0.96 | 2 | R | Parts per billion Carbon | ||||
| Ethylcyclohexane | 43296 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylcyclohexane | 43296 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylcyclohexane | 43296 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylcyclohexane | 43296 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylcyclohexane | 43296 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylcyclohexane | 43296 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylcyclohexane | 43296 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylcyclohexane | 43296 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylcyclohexane | 43296 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylcyclohexane | 43296 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylcyclohexane | 43296 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylcyclohexane | 43296 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylcyclohexane | 43296 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylcyclohexane | 43296 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene | 43203 | 011 | Continuous | INSTRUMENTAL | FLAME IONIZATION | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethylene | 43203 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylene | 43203 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylene | 43203 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME: GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylene | 43203 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylene | 43203 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Ethylene | 43203 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| Ethylene | 43203 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethylene | 43203 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylene | 43203 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Ethylene | 43203 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylene | 43203 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylene | 43203 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylene | 43203 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| Ethylene | 43203 | 141 | Continuous | IR Spectrometer | Spectra reference matching with PLS | 1.2 | -1.2 | 1 | R | Parts per billion Carbon | ||||
| Ethylene | 43203 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.11658 | -0.11658 | 4 | R | Parts per billion Carbon | ||||
| Ethylene | 43203 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylene | 43203 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylene | 43203 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylene | 43203 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylene | 43203 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylene | 43203 | 174 | Continuous | Passivated Canister | Cryogenic Preconcentration GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethylene | 43203 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylene | 43203 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene | 43203 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene | 43203 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene | 43203 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene | 43203 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene | 43203 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene | 43203 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene | 43203 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene | 43203 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene | 43203 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene | 43203 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene | 43203 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene & acetylene | 43126 | 126 | Intermittent | SS Canister Pressurized | Cryogenic Preconcentration GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 107 | Intermittent | TEDLAR-BAG-24-HR-SAMPLE | GC - ELECTRON CAPTURE DETECTOR | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 1.0 | -1.0 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.033 | -0.033 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.49 | -0.49 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.4 | -0.4 | 1 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 151 | Intermittent | 6L PRESSURIZED CANISTER | CAPILLARY GC-ECD/PID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 168 | Intermittent | 6L PRESSURIZED CANISTER | PACKED COLUMN GC - ECD/PID | 1.0 | -1.0 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 169 | Intermittent | TEDLAR BAG | PACKED COLUMN GC - ECD/PID | 1.0 | -1.0 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.04 | -0.04 | 3 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.18 | -0.18 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dibromide | 43843 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dibromide | 43843 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dibromide | 43843 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dibromide | 43843 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dibromide | 43843 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dibromide | 43843 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dibromide | 43843 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dibromide | 43843 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dibromide | 43843 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dibromide | 43843 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dibromide | 43843 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dibromide | 43843 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dichloride | 43815 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 4.0 | -4.0 | 0 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.02 | -0.02 | 1 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 105 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 107 | Intermittent | TEDLAR-BAG-24-HR-SAMPLE | GC - ELECTRON CAPTURE DETECTOR | 0.4 | -0.4 | 3 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.08 | -0.08 | 3 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 117 | Intermittent | TENAX SORBENT CARTRIDGE | GC/MS | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 119 | Intermittent | PERSONAL PUMP MOLECULAR SIEVE | GC/MS | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.033 | -0.033 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 3 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.52 | -0.52 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 151 | Intermittent | 6L PRESSURIZED CANISTER | CAPILLARY GC-ECD/PID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 168 | Intermittent | 6L PRESSURIZED CANISTER | PACKED COLUMN GC - ECD/PID | 1.0 | -1.0 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 169 | Intermittent | TEDLAR BAG | PACKED COLUMN GC - ECD/PID | 1.0 | -1.0 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.04 | -0.04 | 3 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.22 | -0.22 | 2 | R | Parts per billion Carbon | ||||
| Ethylene dichloride | 43815 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dichloride | 43815 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dichloride | 43815 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dichloride | 43815 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dichloride | 43815 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dichloride | 43815 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dichloride | 43815 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dichloride | 43815 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dichloride | 43815 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dichloride | 43815 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dichloride | 43815 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dichloride | 43815 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene dichloride | 43815 | 901 | Intermittent | SKC Pump Charcoal Tube | GC/FID NIOSH 1003 | 1.71 | -1.71 | 2 | R | Parts per billion Carbon | ||||
| Ethylene oxide | 43601 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 1.2 | -1.2 | 1 | R | Parts per billion Carbon | ||||
| Ethylene oxide | 43601 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethylene oxide | 43601 | 149 | Intermittent | 6L SUBATM SS CANISTER | PRECONC: GC/MS | 0.12 | -0.12 | 2 | R | Parts per billion Carbon | ||||
| Ethylene oxide | 43601 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | PRECONC: GC/MS | 0.12 | -0.12 | 2 | R | Parts per billion Carbon | ||||
| Ethylene oxide | 43601 | 172 | Intermittent | SS 6L - PRESSURIZED CANISTER | PRECONC: GC/MS | 0.12 | -0.12 | 2 | R | Parts per billion Carbon | ||||
| Ethylene oxide | 43601 | 176 | Intermittent | 6L SUBATM SS CANISTER | PRECONC: GC/MS | 0.12 | -0.12 | 2 | R | Parts per billion Carbon | ||||
| Ethylene oxide | 43601 | 186 | Continuous | UNKNOWN | UNKNOWN | 0.001 | -0.001 | 2 | R | Parts per billion Carbon | ||||
| Ethylene oxide | 43601 | 211 | Intermittent | 6L SUBATM SS CANISTER | PRECONC: GC/MS | 0.12 | -0.12 | 2 | R | Parts per billion Carbon | ||||
| Ethylene oxide | 43601 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene oxide | 43601 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene oxide | 43601 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene oxide | 43601 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene oxide | 43601 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene oxide | 43601 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene oxide | 43601 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene oxide | 43601 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene oxide | 43601 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene oxide | 43601 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene oxide | 43601 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethylene oxide | 43601 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Ethyne & isobutane | 43340 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Ethyne & isobutane | 43340 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Europium (TSP) STP | 12121 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Europium (TSP) STP | 12121 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Europium PM2.5 LC | 88121 | 811 | Intermittent | Met One SASS Teflon | Energy Dispersive XRF | 0.01124 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Europium PM2.5 LC | 88121 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00451 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Europium PM2.5 LC | 88121 | 831 | Intermittent | URG MASS400 TeflonWINS | Energy Dispersive XRF | 0.00451 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Europium PM2.5 LC | 88121 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00451 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Europium PM2.5 LC | 88121 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00451 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Europium PM2.5 LC | 88121 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00451 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Europium PM2.5 LC | 88121 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00451 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Fluoranthene (TSP) STP | 17201 | 092 | Intermittent | HI-VOL | THIN LAYER CHROMATOGRAPHY | 0.2 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Fluoranthene (TSP) STP | 17201 | 101 | Intermittent | HI-VOL/PUF-XAD | GC-MS-SIM | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Fluoranthene (TSP) STP | 17201 | 102 | Intermittent | HI-VOL/PUF CARTRIDGE | TO-13- EPA610- EPA625 | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Fluoranthene (TSP) STP | 17201 | 103 | Intermittent | Hi-Vol/PUF Cartridge | Micro Wave Extraction GC/MS | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Fluoranthene (TSP) STP | 17201 | 104 | Intermittent | Hi-Vol/PUF Cartridge | Accelerated solvent extraction GC-MS | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Fluoranthene (TSP) STP | 17201 | 105 | Intermittent | Hi Vol/PUF | GC/MS TO-13A | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Fluoranthene (TSP) STP | 17201 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Fluoranthene (TSP) STP | 17201 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 19.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Fluoranthene (TSP) STP | 17201 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00016 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Fluoranthene (TSP) STP | 17201 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.0466 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| Fluoranthene (TSP) STP | 17201 | 119 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS-SIM Modified TO-13A | 0.0466 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| Fluoranthene (TSP) STP | 17201 | 904 | Intermittent | SKC Pump XAD-2 SORBENT Tube | HPLC Fluorescence/UV NIOSH 5506 | 350.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Fluoranthene (TSP) STP | 17201 | 909 | Intermittent | SKC Pump XAD-2 SORBENT Tube | GC/MS NIOSH 5515 REAC SOP 1817 | 4240.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Fluorene (TSP) STP | 17149 | 101 | Intermittent | HI-VOL/PUF-XAD | GC-MS-SIM | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Fluorene (TSP) STP | 17149 | 102 | Intermittent | HI-VOL/PUF CARTRIDGE | TO-13- EPA610- EPA625 | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Fluorene (TSP) STP | 17149 | 103 | Intermittent | Hi-Vol/PUF Cartridge | Micro Wave Extraction GC/MS | 0.27 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Fluorene (TSP) STP | 17149 | 104 | Intermittent | Hi-Vol/PUF Cartridge | Accelerated solvent extraction GC-MS | 0.37 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Fluorene (TSP) STP | 17149 | 105 | Intermittent | Hi Vol/PUF | GC/MS TO-13A | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Fluorene (TSP) STP | 17149 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Fluorene (TSP) STP | 17149 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 21.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Fluorene (TSP) STP | 17149 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00014 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Fluorene (TSP) STP | 17149 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.0554 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| Fluorene (TSP) STP | 17149 | 119 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS-SIM Modified TO-13A | 0.0554 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| Fluorene (TSP) STP | 17149 | 904 | Intermittent | SKC Pump XAD-2 SORBENT Tube | HPLC Fluorescence/UV NIOSH 5506 | 350.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Fluorene (TSP) STP | 17149 | 909 | Intermittent | SKC Pump XAD-2 SORBENT Tube | GC/MS NIOSH 5515 REAC SOP 1817 | 4240.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Fluoride (TSP) STP | 12202 | 071 | Intermittent | HI-VOL | SAN FRANCISCO AREA METHOD | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Fluoride (TSP) STP | 12202 | 091 | Intermittent | HI-VOL | WILLARD-WINTER / SPECIFIC ION | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Fluoride (TSP) STP | 12202 | 096 | Intermittent | HI-VOL | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.08 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Fluoride (paper samplers) | 12209 | 081 | Intermittent | CALCIUM-PAPER | WILLARD-WINTER / SPADNS | 0.01 | 0.0 | 2 | R | Ug/sq cm/30 days | ||||
| Fluoride (paper samplers) | 12209 | 082 | Intermittent | CALCIUM-PAPER | WILLARD-WINTER / SECIFIC ION | 0.01 | 0.0 | 2 | R | Ug/sq cm/30 days | ||||
| Fluoride (paper samplers) | 12209 | 083 | Intermittent | CALCIUM-PAPER | AUTO-ANALYZER / COLORIMETRIC | 0.01 | 0.0 | 2 | R | Ug/sq cm/30 days | ||||
| Fluoride (paper samplers) | 12209 | 084 | Intermittent | SODIUM-PAPER | SPECIFIC ION | 0.01 | 0.0 | 2 | R | Ug/sq cm/30 days | ||||
| Fluoride (paper samplers) | 12209 | 088 | Intermittent | CARBONATE-PLATE | SPECIFIC ION ELECTRODE | 0.1 | 0.0 | 2 | R | Ug/sq cm/30 days | ||||
| Fluoride (paper samplers) | 12209 | 093 | Intermittent | CALCIUM-PAPER | SPECIFIC ION ELECTRODE | 0.05 | 0.0 | 2 | R | Ug/sq cm/30 days | ||||
| Fluoride (precip) | 65315 | 081 | Intermittent | PRECIP | SPECIFIC ION ELECTRODE | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Fluoride (precip) | 65315 | 083 | Intermittent | PRECIP | COLORIMETRIC WITH ALTMARINE | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Fluoride (vegation) | 12208 | 085 | Intermittent | VEGETATION | WILLARD-WINTER / SPADNS | 0.1 | 0.0 | 1 | R | Parts per million | ||||
| Fluoride (vegation) | 12208 | 086 | Intermittent | VEGETATION | WILLARD-WINTER / SPECIFIC ION | 0.1 | 0.0 | 1 | R | Parts per million | ||||
| Fluoride (vegation) | 12208 | 087 | Intermittent | VEGETATION | AUTO-ANALYZER / COLORIMETRIC | 0.01 | 0.0 | 2 | R | Parts per million | ||||
| Fluoride PM10 STP | 82202 | 092 | Intermittent | HI-VOL-SA/GMW-321-B | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.08 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Fluoride PM10 STP | 82202 | 102 | Intermittent | HI-VOL-SA/GMW1200 | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.08 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Fluoride ion | 42513 | 011 | Continuous | INSTRUMENTAL | COLORIMETRIC | 0.02 | -0.02 | 2 | R | Parts per billion | ||||
| Fluoride ion | 42513 | 012 | Continuous | INSTRUMENTAL | SPECIFIC ION ELECTRODE | 0.5 | -0.5 | 1 | R | Parts per billion | ||||
| Fluoride ion | 42513 | 013 | Continuous | TAPE-SAMPLER | SPECIFIC ION ELECTRODE | 0.013 | -0.013 | 2 | R | Parts per billion | ||||
| Fluoride ion | 42513 | 091 | Intermittent | GAS-BUBBLER | SPECIFIC ION ELECTRODE | 2.6 | -2.6 | 1 | R | Parts per billion | ||||
| Fluoride ion | 42513 | 092 | Continuous | AUTO-ANALYZER | COLORIMETRIC | 10.0 | -10.0 | 0 | R | Parts per billion | ||||
| Fluoride ion | 42513 | 093 | Intermittent | GAS-BUBBLER | WILLARD-WINTER TITRIMETRIC | 10.0 | -10.0 | 0 | R | Parts per billion | ||||
| Fluoride ion | 42513 | 094 | Continuous | TAPE-SAMPLER | COLORIMETRIC - ALIZARIAN | 0.01 | -0.01 | 2 | R | Parts per billion | ||||
| Formaldehyde | 43502 | 090 | Intermittent | GAS-BUBBLER | CHROMATROPIC ACID | 0.4 | -0.4 | 1 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 102 | Intermittent | CARTRIDGE-DNPH-ON-SILICA | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 114 | Intermittent | CARTRIDGE-DNPH-SILICA-SEP-PAK | HPLC-PHOTODIODE ARRAY | 0.085 | -0.085 | 2 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE;C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 140 | Continuous | UV Spectrometer with URS methods | Spectra reference matching via PLS | 3.4 | -3.4 | 2 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 141 | Continuous | IR Spectrometer | Spectra reference matching with PLS | 1.6 | -1.6 | 1 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 156 | Intermittent | Cartridge DNPH on Silica, Heated O3 Denuder | HPLC Photo Diode Array | 0.175 | -0.175 | 1 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 157 | Continuous | Instrumental Open Path | UV OPSIS Model AR 500 | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 165 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | HP LC-1050 W/DIODE ARRAY DETECTOR | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 166 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | TO-11 DIONEX DX-300 ION CHRMTGRAPH | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 179 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | Liquid Chromatography w/diode array detection | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Formaldehyde | 43502 | 203 | Intermittent | C18-DNPH-CARTRIDGE | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Freon 113 | 43207 | 101 | Intermittent | Canister Subambient Pressure | Multi Detector GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Freon 113 | 43207 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Freon 113 | 43207 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Freon 113 | 43207 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Freon 113 | 43207 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Freon 113 | 43207 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Freon 113 | 43207 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Freon 113 | 43207 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Freon 113 | 43207 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Freon 113 | 43207 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Freon 113 | 43207 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| Freon 113 | 43207 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.04 | -0.04 | 3 | R | Parts per billion Carbon | ||||
| Freon 113 | 43207 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Freon 114 | 43208 | 101 | Intermittent | Canister Subambient Pressure | Multi Detector GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Freon 114 | 43208 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Freon 114 | 43208 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Freon 114 | 43208 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Freon 114 | 43208 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Freon 114 | 43208 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Freon 114 | 43208 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Freon 114 | 43208 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Freon 114 | 43208 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Freon 114 | 43208 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Freon 114 | 43208 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Freon 114 | 43208 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.34 | -0.34 | 2 | R | Parts per billion Carbon | ||||
| Freon 114 | 43208 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.04 | -0.04 | 3 | R | Parts per billion Carbon | ||||
| Freon 114 | 43208 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.16 | -0.16 | 2 | R | Parts per billion Carbon | ||||
| Freon 114 | 43208 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Freon 114 | 43208 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Freon 114 | 43208 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Freon 114 | 43208 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Freon 114 | 43208 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Freon 114 | 43208 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Freon 114 | 43208 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Freon 114 | 43208 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Freon 114 | 43208 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Freon 114 | 43208 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Freon 114 | 43208 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Freon 114 | 43208 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Freon 23 | 43849 | 102 | Intermittent | CARTRIDGE-DNPH-ON-SILICA | HPLC ULTRAVIOLET ABSORPTION | 1.0 | -1.0 | 2 | R | Parts per billion Carbon | ||||
| Furan, tetrahydro- | 46401 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Furan, tetrahydro- | 46401 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Furan, tetrahydro- | 46401 | 113 | Intermittent | SS-Canister_Pressurized | Capillary GC ITD Mass Spectro | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Furan, tetrahydro- | 46401 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 29.4 | -29.4 | 1 | R | Parts per billion Carbon | ||||
| Furan, tetrahydro- | 46401 | 150 | Intermittent | SS 6L - PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Furan, tetrahydro- | 46401 | 176 | Intermittent | 6L Subatm SS Canister | Entech Precon GC/MS | 0.152 | -0.152 | 2 | R | Parts per billion Carbon | ||||
| Furan, tetrahydro- | 46401 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Furan, tetrahydro- | 46401 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Galactosan PM2.5 LC | 88392 | 902 | Intermittent | Met One SASS Teflon | Liquid Injection Varian GC/MS | 0.02 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Galactosan PM2.5 LC | 88392 | 903 | Intermittent | BGI Model PQ100 PM2.5 Sampler | Liquid Injection Varian GC/MS | 0.01 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Galactosan PM2.5 LC | 88392 | 907 | Intermittent | Met One SASS Teflon | HPLC Charged Aerosol Detector | 0.1 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Galactosan PM2.5 LC | 88392 | 908 | Intermittent | R&P FRM Model 2000(Single) | Liquid Injection Varian GC/MS | 0.01 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Gallium (PM10) | 83130 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 0.005 | 0.0 | 3 | Micrograms/cubic meter (25 C) | |||||
| Gallium (PM10) | 83130 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 0.005 | 0.0 | 3 | Micrograms/cubic meter (25 C) | |||||
| Gallium (PM10) | 83130 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 0.005 | 0.0 | 3 | Micrograms/cubic meter (25 C) | |||||
| Gallium (TSP) LC | 14124 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.108 | 3 | Micrograms/cubic meter (LC) | ||||||
| Gallium (TSP) STP | 12124 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Gallium (TSP) STP | 12124 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Gallium (TSP) STP | 12124 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.048 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Gallium PM10 LC | 85124 | 820 | Continuous | Cooper Environmental Services (CES) XACT 625 | x | 0.108 | 3 | Nanograms/cubic meter (LC) | ||||||
| Gallium PM10 STP | 82124 | 304 | Intermittent | Hi Vol SA/GMW 1200 | X-ray Fluorescence | 5.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Gallium PM10 STP | 82124 | 305 | Intermittent | Hi Vol SA/GMW 321B | X-ray Fluorescence | 5.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Gallium PM10 STP | 82124 | 306 | Intermittent | Hi Vol Wedding Inlet | X-ray Fluorescence | 5.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Gallium PM2.5 LC | 88124 | 811 | Intermittent | Met One SASS Teflon | Energy Dispersive XRF | 0.00331 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Gallium PM2.5 LC | 88124 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 0.108 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Gallium PM2.5 LC | 88124 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00133 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Gallium PM2.5 LC | 88124 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00133 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Gallium PM2.5 LC | 88124 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00133 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Gallium PM2.5 LC | 88124 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00133 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Gallium PM2.5 LC | 88124 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00133 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Gallium PM2.5 LC | 88124 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00133 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Germanium (TSP) LC | 14125 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.121 | 3 | Micrograms/cubic meter (LC) | ||||||
| Germanium (TSP) STP | 12125 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Germanium (TSP) STP | 12125 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Germanium (TSP) STP | 12125 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.045 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Germanium PM10 LC | 85125 | 820 | Continuous | Cooper Environmental Services (CES) XACT 625 | x | 0.121 | 3 | Nanograms/cubic meter (LC) | ||||||
| Germanium PM2.5 LC | 88125 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 0.121 | 3 | Micrograms/cubic meter (LC) | ||||||
| Gold (TSP) LC | 14143 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.23 | 3 | Micrograms/cubic meter (LC) | ||||||
| Gold (TSP) STP | 12143 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Gold (TSP) STP | 12143 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Gold PM10 LC | 85143 | 820 | Continuous | Cooper Environmental Services (CES) XACT 625 | X-ray fluorescence (XRF) | 0.23 | 3 | Nanograms/cubic meter (LC) | ||||||
| Gold PM2.5 LC | 88143 | 811 | Intermittent | Met One SASS Teflon | Energy Dispersive XRF | 0.00501 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Gold PM2.5 LC | 88143 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 0.23 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Gold PM2.5 LC | 88143 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00201 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Gold PM2.5 LC | 88143 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00201 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Gold PM2.5 LC | 88143 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00201 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Gold PM2.5 LC | 88143 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00201 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Gold PM2.5 LC | 88143 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00201 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Gold PM2.5 LC | 88143 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00201 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Guthion | 43154 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Hafnium (TSP) STP | 12127 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Hafnium (TSP) STP | 12127 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Hafnium PM2.5 LC | 88127 | 811 | Intermittent | Met One SASS Teflon | Energy Dispersive XRF | 0.02605 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Hafnium PM2.5 LC | 88127 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.01051 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Hafnium PM2.5 LC | 88127 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.0105 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Hafnium PM2.5 LC | 88127 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.0105 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Hafnium PM2.5 LC | 88127 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.0105 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Hafnium PM2.5 LC | 88127 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.0105 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Hafnium PM2.5 LC | 88127 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.0105 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Halocarbon 134a | 43848 | 102 | Intermittent | CARTRIDGE-DNPH-ON-SILICA | HPLC ULTRAVIOLET ABSORPTION | 2.0 | -2.0 | 2 | R | Parts per billion Carbon | ||||
| Halocarbon 134a | 43848 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Heptachlor | 43170 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Heptachlor | 43170 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | -0.5 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Heptachlor epoxide | 43151 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Heptachlor epoxide | 43151 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | -0.5 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Heptachlorobiphenyl (TSP) STP | 17815 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 2.0 | 0.0 | 0 | R | Pg/cubic meter(25 C) | ||||
| Heptanal | 43950 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Heptanal | 43950 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Heptanal | 43950 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Heptanal | 43950 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Heptanal | 43950 | 156 | Intermittent | Cartridge DNPH on Silica, Heated O3 Denuder | HPLC Photo Diode Array | 0.175 | -0.175 | 2 | R | Parts per billion Carbon | ||||
| Heptanal | 43950 | 165 | Intermittent | ATEC 2400 W/Waters Silica DNPH | HP LC-1050 W/Diode Array Detector | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| Heptanal | 43950 | 166 | Intermittent | ATEC 2400 W/Waters Silica DNPH | TO-11 Dionex DX-300 Ion Chrmtg | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| Heptanal | 43950 | 179 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | Liquid Chromatography w/diode array detection | 0.07 | -0.07 | 2 | R | Parts per billion Carbon | ||||
| Heptanal | 43950 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Heptanal | 43950 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Heptanal | 43950 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Heptanal | 43950 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Heptanal | 43950 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Heptanal | 43950 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Heptanal | 43950 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Heptanal | 43950 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Heptanal | 43950 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Heptanal | 43950 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Heptanal | 43950 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Heptanal | 43950 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Heptane | 43264 | 101 | Intermittent | Canister Subambient Pressure | Multi Detector GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Heptane | 43264 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Heptane | 43264 | 124 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| Heptane | 43264 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Heptane | 43264 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.48 | -0.48 | 2 | R | Parts per billion Carbon | ||||
| Heptane | 43264 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.87 | -0.87 | 2 | R | Parts per billion Carbon | ||||
| Heptane | 43264 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Heptane | 43264 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Heptane | 43264 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Heptane | 43264 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Heptane | 43264 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.24 | -0.24 | 2 | R | Parts per billion Carbon | ||||
| Heptane | 43264 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Heptane | 43264 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Heptane | 43264 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Heptane | 43264 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Heptane | 43264 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Heptane | 43264 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Heptane | 43264 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Heptane | 43264 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Heptane | 43264 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Heptane | 43264 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Heptane | 43264 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Heptane | 43264 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Hexachlorobenzene (TSP) STP | 17804 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 10.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Hexachlorobenzene (TSP) STP | 17804 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 23.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Hexachlorobenzene (TSP) STP | 17804 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00013 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Hexachlorobiphenyl (TSP) STP | 17814 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 2.0 | 0.0 | 0 | R | Pg/cubic meter(25 C) | ||||
| Hexachlorobutadiene | 43844 | 101 | Intermittent | Canister Subambient Pressure | Multi Detector GC | 0.025 | -0.025 | 2 | R | Parts per billion Carbon | ||||
| Hexachlorobutadiene | 43844 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Hexachlorobutadiene | 43844 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.4 | -0.4 | 1 | R | Parts per billion Carbon | ||||
| Hexachlorobutadiene | 43844 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| Hexachlorobutadiene | 43844 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Hexachlorobutadiene | 43844 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Hexachlorobutadiene | 43844 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Hexachlorobutadiene | 43844 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Hexachlorobutadiene | 43844 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Hexachlorobutadiene | 43844 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.025 | -0.025 | 2 | R | Parts per billion Carbon | ||||
| Hexachlorobutadiene | 43844 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Hexachlorobutadiene | 43844 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Hexachlorobutadiene | 43844 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Hexachlorobutadiene | 43844 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.12 | -0.12 | 2 | R | Parts per billion Carbon | ||||
| Hexachlorobutadiene | 43844 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.08 | -0.08 | 3 | R | Parts per billion Carbon | ||||
| Hexachlorobutadiene | 43844 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.6 | -0.6 | 2 | R | Parts per billion Carbon | ||||
| Hexachlorobutadiene | 43844 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Hexachlorobutadiene | 43844 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Hexachlorobutadiene | 43844 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Hexachlorobutadiene | 43844 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Hexachlorobutadiene | 43844 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Hexachlorobutadiene | 43844 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Hexachlorobutadiene | 43844 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Hexachlorobutadiene | 43844 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Hexachlorobutadiene | 43844 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Hexachlorobutadiene | 43844 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Hexachlorobutadiene | 43844 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Hexachlorobutadiene | 43844 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Hexachlorobutadiene (TSP) STP | 16782 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 36.0 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Hexachlorobutadiene (TSP) STP | 16782 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00013 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Hexachlorocyclopentadiene (TSP) STP | 16826 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 51.4 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Hexachloroethane (TSP) STP | 16807 | 110 | Intermittent | SS-Canister-Pressurized | GC/MS | 2.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Hexachloroethane (TSP) STP | 16807 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 25.5 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Hexachloroethane (TSP) STP | 16807 | 176 | Intermittent | 6L SUBATM SS CANISTER | Entech Precon GC/MS | 0.24 | -0.24 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Hexachloropropene (TSP) STP | 16783 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 32.5 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Hexamethylene diisocyanate | 16714 | 180 | Intermittent | Lo-Vol/Glass Fiber Filter | OSHA No. 42 | 0.25 | 3 | Micrograms/cubic meter (LC) | ||||||
| Hexanaldehyde | 43517 | 102 | Intermittent | Cartridge-DNPH-on silica | HPLC Ultraviolet Absorption | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Hexanaldehyde | 43517 | 114 | Intermittent | CARTRIDGE-DNPH-SILICA-SEP-PAK | HPLC-PHOTODIODE ARRAY | 0.085 | -0.085 | 2 | R | Parts per billion Carbon | ||||
| Hexanaldehyde | 43517 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Hexanaldehyde | 43517 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Hexanaldehyde | 43517 | 130 | Intermittent | DNPH-COATED CARTRIDGE | HPLC (TO-14) | 3.42 | -3.42 | 1 | R | Parts per billion Carbon | ||||
| Hexanaldehyde | 43517 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Hexanaldehyde | 43517 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Hexanaldehyde | 43517 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Hexanaldehyde | 43517 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Hexanaldehyde | 43517 | 156 | Intermittent | Cartridge DNPH on Silica, Heated O3 Denuder | HPLC Photo Diode Array | 0.546 | -0.546 | 1 | R | Parts per billion Carbon | ||||
| Hexanaldehyde | 43517 | 165 | Intermittent | ATEC 2400 W/Waters Silica DNPH | HP LC-1050 W/Diode Array Detector | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| Hexanaldehyde | 43517 | 166 | Intermittent | ATEC 2400 W/Waters Silica DNPH | TO-11 Dionex DX-300 Ion Chrmtg | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| Hexanaldehyde | 43517 | 179 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | Liquid Chromatography w/diode array detection | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| Hexanaldehyde | 43517 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Hydrobromic acid | 42301 | 101 | Intermittent | SILICA GEL TUBE | IC SCAN | 2.0 | -2.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Hydrochloric acid | 42302 | 050 | Intermittent | ANNULAR DIFFUSION DENUDER | ION CHROMATOGRAPH | 0.02 | -0.02 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Hydrochloric acid | 42302 | 101 | Intermittent | SILICA GEL TUBE | IC SCAN | 2.0 | -2.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Hydrofluoric acid | 42303 | 101 | Intermittent | SILICA GEL TUBE | IC SCAN | 2.0 | -2.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Hydrofluoric acid | 42303 | 122 | Intermittent | COSTAR (NUCLEOPORE) FILTERS | ISOCRATIC 2 MM SODIUM BORATE | 0.055 | -0.055 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Hydrogen PM2.5 LC | 88337 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Hydrogen PM2.5 LC | 88337 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Hydrogen PM2.5 LC | 88337 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Hydrogen PM2.5 LC | 88337 | 851 | Intermittent | RP Partisol Model 2300 PM2.5 Seq SSampler - Teflon-# | Energy Dispersive X-Ray Fluorescence | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Hydrogen PM2.5 LC | 88337 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Hydrogen cyanide | 42607 | 100 | Continuous | INSTRUMENTAL | ELECTRO CHEMICAL | 0.5 | -0.5 | 1 | R | Parts per million | ||||
| Hydrogen ion conc (TSP) STP | 12602 | 091 | Intermittent | HI-VOL | PH METER | 0.01 | 0.0 | 2 | R | pH Units | ||||
| Hydrogen sulfide | 42402 | 016 | Continuous | INSTRUMENTAL | FLAME PHOTOMETRIC | 0.0005 | -0.0005 | 4 | R | Parts per million | ||||
| Hydrogen sulfide | 42402 | 017 | Continuous | INSTRUMENTAL | COULOMETRIC | 0.005 | -0.005 | 3 | R | Parts per million | ||||
| Hydrogen sulfide | 42402 | 020 | Continuous | INSTRUMENTAL | PULSED FLUORESCENT | 0.002 | -0.002 | 3 | R | Parts per million | ||||
| Hydrogen sulfide | 42402 | 023 | Continuous | INSTRUMENTAL | ULTRA VIOLET STIMULATED FLUORESCEN | 0.004 | -0.004 | 3 | R | Parts per million | ||||
| Hydrogen sulfide | 42402 | 071 | Continuous | TAPE-SAMPLER | AISI LEAD ACETATE PAPER | 0.0005 | -0.0005 | 4 | R | Parts per million | ||||
| Hydrogen sulfide | 42402 | 091 | Intermittent | GAS-BUBBLER | METHYLENE BLUE(100ML TUBE+ORIFICE) | 0.0005 | -0.0005 | 4 | R | Parts per million | ||||
| Hydrogen sulfide | 42402 | 092 | Continuous | AUTOMATED ANALYZER | ULTRAVIOLET FLUORESCENCE | 0.002 | -0.002 | 3 | R | Parts per million | ||||
| Hydrogen sulfide | 42402 | 100 | Continuous | INSTRUMENTAL | ULTRAVIOLET FLUORESCENCE | API MODEL 100E SO2 ANALYZER | 0.0004 | 4 | R | Parts per million | ||||
| Hydronium ion | 42304 | 050 | Intermittent | ANNULAR DIFFUSION DENUDER | ION CHROMATOGRAPH | 0.02 | -0.02 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Indan | 43952 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Indan | 43952 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Indeno[1,2,3-cd] pyrene PM10 STP | 82243 | 063 | Intermittent | HI-VOL-SA/GMW1200 | HPLC SCANNING FLUORESCENCE | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Indeno[1,2,3-cd]pyrene (TSP) STP | 17243 | 101 | Intermittent | HI-VOL/PUF-XAD | GC-MS-SIM | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Indeno[1,2,3-cd]pyrene (TSP) STP | 17243 | 102 | Intermittent | HI-VOL/PUF CARTRIDGE | TO-13- EPA610- EPA625 | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Indeno[1,2,3-cd]pyrene (TSP) STP | 17243 | 103 | Intermittent | Hi-Vol/PUF Cartridge | Micro Wave Extraction GC/MS | 0.4 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Indeno[1,2,3-cd]pyrene (TSP) STP | 17243 | 104 | Intermittent | Hi-Vol/PUF Cartridge | Accelerated solvent extraction GC-MS | 0.55 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Indeno[1,2,3-cd]pyrene (TSP) STP | 17243 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Indeno[1,2,3-cd]pyrene (TSP) STP | 17243 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 40.5 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Indeno[1,2,3-cd]pyrene (TSP) STP | 17243 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00017 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Indeno[1,2,3-cd]pyrene (TSP) STP | 17243 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.0975 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| Indeno[1,2,3-cd]pyrene (TSP) STP | 17243 | 119 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS-SIM Modified TO-13A | 0.0975 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| Indeno[1,2,3-cd]pyrene (TSP) STP | 17243 | 904 | Intermittent | SKC Pump XAD-2 SORBENT Tube | HPLC Fluorescence/UV NIOSH 5506 | 170.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Indeno[1,2,3-cd]pyrene (TSP) STP | 17243 | 909 | Intermittent | SKC Pump XAD-2 SORBENT Tube | GC/MS NIOSH 5515 REAC SOP 1817 | 4760.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Indium (PM10) | 83129 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 0.016 | 0.0 | 3 | Micrograms/cubic meter (25 C) | |||||
| Indium (PM10) | 83129 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 0.016 | 0.0 | 3 | Micrograms/cubic meter (25 C) | |||||
| Indium (PM10) | 83129 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 0.016 | 0.0 | 3 | Micrograms/cubic meter (25 C) | |||||
| Indium (TSP) LC | 14131 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 6.775 | 3 | Micrograms/cubic meter (LC) | ||||||
| Indium (TSP) STP | 12131 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Indium (TSP) STP | 12131 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Indium (TSP) STP | 12131 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.447 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Indium PM10 STP | 82131 | 304 | Intermittent | Hi Vol SA/GMW 1200 | X-ray Fluorescence | 16.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Indium PM10 STP | 82131 | 305 | Intermittent | Hi Vol SA/GMW 321B | X-ray Fluorescence | 16.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Indium PM10 STP | 82131 | 306 | Intermittent | Hi Vol Wedding Inlet | X-ray Fluorescence | 16.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Indium PM10-2.5 LC | 86131 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00452 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Indium PM2.5 LC | 88131 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.01128 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Indium PM2.5 LC | 88131 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 6.775 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Indium PM2.5 LC | 88131 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00452 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Indium PM2.5 LC | 88131 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00452 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Indium PM2.5 LC | 88131 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00452 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Indium PM2.5 LC | 88131 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00452 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Indium PM2.5 LC | 88131 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00452 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Indium PM2.5 LC | 88131 | 871 | Intermittent | URG MASS400 TeflonVSCC | Energy Dispersive XRF | 0.00452 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Indium PM2.5 LC | 88131 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00452 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Indium Pm10 Lc | 85131 | 820 | Continuous | Cooper Environmental Services (CES) XACT 625 | X-ray fluorescence (XRF) | 6.775 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Indium Pm10 Lc | 85131 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 4.52 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Indoor Temperature | 62107 | 011 | Continuous | INSTRUMENTAL HY-CAL ENGINEERIN | ELEC AVG RTD LINEAR BRIDGE AMPLIFIE | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Indoor Temperature | 62107 | 012 | Continuous | Instrumental | 3 Element thermistor | -60.0 | -60.0 | 150.0 | 1 | R | Degrees Fahrenheit | |||
| Indoor Temperature | 62107 | 013 | Continuous | Instrumental | Electronic or Machine average | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Indoor Temperature | 62107 | 014 | Continuous | Instrumental | Hampshire 140 Sensor | -60.0 | -60.0 | 150.0 | 1 | R | Degrees Fahrenheit | |||
| Indoor Temperature | 62107 | 040 | Continuous | INSTRUMENTAL | ELECTRONIC OR MACHINE AVG. | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Infrared PM 2.5 Carbon at 950 nm | 88364 | 878 | Continuous | Met One BC-1054 Black Carbon Monitor | Optical Absorption | 0.1 | 2 | Micrograms/cubic meter (LC) | ||||||
| Infrared PM 2.5 Carbon at 950 nm | 88364 | 894 | Continuous | Magee AE33/ TAPI M633 Aethalometer | Optical Absorption | 0.2 | -1.9 | 2 | Micrograms/cubic meter (LC) | |||||
| Infrared Radiation | 63303 | 011 | Continuous | INSTRUMENTAL | EPPLEY PIR INFRARED | 0.01 | 0.0 | 3 | R | Langleys/minute | ||||
| Inorganic Fractn (SP) | 21113 | 071 | Intermittent | BUCKET | GRAVIMETRIC (APCA) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Inorganic Fractn (SP) | 21113 | 081 | Intermittent | BUCKET | GRAVIMETRIC (ASTM) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Iodide (TSP) STP | 12204 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.07 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Iridium (TSP) STP | 12133 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Iridium (TSP) STP | 12133 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Iridium PM2.5 LC | 88133 | 811 | Intermittent | Met One SASS Teflon | Energy Dispersive XRF | 0.00594 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Iridium PM2.5 LC | 88133 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00238 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Iridium PM2.5 LC | 88133 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00238 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Iridium PM2.5 LC | 88133 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00238 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Iridium PM2.5 LC | 88133 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00238 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Iridium PM2.5 LC | 88133 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00238 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Iridium PM2.5 LC | 88133 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00238 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Iron (SP) | 22126 | 092 | Intermittent | BUCKET | ATOMIC ABSORPTION | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Iron (SP) | 22126 | 101 | Intermittent | NADP BUCKET: DRY SIDE | ATOMIC ABSORPTION | 0.0001 | 0.0 | 5 | R | Grams/sq meter/month | ||||
| Iron (TSP) LC | 14126 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.4374 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Iron (TSP) LC | 14126 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.003 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Iron (TSP) LC | 14126 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Iron (TSP) LC | 14126 | 310 | Intermittent | LO-VOL | ICP-MS | 0.012 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Iron (TSP) LC | 14126 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.759 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Iron (TSP) STP | 12126 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Iron (TSP) STP | 12126 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.003 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Iron (TSP) STP | 12126 | 091 | Intermittent | HI-VOL | EMISSION SPECTRA MUFFLE FURNACE | 0.1 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Iron (TSP) STP | 12126 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Iron (TSP) STP | 12126 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.1 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Iron (TSP) STP | 12126 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.03 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Iron (TSP) STP | 12126 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Iron (TSP) STP | 12126 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Iron (TSP) STP | 12126 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Iron (TSP) STP | 12126 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.012 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Iron (TSP) STP | 12126 | 905 | Intermittent | SKC Pump Filter | ICP/AES NIOSH 7300 | 1.74 | 2 | R | Micrograms/cubic meter (25 C) | |||||
| Iron (TSP) STP | 12126 | 910 | Intermittent | SKC Pump Filter | MOd NISH 7300/6010B SOP 1813 | 0.2208 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Iron (precip) | 65334 | 082 | Intermittent | PRECIP | ATOMIC ABSORPTION | 0.03 | 0.0 | 2 | R | Milligrams/liter | ||||
| Iron (precip) | 65334 | 085 | Intermittent | ANDERSON RAINFALL BUCKET | EMISSION SPECTRA ICAP | 0.01 | 0.0 | 3 | R | Milligrams/liter | ||||
| Iron - 56 (TSP) | 11350 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.012 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Iron - 57 (TSP) | 11358 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.0071 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Iron PM10 LC | 85126 | 110 | Intermittent | Hi-Vol SA/GMW1200 | ICP/MS | 0.04 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Iron PM10 LC | 85126 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Iron PM10 LC | 85126 | 820 | Continuous | Cooper Environmental Services model Xact 620 | X-ray fluorescence (XRF) | 0.08 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Iron PM10 LC | 85126 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 0.79 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Iron PM10 STP | 82126 | 092 | Intermittent | HI-VOL-SA/GMW-321-B | ATOMIC ABSORPTION | 10.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Iron PM10 STP | 82126 | 102 | Intermittent | HI-VOL-SA/GMW1200 | ATOMIC ABSORPTION | 10.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Iron PM10 STP | 82126 | 105 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 10.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Iron PM10 STP | 82126 | 106 | Intermittent | HI-VOL-WEDDING-INLET | EMISSION SPECTRA ICAP | 10.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Iron PM10 STP | 82126 | 107 | Intermittent | HI-VOL-SA/GMW-321B | EMISSION SPECTRA ICAP | 10.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Iron PM10 STP | 82126 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Iron PM10 STP | 82126 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 0.04 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Iron PM10 STP | 82126 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 0.04 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Iron PM10 STP | 82126 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 0.04 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Iron PM10-2.5 LC | 86126 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00079 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Iron PM10-2.5 STP | 83126 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Iron PM2.5 LC | 88126 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Iron PM2.5 LC | 88126 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Iron PM2.5 LC | 88126 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Iron PM2.5 LC | 88126 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.00196 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Iron PM2.5 LC | 88126 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE (XRF) INSTRUMENTAL | 0.759 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Iron PM2.5 LC | 88126 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00079 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Iron PM2.5 LC | 88126 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00079 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Iron PM2.5 LC | 88126 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00079 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Iron PM2.5 LC | 88126 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00079 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Iron PM2.5 LC | 88126 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00079 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Iron PM2.5 LC | 88126 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00079 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Iron PM2.5 LC | 88126 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00079 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Iron PM2.5 LC | 88126 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Iron PM2.5 STP | 84126 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Isobutane | 43214 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isobutane | 43214 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isobutane | 43214 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isobutane | 43214 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isobutane | 43214 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Isobutane | 43214 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| Isobutane | 43214 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Isobutane | 43214 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isobutane | 43214 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Isobutane | 43214 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isobutane | 43214 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isobutane | 43214 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| Isobutane | 43214 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.51052 | -0.51052 | 4 | R | Parts per billion Carbon | ||||
| Isobutane | 43214 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isobutane | 43214 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 1.73 | -1.73 | 2 | R | Parts per billion Carbon | ||||
| Isobutane | 43214 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isobutane | 43214 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isobutane | 43214 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isobutane | 43214 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isobutane | 43214 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Isobutane | 43214 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isobutane | 43214 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutane | 43214 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutane | 43214 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutane | 43214 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutane | 43214 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutane | 43214 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutane | 43214 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutane | 43214 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutane | 43214 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutane | 43214 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutane | 43214 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutane | 43214 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutene | 43270 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isobutene | 43270 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | 2 | R | Parts per billion Carbon | |||||
| Isobutene | 43270 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isobutene | 43270 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Isobutene | 43270 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Isobutene | 43270 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Isobutene | 43270 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Isobutene | 43270 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isobutene | 43270 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutene | 43270 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutene | 43270 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutene | 43270 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutene | 43270 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutene | 43270 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutene | 43270 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutene | 43270 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutene | 43270 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutene | 43270 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutene | 43270 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutene | 43270 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isobutene & 1-butene | 43127 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.72 | -0.72 | 2 | R | Parts per billion Carbon | ||||
| Isobutene & 1-butene | 43127 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isobutene & 1-butene | 43127 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Isobutene & 1-butene | 43127 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Isobutyraldehyde | 43512 | 130 | Intermittent | DNPH-COATED CARTRIDGE | HPLC (TO-14) | 2.68 | -2.68 | 1 | R | Parts per billion Carbon | ||||
| Isobutyraldehyde | 43512 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Isodrin (TSP) STP | 16784 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 22.8 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Isomers of dodecane | 43111 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isomers of ethyltoluene | 45104 | 128 | Continuous | Preconcentration Trap | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Isomers of pentene | 43121 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopentane | 43221 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopentane | 43221 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopentane | 43221 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopentane | 43221 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopentane | 43221 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Isopentane | 43221 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| Isopentane | 43221 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Isopentane | 43221 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopentane | 43221 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Isopentane | 43221 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopentane | 43221 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopentane | 43221 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopentane | 43221 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| Isopentane | 43221 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.53076 | -0.53076 | 4 | R | Parts per billion Carbon | ||||
| Isopentane | 43221 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopentane | 43221 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.48 | -0.48 | 2 | R | Parts per billion Carbon | ||||
| Isopentane | 43221 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopentane | 43221 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopentane | 43221 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopentane | 43221 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopentane | 43221 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Isopentane | 43221 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopentane | 43221 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopentane | 43221 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopentane | 43221 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopentane | 43221 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopentane | 43221 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopentane | 43221 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopentane | 43221 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopentane | 43221 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopentane | 43221 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopentane | 43221 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopentane | 43221 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopentane | 43221 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopentane & cyclopentane | 43341 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopentane & cyclopentane | 43341 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Isopentane & cyclopentane | 43341 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Isophorone (TSP) STP | 16914 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 27.8 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Isoprene | 43243 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isoprene | 43243 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isoprene | 43243 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isoprene | 43243 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isoprene | 43243 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Isoprene | 43243 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| Isoprene | 43243 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Isoprene | 43243 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isoprene | 43243 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Isoprene | 43243 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isoprene | 43243 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isoprene | 43243 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isoprene | 43243 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| Isoprene | 43243 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.5705 | -0.5705 | 4 | R | Parts per billion Carbon | ||||
| Isoprene | 43243 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isoprene | 43243 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.74 | -0.74 | 2 | R | Parts per billion Carbon | ||||
| Isoprene | 43243 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isoprene | 43243 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isoprene | 43243 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isoprene | 43243 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isoprene | 43243 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Isoprene | 43243 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isoprene | 43243 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.1 | -0.1 | 3 | R | Parts per billion Carbon | ||||
| Isoprene | 43243 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isoprene | 43243 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isoprene | 43243 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isoprene | 43243 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isoprene | 43243 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isoprene | 43243 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isoprene | 43243 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isoprene | 43243 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isoprene | 43243 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isoprene | 43243 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isoprene | 43243 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isoprene | 43243 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopropylbenzene | 45210 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| Isopropylbenzene | 45210 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 2.28938 | -2.28938 | 4 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.44 | -0.44 | 2 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.45 | -0.45 | 2 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 176 | Intermittent | 6L Subatm SS Canister | Entech Precon GC/MS | 0.159 | -0.159 | 3 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopropylbenzene | 45210 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopropylbenzene | 45210 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopropylbenzene | 45210 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopropylbenzene | 45210 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopropylbenzene | 45210 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopropylbenzene | 45210 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopropylbenzene | 45210 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopropylbenzene | 45210 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopropylbenzene | 45210 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopropylbenzene | 45210 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopropylbenzene | 45210 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Isopropylbenzene | 45210 | 903 | Intermittent | SKC Pump Charcoal Tube | GC/FID NIOSH 1501 | 4.04 | -4.04 | 2 | R | Parts per billion Carbon | ||||
| Isopropylbenzene | 45210 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.7 | -0.7 | 2 | R | Parts per billion Carbon | ||||
| Isosafrole (TSP) STP | 16785 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 29.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Isovaleraldehyde | 43513 | 102 | Intermittent | Cartridge-DNPH-on silica | HPLC Ultraviolet Absorption | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Isovaleraldehyde | 43513 | 114 | Intermittent | CARTRIDGE-DNPH-SILICA-SEP-PAK | HPLC-PHOTODIODE ARRAY | 0.085 | -0.085 | 2 | R | Parts per billion Carbon | ||||
| Isovaleraldehyde | 43513 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isovaleraldehyde | 43513 | 130 | Intermittent | DNPH-COATED CARTRIDGE | HPLC (TO-14) | 1.8 | -1.8 | 1 | R | Parts per billion Carbon | ||||
| Isovaleraldehyde | 43513 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Isovaleraldehyde | 43513 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isovaleraldehyde | 43513 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Isovaleraldehyde | 43513 | 156 | Intermittent | Cartridge DNPH on Silica, Heated O3 Denuder | HPLC Photo Diode Array | 0.175 | -0.175 | 2 | R | Parts per billion Carbon | ||||
| Isovaleraldehyde | 43513 | 165 | Intermittent | ATEC 2400 W/Waters Silica DNPH | HP LC-1050 W/Diode Array Detector | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| Isovaleraldehyde | 43513 | 166 | Intermittent | ATEC 2400 W/Waters Silica DNPH | TO-11 Dionex DX-300 Ion Chrmtg | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| Isovaleraldehyde | 43513 | 179 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | Liquid Chromatography w/diode array detection | 0.05 | -0.05 | 2 | R | Parts per billion Carbon | ||||
| Isovaleraldehyde | 43513 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Lanthanum (PM10) | 83147 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 0.057 | 0.0 | 3 | Micrograms/cubic meter (25 C) | |||||
| Lanthanum (PM10) | 83147 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 0.057 | 0.0 | 3 | Micrograms/cubic meter (25 C) | |||||
| Lanthanum (PM10) | 83147 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 0.057 | 0.0 | 3 | Micrograms/cubic meter (25 C) | |||||
| Lanthanum (TSP) STP | 12146 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.371 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Lanthanum (TSP) STP | 12146 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Lanthanum (TSP) STP | 12146 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Lanthanum (TSP) STP | 12146 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 1.16 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Lanthanum PM10 STP | 82146 | 304 | Intermittent | Hi Vol SA/GMW 1200 | X-ray Fluorescence | 57.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Lanthanum PM10 STP | 82146 | 305 | Intermittent | Hi Vol SA/GMW 321B | X-ray Fluorescence | 57.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Lanthanum PM10 STP | 82146 | 306 | Intermittent | Hi Vol Wedding Inlet | X-ray Fluorescence | 57.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Lanthanum PM2.5 LC | 88146 | 811 | Intermittent | Met One SASS Teflon | Energy Dispersive XRF | 0.06947 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Lanthanum PM2.5 LC | 88146 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.0279 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Lanthanum PM2.5 LC | 88146 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.0279 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Lanthanum PM2.5 LC | 88146 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.0279 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Lanthanum PM2.5 LC | 88146 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.0279 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Lanthanum PM2.5 LC | 88146 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.0279 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Lanthanum PM2.5 LC | 88146 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.0279 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Lapse Rate | 61202 | 021 | Continuous | Instrumental | Electronic or machine average level 2 - level 1 | -100.0 | -100.0 | 1 | R | Degrees Centigrade/100m | ||||
| Lapse Rate | 61202 | 031 | Continuous | Instrumental | Electronic or machine average level 3 - level 1 | -100.0 | -100.0 | 1 | R | Degrees Centigrade/100m | ||||
| Lapse Rate | 61202 | 032 | Continuous | Instrumental | Electronic or machine average level 3 - level 2 | -100.0 | -100.0 | 1 | R | Degrees Centigrade/100m | ||||
| Lead (SP) | 22128 | 092 | Intermittent | BUCKET | ATOMIC ABSORPTION | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Lead (SP) | 22128 | 101 | Intermittent | NADP BUCKET: DRY SIDE | ATOMIC ABSORPTION | 3.0e-05 | 0.0 | 5 | R | Grams/sq meter/month | ||||
| Lead (TSP) LC | 14129 | 043 | Intermittent | Hi-Vol | Atomic Absorption (AA) Alt. Extr; 1.03M HNO3/2.23MHCl sonicate 50 min. at 100C | FEM | EQL-0380-043 | Pb-TSP/AA (Alt. Extr) | 0.02 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 044 | Intermittent | Hi-Vol | Flameless Atomic absorption (GFAA) EPA; 3 extraction options: (a) 2.6M HNO3 sonicate 30 min no heat, (b) 2.6M HNO3/.9MHC | FEM | EQL-0380-044 | Pb-TSP/FLAMELESS-AA (EPA) | 0.002 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 045 | Intermittent | Hi-Vol | Emission Spectra ICAP (ICP-OES) EPA 1.03M HNO3/2.23M HCl sonicate 50 min at 100C | FEM | EQL-0380-045 | Pb-TSP/ICAP SPECTRA (EPA) | 0.0045 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 052 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | FEM | EQL-0581-052 | WAVE LENGTH DISP XRF | 0.02 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 057 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | FEM | EQL-0483-057 | ICAP SPECTRA (MONTANA) | 0.02 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 058 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | FEM | EQL-0783-058 | ENERGY-DISP XRF | 0.03 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 059 | Intermittent | HI-VOL | FLAMELESS ATOMIC ABSORPTION (GFAA) | FEM | EQL-0785-059 | Pb-TSP/FLAMELESS AA | 0.0078 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 068 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | FEM | EQL-0888-068 | ICAP SPECTRA (RHODE ISLAND) | 0.06 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 069 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | FEM | EQL-1188-069 | ICAP SPECTRA (NE & T) | 0.01 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 070 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | FEM | EQL-1288-070 | ICAP SPECTRA (S.V.LABS) | 0.01 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 072 | Intermittent | HI-VOL | X-RAY FLUORESCENCE (EDXRF) | FEM | EQL-0589-072 | Pb-TSP/ENERGY-DISP XREF | 0.07 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 080 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | FEM | EQL-1290-080 | ICAP SPECTRA (NEW HAMPSHIRE) | 0.01 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 085 | Intermittent | Hi-Vol | Emission Spectra ICAP (ICP-OES) No extr info | FEM | EQL-0592-085 | Pb-TSP/ICAP SPECTRA (EPA) | 0.01 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 086 | Intermittent | Hi-Vol | Emission Spectra ICAP (ICP-OES); 1.03MHNO3/2.23MHCl sonicate 50 min at100C | FEM | EQL-0592-086 | Pb-TSP/ICAP SPECTRA (EPA) | 0.0036 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 094 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | FEM | EQL-1193-094 | HI-VOL/ICAP SPECT. (ILLINOIS) | 0.01 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 096 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | FEM | EQL-0694-096 | HI-VOL ICAP SPECT (WV) | 0.002 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 107 | Intermittent | Hi-Vol | Flameless Atomic absorption (GFAA); 3M HNO3 Boil 30 min | FEM | EQL-0895-107 | PB-TSP/FLAMELESS AA | 0.0075 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 109 | Intermittent | HI-VOL | ICAP SPECTRA | FEM | EQL-0995-109 | HI-VOL/ICAP SPECT. | 0.01 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 110 | Intermittent | Hi-Vol | ICAP SPECTRA (ICP-MS); 0.45M HNO3 Boil30 min | FEM | EQL-0995-110 | Pb-TSP/ICAP SPECTRA (ICP-MS) | 0.0075 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 113 | Intermittent | Hi-Vol | Emission Spectra ICAP (ICP-OES); 3M HNO3 Boil 30 min | FEM | EQL-0196-113 | Pb-TSP/ICAP SPECTRA (ICP-OES) | 0.0075 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 140 | Intermittent | Hi-Vol | Emission Spectra ICAP (ICP-AES); 6:3:1 DI water:HCl:HNO3 microwave 95C; add DI water sonicate 30 min; sit overnight | FEM | EQL-0400-140 | Pb-TSP/ICAP SPECTRA (ICP-AES) | 0.0075 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 189 | Intermittent | Hi-Vol | ICP-MS Extracted on a hot plate with 3M HNO3 according to refrn methd. SW-846 Meth 6020A | FEM | EQL-0310-189 | Pb-TSP/ICAP SPECTRA (ICP-MS) | 0.0075 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 191 | Intermittent | Hi-Vol | Inductively Coupled Plasma-Mass Spectrometry Acid filter extraction with nitric and hydrochloric acid | FEM | EQL-0510-191 | Pb-TSP/ICP SPECTRA (ICP-MS) | 2.0e-05 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 192 | Intermittent | Hi-Vol | Inductively Coupled Plasma-Mass Spectrometry Acid filter extract with hot nitric acid | FEM | EQL-0710-192 | Pb-TSP/ICP SPECTRA (ICP-MS) | 0.0075 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 193 | Intermittent | Hi-Vol | ICP-MS | FEM | EQL-0512-201 | ICP-MS (ERG) | 0.0075 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 196 | Intermittent | HI-VOL | HEATED ULTRASONIC HNO3/HCL EXTRACTION WITH ICP-AES | FEM | EQL-0311-196 | 0.0075 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) | |
| Lead (TSP) LC | 14129 | 213 | Intermittent | HI-VOL | ICP-MS Time of Flight (TOF) | FEM | EQL-0514-213 | ICP-MS Time of Flight (TOF) SCAQMD | 0.0075 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 261 | Intermittent | HI-VOL | Microwave Assisted Digestion Quadrapole ICP-MS (SCAQMD) | FEM | EQL-0723-261 | Quadrapole ICP-MS (SCAQMD) | 0.0075 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 310 | Intermittent | LO-VOL | ICP-MS | 0.003 | 5 | T | Micrograms/cubic meter (LC) | |||||
| Lead (TSP) LC | 14129 | 803 | Intermittent | Hi-Vol | Atomic Absorption (AA); 2.6M HNO3/0.9M HCl or 0.45 HNO3 Boil 30 min | FEM | EQLA-813-803 | Pb-TSP/AA (FRM) | 0.0075 | -0.0075 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC | 14129 | 813 | Intermittent | HI-VOL | ICP-MS FRM; Heated ultrasonic 1.03M HNO3/2.23M HCl or Hot block 1:19 v/v HNO3 | FRM | RFLA-0813-813 | Pb-TSP/AA (FRM) | 0.0002 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC Non-FRM/FEM | 14128 | 043 | Intermittent | Hi-Vol | Atomic Absorption (AA) Alt. Extr; 1.03M HNO3/2.23MHCl sonicate 50 min. at 100C | FEM | EQL-0380-043 | Pb-TSP/AA (Alt. Extr) | 0.0075 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC Non-FRM/FEM | 14128 | 044 | Intermittent | Hi-Vol | Flameless Atomic absorption (GFAA) EPA; 3 extraction options: (a) 2.6M HNO3 sonicate 30 min no heat, (b) 2.6M HNO3/.9MHC | FEM | EQL-0380-044 | Pb-TSP/FLAMELESS-AA (EPA) | 0.0075 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC Non-FRM/FEM | 14128 | 045 | Intermittent | Hi-Vol | Emission Spectra ICAP (ICP-OES) EPA 1.03M HNO3/2.23M HCl sonicate 50 min at 100C | FEM | EQL-0380-045 | Pb-TSP/ICAP SPECTRA (EPA) | 0.0075 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC Non-FRM/FEM | 14128 | 052 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | FEM | EQL-0581-052 | WAVE LENGTH DISP XRF | 0.01 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC Non-FRM/FEM | 14128 | 057 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | FEM | EQL-0483-057 | ICAP SPECTRA (MONTANA) | 0.01 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC Non-FRM/FEM | 14128 | 058 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | FEM | EQL-0783-058 | ENERGY-DISP XRF | 0.01 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC Non-FRM/FEM | 14128 | 059 | Intermittent | HI-VOL | FLAMELESS ATOMIC ABSORPTION (GFAA) | FEM | EQL-0785-059 | Pb-TSP/FLAMELESS AA | 0.0075 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC Non-FRM/FEM | 14128 | 068 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | FEM | EQL-0888-068 | ICAP SPECTRA (RHODE ISLAND) | 0.01 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC Non-FRM/FEM | 14128 | 069 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | FEM | EQL-1188-069 | ICAP SPECTRA (NE & T) | 0.01 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC Non-FRM/FEM | 14128 | 070 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | FEM | EQL-1288-070 | ICAP SPECTRA (S.V.LABS) | 0.01 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC Non-FRM/FEM | 14128 | 072 | Intermittent | HI-VOL | X-RAY FLUORESCENCE (EDXRF) | FEM | EQL-0589-072 | Pb-TSP/ENERGY-DISP XREF | 0.0075 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC Non-FRM/FEM | 14128 | 080 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | FEM | EQL-1290-080 | ICAP SPECTRA (NEW HAMPSHIRE) | 0.01 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC Non-FRM/FEM | 14128 | 085 | Intermittent | Hi-Vol | Emission Spectra ICAP (ICP-OES) No extr info | FEM | EQL-0592-085 | Pb-TSP/ICAP SPECTRA (EPA) | 0.0075 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC Non-FRM/FEM | 14128 | 086 | Intermittent | Hi-Vol | Emission Spectra ICAP (ICP-OES); 1.03MHNO3/2.23MHCl sonicate 50 min at100C | FEM | EQL-0592-086 | Pb-TSP/ICAP SPECTRA (EPA) | 0.0075 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC Non-FRM/FEM | 14128 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0547 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) | |||
| Lead (TSP) LC Non-FRM/FEM | 14128 | 094 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | FEM | EQL-1193-094 | HI-VOL/ICAP SPECT. (ILLINOIS) | 0.01 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC Non-FRM/FEM | 14128 | 096 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | FEM | EQL-0694-096 | HI-VOL ICAP SPECT (WV) | 0.002 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC Non-FRM/FEM | 14128 | 107 | Intermittent | Hi-Vol | Flameless Atomic absorption (GFAA); 3M HNO3 Boil 30 min | FEM | EQL-0895-107 | PB-TSP/FLAMELESS AA | 0.0075 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC Non-FRM/FEM | 14128 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 3.0e-05 | 3 | T | Micrograms/cubic meter (LC) | |||||
| Lead (TSP) LC Non-FRM/FEM | 14128 | 109 | Intermittent | HI-VOL | ICAP SPECTRA (PIMA CO.- AZ) | FEM | EQL-0995-109 | HI-VOL/ICAP SPECT. | 0.01 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC Non-FRM/FEM | 14128 | 110 | Intermittent | Hi-Vol | ICAP SPECTRA (ICP-MS); 0.45M HNO3 Boil30 min | FEM | EQL-0995-110 | Pb-TSP/ICAP SPECTRA (ICP-MS) | 0.0075 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC Non-FRM/FEM | 14128 | 113 | Intermittent | Hi-Vol | Emission Spectra ICAP (ICP-OES); 3M HNO3 Boil 30 min | FEM | EQL-0196-113 | Pb-TSP/ICAP SPECTRA (ICP-OES) | 0.0075 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC Non-FRM/FEM | 14128 | 140 | Intermittent | Hi-Vol | Emission Spectra ICAP (ICP-AES); 6:3:1 DI water:HCl:HNO3 microwave 95C; add DI water sonicate 30 min; sit overnight | FEM | EQL-0400-140 | Pb-TSP/ICAP SPECTRA (ICP-AES) | 0.0075 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead (TSP) LC Non-FRM/FEM | 14128 | 803 | Intermittent | Hi-Vol | Atomic Absorption (AA) FRM; 2.6M HNO3/0.9M HCl or 0.45 HNO3 Boil 30 min | FRL-1087-001 | Pb-TSP/AA (FRM) | 0.0075 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) | |
| Lead (TSP) LC Non-FRM/FEM | 14128 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.218 | 3 | T | Micrograms/cubic meter (LC) | |||||
| Lead (TSP) LC Non-FRM/FEM | 14128 | 821 | Intermittent | Low- Vol TEI 2025 with Omni-directional Inlet | Energy Dispersive X-Ray Fluorescence (EDXRF) | 0.0018 | 4 | T | Micrograms/cubic meter (LC) | |||||
| Lead (TSP) LC Non-FRM/FEM | 14128 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0004 | 5 | T | Micrograms/cubic meter (LC) | |||||
| Lead (TSP) STP | 12128 | 043 | Intermittent | HI-VOL | ATOMIC ABSORPTION (ALT.EXTR.) | FEM | EQL-0380-043 | ALTERNATE-EXTRACTION | 0.01 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) |
| Lead (TSP) STP | 12128 | 044 | Intermittent | HI-VOL | FLAMELESS ATOMIC ABSORPTION (GFAA) | FEM | EQL-0380-044 | Pb-TSP/FLAMELESS-AA-(EPA) | 0.0075 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) |
| Lead (TSP) STP | 12128 | 045 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP (ICP-OES) | FEM | EQL-0380-045 | Pb-TSP/ICAP SPECTRA (EPA) | 0.0075 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) |
| Lead (TSP) STP | 12128 | 052 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | FEM | EQL-0581-052 | WAVE LENGTH DISP XRF | 0.01 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) |
| Lead (TSP) STP | 12128 | 057 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | FEM | EQL-0483-057 | ICAP SPECTRA (MONTANA) | 0.01 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) |
| Lead (TSP) STP | 12128 | 058 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | FEM | EQL-0783-058 | ENERGY-DISP XRF | 0.01 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) |
| Lead (TSP) STP | 12128 | 059 | Intermittent | HI-VOL | FLAMELESS ATOMIC ABSORPTION (GFAA) | FEM | EQL-0785-059 | Pb-TSP/FLAMELESS AA | 0.0075 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) |
| Lead (TSP) STP | 12128 | 068 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | FEM | EQL-0888-068 | ICAP SPECTRA (RHODE ISLAND) | 0.01 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) |
| Lead (TSP) STP | 12128 | 069 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | FEM | EQL-1188-069 | ICAP SPECTRA (NE & T) | 0.01 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) |
| Lead (TSP) STP | 12128 | 070 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | FEM | EQL-1288-070 | ICAP SPECTRA (S.V.LABS) | 0.01 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) |
| Lead (TSP) STP | 12128 | 072 | Intermittent | HI-VOL | X-RAY FLUORESCENCE (EDXRF) | FEM | EQL-0589-072 | Pb-TSP/ENERGY-DISP XREF | 0.0075 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) |
| Lead (TSP) STP | 12128 | 074 | Intermittent | LO-VOL | ATOMIC ABSORPTION | 0.002 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) | |||
| Lead (TSP) STP | 12128 | 080 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | FEM | EQL-1290-080 | ICAP SPECTRA (NEW HAMPSHIRE) | 0.01 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) |
| Lead (TSP) STP | 12128 | 085 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | FEM | EQL-0592-085 | ICAP SPECTRA (KANSAS) | 0.01 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) |
| Lead (TSP) STP | 12128 | 086 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | FEM | EQL-0592-086 | ICAP SPECTRA (PENNSYLVANIA) | 0.01 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) |
| Lead (TSP) STP | 12128 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0547 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) | |||
| Lead (TSP) STP | 12128 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.003 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) | |||
| Lead (TSP) STP | 12128 | 091 | Intermittent | HI-VOL | EMISSION SPECTRA MUFFLE FURNACE | 0.01 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) | |||
| Lead (TSP) STP | 12128 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.002 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) | |||
| Lead (TSP) STP | 12128 | 093 | Intermittent | HI-VOL | DITHIOZONE METHOD | 0.002 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) | |||
| Lead (TSP) STP | 12128 | 094 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | FEM | EQL-1193-094 | HI-VOL/ICAP SPECT. (ILLINOIS) | 0.01 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) |
| Lead (TSP) STP | 12128 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.01 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) | |||
| Lead (TSP) STP | 12128 | 096 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | FEM | EQL-0694-096 | HI-VOL ICAP SPECT (WV) | 0.002 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) |
| Lead (TSP) STP | 12128 | 097 | Intermittent | HI-VOL | FLAMELESS ATOMIC ABSORPTION | 0.01 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) | |||
| Lead (TSP) STP | 12128 | 101 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.001 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) | |||
| Lead (TSP) STP | 12128 | 107 | Intermittent | HI-VOL | Flameless Atomic absorption (GFAA) | FEM | EQL-0895-107 | Pb-TSP/FLAMELESS AA | 0.0075 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) |
| Lead (TSP) STP | 12128 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 1.0e-05 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) | |||
| Lead (TSP) STP | 12128 | 109 | Intermittent | HI-VOL | ICAP SPECTRA (PIMA CO.- AZ) | FEM | EQL-0995-109 | HI-VOL/ICAP SPECT. | 0.01 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) |
| Lead (TSP) STP | 12128 | 110 | Intermittent | HI-VOL | ICAP SPECTRA (ICP-MS) | FEM | EQL-0995-110 | Pb-TSP/ICAP SPECTRA | 0.0075 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) |
| Lead (TSP) STP | 12128 | 113 | Intermittent | HI-VOL | Emission Spectra ICAP (ICP-OES) | FEM | EQL-0196-113 | Pb-TSP/ICAP SPECTRA | 0.0075 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) |
| Lead (TSP) STP | 12128 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) | |||
| Lead (TSP) STP | 12128 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) | |||
| Lead (TSP) STP | 12128 | 140 | Intermittent | Hi-Vol | Emission Spectra ICAP(ICP-AES) | FEM | EQL-0400-140 | Pb-TSP/ICAP SPECTRA (ICP-AES) | 0.0075 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) |
| Lead (TSP) STP | 12128 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.004 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) | |||
| Lead (TSP) STP | 12128 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.003 | 0.0 | 100.0 | 5 | T | Micrograms/cubic meter (25 C) | |||
| Lead (TSP) STP | 12128 | 803 | Intermittent | HI-VOL | ATOMIC ABSORPTION (AA) FRM | FRL-1087-001 | Pb-TSP/AA FRM | 0.01 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (25 C) | |
| Lead (TSP) STP | 12128 | 905 | Intermittent | SKC Pump Filter | ICP/AES NIOSH 7300 | 0.35 | 4 | T | Micrograms/cubic meter (25 C) | |||||
| Lead (TSP) STP | 12128 | 910 | Intermittent | SKC Pump Filter | MOd NISH 7300/6010B SOP 1813 | 0.0486 | 0.0 | 4 | T | Micrograms/cubic meter (25 C) | ||||
| Lead (precip) | 65337 | 101 | Intermittent | NADP BUCKET: WET SIDE | ATOMIC ABSORPTION | 0.036 | 0.0 | 4 | R | Ug/sq meter/hour | ||||
| Lead - 208 (TSP) | 11351 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Lead PM10 LC | 85128 | 110 | Intermittent | Hi-Vol SA/GMW1200 | ICP/MS | 0.0025 | 0.0 | 4 | T | Micrograms/cubic meter (LC) | ||||
| Lead PM10 LC | 85128 | 202 | Intermittent | R&P Model 2000 PM10 Teflon | ICP/MS | 0.0729 | 4 | T | Micrograms/cubic meter (LC) | |||||
| Lead PM10 LC | 85128 | 204 | Intermittent | Wedding & Ass. Model 600 PM10 HiVol | ICP-MS | 0.00011 | 0.0 | 10.0 | 5 | T | Micrograms/cubic meter (LC) | |||
| Lead PM10 LC | 85128 | 216 | Intermittent | Tisch Model TE-Wilbur10 Low-Volume Sampler | ICP-MS | 0.0004 | 5 | T | Micrograms/cubic meter (LC) | |||||
| Lead PM10 LC | 85128 | 231 | Intermittent | Met One E-FRM PM10 | X-ray Fluorescence (EDXRF) | 0.001 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) | |||
| Lead PM10 LC | 85128 | 501 | Intermittent | Tisch Environmental 6000 Series | ICP-MS | 0.00011 | 0.0 | 5 | T | Micrograms/cubic meter (LC) | ||||
| Lead PM10 LC | 85128 | 809 | Intermittent | Thermo/R & P Partisol 2000 PM10 FRM | X-ray Fluorescence | 0.0004 | 0.0 | 100.0 | 4 | T | Micrograms/cubic meter (LC) | |||
| Lead PM10 LC | 85128 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 0.002 | 0.0 | 4 | T | Micrograms/cubic meter (LC) | ||||
| Lead PM10 LC | 85128 | 820 | Continuous | Cooper Environmental Services model Xact 620 | X-ray fluorescence (XRF) | 0.053 | 3 | T | Micrograms/cubic meter (LC) | |||||
| Lead PM10 LC | 85128 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 0.0022 | 0.0 | 4 | T | Micrograms/cubic meter (LC) | ||||
| Lead PM10 LC | 85128 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 0.0014 | 0.0 | 5000.0 | 4 | T | Micrograms/cubic meter (LC) | |||
| Lead PM10 LC | 85128 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0004 | 0.0 | 4 | T | Micrograms/cubic meter (LC) | ||||
| Lead PM10 LC | 85128 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.0004 | 4 | T | Micrograms/cubic meter (LC) | |||||
| Lead PM10 LC | 85128 | 907 | Intermittent | R & P Partisol 2025 Teflon | ICPMS | 0.00026 | 4 | T | Micrograms/cubic meter (LC) | |||||
| Lead PM10 LC | 85128 | 908 | Intermittent | MET ONE E-SEQ-FRM | ICP-MS | 0.0722 | 4 | T | Micrograms/cubic meter (LC) | |||||
| Lead PM10 LC | 85128 | 911 | Intermittent | ARA low-volume sampler | ICP-MS | 0.0004 | 4 | T | Micrograms/cubic meter (LC) | |||||
| Lead PM10 LC FRM/FEM | 85129 | 202 | Intermittent | R&P Model 2000 PM10 Teflon | ICP/MS | FEM | EQL-0512-202 | Teflon filters + ICP/MS (ERG) | 0.0008 | 4 | T | Micrograms/cubic meter (LC) | ||
| Lead PM10 LC FRM/FEM | 85129 | 804 | Intermittent | Andersen RASS10-100 PM10 | X-ray Fluorescence (EDXRF) FRM | FRM | RFPS-0699-130 and RFLQ-1108-804 | Andersen RAAS10-100 PM10 | 0.001 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead PM10 LC FRM/FEM | 85129 | 805 | Intermittent | Andersen RASS10-200 PM10 | X-ray Fluorescence (EDXRF) FRM | FRM | RFPS-0699-131 and RFLQ-1108-804 | Andersen RAAS10-200 PM10 | 0.001 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead PM10 LC FRM/FEM | 85129 | 806 | Intermittent | Andersen RASS10-300 PM10 | X-ray Fluorescence (EDXRF) FRM | FRM | RFPS-0699-132 and RFLQ-1108-804 | Andersen RAAS10-300 PM10 | 0.001 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead PM10 LC FRM/FEM | 85129 | 807 | Intermittent | BGI PQ100 PM10 | X-ray Fluorescence (EDXRF) FRM | FRM | RFPS-1298-124 and RFLQ-1108-804 | BGI PQ100 PM10 | 0.001 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead PM10 LC FRM/FEM | 85129 | 808 | Intermittent | BGI PQ200 PM10 | X-ray Fluorescence (EDXRF) FRM | FRM | RFPS-1298-125 and RFLQ-1108-804 | BGI PQ200 PM10 | 0.001 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead PM10 LC FRM/FEM | 85129 | 809 | Intermittent | Thermo/R & P Partisol 2000 PM10 FRM | X-ray Fluorescence (EDXRF) FRM | FRM | RFPS-1298-126 and RFLQ-1108-804 | Thermo/R & P Partisol 2000 PM10 FRM | 0.001 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead PM10 LC FRM/FEM | 85129 | 810 | Intermittent | Thermo/R & P Partisol 2000 PM10 Air Sampler | X-ray Fluorescence (EDXRF) FRM | FRM | RFPS-0694-098 and RFLQ-1108-804 | Thermo/R & P Partisol 2000 PM10 Air Sampler | 0.001 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead PM10 LC FRM/FEM | 85129 | 811 | Intermittent | Thermo/R & P 2025 PM10 | X-ray Fluorescence (EDXRF) FRM | FRM | RFPS-1298-127 and RFLQ-1108-804 | Thermo/R & P 2025 PM10 | 0.001 | 0.0 | 100.0 | 3 | T | Micrograms/cubic meter (LC) |
| Lead PM10 LC FRM/FEM | 85129 | 907 | Intermittent | Thermo/R & P 2025 Teflon | ICPMS | FEM | EQL-0512-202 | 0.0008 | 4 | T | Micrograms/cubic meter (LC) | |||
| Lead PM10 STP | 82128 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0 | 5 | T | Micrograms/cubic meter (25 C) | |||||
| Lead PM10 STP | 82128 | 092 | Intermittent | HI-VOL-SA/GMW-321-B | ATOMIC ABSORPTION | 0.002 | 0.0 | 4 | T | Micrograms/cubic meter (25 C) | ||||
| Lead PM10 STP | 82128 | 096 | Intermittent | Med-Vol SA254 TFE | X-ray fluorescence | 0.1 | 0.0 | 4 | T | Micrograms/cubic meter (25 C) | ||||
| Lead PM10 STP | 82128 | 101 | Intermittent | HI-VOL-SA321A | ATOMIC ABSORPTION | 0.08 | 0.0 | 4 | T | Micrograms/cubic meter (25 C) | ||||
| Lead PM10 STP | 82128 | 102 | Intermittent | HI-VOL-SA/GMW1200 | ATOMIC ABSORPTION | 0.08 | 0.0 | 4 | T | Micrograms/cubic meter (25 C) | ||||
| Lead PM10 STP | 82128 | 103 | Intermittent | HI-VOL-WEDDING-INLET | ATOMIC ABSORPTION | 0.08 | 0.0 | 4 | T | Micrograms/cubic meter (25 C) | ||||
| Lead PM10 STP | 82128 | 104 | Intermittent | HI-VOL-SA321A | EMISSION SPECTRA ICAP | 0.08 | 0.0 | 4 | T | Micrograms/cubic meter (25 C) | ||||
| Lead PM10 STP | 82128 | 105 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 0.01 | 0.0 | 4 | T | Micrograms/cubic meter (25 C) | ||||
| Lead PM10 STP | 82128 | 106 | Intermittent | HI-VOL-WEDDING-INLET | EMISSION SPECTRA ICAP | 0.08 | 0.0 | 4 | T | Micrograms/cubic meter (25 C) | ||||
| Lead PM10 STP | 82128 | 107 | Intermittent | HI-VOL-SA/GMW-321B | EMISSION SPECTRA ICAP | 0.01 | 0.0 | 4 | T | Micrograms/cubic meter (25 C) | ||||
| Lead PM10 STP | 82128 | 109 | Intermittent | Hi Vol SA/GMW 321B | ICP/MS | 0.0003 | 0.0 | 4 | T | Micrograms/cubic meter (25 C) | ||||
| Lead PM10 STP | 82128 | 110 | Intermittent | Hi-Vol SA/GMW1200 Quartz | ICP/MS | 1.0e-05 | 0.0 | 4 | T | Micrograms/cubic meter (25 C) | ||||
| Lead PM10 STP | 82128 | 113 | Intermittent | Hi Vol Anderson IP1076 | ICP/MS | 9.0e-05 | 0.0 | 4 | T | Micrograms/cubic meter (25 C) | ||||
| Lead PM10 STP | 82128 | 201 | Intermittent | R&P Model 2000 PM10 Quartz | ICP/MS | 2.0e-05 | 0.0 | 4 | T | Micrograms/cubic meter (25 C) | ||||
| Lead PM10 STP | 82128 | 202 | Intermittent | R&P Model 2000 PM10 Teflon | ICP/MS | FEM | EQL-0512-202 | ICP-MS (ERG) | 2.0e-05 | 0.0 | 4 | T | Micrograms/cubic meter (25 C) | |
| Lead PM10 STP | 82128 | 203 | Intermittent | R&P Model 2025 PM10 Teflon | ICP/MS | 0.0007 | 0.0 | 4 | T | Micrograms/cubic meter (25 C) | ||||
| Lead PM10 STP | 82128 | 204 | Intermittent | Wedding & Ass. Model 600 PM10 HiVol | ICP-MS | 0.00066 | 0.0 | 10.0 | 4 | T | Micrograms/cubic meter (25 C) | |||
| Lead PM10 STP | 82128 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.002 | 0.0 | 4 | T | Micrograms/cubic meter (25 C) | ||||
| Lead PM10 STP | 82128 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 0.0001 | 0.0 | 4 | T | Micrograms/cubic meter (25 C) | ||||
| Lead PM10 STP | 82128 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 0.0001 | 0.0 | 4 | T | Micrograms/cubic meter (25 C) | ||||
| Lead PM10 STP | 82128 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 0.0001 | 0.0 | 4 | T | Micrograms/cubic meter (25 C) | ||||
| Lead PM10 STP | 82128 | 501 | Intermittent | Tisch Environmental 6000 Series | ICP-MS | 0.00011 | 0.0 | 5 | T | Micrograms/cubic meter (25 C) | ||||
| Lead PM10 STP | 82128 | 908 | Intermittent | MET ONE E-SEQ-FRM | ICP-MS | 0.0722 | 4 | T | Micrograms/cubic meter (25 C) | |||||
| Lead PM10-2.5 LC | 86128 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.0022 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Lead PM10-2.5 STP | 83128 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Lead PM2.5 LC | 88128 | 118 | Intermittent | R & P Model 2025 PM2.5 Sequential w/WINS | ICP/MS | 0.00016 | 5.0 | 5 | R | Micrograms/cubic meter (LC) | ||||
| Lead PM2.5 LC | 88128 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Lead PM2.5 LC | 88128 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Lead PM2.5 LC | 88128 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Lead PM2.5 LC | 88128 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.00549 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Lead PM2.5 LC | 88128 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 0.218 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Lead PM2.5 LC | 88128 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.0022 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Lead PM2.5 LC | 88128 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.0022 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Lead PM2.5 LC | 88128 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.0022 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Lead PM2.5 LC | 88128 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.0022 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Lead PM2.5 LC | 88128 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.0022 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Lead PM2.5 LC | 88128 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.0022 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Lead PM2.5 LC | 88128 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.0022 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Lead PM2.5 LC | 88128 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Lead PM2.5 LC | 88128 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 0.0014 | 5000.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Lead PM2.5 LC | 88128 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0004 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Lead PM2.5 LC | 88128 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.0004 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Lead PM2.5 LC | 88128 | 908 | Intermittent | R & P Partisol 2000 | X-Ray Fluorescence | 0.0004 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Lead PM2.5 STP | 84128 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Lead-210 (TSP) STP | 12129 | 096 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Levoglucosan PM2.5 LC | 88390 | 900 | Intermittent | R & P Partisol 2025 Teflon | Aqueous Extraction GC-MS | 0.01 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Levoglucosan PM2.5 LC | 88390 | 901 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | Ion Chromatography | 0.00625 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Levoglucosan PM2.5 LC | 88390 | 902 | Intermittent | Met One SASS Teflon | Liquid Injection Varian GC/MS | 0.02 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Levoglucosan PM2.5 LC | 88390 | 903 | Intermittent | BGI MOdel PQ!)) PM2.5 Sampler | Liquid Injection Varian GC/MS | 0.01 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Levoglucosan PM2.5 LC | 88390 | 907 | Intermittent | Met One SASS Teflon | HPLC Charged Aerosol Detector | 0.1 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Levoglucosan PM2.5 LC | 88390 | 908 | Intermittent | R&P FRM Model 2000 (Single) | Liquid Injection Varian GC/MS | 0.01 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Light Absorption Coeffiecient | 63102 | 898 | Intermittent | Met One SASS/SuperSASS Teflon | Filter absorption at 633nm by HIPS | 0.002 | 3 | Inverse 100 Megameters | ||||||
| Light Absorption Coeffiecient | 63102 | 899 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Filter absorption at 633nm by HIPS | 0.002 | 3 | Inverse 100 Megameters | ||||||
| Light scatter | 11203 | 771 | Continuous | Radiance Research M903 With Heated Inlet | Nephelometry | 0.1 | 1 | R | Beta Scatter | |||||
| Light scatter | 11203 | 812 | Continuous | Ecotech M9003/Aurora | Nephelometry | 0.1 | 0.0 | 1 | R | Beta Scatter | ||||
| Light scatter | 11203 | 813 | Continuous | Meteorology Research 550B | Nephelometry | 0.1 | 1 | R | Beta Scatter | |||||
| Light scatter (miles visibility) | 11207 | 011 | Continuous | Instrumental | Nephelometer | 0.1 | 0.0 | 1 | R | Miles (visibility) | ||||
| Light scatter (miles visibility) | 11207 | 812 | Continuous | Ecotech M9003/ Aurora | Nephelometry | 0.1 | 0.0 | 1 | R | Miles (visibility) | ||||
| Light scatter (ug/m3) | 11206 | 011 | Continuous | Instrumental | Nephelometer | 0.01 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Light scatter (ug/m3) | 11206 | 812 | Continuous | Ecotech M9003/Aurora | Nephelometry | 0.1 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Limonene | 43255 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Limonene | 43255 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Lindane | 43137 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Lindane | 43137 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | -0.5 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Magnesium (TSP) LC | 14140 | 090 | Intermittent | HI-VOL | Emission Spectra ICAP | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Magnesium (TSP) LC | 14140 | 900 | Intermittent | Teflon CASTNET-style 3-stage filter pack | Inductively Coupled Plasma - Optical Emission Spectrometry (ICP-OES) EPA Modified Method 6010B | 0.001 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Magnesium (TSP) STP | 12140 | 045 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.0128 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Magnesium (TSP) STP | 12140 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.0128 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Magnesium (TSP) STP | 12140 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Magnesium (TSP) STP | 12140 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Magnesium (TSP) STP | 12140 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Magnesium (TSP) STP | 12140 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.288 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Magnesium (TSP) STP | 12140 | 905 | Intermittent | SKC Pump Filter | ICP/AES NIOSH 7300 | 13.89 | 2 | R | Micrograms/cubic meter (25 C) | |||||
| Magnesium (TSP) STP | 12140 | 910 | Intermittent | SKC Pump Filter | MOd NISH 7300/6010B SOP 1813 | 1.3194 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Magnesium (precip) | 65313 | 082 | Intermittent | PRECIP | ATOMIC ABSORPTION | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Magnesium (precip) | 65313 | 083 | Intermittent | PRECIP | FLAME EMISSION | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Magnesium (precip) | 65313 | 084 | Intermittent | PRECIP | EDTA TITRATION | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Magnesium (precip) | 65313 | 085 | Intermittent | ANDERSON RAINFALL BUCKET | EMISSION SPECTRA ICAP | 0.03 | 0.0 | 3 | R | Milligrams/liter | ||||
| Magnesium (precip) | 65313 | 086 | Intermittent | ANDERSON RAINFALL BUCKET | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.02 | 0.0 | 2 | R | Milligrams/liter | ||||
| Magnesium PM10 LC | 85140 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 7.38 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Magnesium PM10 LC | 85140 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 9.32 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Magnesium PM10 STP | 82140 | 069 | Intermittent | HIVOL-SA/GMW-321-B | EMISSION SPECTRA ICAP | 12.8 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Magnesium PM10 STP | 82140 | 085 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 12.8 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Magnesium PM10 STP | 82140 | 092 | Intermittent | HI-VOL-SA/GMW-321-B | ATOMIC ABSORPTION | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Magnesium PM10 STP | 82140 | 106 | Intermittent | HI-VOL-Wedding Inlet | Emission Spectra ICAP | 17.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Magnesium PM10 STP | 82140 | 107 | Intermittent | HI-VOL-SA/GMW-321-B | Emission Spectra ICAP | 28.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Magnesium PM10-2.5 LC | 86140 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00738 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Magnesium PM2.5 LC | 88140 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Magnesium PM2.5 LC | 88140 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Magnesium PM2.5 LC | 88140 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Magnesium PM2.5 LC | 88140 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.01841 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Magnesium PM2.5 LC | 88140 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00738 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Magnesium PM2.5 LC | 88140 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00738 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Magnesium PM2.5 LC | 88140 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00738 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Magnesium PM2.5 LC | 88140 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00738 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Magnesium PM2.5 LC | 88140 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00738 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Magnesium PM2.5 LC | 88140 | 871 | Intermittent | URG MASS400 TeflonVSCC | Energy Dispersive XRF | 0.00738 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Magnesium PM2.5 LC | 88140 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00738 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Magnesium PM2.5 LC | 88140 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Malathion | 43169 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Manganese (SP) | 22132 | 092 | Intermittent | BUCKET | ATOMIC ABSORPTION | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Manganese (SP) | 22132 | 101 | Intermittent | NADP BUCKET: DRY SIDE | ATOMIC ABSORPTION | 3.0e-05 | 0.0 | 5 | R | Grams/sq meter/month | ||||
| Manganese (TSP) LC | 14132 | 044 | Intermittent | HI-VOL | FLAMELESS ATOMIC ABSORPTION (GFAA) | Pb-TSP/FLAMELESS-AA-(EPA) | 0.0075 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Manganese (TSP) LC | 14132 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0547 | 0.0 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Manganese (TSP) LC | 14132 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.0408 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Manganese (TSP) LC | 14132 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Manganese (TSP) LC | 14132 | 107 | Intermittent | HI-VOL | Flameless Atomic absorption | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Manganese (TSP) LC | 14132 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 3.0e-05 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Manganese (TSP) LC | 14132 | 110 | Intermittent | Hi-Vol | ICAP SPECTRA (ICP-MS); 0.45M HNO3 Boil30 min | 0.0075 | 0.0 | 100.0 | 3 | R | Micrograms/cubic meter (LC) | |||
| Manganese (TSP) LC | 14132 | 310 | Intermittent | LO-VOL | ICP-MS | 0.005 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Manganese (TSP) LC | 14132 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.283 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Manganese (TSP) LC | 14132 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0002 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Manganese (TSP) STP | 12132 | 045 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.0006 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Manganese (TSP) STP | 12132 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0547 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Manganese (TSP) STP | 12132 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.0408 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Manganese (TSP) STP | 12132 | 091 | Intermittent | HI-VOL | EMISSION SPECTRA MUFFLE FURNACE | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Manganese (TSP) STP | 12132 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Manganese (TSP) STP | 12132 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Manganese (TSP) STP | 12132 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.04 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Manganese (TSP) STP | 12132 | 107 | Intermittent | HI-VOL | Flameless Atomic absorption | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Manganese (TSP) STP | 12132 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 2.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Manganese (TSP) STP | 12132 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Manganese (TSP) STP | 12132 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Manganese (TSP) STP | 12132 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Manganese (TSP) STP | 12132 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.005 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Manganese (TSP) STP | 12132 | 905 | Intermittent | SKC Pump Filter | ICP/AES NIOSH 7300 | 0.35 | 2 | R | Micrograms/cubic meter (25 C) | |||||
| Manganese (TSP) STP | 12132 | 910 | Intermittent | SKC Pump Filter | MOd NISH 7300/6010B SOP 1813 | 0.0313 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Manganese (precip) | 65335 | 082 | Intermittent | PRECIP | ATOMIC ABSORPTION | 0.03 | 0.0 | 2 | R | Milligrams/liter | ||||
| Manganese (precip) | 65335 | 085 | Intermittent | ANDERSON RAINFALL BUCKET | EMISSION SPECTRA ICAP | 0.005 | 0.0 | 3 | R | Milligrams/liter | ||||
| Manganese - 55 (TSP) | 11352 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Manganese PM10 LC | 85132 | 110 | Intermittent | Hi-Vol SA/GMW1200 | ICP/MS | 331.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Manganese PM10 LC | 85132 | 202 | Intermittent | R&P Model 2000 PM10 Teflon | ICP/MS | 0.317 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Manganese PM10 LC | 85132 | 204 | Intermittent | Wedding & Ass. Model 600 PM10 HiVol | ICP-MS | 0.02 | 0.0 | 10000.0 | 2 | R | Nanograms/cubic meter (LC) | |||
| Manganese PM10 LC | 85132 | 216 | Intermittent | Tisch Model TE-Wilbur10 Low-Volume Sampler | ICP-MS | 0.2 | 5 | R | Nanograms/cubic meter (LC) | |||||
| Manganese PM10 LC | 85132 | 501 | Intermittent | Tisch Environmental 6000 Series | ICP-MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (LC) | ||||
| Manganese PM10 LC | 85132 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Manganese PM10 LC | 85132 | 820 | Continuous | Cooper Environmental Services model Xact 620 | X-ray fluorescence (XRF) | 0.067 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Manganese PM10 LC | 85132 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 0.92 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Manganese PM10 LC | 85132 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 0.7 | 0.0 | 99999.99999 | 1 | R | Nanograms/cubic meter (LC) | |||
| Manganese PM10 LC | 85132 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.2 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Manganese PM10 LC | 85132 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.2 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Manganese PM10 LC | 85132 | 907 | Intermittent | R & P Partisol 2025 Teflon | ICPMS | 0.26 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Manganese PM10 LC | 85132 | 908 | Intermittent | MET ONE E-SEQ-FRM | ICP-MS | 0.529 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Manganese PM10 LC | 85132 | 911 | Intermittent | ARA low-volume sampler | ICP-MS | 0.2 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Manganese PM10 STP | 82132 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | |||||
| Manganese PM10 STP | 82132 | 092 | Intermittent | HI-VOL-SA/GMW-321-B | ATOMIC ABSORPTION | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Manganese PM10 STP | 82132 | 096 | Intermittent | Med-Vol SA254 TFE | X-ray fluorescence | 100.0 | 0.0 | -2 | R | Nanograms/cubic meter (25 C) | ||||
| Manganese PM10 STP | 82132 | 102 | Intermittent | HI-VOL-SA/GMW1200 | ATOMIC ABSORPTION | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Manganese PM10 STP | 82132 | 105 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Manganese PM10 STP | 82132 | 106 | Intermittent | HI-VOL-WEDDING-INLET | EMISSION SPECTRA ICAP | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Manganese PM10 STP | 82132 | 107 | Intermittent | HI-VOL-SA/GMW-321B | EMISSION SPECTRA ICAP | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Manganese PM10 STP | 82132 | 109 | Intermittent | Hi Vol SA/GMW 321B | ICP/MS | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Manganese PM10 STP | 82132 | 110 | Intermittent | Hi-Vol SA/GMW1200 Quartz | ICP/MS | 0.06 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Manganese PM10 STP | 82132 | 113 | Intermittent | Hi Vol Anderson IP1076 | ICP/MS | 0.13 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Manganese PM10 STP | 82132 | 201 | Intermittent | R&P Model 2000 PM10 Quartz | ICP/MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Manganese PM10 STP | 82132 | 202 | Intermittent | R&P Model 2000 PM10 Teflon | ICP/MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Manganese PM10 STP | 82132 | 203 | Intermittent | R&P Model 2025 PM10 Teflon | ICP/MS | 0.6 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Manganese PM10 STP | 82132 | 204 | Intermittent | Wedding & Ass. Model 600 PM10 HiVol | ICP-MS | 1.22 | 0.0 | 10000.0 | 2 | R | Nanograms/cubic meter (25 C) | |||
| Manganese PM10 STP | 82132 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Manganese PM10 STP | 82132 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 0.05 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Manganese PM10 STP | 82132 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 0.05 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Manganese PM10 STP | 82132 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 0.05 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Manganese PM10 STP | 82132 | 501 | Intermittent | Tisch Environmental 6000 Series | ICP-MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Manganese PM10 STP | 82132 | 908 | Intermittent | MET ONE E-SEQ-FRM | ICP-MS | 0.529 | 3 | R | Nanograms/cubic meter (25 C) | |||||
| Manganese PM10-2.5 LC | 86132 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00092 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Manganese PM10-2.5 STP | 83132 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Manganese PM2.5 LC | 88132 | 118 | Intermittent | R & P Model 2025 PM2.5 Sequential w/WINS | ICP/MS | 0.00022 | 5.0 | 5 | R | Micrograms/cubic meter (LC) | ||||
| Manganese PM2.5 LC | 88132 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Manganese PM2.5 LC | 88132 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Manganese PM2.5 LC | 88132 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Manganese PM2.5 LC | 88132 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.00231 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Manganese PM2.5 LC | 88132 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES CES XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 0.283 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Manganese PM2.5 LC | 88132 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00092 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Manganese PM2.5 LC | 88132 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00092 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Manganese PM2.5 LC | 88132 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00092 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Manganese PM2.5 LC | 88132 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00092 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Manganese PM2.5 LC | 88132 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00092 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Manganese PM2.5 LC | 88132 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00092 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Manganese PM2.5 LC | 88132 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00092 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Manganese PM2.5 LC | 88132 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Manganese PM2.5 LC | 88132 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 0.0007 | 5000.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Manganese PM2.5 LC | 88132 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0002 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Manganese PM2.5 LC | 88132 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.0002 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Manganese PM2.5 LC | 88132 | 908 | Intermittent | R & P Partisol 2000 | X-Ray Fluorescence | 0.0004 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Manganese PM2.5 STP | 84132 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Mannosan PM2.5 LC | 88391 | 902 | Intermittent | Met One SASS Teflon | Liquid Injection Varian GC/MS | 0.02 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Mannosan PM2.5 LC | 88391 | 903 | Intermittent | BGI Model PQ100 PM2.5 Sampler | Liquid Injection Varian GC/MS | 0.01 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Mannosan PM2.5 LC | 88391 | 907 | Intermittent | Met One SASS Teflon | HPLC Charged Aerosol Detector | 0.1 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Mannosan PM2.5 LC | 88391 | 908 | Intermittent | R&P FRM Model 2000 (Single) | Liquid Injection Varian GC/MS | 0.01 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Mercury (PM2.5 STP particulate bound) | 84242 | 084 | Continuous | Instrumental Tekrans | Atomic Fluorescence | 0.5725 | 0.0 | 3 | R | Nanograms/cubic meter (25 C) | ||||
| Mercury (Reactive Gaseous) | 42243 | 084 | Continuous | Instrumental Tekrans | Atomic Fluorescence | 0.5725 | -0.5725 | 3 | R | Pg/cubic meter(25 C) | ||||
| Mercury (SP) | 22142 | 101 | Intermittent | NADP BUCKET: DRY SIDE | ATOMIC ABSORPTION | 1.0e-05 | 0.0 | 5 | R | Grams/sq meter/month | ||||
| Mercury (TSP) LC | 14142 | 082 | Intermittent | Hi Vol | FLAMELESS AA | 1.0e-05 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Mercury (TSP) LC | 14142 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 3.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (LC) | ||||
| Mercury (TSP) LC | 14142 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 3.0e-05 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Mercury (TSP) LC | 14142 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.189 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Mercury (TSP) LC | 14142 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0006 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Mercury (TSP) STP | 12142 | 082 | Intermittent | Hi Vol | FLAMELESS AA | 1.0e-05 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Mercury (TSP) STP | 12142 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 3.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Mercury (TSP) STP | 12142 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Mercury (TSP) STP | 12142 | 093 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Mercury (TSP) STP | 12142 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 2.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Mercury (TSP) STP | 12142 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Mercury (TSP) STP | 12142 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Mercury (TSP) STP | 12142 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Mercury (deposition) | 65429 | 082 | Intermittent | MIC_BIC sampler, Dual gold amalgamation | Cold vapor atomic fluorescence | 2.0 | 0.0 | 2 | R | Nanograms/cubic meter (0 C) | ||||
| Mercury (precip) | 65329 | 100 | Intermittent | Passive bulk deposition sampling | Oxidation, purge & trap with CVAFS detection (Method 1631) | 0.7 | 0.0 | 1 | R | Nanograms/liter | ||||
| Mercury (vapor) | 42242 | 082 | Intermittent | DUAL GOLD AMALGAMATION | COLD VAPOR ATOMIC FLUORESCENCE | 0.01 | -0.01 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Mercury (vapor) | 42242 | 083 | Continuous | Dual Gold Amalgamation | Cold Vapor Atomic Absorption | 0.01 | -0.01 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Mercury (vapor) | 42242 | 084 | Continuous | Instrumental Tekrans | Atomic Fluorescence | 0.01 | -0.01 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Mercury (vapor) | 42242 | 157 | Continuous | Instrumental | Opsis Model AR 500 | 0.01 | -0.01 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Mercury PM10 LC | 85142 | 110 | Intermittent | Hi-Vol SA/GMW1200 | ICP/MS | 302.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Mercury PM10 LC | 85142 | 202 | Intermittent | R&P Model 2000 PM10 Teflon | ICP/MS | 0.0464 | 4 | R | Nanograms/cubic meter (LC) | |||||
| Mercury PM10 LC | 85142 | 204 | Intermittent | Wedding & Ass. Model 600 PM10 HiVol | ICP-MS | 0.02 | 0.0 | 10000.0 | 2 | R | Nanograms/cubic meter (LC) | |||
| Mercury PM10 LC | 85142 | 216 | Intermittent | Tisch Model TE-Wilbur10 Low-Volume Sampler | ICP-MS | 0.6 | 5 | R | Nanograms/cubic meter (LC) | |||||
| Mercury PM10 LC | 85142 | 501 | Intermittent | Tisch Environmental 6000 Series | ICP-MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (LC) | ||||
| Mercury PM10 LC | 85142 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Mercury PM10 LC | 85142 | 820 | Continuous | Cooper Environmental Services model Xact 620 | X-ray fluorescence (XRF) | 0.043 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Mercury PM10 LC | 85142 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 2.1 | 0.0 | 99999.99999 | 1 | R | Nanograms/cubic meter (LC) | |||
| Mercury PM10 LC | 85142 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.6 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Mercury PM10 LC | 85142 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.6 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Mercury PM10 LC | 85142 | 907 | Intermittent | R & P Partisol 2025 Teflon | ICPMS | 0.26 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Mercury PM10 LC | 85142 | 911 | Intermittent | ARA low-volume sampler | ICP-MS | 0.6 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Mercury PM10 STP | 82142 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | |||||
| Mercury PM10 STP | 82142 | 096 | Intermittent | Med-Vol SA254 TFE | X-ray fluorescence | 100.0 | 0.0 | -2 | R | Nanograms/cubic meter (25 C) | ||||
| Mercury PM10 STP | 82142 | 105 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 25.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Mercury PM10 STP | 82142 | 110 | Intermittent | Hi-Vol SA/GMW1200 Quartz | ICP/MS | 0.03 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Mercury PM10 STP | 82142 | 113 | Intermittent | Hi Vol Anderson IP1076 | ICP/MS | 0.03 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Mercury PM10 STP | 82142 | 202 | Intermittent | R&P Model 2000 PM10 Teflon | ICP/MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Mercury PM10 STP | 82142 | 203 | Intermittent | R&P Model 2025 PM10 Teflon | ICP/MS | 0.0464 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| Mercury PM10 STP | 82142 | 204 | Intermittent | Wedding & Ass. Model 600 PM10 HiVol | ICP-MS | 2.07 | 0.0 | 10000.0 | 2 | R | Nanograms/cubic meter (25 C) | |||
| Mercury PM10 STP | 82142 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Mercury PM10 STP | 82142 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 57.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Mercury PM10 STP | 82142 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 57.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Mercury PM10 STP | 82142 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 57.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Mercury PM10-2.5 STP | 83142 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Mercury PM2.5 LC | 88142 | 811 | Intermittent | Met One SASS Teflon | Energy Dispersive XRF | 0.00437 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Mercury PM2.5 LC | 88142 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 0.189 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Mercury PM2.5 LC | 88142 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00175 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Mercury PM2.5 LC | 88142 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00175 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Mercury PM2.5 LC | 88142 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00175 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Mercury PM2.5 LC | 88142 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00175 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Mercury PM2.5 LC | 88142 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00175 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Mercury PM2.5 LC | 88142 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00175 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Mercury PM2.5 LC | 88142 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 0.0021 | 5000.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Mercury PM2.5 LC | 88142 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0006 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Mercury PM2.5 LC | 88142 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.0006 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Mercury PM2.5 LC | 88142 | 908 | Intermittent | R & P Partisol 2000 | X-Ray Fluorescence | 0.0002 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Mercury PM2.5 STP | 84142 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Mercury compounds | 92142 | 100 | Intermittent | IODATED CARBON TRAPS | COLD VAPOR ATOMIC FLUORESCENCE | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Methacrolein | 43515 | 102 | Intermittent | Cartridge-DNPH-ON-Silica | HPLC Ultraviolet Absorption | 0.4 | -0.4 | 2 | R | Parts per billion Carbon | ||||
| Methacrolein | 43515 | 130 | Intermittent | DNPH-COATED CARTRIDGES | HPLC (TO-14) | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methacrolein | 43515 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methacrolein | 43515 | 156 | Intermittent | Cartridge DNPH on Silica, Heated O3 Denuder | HPLC Photo Diode Array | 0.292 | -0.292 | 1 | R | Parts per billion Carbon | ||||
| Methacrolein | 43515 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methane | 43201 | 011 | Continuous | INSTRUMENTAL | FLAME IONIZATION | 0.1 | -0.1 | 70000.0 | 1 | R | Parts per billion Carbon | |||
| Methane | 43201 | 091 | Intermittent | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 70000.0 | 1 | R | Parts per billion Carbon | |||
| Methane | 43201 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 70000.0 | 1 | R | Parts per billion Carbon | |||
| Methane | 43201 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| Methane | 43201 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 70000.0 | 1 | R | Parts per billion Carbon | |||
| Methane | 43201 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methane | 43201 | 160 | Continuous | INSTRUMENTAL | 8202/8202A:NMOC CAL GAS = METHANE | 0.1 | -0.1 | 70000.0 | 2 | R | Parts per billion Carbon | |||
| Methane | 43201 | 161 | Continuous | INSTRUMENTAL | 8202/8202A:NMOC CAL GAS = PROPANE | 0.1 | -0.1 | 99999.0 | 2 | R | Parts per billion Carbon | |||
| Methane | 43201 | 162 | Continuous | INSTRUMENTAL | 8202/8202A:NMOC CAL GAS = HEXANE | 0.1 | -0.1 | 70000.0 | 2 | R | Parts per billion Carbon | |||
| Methane | 43201 | 164 | Continuous | INSTRUMENTAL | TEI 55:NMOC CAL GAS = PROPANE | 0.1 | -0.1 | 70000.0 | 2 | R | Parts per billion Carbon | |||
| Methane | 43201 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methane | 43201 | 206 | Intermittent | 6L SUBAMBIENT SS-CANISTER | PRECONCENTRATOR GC/FID | 66.0 | -66.0 | 99999.0 | 3 | R | Parts per billion Carbon | |||
| Methane | 43201 | 561 | Continuous | INSTRUMENTAL | Wavelength-Scanned Cavity Ringdown Spectroscopy - Picarro G1301 | 0.21 | -0.21 | 70000.0 | 2 | R | Parts per billion Carbon | |||
| Methanol | 43301 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | 1 | R | Parts per billion Carbon | |||||
| Methanol | 43301 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Methanol | 43301 | 119 | Intermittent | PERSONAL PUMP MOLECULAR SIEVE | GC/MS | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| Methanol | 43301 | 126 | Intermittent | SS Canister Pressurized | Cryogenic Preconcentration GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methanol | 43301 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methanol | 43301 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methoxychlor | 43153 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Methoxychlor | 43153 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Methoxychlor | 43153 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | -0.5 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Methyl Butyl Ketone | 43559 | 101 | Intermittent | Canister Subambient Pressure | Multi Detector GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl Butyl Ketone | 43559 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl Butyl Ketone | 43559 | 113 | Intermittent | SS-Canister_Pressurized | Capillary GC ITD Mass Spectro | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| Methyl Butyl Ketone | 43559 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 29.4 | -29.4 | 1 | R | Parts per billion Carbon | ||||
| Methyl Butyl Ketone | 43559 | 150 | Intermittent | SS 6L - PRESSURIZED CANISTER | CRYOGENIC PRECON:GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl Butyl Ketone | 43559 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl Butyl Ketone | 43559 | 176 | Intermittent | 6L Subatm SS Canister | Entech Precon GC/MS | 0.09 | -0.09 | 3 | R | Parts per billion Carbon | ||||
| Methyl Butyl Ketone | 43559 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl Butyl Ketone | 43559 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl Iodide | 43808 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | Parts per billion Carbon | |||||
| Methyl Iodide | 43808 | 150 | Intermittent | SS 6L- Pressurized Canister | Cryogenic Precon: GC/MS | 0.1 | -0.1 | 1 | Parts per billion Carbon | |||||
| Methyl Parathion | 43160 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Methyl Vinyl Ketone | 43558 | 150 | Intermittent | SS 6L- Pressurized Canister | Cryogenic Precon: GC/MS | 0.1 | -0.1 | 1 | Parts per billion Carbon | |||||
| Methyl chloroform | 43814 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 2250.0 | -2250.0 | 0 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 105 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 107 | Intermittent | TEDLAR-BAG-24-HR-SAMPLE | GC - ELECTRON CAPTURE DETECTOR | 0.03 | -0.03 | 3 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 115 | Intermittent | TENAX TRAP AC PUMP | HEAT DESORPTION GC MASS SPEC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.18 | -0.18 | 3 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 117 | Intermittent | TENAX SORBENT CARTRIDGE | GC/MS | 0.12 | -0.12 | 2 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 118 | Intermittent | TENAX SORBENT CARTRIDGE | GC-FID/ECD | 0.03 | -0.03 | 3 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 119 | Intermittent | PERSONAL PUMP MOLECULAR SIEVE | GC/MS | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 121 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/ELECTRON;GC ECD | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.033 | -0.033 | 2 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.38 | -0.38 | 2 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSDD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 151 | Intermittent | 6L PRESSURIZED CANISTER | CAPILLARY GC-ECD/PID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 168 | Intermittent | 6L PRESSURIZED CANISTER | PACKED COLUMN GC - ECD/PID | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 169 | Intermittent | TEDLAR BAG | PACKED COLUMN GC - ECD/PID | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.04 | -0.04 | 3 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.16 | -0.16 | 2 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl chloroform | 43814 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl chloroform | 43814 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl chloroform | 43814 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl chloroform | 43814 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl chloroform | 43814 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl chloroform | 43814 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl chloroform | 43814 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl chloroform | 43814 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl chloroform | 43814 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl chloroform | 43814 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl chloroform | 43814 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl chloroform | 43814 | 901 | Intermittent | SKC Pump Charcoal Tube | GC/FID NIOSH 1003 | 1.55 | -1.55 | 2 | R | Parts per billion Carbon | ||||
| Methyl chloroform | 43814 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 101 | Intermittent | Canister Subambient Pressure | Multi Detector GC | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 102 | Intermittent | DNPH-COATED CARTRIDGES | HPLC (TO-14) | 0.57 | -0.57 | 1 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 113 | Intermittent | SS-Canister_Pressurized | Capillary GC ITD Mass Spectro | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 114 | Intermittent | CARTRIDGE-DNPH-SILICA-SEP-PAK | HPLC-PHOTODIODE ARRAY | 0.085 | -0.085 | 2 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 119 | Intermittent | PERSONAL PUMP MOLECULAR SIEVE | GC/MS | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 130 | Intermittent | DNPH-COATED CARTRIDGE | HPLC (TO-14) | 2.28 | -2.28 | 1 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 7.37 | -7.37 | 2 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 150 | Intermittent | SS 6L - PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 156 | Intermittent | Cartridge DNPH on Silica, Heated O3 Denuder | HPLC Photo Diode Array | 0.292 | -0.292 | 1 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 176 | Intermittent | 6L Subatm SS Canister | Entech Precon GC/MS | 0.268 | -0.268 | 3 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 203 | Intermittent | C18-DNPH-CARTRIDGE | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.08 | -0.08 | 3 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.36 | -0.36 | 2 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone | 43552 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl ethyl ketone | 43552 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl ethyl ketone | 43552 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl ethyl ketone | 43552 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl ethyl ketone | 43552 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl ethyl ketone | 43552 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl ethyl ketone | 43552 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl ethyl ketone | 43552 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl ethyl ketone | 43552 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl ethyl ketone | 43552 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl ethyl ketone | 43552 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl ethyl ketone | 43552 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl ethyl ketone & methacrolein | 43549 | 165 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | HP LC-1050 W/DIODE ARRAY DETECTOR | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone & methacrolein | 43549 | 166 | Intermittent | ATEC 2400 W/Waters Silica DNPH | TO-11 Dionex DX-300 Ion Chrmtg | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone & methacrolein | 43549 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone & methacrolein | 43549 | 179 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | Liquid Chromatography w/diode array detection | 0.12 | -0.12 | 2 | R | Parts per billion Carbon | ||||
| Methyl ethyl ketone & methacrolein | 43549 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl isoamyl ketone | 16521 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | 0.0 | 2 | R | Parts per billion Carbon | ||||
| Methyl isobutyl ketone | 43560 | 101 | Intermittent | Canister Subambient Pressure | Multi Detector GC | 0.07 | -0.07 | 2 | R | Parts per billion Carbon | ||||
| Methyl isobutyl ketone | 43560 | 102 | Intermittent | CARTRIDGE-DNPH-ON-SILICA | HPLC ULTRAVIOLET ABSORPTION | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| Methyl isobutyl ketone | 43560 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl isobutyl ketone | 43560 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl isobutyl ketone | 43560 | 113 | Intermittent | SS-Canister_Pressurized | Capillary GC ITD Mass Spectro | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| Methyl isobutyl ketone | 43560 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Methyl isobutyl ketone | 43560 | 119 | Intermittent | PERSONAL PUMP MOLECULAR SIEVE | GC/MS | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| Methyl isobutyl ketone | 43560 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl isobutyl ketone | 43560 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl isobutyl ketone | 43560 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl isobutyl ketone | 43560 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 5.48 | -5.48 | 2 | R | Parts per billion Carbon | ||||
| Methyl isobutyl ketone | 43560 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl isobutyl ketone | 43560 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl isobutyl ketone | 43560 | 150 | Intermittent | SS 6L - PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl isobutyl ketone | 43560 | 156 | Intermittent | Cartridge DNPH on Silica, Heated O3 Denuder | HPLC Photo Diode Array | 0.175 | -0.175 | 1 | R | Parts per billion Carbon | ||||
| Methyl isobutyl ketone | 43560 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl isobutyl ketone | 43560 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl isobutyl ketone | 43560 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.24 | -0.24 | 2 | R | Parts per billion Carbon | ||||
| Methyl isobutyl ketone | 43560 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.04 | -0.04 | 3 | R | Parts per billion Carbon | ||||
| Methyl isobutyl ketone | 43560 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.48 | -0.48 | 2 | R | Parts per billion Carbon | ||||
| Methyl isobutyl ketone | 43560 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl isobutyl ketone | 43560 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl isobutyl ketone | 43560 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl isobutyl ketone | 43560 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl isobutyl ketone | 43560 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl isobutyl ketone | 43560 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl isobutyl ketone | 43560 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl isobutyl ketone | 43560 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl isobutyl ketone | 43560 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl isobutyl ketone | 43560 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl isobutyl ketone | 43560 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl isobutyl ketone | 43560 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl isobutyl ketone | 43560 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 1.65 | -1.65 | 2 | R | Parts per billion Carbon | ||||
| Methyl mercaptan | 43901 | 016 | Continuous | INSTRUMENTAL | FLAME PHOTOMETRIC | 1.0 | -1.0 | 0 | R | Parts per billion Carbon | ||||
| Methyl methacrylate | 43441 | 101 | Intermittent | Canister Subambient Pressure | Multi Detector GC | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| Methyl methacrylate | 43441 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl methacrylate | 43441 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Methyl methacrylate | 43441 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl methacrylate | 43441 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl methacrylate | 43441 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl methacrylate | 43441 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| Methyl methacrylate | 43441 | 150 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl methacrylate | 43441 | 176 | Intermittent | 6L Subatm SS Canister | Entech Precon GC/MS | 0.025 | -0.025 | 2 | R | Parts per billion Carbon | ||||
| Methyl methacrylate | 43441 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.04 | -0.04 | 3 | R | Parts per billion Carbon | ||||
| Methyl methacrylate | 43441 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.35 | -0.35 | 2 | R | Parts per billion Carbon | ||||
| Methyl methacrylate | 43441 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl methacrylate | 43441 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl methacrylate | 43441 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl methacrylate | 43441 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl methacrylate | 43441 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl methacrylate | 43441 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl methacrylate | 43441 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl methacrylate | 43441 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl methacrylate | 43441 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl methacrylate | 43441 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl methacrylate | 43441 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl methacrylate | 43441 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl methanesulfonate (TSP) STP | 16787 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 40.4 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Methyl tert-butyl ether | 43372 | 101 | Intermittent | Canister Subambient Pressure | Multi Detector GC | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 113 | Intermittent | SS-Canister_Pressurized | Capillary GC ITD Mass Spectro | 0.05 | -0.05 | 2 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 1.3 | -1.3 | 2 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 131 | Continuous | GC SRI Model #8610 | Thermal Desorber GC/FID | 0.25 | -0.25 | 2 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 1.42 | -1.42 | 2 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 150 | Intermittent | SS 6L - PRESSURIZED CANISTER | CRYOGENIC PRECON:GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 169 | Intermittent | TEDLAR BAG | PACKED COLUMN GC - ECD/PID | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.3 | -0.3 | 2 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.24 | -0.24 | 2 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 204 | Continuous | Instrumental | Process Analyzer GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 205 | Continuous | Preconcentration trap | GC Dual FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.1 | -0.1 | 3 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.3 | -0.3 | 1 | R | Parts per billion Carbon | ||||
| Methyl tert-butyl ether | 43372 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl tert-butyl ether | 43372 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl tert-butyl ether | 43372 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl tert-butyl ether | 43372 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl tert-butyl ether | 43372 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl tert-butyl ether | 43372 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl tert-butyl ether | 43372 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl tert-butyl ether | 43372 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl tert-butyl ether | 43372 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl tert-butyl ether | 43372 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl tert-butyl ether | 43372 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methyl tert-butyl ether | 43372 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclohexane | 43261 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclohexane | 43261 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclohexane | 43261 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclohexane | 43261 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclohexane | 43261 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclohexane | 43261 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| Methylcyclohexane | 43261 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methylcyclohexane | 43261 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclohexane | 43261 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Methylcyclohexane | 43261 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclohexane | 43261 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclohexane | 43261 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclohexane | 43261 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.42 | -0.42 | 2 | R | Parts per billion Carbon | ||||
| Methylcyclohexane | 43261 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.75153 | -0.75153 | 4 | R | Parts per billion Carbon | ||||
| Methylcyclohexane | 43261 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclohexane | 43261 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.31 | -0.31 | 2 | R | Parts per billion Carbon | ||||
| Methylcyclohexane | 43261 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclohexane | 43261 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclohexane | 43261 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclohexane | 43261 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclohexane | 43261 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methylcyclohexane | 43261 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclohexane | 43261 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclohexane | 43261 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclohexane | 43261 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclohexane | 43261 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclohexane | 43261 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclohexane | 43261 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclohexane | 43261 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclohexane | 43261 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclohexane | 43261 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclohexane | 43261 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclohexane | 43261 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclohexane | 43261 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclohexane | 43261 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 1.38 | -1.38 | 2 | R | Parts per billion Carbon | ||||
| Methylcyclopentane | 43262 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclopentane | 43262 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclopentane | 43262 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclopentane | 43262 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclopentane | 43262 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclopentane | 43262 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| Methylcyclopentane | 43262 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methylcyclopentane | 43262 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclopentane | 43262 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Methylcyclopentane | 43262 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclopentane | 43262 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclopentane | 43262 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclopentane | 43262 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| Methylcyclopentane | 43262 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.4031 | -0.4031 | 4 | R | Parts per billion Carbon | ||||
| Methylcyclopentane | 43262 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclopentane | 43262 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.29 | -0.29 | 2 | R | Parts per billion Carbon | ||||
| Methylcyclopentane | 43262 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclopentane | 43262 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclopentane | 43262 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclopentane | 43262 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclopentane | 43262 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Methylcyclopentane | 43262 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Methylcyclopentane | 43262 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclopentane | 43262 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclopentane | 43262 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclopentane | 43262 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclopentane | 43262 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclopentane | 43262 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclopentane | 43262 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclopentane | 43262 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclopentane | 43262 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclopentane | 43262 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclopentane | 43262 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclopentane | 43262 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Methylcyclopentane & 2,4-dimethylpentane | 43346 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Mixing Height | 61301 | 011 | Continuous | RADIOSONDE | CALCULATED | 1.0 | 0.0 | 0 | R | Meters | ||||
| Mixing Height | 61301 | 012 | Continuous | INSTRUMENTAL | MONOSTATIC ACOUSTIC RADAR | 1.0 | 0.0 | 0 | R | Meters | ||||
| Mixing Height | 61301 | 013 | Continuous | INSTRUMENTAL | ACOUSTIC SOUNDER | 30.0 | 0.0 | 0 | R | Meters | ||||
| Mixing Height | 61301 | 127 | Continuous | Instrumental | ACOUSTIC SOUNDER | 1.0 | 0.0 | 0 | R | Meters | ||||
| Mixing Height | 61301 | 128 | Continuous | Instrumental | Optical Scattering Ceilometer | 1.0 | 0 | R | Meters | |||||
| Mixing Speed | 61302 | 011 | Continuous | RADIOSONDE | CALCULATED | 1.0 | 0.0 | 0 | R | Meters/second | ||||
| Mixture PCB 105/132/153 (TSP) STP | 17028 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.0 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Mixture PCB 123/149 (TSP) STP | 17054 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.4 | 0.0 | 2 | Pg/cubic meter(25 C) | |||||
| Mixture PCB 135/144 (TSP) STP | 17029 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Mixture PCB 138/163 (TSP) STP | 17030 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Mixture PCB 15/17 (TSP) STP | 17020 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Mixture PCB 16/32 (TSP) STP | 17050 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 4.0 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Mixture PCB 170/190 (TSP) STP | 17031 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Mixture PCB 171/202 (TSP) STP | 17032 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Mixture PCB 18/32 (TSP) STP | 17021 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Mixture PCB 187/182 (TSP) STP | 17055 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.5 | 0.0 | 2 | Pg/cubic meter(25 C) | |||||
| Mixture PCB 203/196 (TSP) STP | 17033 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Mixture PCB 208/195 (TSP) STP | 17034 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Mixture PCB 28/31 (TSP) STP | 17022 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Mixture PCB 37/42 (TSP) STP | 17023 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 2.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Mixture PCB 4/10 (TSP) STP | 17018 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 6.5 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Mixture PCB 41/71/64 (TSP) STP | 17024 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.25 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Mixture PCB 47/48 (TSP) STP | 17025 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Mixture PCB 56/60 (TSP) STP | 17026 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.25 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Mixture PCB 7/ 9 (TSP) STP | 17019 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 0.75 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Mixture PCB 70/76 (TSP) STP | 17052 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 4.3 | 0.0 | 2 | Pg/cubic meter(25 C) | |||||
| Mixture PCB 77/110 (TSP) STP | 17027 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.0 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Mixture PCB 8/5 (TSP) STP | 17051 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 11.7 | 0.0 | 2 | Pg/cubic meter(25 C) | |||||
| Mixture PCB 92/84 (TSP) STP | 17053 | 121 | Intermittent | Hi Vol Puf (PS-1) | High resolution GC - ECD (Electron Capture Detector) | 1.7 | 0.0 | 2 | Pg/cubic meter(25 C) | |||||
| Molybdenum (TSP) STP | 12134 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0219 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Molybdenum (TSP) STP | 12134 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.0023 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Molybdenum (TSP) STP | 12134 | 091 | Intermittent | HI-VOL | EMISSION SPECTRA MUFFLE FURNACE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Molybdenum (TSP) STP | 12134 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Molybdenum (TSP) STP | 12134 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Molybdenum (TSP) STP | 12134 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Molybdenum (TSP) STP | 12134 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 4.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Molybdenum (TSP) STP | 12134 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Molybdenum (TSP) STP | 12134 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Molybdenum (TSP) STP | 12134 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.004 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Molybdenum (TSP) STP | 12134 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.005 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Molybdenum (TSP) STP | 12134 | 910 | Intermittent | SKC Pump Filter | MOd NISH 7300/6010B SOP 1813 | 0.0365 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Molybdenum (precip) | 65134 | 085 | Intermittent | ANDERSON RAINFALL BUCKET | EMISSION SPECTRA ICAP | 0.01 | 0.0 | 3 | R | Milligrams/liter | ||||
| Molybdenum - 98 (TSP) | 11353 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Molybdenum PM10 LC | 85134 | 110 | Intermittent | Hi-Vol SA/GMW1200 | ICP/MS | 0.04 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Molybdenum PM10 LC | 85134 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Molybdenum PM10 LC | 85134 | 820 | Continuous | Cooper Environmental Services (CES) XACT 625 | X-ray fluorescence (XRF) | 0.981 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Molybdenum PM10 LC | 85134 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.29 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Molybdenum PM10 LC | 85134 | 907 | Intermittent | R & P Partisol 2025 Teflon | ICPMS | 0.26 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Molybdenum PM10 STP | 82134 | 085 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 4.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Molybdenum PM10 STP | 82134 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | |||||
| Molybdenum PM10 STP | 82134 | 106 | Intermittent | HI-VOL-WEDDING-INLET | EMISSION SPECTRA ICAP | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Molybdenum PM10 STP | 82134 | 107 | Intermittent | HI-VOL-SA/GMW-3218 | EMISSION SPECTRA ICAP | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Molybdenum PM10 STP | 82134 | 109 | Intermittent | Hi Vol SA/GMW 321B | ICP/MS | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Molybdenum PM10 STP | 82134 | 201 | Intermittent | R&P Model 2000 PM10 Quartz | ICP/MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Molybdenum PM10 STP | 82134 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Molybdenum PM10 STP | 82134 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 13.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Molybdenum PM10 STP | 82134 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 13.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Molybdenum PM10 STP | 82134 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 13.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Molybdenum PM10-2.5 STP | 83134 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Molybdenum PM2.5 LC | 88134 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Molybdenum PM2.5 LC | 88134 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Molybdenum PM2.5 LC | 88134 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Molybdenum PM2.5 LC | 88134 | 811 | Intermittent | Met One SASS Teflon | Energy Dispersive XRF | 0.00477 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Molybdenum PM2.5 LC | 88134 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 0.981 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Molybdenum PM2.5 LC | 88134 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00191 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Molybdenum PM2.5 LC | 88134 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00191 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Molybdenum PM2.5 LC | 88134 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00191 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Molybdenum PM2.5 LC | 88134 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00191 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Molybdenum PM2.5 LC | 88134 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00191 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Molybdenum PM2.5 LC | 88134 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00191 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Molybdenum PM2.5 LC | 88134 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Molybdenum PM2.5 STP | 84134 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Molybdenum(TSP) LC | 14134 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0219 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Molybdenum(TSP) LC | 14134 | 310 | Intermittent | LO-VOL | ICP-MS | 0.005 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Molybdenum(TSP) LC | 14134 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.981 | 3 | R | Micrograms/cubic meter (LC) | |||||
| N-Nitrosodibutylamine (TSP) STP | 16789 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 24.9 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| N-Nitrosodibutylamine (TSP) STP | 16789 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00026 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| N-Nitrosodiethylamine (TSP) STP | 16790 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 36.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| N-Nitrosodimethylamine (TSP) STP | 16722 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 33.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| N-Nitrosodipropylamine (TSP) STP | 16791 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 27.6 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| N-Nitrosodipropylamine (TSP) STP | 16791 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00016 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| N-Nitrosomethylethylamine (TSP) STP | 16792 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 35.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| N-Nitrosopiperidine (TSP) STP | 16793 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 24.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| N-Nitrosopyrrolidine (TSP) STP | 16794 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 36.6 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| NITROUS OXIDE | 42605 | 130 | Continuous | LGR (Los GAtos Research | Off-Axis ICOS Cavity Ringdown Spectroscopy | 5.0e-05 | 1 | Parts per billion | ||||||
| NOy - NO | 42612 | 674 | Continuous | Instrumental | Chemiluminescence Thermo Electron 42C-Y, 42i-Y | 0.05 | -5.0 | 1000.0 | 1 | T | Parts per billion | |||
| NOy - NO | 42612 | 690 | Continuous | Instrumental | Chemiluminescence Ecotech EC9841T | 0.05 | -5.0 | 200.0 | 1 | T | Parts per billion | |||
| NOy - NO | 42612 | 691 | Continuous | Instrumental | Chemiluminescence Ecotech EC9843 | 0.05 | -5.0 | 200.0 | 1 | T | Parts per billion | |||
| NOy - NO | 42612 | 699 | Continuous | Instrumental | Chemiluminescence Teledyne API 200 EU/501 | 0.05 | -5.0 | 200.0 | 1 | T | Parts per billion | |||
| Naphthalene | 45850 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -2.0 | 1 | R | Parts per billion Carbon | ||||
| Naphthalene | 45850 | 116 | Intermittent | Mixed Sorbent Cartridge | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Naphthalene | 45850 | 136 | Continuous | iNSTRUMENTAL | ENTECH 2000 W/MS/FID | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Naphthalene | 45850 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON GC/MS | 0.1 | 0.0 | 1 | R | Parts per billion Carbon | ||||
| Naphthalene | 45850 | 176 | Intermittent | 6L Subatm SS Canister | Entech Precon GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Naphthalene | 45850 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.04 | -0.04 | 3 | R | Parts per billion Carbon | ||||
| Naphthalene (TSP) STP | 17141 | 101 | Intermittent | HI-VOL/PUF-XAD | GC-MS-SIM | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Naphthalene (TSP) STP | 17141 | 102 | Intermittent | HI-VOL/PUF CARTRIDGE | TO-13- EPA610- EPA625 | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Naphthalene (TSP) STP | 17141 | 105 | Intermittent | Hi Vol/PUF | GC/MS TO-13A | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Naphthalene (TSP) STP | 17141 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Naphthalene (TSP) STP | 17141 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Naphthalene (TSP) STP | 17141 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 34.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Naphthalene (TSP) STP | 17141 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.0001 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Naphthalene (TSP) STP | 17141 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.477 | 0.0 | 3 | R | Nanograms/cubic meter (25 C) | ||||
| Naphthalene (TSP) STP | 17141 | 119 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS-SIM Modified TO-13A | 0.477 | 0.0 | 3 | R | Nanograms/cubic meter (25 C) | ||||
| Naphthalene (TSP) STP | 17141 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.01 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Naphthalene (TSP) STP | 17141 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON GC/MS | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Naphthalene (TSP) STP | 17141 | 904 | Intermittent | SKC Pump XAD-2 SORBENT Tube | HPLC Fluorescence/UV NIOSH 5506 | 690.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Naphthalene (TSP) STP | 17141 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 1610.0 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Naphthalene (TSP) STP | 17141 | 909 | Intermittent | SKC Pump XAD-2 SORBENT Tube | GC/MS NIOSH 5515 REAC SOP 1817 | 3970.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Net radiation | 63305 | 011 | Continuous | Instrumental | Net radiometer | -99.0 | -99.0 | 1 | R | Langleys/minute | ||||
| Nickel (SP) | 22136 | 092 | Intermittent | BUCKET | ATOMIC ABSORPTION | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Nickel (SP) | 22136 | 101 | Intermittent | NADP BUCKET: DRY SIDE | ATOMIC ABSORPTION | 6.0e-05 | 0.0 | 5 | R | Grams/sq meter/month | ||||
| Nickel (TSP) LC | 14136 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.1094 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Nickel (TSP) LC | 14136 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.0056 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Nickel (TSP) LC | 14136 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.004 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Nickel (TSP) LC | 14136 | 107 | Intermittent | HI-VOL | Flameless Atomic absorption | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Nickel (TSP) LC | 14136 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (LC) | ||||
| Nickel (TSP) LC | 14136 | 310 | Intermittent | LO-VOL | ICP-MS | 0.005 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Nickel (TSP) LC | 14136 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.226 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Nickel (TSP) LC | 14136 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0004 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Nickel (TSP) STP | 12136 | 045 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Nickel (TSP) STP | 12136 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.1094 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Nickel (TSP) STP | 12136 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.0056 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Nickel (TSP) STP | 12136 | 091 | Intermittent | HI-VOL | EMISSION SPECTRA MUFFLE FURNACE | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Nickel (TSP) STP | 12136 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.004 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Nickel (TSP) STP | 12136 | 094 | Intermittent | HI-VOL | HEPTOXIME (COLORIMETRIC) | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Nickel (TSP) STP | 12136 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Nickel (TSP) STP | 12136 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.02 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Nickel (TSP) STP | 12136 | 107 | Intermittent | HI-VOL | Flameless Atomic absorption | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Nickel (TSP) STP | 12136 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Nickel (TSP) STP | 12136 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Nickel (TSP) STP | 12136 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Nickel (TSP) STP | 12136 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Nickel (TSP) STP | 12136 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.005 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Nickel (TSP) STP | 12136 | 905 | Intermittent | SKC Pump Filter | ICP/AES NIOSH 7300 | 0.35 | 2 | R | Micrograms/cubic meter (25 C) | |||||
| Nickel (TSP) STP | 12136 | 910 | Intermittent | SKC Pump Filter | MOd NISH 7300/6010B SOP 1813 | 0.0368 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Nickel (precip) | 65336 | 082 | Intermittent | PRECIP | ATOMIC ABSORPTION | 0.03 | 0.0 | 2 | R | Milligrams/liter | ||||
| Nickel (precip) | 65336 | 085 | Intermittent | ANDERSON RAINFALL BUCKET | EMISSION SPECTRA ICAP | 0.05 | 0.0 | 3 | R | Milligrams/liter | ||||
| Nickel - 58 (TSP) | 11359 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.0014 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Nickel - 60 (TSP) | 11354 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Nickel PM10 LC | 85136 | 110 | Intermittent | Hi-Vol SA/GMW1200 | ICP/MS | 354.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Nickel PM10 LC | 85136 | 202 | Intermittent | R&P Model 2000 PM10 Teflon | ICP/MS | 0.402 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Nickel PM10 LC | 85136 | 204 | Intermittent | Wedding & Ass. Model 600 PM10 HiVol | ICP-MS | 0.11 | 0.0 | 10000.0 | 2 | R | Nanograms/cubic meter (LC) | |||
| Nickel PM10 LC | 85136 | 216 | Intermittent | Tisch Model TE-Wilbur10 Low-Volume Sampler | ICP-MS | 0.4 | 5 | R | Nanograms/cubic meter (LC) | |||||
| Nickel PM10 LC | 85136 | 501 | Intermittent | Tisch Environmental 6000 Series | ICP-MS | 0.11 | 0.0 | 2 | R | Nanograms/cubic meter (LC) | ||||
| Nickel PM10 LC | 85136 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Nickel PM10 LC | 85136 | 820 | Continuous | Cooper Environmental Services model Xact 620 | X-ray fluorescence (XRF) | 0.035 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Nickel PM10 LC | 85136 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 0.5 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Nickel PM10 LC | 85136 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 1.4 | 0.0 | 99999.99999 | 1 | R | Nanograms/cubic meter (LC) | |||
| Nickel PM10 LC | 85136 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.4 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Nickel PM10 LC | 85136 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.4 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Nickel PM10 LC | 85136 | 907 | Intermittent | R & P Partisol 2025 Teflon | ICPMS | 0.26 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Nickel PM10 LC | 85136 | 908 | Intermittent | MET ONE E-SEQ-FRM | ICP-MS | 0.34 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Nickel PM10 LC | 85136 | 911 | Intermittent | ARA low-volume sampler | ICP-MS | 0.4 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Nickel PM10 STP | 82136 | 092 | Intermittent | HI-VOL-SA/GMW-321-B | ATOMIC ABSORPTION | 4.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Nickel PM10 STP | 82136 | 096 | Intermittent | Med-Vol SA254 TFE | X-ray fluorescence | 100.0 | 0.0 | -2 | R | Nanograms/cubic meter (25 C) | ||||
| Nickel PM10 STP | 82136 | 102 | Intermittent | HI-VOL-SA/GMW1200 | ATOMIC ABSORPTION | 4.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Nickel PM10 STP | 82136 | 105 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 4.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Nickel PM10 STP | 82136 | 106 | Intermittent | HI-VOL-WEDDING-INLET | EMISSION SPECTRA ICAP | 4.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Nickel PM10 STP | 82136 | 107 | Intermittent | HI-VOL-SA/GMW-321B | EMISSION SPECTRA ICAP | 4.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Nickel PM10 STP | 82136 | 109 | Intermittent | Hi Vol SA/GMW 321B | ICP/MS | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Nickel PM10 STP | 82136 | 110 | Intermittent | Hi-Vol SA/GMW1200 Quartz | ICP/MS | 0.07 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Nickel PM10 STP | 82136 | 113 | Intermittent | Hi Vol Anderson IP1076 | ICP/MS | 0.5 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Nickel PM10 STP | 82136 | 141 | Intermittent | Tisch Environ Model-6070 PM10 Hi-Vol | ICP - AES | 1.2 | 0.0 | 99999.99999 | 1 | R | Nanograms/cubic meter (25 C) | |||
| Nickel PM10 STP | 82136 | 201 | Intermittent | R&P Model 2000 PM10 Quartz | ICP/MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Nickel PM10 STP | 82136 | 202 | Intermittent | R&P Model 2000 PM10 Teflon | ICP/MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Nickel PM10 STP | 82136 | 203 | Intermittent | R&P Model 2025 PM10 Teflon | ICP/MS | 1.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Nickel PM10 STP | 82136 | 204 | Intermittent | Wedding & Ass. Model 600 PM10 HiVol | ICP-MS | 1.79 | 0.0 | 10000.0 | 2 | R | Nanograms/cubic meter (25 C) | |||
| Nickel PM10 STP | 82136 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Nickel PM10 STP | 82136 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Nickel PM10 STP | 82136 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Nickel PM10 STP | 82136 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Nickel PM10 STP | 82136 | 501 | Intermittent | Tisch Environmental 6000 Series | ICP-MS | 0.11 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Nickel PM10 STP | 82136 | 908 | Intermittent | MET ONE E-SEQ-FRM | ICP-MS | 0.34 | 3 | R | Nanograms/cubic meter (25 C) | |||||
| Nickel PM10-2.5 LC | 86136 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.0005 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Nickel PM10-2.5 STP | 83136 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Nickel PM2.5 LC | 88136 | 118 | Intermittent | R & P Model 2025 PM2.5 Sequential w/WINS | ICP/MS | 9.0e-05 | 5.0 | 5 | R | Micrograms/cubic meter (LC) | ||||
| Nickel PM2.5 LC | 88136 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Nickel PM2.5 LC | 88136 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Nickel PM2.5 LC | 88136 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Nickel PM2.5 LC | 88136 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.00125 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Nickel PM2.5 LC | 88136 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY INSTRUMENTAL (XRF) | 0.226 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Nickel PM2.5 LC | 88136 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.0005 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Nickel PM2.5 LC | 88136 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.0005 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Nickel PM2.5 LC | 88136 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.0005 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Nickel PM2.5 LC | 88136 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.0005 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Nickel PM2.5 LC | 88136 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.0005 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Nickel PM2.5 LC | 88136 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.0005 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Nickel PM2.5 LC | 88136 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.0005 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Nickel PM2.5 LC | 88136 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Nickel PM2.5 LC | 88136 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 0.0014 | 5000.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Nickel PM2.5 LC | 88136 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0004 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Nickel PM2.5 LC | 88136 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.0004 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Nickel PM2.5 STP | 84136 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Niobium (TSP) STP | 12147 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Niobium (TSP) STP | 12147 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Niobium PM2.5 LC | 88147 | 811 | Intermittent | Met One SASS Teflon | Energy Dispersive XRF | 0.0042 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Niobium PM2.5 LC | 88147 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00168 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Niobium PM2.5 LC | 88147 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00168 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Niobium PM2.5 LC | 88147 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00168 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Niobium PM2.5 LC | 88147 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00168 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Niobium PM2.5 LC | 88147 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00168 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Niobium PM2.5 LC | 88147 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00168 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Nitrate (SP) | 22306 | 071 | Intermittent | BUCKET | 2-4 XYLENOL (APCA) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Nitrate (SP) | 22306 | 072 | Intermittent | BUCKET | REDUCTION DIAZO (APCA) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Nitrate (SP) | 22306 | 081 | Intermittent | BUCKET | 2-4 XYLENOL (ASTM) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Nitrate (SP) | 22306 | 082 | Intermittent | BUCKET | REDUCTION DIAZO (ASTM) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Nitrate (TSP) LC | 14306 | 096 | Intermittent | HI-VOL | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Nitrate (TSP) STP | 12306 | 091 | Intermittent | HI-VOL | 2-4 XYLENOL | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Nitrate (TSP) STP | 12306 | 092 | Intermittent | HI-VOL | REDUCTION-DIAZO COUPLING | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Nitrate (TSP) STP | 12306 | 093 | Intermittent | HI-VOL | SPECIFIC ION ELECTRODE | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Nitrate (TSP) STP | 12306 | 094 | Intermittent | HI-VOL | PHENOL-DISULFONIC ACID | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Nitrate (TSP) STP | 12306 | 095 | Intermittent | HI-VOL | ULTRAVIOLET SPECTROPHOTOMETRIC | 0.017 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Nitrate (TSP) STP | 12306 | 096 | Intermittent | HI-VOL | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Nitrate (TSP) STP | 12306 | 097 | Intermittent | HI-VOL | COLORIMETRIC CADMIUM REDUCTION | 0.056 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Nitrate (TSP) STP | 12306 | 900 | Intermittent | Teflon CASTNET-style 3-stage filter pack | Ion Chromatography EPA Mehtod 300.0 | 0.007 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Nitrate (precip) | 65321 | 081 | Intermittent | Precipitation | Nessler's reagent | 0.01 | 0.0 | 1 | R | Milligrams/liter | ||||
| Nitrate (precip) | 65321 | 082 | Intermittent | PRECIP | HYDRAZINE REDUCTION | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Nitrate (precip) | 65321 | 083 | Intermittent | PRECIP | COLORIMETRIC | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Nitrate (precip) | 65321 | 084 | Intermittent | PRECIP | ULTRA-VIOLET | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Nitrate (precip) | 65321 | 086 | Intermittent | ANDERSON RAINFALL BUCKET | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.02 | 0.0 | 2 | R | Milligrams/liter | ||||
| Nitrate PM10 STP | 82306 | 062 | Intermittent | HI-VOL-WEDDING-INLET | GRAVIMETRIC | 4.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Nitrate PM10 STP | 82306 | 092 | Intermittent | HI-VOL-SA/GMW-321-B | REDUCTION-DIAZO COUPLING | 0.1 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Nitrate PM10 STP | 82306 | 093 | Intermittent | HI-VOL-SA/GMW-321-B | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.05 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Nitrate PM10 STP | 82306 | 094 | Intermittent | HI-VOL-SA/GMW-321-B | REDUCTION-DIAZO COUPLING | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Nitrate PM10 STP | 82306 | 102 | Intermittent | HI-VOL-SA/GMW1200 | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Nitrate PM10 STP | 82306 | 103 | Intermittent | HI-VOL-WEDDING-INLET | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Nitrate PM2.5 STP | 82356 | 050 | Intermittent | ANNULAR DIFFUSION DENUDER | ION CHROMATOGRAPH | 0.002 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Nitric acid | 42305 | 050 | Intermittent | ANNULAR DIFFUSION DENUDER | ION CHROMATOGRAPH | 0.02 | -0.02 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Nitric acid | 42305 | 101 | Intermittent | SILICA GEL TUBE | IC SCAN | 2.0 | -2.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Nitric acid | 42305 | 900 | Intermittent | Nylon CASTNET-style 3-stage filter pack | Ion Chromatography EPA Mehtod 300.0 | 0.007 | -0.007 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Nitric acid (HNO3) LC | 42309 | 900 | Intermittent | Nylon CASTNET-style 3-stage filter pack | Ion Chromatography EPA Modified Method 300.0 | 0.01 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Nitric oxide (NO) | 42601 | 011 | Continuous | INSTRUMENTAL | COLORIMETRIC | 10.0 | -5.0 | 500.0 | 1 | T | Parts per billion | |||
| Nitric oxide (NO) | 42601 | 014 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | 5.0 | -5.0 | 500.0 | 1 | T | Parts per billion | |||
| Nitric oxide (NO) | 42601 | 021 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0677-021 | MONITOR LABS 8440E | 10.0 | -5.0 | 500.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 022 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0777-022 | BENDIX 8101-C | 10.0 | -5.0 | 500.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 025 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0977-025 | CSI 1600 | 10.0 | -5.0 | 500.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 031 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-1078-031 | MELOY NA530R | 10.0 | -5.0 | 500.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 034 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0179-034 | BECKMAN 952A | 10.0 | -5.0 | 500.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 035 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0179-035 | THERMO ELECTRON 14B/E | 10.0 | -5.0 | 500.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 037 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0279-037 | THERMO ELECTRON 14D/E | 10.0 | -5.0 | 500.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 038 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0479-038 | BENDIX 8101B | 10.0 | -5.0 | 500.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 040 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0879-040 | PHILIPS PW9762/02 | 10.0 | -5.0 | 500.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 042 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0280-042 | MONITOR LABS 8840 | 10.0 | -5.0 | 500.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 061 | Intermittent | GAS-BUBBLER | SALTZMAN (999 AP-11) | 10.0 | -5.0 | 500.0 | 1 | T | Parts per billion | |||
| Nitric oxide (NO) | 42601 | 071 | Intermittent | GAS-BUBBLER | SALTZMAN (50ML TUBE+ORIFICE) | 10.0 | -5.0 | 500.0 | 1 | T | Parts per billion | |||
| Nitric oxide (NO) | 42601 | 074 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-1289-074 | THERMO ENVIRON. INST. MODEL 42 | 10.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 075 | Continuous | LOW LEVEL NOX INSTRUMENTAL | TECO 42S CHEMILUMINESCENCE | 0.05 | -5.0 | 1200.0 | 1 | T | Parts per billion | |||
| Nitric oxide (NO) | 42601 | 082 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0691-082 | ADVANCED POLL INSTR MODEL 200 | 10.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 083 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0991-083 | MONITOR LABS 8841 | 10.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 089 | Continuous | INSTRUMENTAL | GAS PHASE CHEMILUMINESCENCE | 2.7 | -5.0 | 1200.0 | 1 | T | Parts per billion | |||
| Nitric oxide (NO) | 42601 | 090 | Continuous | Instrumental | Gas Phase Chemiluminescence | FRM | RFNA-1292-090 | LEAR SIEGLER MCC ML9841 | 10.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 091 | Intermittent | GAS-BUBBLER | SALTZMAN (100ML TUBE+ORIFICE) | 10.0 | -5.0 | 1200.0 | 1 | T | Parts per billion | |||
| Nitric oxide (NO) | 42601 | 099 | Continuous | INSTRUMENTAL | GAS PHASE CHEMILUMINESCENCE | FRM | RFNA-1104-099 | API MODEL 200A/E NO ANALYZER | 5.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 100 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | 1000.0 | -5.0 | 1200.0 | 1 | T | Parts per billion | |||
| Nitric oxide (NO) | 42601 | 111 | Continuous | Instrumental | Chemiluminescence | 5.0 | -5.0 | 1200.0 | 1 | T | Parts per billion | |||
| Nitric oxide (NO) | 42601 | 146 | Continuous | E. S. A. Model AC32M | Chemiluminescent | FRM | RFNA-0202-146 | Environnement S. A. Model AC32M Chem NOX Analyzer | 5.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 152 | Continuous | Instrumental | Chemiluminescent | FRM | RFNA-0804-152 | SIR S.A. Model S-5012 | 5.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 157 | Continuous | Instrumental | Chemiluminescence | FRM | RFNA_0506-157 | Horiba APNA-370 | 5.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 163 | Continuous | Instrumental | Chemiluminescence | FRM | RFNA-0706-163 | Seres Model NOx 2000 G | 5.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 171 | Continuous | Instrumental | Chemiluminescence | FRM | RFNA-0508-171 | DKK-TOA Corp Model GLN-314E | 5.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 186 | Continuous | Instrumental | Chemiluminescence | FRM | RFNA-0809-186 | Ecotech Serinus 40 Oxides of Nitrogen Analyzer | 5.0 | -5.0 | 500.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 200 | Continuous | Teledyne-API Model 200EUP or T200UP | Photolytic-Chemiluminescence | FEM | EQNA-0512-200 | Teledyne API Chemiluminescence Nitrogen Oxides Analyzer Automated | 0.1 | -5.0 | 2000.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 241 | Continuous | Teledyne-API Model T200P Chemiluminescence | Photolytic-Chemiluminescence | FEM | EQNA-1016-241 | Teledyne API Chemiluminescence Nitrogen Oxides Analyzer Automated | 0.4 | -5.0 | 4000.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 243 | Continuous | 2B Technologies, Model 405 nm | UV-absorbance at 405 nm | FEM | EQNA-0217-243 | 2B Technologies, Model 405 nm | 1.0 | -5.0 | 500.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 256 | Continuous | Instrumental - Teledyne API - Model N500 | Cavity-Attenuated Phase-Shift (CAPS) spectroscopy Nitrogen Oxides Analyzer | FEM | EQNA-0320-256 | T-API N500 CAPS Nitrogen Oxides Analyzer | 0.1 | -5.0 | 1000.0 | 1 | T | Parts per billion |
| Nitric oxide (NO) | 42601 | 574 | Continuous | Instrumental | Chemiluminescence Thermo Electron 42C-Y, 42i-Y | 0.05 | -5.0 | 1000.0 | 1 | T | Parts per billion | |||
| Nitric oxide (NO) | 42601 | 590 | Continuous | Instrumental | Chemiluminescence Ecotech EC9841T | 0.05 | -5.0 | 2000.0 | 1 | T | Parts per billion | |||
| Nitric oxide (NO) | 42601 | 591 | Continuous | Instrumental | Chemiluminescence Ecotech EC9843 | 0.05 | -5.0 | 2000.0 | 1 | T | Parts per billion | |||
| Nitric oxide (NO) | 42601 | 599 | Continuous | Instrumental | Chemiluminescence Teledyne API 200 EU/501 | 0.05 | -5.0 | 1000.0 | 1 | T | Parts per billion | |||
| Nitric oxide (NO) | 42601 | 674 | Continuous | Instrumental | Chemiluminescence Thermo Electron 42C-Y, 42i-Y | 0.05 | -5.0 | 1000.0 | 1 | T | Parts per billion | |||
| Nitric oxide (NO) | 42601 | 690 | Continuous | Instrumental | Chemiluminescence Ecotech EC9841T | 0.05 | -5.0 | 2000.0 | 1 | T | Parts per billion | |||
| Nitric oxide (NO) | 42601 | 691 | Continuous | Instrumental | Chemiluminescence Ecotech EC9843 | 0.05 | -5.0 | 2000.0 | 1 | T | Parts per billion | |||
| Nitric oxide (NO) | 42601 | 699 | Continuous | Instrumental | Chemiluminescence Teledyne API 200 EU/501 | 0.05 | -5.0 | 1000.0 | 1 | T | Parts per billion | |||
| Nitrite | 42609 | 050 | Intermittent | ANNULAR DIFFUSION DENUDER | ION CHROMATOGRAPH | 0.02 | -0.02 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Nitrite (TSP) STP | 12309 | 091 | Intermittent | HI-VOL | DIAZO COUPLING | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Nitrite (precip) | 65343 | 082 | Intermittent | PRECIP | ATOMIC ABSORPTION | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Nitrite PM2.5 LC | 88338 | 803 | Intermittent | IMPROVE Module B with Cyclone Inlet and Glycerin-Nylon Filter, 4.9 sq. cm. | Ion Chromatography | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Nitrite PM2.5 LC | 88338 | 805 | Intermittent | IMPROVE Module B with Cyclone Inlet and Na2CO3-Nylon Filter, 17.4 sq. cm. | Ion Chromatography | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Nitrite PM2.5 LC | 88338 | 806 | Intermittent | IMPROVE Module B with Cyclone Inlet and Na2CO3-Nylon Filter, 4.9 sq. cm. | Ion Chromatography | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Nitrite PM2.5 LC | 88338 | 807 | Intermittent | IMPROVE Module B with Cyclone Inlet and Glycerin/Na2CO3-Nylon Filter, 10.8 sq. cm. | Ion Chromatography | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Nitrite PM2.5 LC | 88338 | 853 | Intermittent | RP Partisol Model 2300 PM2.5 Seq SSampler - Quartz-# | Thermal Optical Reflectance | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Nitrite PM2.5 LC | 88338 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Nitrobenzene | 45705 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Nitrobenzene | 45705 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Nitrobenzene | 45705 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Nitrobenzene (TSP) STP | 16788 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 28.7 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Nitrogen dioxide (NO2) | 42602 | 010 | Intermittent | Integrated Passive Monitor | Ion Chromatography | 0.1 | -5.0 | 400.0 | 1 | T | Parts per billion | |||
| Nitrogen dioxide (NO2) | 42602 | 011 | Continuous | INSTRUMENTAL | COLORIMETRIC-LYSHKOW (MOD) | 10.0 | -5.0 | 400.0 | 1 | T | Parts per billion | |||
| Nitrogen dioxide (NO2) | 42602 | 012 | Continuous | INSTRUMENTAL | COLORIMETRIC-GRIESS-SALTZMAN | 10.0 | -5.0 | 400.0 | 1 | T | Parts per billion | |||
| Nitrogen dioxide (NO2) | 42602 | 013 | Continuous | INSTRUMENTAL | COULOMETRIC | 10.0 | -5.0 | 400.0 | 1 | T | Parts per billion | |||
| Nitrogen dioxide (NO2) | 42602 | 014 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | 5.0 | -5.0 | 400.0 | 1 | T | Parts per billion | |||
| Nitrogen dioxide (NO2) | 42602 | 016 | Continuous | INSTRUMENTAL | POLAND NO2 METHOD | 10.0 | -5.0 | 400.0 | 1 | T | Parts per billion | |||
| Nitrogen dioxide (NO2) | 42602 | 021 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0677-021 | MONITOR LABS 8440E | 5.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 022 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0777-022 | BENDIX 8101-C | 5.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 025 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0977-025 | CSI 1600 | 5.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 031 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-1078-031 | MELOY NA530R | 5.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 034 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0179-034 | BECKMAN 952A | 5.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 035 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0179-035 | THERMO ELECTRON 14B/E | 5.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 037 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0279-037 | THERMO ELECTRON 14D/E | 5.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 038 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0479-038 | BENDIX 8101-B | 5.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 040 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0879-040 | PHILIPS PW9762/02 | 5.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 042 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0280-042 | MONITOR LABS 8840 | 5.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 074 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-1289-074 | THERMO ENVIRON. INST. MODEL 42 | 1.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 082 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0691-082 | ADVANCED POLL INSTR MODEL 200 | 5.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 083 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0991-083 | MONITOR LABS 8841 | 5.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 089 | Continuous | INSTRUMENTAL | GAS-PHASE CHEMILUMINESCENCE | FRM | RFNA-1192-089 | DASIBI EC MODEL 2108 | 5.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 090 | Continuous | INSTRUMENTAL | GAS-PHASE CHEMILUMINESCENCE | FRM | RFNA-1292-090 | ECOTECH/LEAR SIEGLER MCC ML9841 | 5.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 091 | Intermittent | GAS BUBBLER | SALTZMAN (100ML TUBE+ORIFICE) | 2.7 | -5.0 | 400.0 | 1 | T | Parts per billion | |||
| Nitrogen dioxide (NO2) | 42602 | 094 | Intermittent | GAS-BUBBLER | NASN SODIUM ARSENITE - FRIT | 2.7 | -5.0 | 400.0 | 1 | T | Parts per billion | |||
| Nitrogen dioxide (NO2) | 42602 | 095 | Intermittent | GAS-BUBBLER | TEA METHOD - FRIT | 2.7 | -5.0 | 400.0 | 1 | T | Parts per billion | |||
| Nitrogen dioxide (NO2) | 42602 | 096 | Intermittent | GAS-BUBBLER | TGS METHOD - FRIT | 2.7 | -5.0 | 400.0 | 1 | T | Parts per billion | |||
| Nitrogen dioxide (NO2) | 42602 | 097 | Intermittent | GAS-BUBBLER | TEA METHOD - ORIFICE | 2.7 | -5.0 | 400.0 | 1 | T | Parts per billion | |||
| Nitrogen dioxide (NO2) | 42602 | 099 | Continuous | INSTRUMENTAL | GAS PHASE CHEMILUMINESCENCE | FRM | RFNA-1194-099 | API MODEL 200A/E NO ANALYZER | 2.7 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 102 | Continuous | INSTRUMENTAL | OPEN PATH NO ANALYZER | FEM | EQNA-0495-102 | OPSIS MODEL AR 500 SYSTEM | 1.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 104 | Continuous | INSTRUMENTAL | GAS PHASE CHEMILUMINESCENCE | FRM | RFNA-0795-104 | ENV.SA MODEL AC 31M NO | 5.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 111 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0196-111 | HORIBA APNA-360 | 5.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 121 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0798-121 | DDK CORP MODEL GLN-114E | 5.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 139 | Continuous | Instrumental | Open Path NO2 Analyzer | FEM | EQNA-0400-139 | SANOA Longpath | 1.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 146 | Continuous | E. S. A. Model AC32M | Chemiluminescent | FRM | RFNA-0202-146 | Environnement S. A. Model AC32M Chem NOX Analyzer | 1.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 152 | Continuous | Instrumental | Chemiluminescent | FRM | RFNA-0804-152 | SIR S.A. Model S-5012 | 5.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 157 | Continuous | Instrumental | Chemiluminescence | FRM | RFNA-0506-157 | HORIBA APNA-370 | 5.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 163 | Continuous | Instrumental | Chemiluminescence | FRM | RFNA-0706-163 | Seres Model NOx 2000 G | 5.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 171 | Continuous | Instrumental | Chemiluminescence | FRM | RFNA-0508-171 | DKK-TOA Corp Model GLN-314E | 5.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 186 | Continuous | Instrumental | Chemiluminescence | FRM | RFNA-0809-186 | Ecotech Serinus 40 Oxides of Nitrogen Analyzer | 5.0 | -5.0 | 500.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 200 | Continuous | Teledyne-API Model 200EUP or T200UP | Photolytic-Chemiluminescence | FEM | EQNA-0512-200 | Teledyne API Chemiluminescence Nitrogen Oxides Analyzer Automated | 0.1 | -5.0 | 2000.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 210 | Continuous | Environnement S.A. Model AS32M | Cavity Attenuated Phase Shift Spectroscopy | FEM | EQNA-1013-210 | Environnement S.A. Model AS32M Nitrogen Dioxide Analyzer Automated | 0.04 | -5.0 | 1000.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 212 | Continuous | Teledyne Model T500U | Cavity Attenuated Phase Shift Spectroscopy | FEM | EQNA-0514-212 | Teledyne Advanced Pollution Instrumentation, Model T500U cavity attenuated phase shift spectroscopy Nitrogen Dioxide Ana | 0.04 | -5.0 | 1000.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 241 | Continuous | Teledyne-API Model T200P Chemiluminescence | Photolytic-Chemiluminescence | FEM | EQNA-1016-241 | Teledyne API Chemiluminescence Nitrogen Oxides Analyzer Automated | 0.4 | -5.0 | 4000.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 243 | Continuous | 2B Technologies, Model 405 nm | UV-absorbance at 405 nm | FEM | EQNA-0217-243 | 2B Technologies, Model 405 nm | 1.0 | -5.0 | 500.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 256 | Continuous | Instrumental - Teledyne API - Model N500 | Cavity-Attenuated Phase-Shift (CAPS) spectroscopy Nitrogen Oxides Analyzer | FEM | EQNA-0320-256 | T-API N500 CAPS Nitrogen Oxides Analyzer | 0.1 | -5.0 | 500.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 574 | Continuous | Instrumental | Chemiluminescence Thermo Electron 42C-TL, 42i-TL | FRM | RFNA-1289-074 | THERMO ENVIRON. INST. MODEL 42 | 0.05 | -5.0 | 1000.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 590 | Continuous | Instrumental | Chemiluminescence Ecotech EC9841T | FRM | RFNA-1292-090 | ECOTECH EC9841T | 0.05 | -5.0 | 2000.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | 599 | Continuous | Instrumental | Chemiluminescence Teledyne API 200 EU/501 | FRM | RFNA-1194-099 | API MODEL 200A/E NO ANALYZER | 0.05 | -5.0 | 200.0 | 1 | T | Parts per billion |
| Nitrogen dioxide (NO2) | 42602 | FBA | Continuous | Gas calibrator with independent flow rate transfer standards | Audit using challenge gas standard | 0.0 | 0.0 | 1500.0 | 4 | T | Parts per billion | |||
| Nitrous acid | 42308 | 050 | Intermittent | ANNULAR DIFFUSION DENUDER | ION CHROMATOGRAPH | 0.02 | -0.02 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Non-volatile Nitrate PM2.5 LC | 88310 | 834 | Intermittent | URG MASS400 Teflon WINS | Ion Chromatography | 0.003 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Non-volatile Nitrate PM2.5 LC | 88310 | 845 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | ION CHROMATOGRAPHY | 0.0006 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Non-volatile Nitrate PM2.5 LC | 88310 | 848 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | Ion Chromatography | 0.027 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Non-volatile Nitrate PM2.5 LC | 88310 | 849 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | ION CHROMATOGRAPHY | 0.0006 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Non-volatile Nitrate PM2.5 LC | 88310 | 874 | Intermittent | URG MASS400 Teflon VSCC | Ion Chromatography | 0.003 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Non-volatile Nitrate PM2.5 LC | 88310 | 878 | Intermittent | Andersen RAAS Quartz | Ion Chromatography | 0.0625 | 50.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Non-volatile Nitrate PM2.5 LC | 88310 | 885 | Intermittent | Model 2025 Dichot Sequential Teflon | Ion Chromatography | 0.003 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Non-volatile nitrate PC10 LC | 85310 | 890 | Intermittent | Model 2025 PM10 Sequential Teflon | Ion Chromatography | 0.0006 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Non-volatile nitrate PM10-2.5 LC | 86310 | 885 | Intermittent | Model 2025 Dichot Sequential Teflon | Ion Chromatography | 0.0006 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Nonachlorobiphenyl (TSP) STP | 17817 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 2.0 | 0.0 | 0 | R | Pg/cubic meter(25 C) | ||||
| Nonanal | 43524 | 102 | Continuous | Cartridge-DNPH-on silica | HPLC Ultraviolet Absorption | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Nonanal | 43524 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Nonanal | 43524 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 15.31 | -15.31 | 2 | R | Parts per billion Carbon | ||||
| Nylon deterioration | 72501 | 091 | Intermittent | NYLON PANEL | OPTICAL EVALUATION | 1.0 | 0.0 | 0 | R | # Defects/7.7 sq inches/month | ||||
| O-xylene & N-nonane | 45140 | 123 | Intermittent | 6L Pressurized Canister | Dual FID - PAMS | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| OC CSN Unadjusted PM2.5 LC TOT | 88305 | 803 | Intermittent | IMPROVE | STN TOT | 0.021 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC CSN Unadjusted PM2.5 LC TOT | 88305 | 813 | Intermittent | Met One SASS Quartz | STN TOT | 0.245 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC CSN Unadjusted PM2.5 LC TOT | 88305 | 823 | Intermittent | Andersen RAAS Quartz | STN TOT | 0.224 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC CSN Unadjusted PM2.5 LC TOT | 88305 | 833 | Intermittent | URG MASS450 Quartz WINS | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC CSN Unadjusted PM2.5 LC TOT | 88305 | 843 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC CSN Unadjusted PM2.5 LC TOT | 88305 | 847 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC CSN Unadjusted PM2.5 LC TOT | 88305 | 853 | Intermittent | R&P MDL2300 PM2.5 Seq Spec Quartz | STN TOT | 0.163 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC CSN Unadjusted PM2.5 LC TOT | 88305 | 860 | Continuous | R&P MODEL 5400 | STN TOT | 0.2 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC CSN Unadjusted PM2.5 LC TOT | 88305 | 867 | Continuous | Sunset Labs | TOT | 0.2 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC CSN Unadjusted PM2.5 LC TOT | 88305 | 873 | Intermittent | URG MASS450 Quartz VSCC | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC CSN Unadjusted PM2.5 LC TOT | 88305 | 899 | Intermittent | Unknown-Unknown | STN TOT | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC CSN Unadjusted PM2.5 STP TOT | 84305 | 867 | Continuous | Sunset Labs | TOT | 0.2 | 0.0 | 2 | Micrograms/cubic meter (20 C) | |||||
| OC CSN_Rev Unadjusted PM2.5 LC TOR | 88370 | 816 | Intermittent | Met One SASS/SuperSASS Quartz | IMPROVE_A | 0.4 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC CSN_Rev Unadjusted PM2.5 LC TOR | 88370 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | OC1+OC2+OC3+OC4+(OP(TOR))=(88374+88375+88376+88377+88378) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC CSN_Rev Unadjusted PM2.5 LC TOR | 88370 | 843 | Intermittent | Met One SASS 22 LPM Quartz | OC1+OC2+OC3+OC4+(OP(TOR))=(88374+88375+88376+88377+88378) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC CSN_Rev Unadjusted PM2.5 LC TOR | 88370 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC CSN_Rev Unadjusted PM2.5 LC TOR | 88370 | 892 | Intermittent | Model 2025 PM2.5 Sequential Quartz VSCC | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC CSN_Rev Unadjusted PM2.5 LC TOT | 88355 | 816 | Intermittent | Met One SASS Quartz | OC1+OC2+OC3+OC4+OP (88374+88375+88376+88377+88388) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC CSN_Rev Unadjusted PM2.5 LC TOT | 88355 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | OC1+OC2+OC3+OC4+OP (88374+88375+88376+88377+88388) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC CSN_Rev Unadjusted PM2.5 LC TOT | 88355 | 839 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | OC1+OC2+OC3+OC4+(OP(TOT))=(88374+88375+88376+88377+88388) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC CSN_Rev Unadjusted PM2.5 LC TOT | 88355 | 843 | Intermittent | Met One SASS 22 LPM Quartz | OC1+OC2+OC3+OC4+(OP(TOT))=(88374+88375+88376+88377+88388) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC CSN_Rev Unadjusted PM2.5 LC TOT | 88355 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC CSN_Rev Unadjusted PM2.5 LC TOT | 88355 | 892 | Intermittent | Model 2025 PM2.5 Sequential Quartz VSCC | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC CSN_rev Unadjusted PM10 LC TOR | 85370 | 888 | Intermittent | Model 2025 PM10 Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| OC CSN_rev Unadjusted PM10 LC TOT | 85355 | 888 | Intermittent | Model 2025 PM10 Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| OC CSN_rev Unadjusted PM10-2.5 LC TOR | 86370 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| OC CSN_rev Unadjusted PM10-2.5 LC TOT | 86355 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| OC PM2.5 LC TOR | 88320 | 805 | Intermittent | IMPROVE | OC1+OC2+OC3+OC4+OP | 0.087 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC PM2.5 LC TOR | 88320 | 809 | Intermittent | IMPROVE Module C with Cyclone Inlet-Quartz Filter | OC1+OC2+OC3+OC4+OP (88324+88325+88326+88327+88328) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC PM2.5 LC TOR | 88320 | 815 | Intermittent | Met One SASS Quartz | OC1+OC2+OC3+OC4+OP | 1.005 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC PM2.5 LC TOR | 88320 | 816 | Intermittent | Met One SASS/SuperSASS Quartz | OC1+OC2+OC3+OC4+(OP(TOR))=(88324+88325+88326+88327+88328) | 0.002 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC PM2.5 LC TOR | 88320 | 825 | Intermittent | Andersen RAAS Quartz | OC1+OC2+OC3+OC4+OP | 0.918 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC PM2.5 LC TOR | 88320 | 827 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | OC1+OC2+OC3+OC4+(OP(TOR))=(88324+88325+88326+88327+88328) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC PM2.5 LC TOR | 88320 | 837 | Intermittent | URG MASS450 Quartz WINS | OC1+OC2+OC3+OC4+OP | 0.025 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC PM2.5 LC TOR | 88320 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | OC1+OC2+OC3+OC4+OP (88324+88325+88326+88327+88328) | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC PM2.5 LC TOR | 88320 | 855 | Intermittent | R&P MDL2300 PM2.5 Seq Spec Quartz | OC1+OC2+OC3+OC4+OP | 0.67 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC PM2.5 LC TOR | 88320 | 857 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | OC1+OC2+OC3+OC4+OP | 0.402 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC PM2.5 LC TOR | 88320 | 859 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | OC1+OC2+OC3+OC4+OP | 0.402 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC PM2.5 LC TOR | 88320 | 877 | Intermittent | URG MASS450 Quartz VSCC | OC1+OC2+OC3+OC4+OP | 0.025 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC PM2.5 LC TOR | 88320 | 899 | Intermittent | Unknown-Unknown | OC1+OC2+OC3+OC4+OP | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC PM2.5 LC TOT | 88382 | 815 | Intermittent | MET ONE SASS QUARTZ | OC1+OC2+OC3+OC4+(OP(TOT))=(88324+88325+88326+88327+88379) | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| OC PM2.5 LC TOT | 88382 | 816 | Intermittent | MET ONE SASS QUARTZ | OC1+OC2+OC3+OC4+(OP(TOT))=(88324+88325+88326+88327+88379) | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| OC PM2.5 LC TOT | 88382 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | OC1+OC2+OC3+OC4+(OP(TOT))=(88324+88325+88326+88327+88379) | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| OC PM2.5 LC TOT | 88382 | 851 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | OC1+OC2+OC3+OC4+ (OP(TOT)) = (88324+88325+88326+88327+88379) | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| OC1 CSN Unadjusted PM2.5 LC TOT | 88332 | 145 | Intermittent | RP Partisol Model 2000 PM2.5 FRM Air Sampler-# | STN TOT | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC1 CSN Unadjusted PM2.5 LC TOT | 88332 | 803 | Intermittent | IMPROVE | STN TOT | 0.021 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC1 CSN Unadjusted PM2.5 LC TOT | 88332 | 809 | Intermittent | IMPROVE Module C with Cyclone Inlet-Quartz Filter | STN TOT | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC1 CSN Unadjusted PM2.5 LC TOT | 88332 | 813 | Intermittent | Met One SASS Quartz | STN TOT | 0.245 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC1 CSN Unadjusted PM2.5 LC TOT | 88332 | 823 | Intermittent | Andersen RAAS Quartz | STN TOT | 0.224 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC1 CSN Unadjusted PM2.5 LC TOT | 88332 | 833 | Intermittent | URG MASS450 Quartz WINS | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC1 CSN Unadjusted PM2.5 LC TOT | 88332 | 843 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC1 CSN Unadjusted PM2.5 LC TOT | 88332 | 847 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC1 CSN Unadjusted PM2.5 LC TOT | 88332 | 853 | Intermittent | R&P MDL2300 PM2.5 Seq Spec Quartz | STN TOT | 0.163 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC1 CSN Unadjusted PM2.5 LC TOT | 88332 | 873 | Intermittent | URG MASS450 Quartz VSCC | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC1 CSN Unadjusted PM2.5 LC TOT | 88332 | 899 | Intermittent | No Method-None | STN TOT | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC1 CSN_Rev Unadjusted PM2.5 LC | 88374 | 816 | Intermittent | Met One SASS/SuperSASS Quartz | IMPROVE_A | 0.4 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC1 CSN_Rev Unadjusted PM2.5 LC | 88374 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE TOR | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC1 CSN_Rev Unadjusted PM2.5 LC | 88374 | 841 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC1 CSN_Rev Unadjusted PM2.5 LC | 88374 | 843 | Intermittent | Met One SASS 22 LPM Quartz | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC1 CSN_Rev Unadjusted PM2.5 LC | 88374 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC1 CSN_Rev Unadjusted PM2.5 LC | 88374 | 892 | Intermittent | Model 2025 PM2.5 Sequential Quartz VSCC | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC1 CSN_rev Unadjusted PM10 LC | 85374 | 888 | Intermittent | Model 2025 PM10 Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| OC1 CSN_rev Unadjusted PM10-2.5 LC | 86374 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| OC1 PM2.5 LC | 88324 | 804 | Intermittent | IMPROVE | IMPROVE TOR w/ Adjustment | 0.01 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC1 PM2.5 LC | 88324 | 809 | Intermittent | IMPROVE Module C with Cyclone Inlet-Quartz Filter | IMPROVE TOR w/Adjustment | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC1 PM2.5 LC | 88324 | 814 | Intermittent | Met One SASS Quartz | IMPROVE TOR w/ Adjustment | 0.11 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC1 PM2.5 LC | 88324 | 816 | Intermittent | Met One SASS/SuperSASS Quartz | IMPROVE_A TOR w/ Adjustment | 0.002 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC1 PM2.5 LC | 88324 | 817 | Intermittent | Met One SASS Quartz | IMPROVE TOR w/o Adjustment | 0.11 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC1 PM2.5 LC | 88324 | 824 | Intermittent | Andersen RAAS Quartz | IMPROVE TOR w/ Adjustment | 0.101 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC1 PM2.5 LC | 88324 | 836 | Intermittent | URG MASS450 Quartz WINS | IMPROVE TOR w/ Adjustment | 0.044 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC1 PM2.5 LC | 88324 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE TOR w/STN Urban Adjustment | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC1 PM2.5 LC | 88324 | 846 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE_A w/CSN urban adjustment | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC1 PM2.5 LC | 88324 | 854 | Intermittent | R&P MDL2300 PM2.5 Seq Spec Quartz | IMPROVE TOR w/ Adjustment | 0.074 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC1 PM2.5 LC | 88324 | 856 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | IMPROVE TOR w/ Adjustment | 0.044 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC1 PM2.5 LC | 88324 | 858 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | IMPROVE TOR w/ Adjustment | 0.044 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC1 PM2.5 LC | 88324 | 876 | Intermittent | URG MASS450 Quartz VSCC | IMPROVE TOR w/ Adjustment | 0.044 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC2 CSN Unadjusted PM2.5 LC TOT | 88333 | 145 | Intermittent | RP Partisol Model 2000 PM2.5 FRM Air Sampler-# | STN TOT | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC2 CSN Unadjusted PM2.5 LC TOT | 88333 | 803 | Intermittent | IMPROVE | STN TOT | 0.021 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC2 CSN Unadjusted PM2.5 LC TOT | 88333 | 809 | Intermittent | IMPROVE Module C with Cyclone Inlet-Quartz Filter | STN TOT | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC2 CSN Unadjusted PM2.5 LC TOT | 88333 | 813 | Intermittent | Met One SASS Quartz | STN TOT | 0.245 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC2 CSN Unadjusted PM2.5 LC TOT | 88333 | 823 | Intermittent | Andersen RAAS Quartz | STN TOT | 0.224 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC2 CSN Unadjusted PM2.5 LC TOT | 88333 | 833 | Intermittent | URG MASS450 Quartz WINS | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC2 CSN Unadjusted PM2.5 LC TOT | 88333 | 843 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC2 CSN Unadjusted PM2.5 LC TOT | 88333 | 847 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC2 CSN Unadjusted PM2.5 LC TOT | 88333 | 853 | Intermittent | R&P MDL2300 PM2.5 Seq Spec Quartz | STN TOT | 0.163 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC2 CSN Unadjusted PM2.5 LC TOT | 88333 | 873 | Intermittent | URG MASS450 Quartz VSCC | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC2 CSN Unadjusted PM2.5 LC TOT | 88333 | 899 | Intermittent | No Method-None | STN TOT | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC2 CSN_Rev Unadjusted PM2.5 LC | 88375 | 816 | Intermittent | Met One SASS/SuperSASS Quartz | IMPROVE_A | 0.4 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC2 CSN_Rev Unadjusted PM2.5 LC | 88375 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE TOR | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC2 CSN_Rev Unadjusted PM2.5 LC | 88375 | 841 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC2 CSN_Rev Unadjusted PM2.5 LC | 88375 | 843 | Intermittent | Met One SASS 22 LPM Quartz | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC2 CSN_Rev Unadjusted PM2.5 LC | 88375 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC2 CSN_Rev Unadjusted PM2.5 LC | 88375 | 892 | Intermittent | Model 2025 PM2.5 Sequential Quartz VSCC | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC2 CSN_rev Unadjusted PM10 LC | 85375 | 888 | Intermittent | Model 2025 PM10 Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| OC2 CSN_rev Unadjusted PM10-2.5 LC | 86375 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| OC2 PM2.5 LC | 88325 | 804 | Intermittent | IMPROVE | IMPROVE TOR w/ Adjustment | 0.018 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC2 PM2.5 LC | 88325 | 809 | Intermittent | IMPROVE Module C with Cyclone Inlet-Quartz Filter | IMPROVE TOR w/Adjustment | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC2 PM2.5 LC | 88325 | 814 | Intermittent | Met One SASS Quartz | IMPROVE TOR w/ Adjustment | 0.208 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC2 PM2.5 LC | 88325 | 816 | Intermittent | Met One SASS/SuperSASS Quartz | IMPROVE_A TOR w/ Adjustment | 0.002 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC2 PM2.5 LC | 88325 | 817 | Intermittent | Met One SASS Quartz | IMPROVE TOR w/o Adjustment | 0.208 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC2 PM2.5 LC | 88325 | 824 | Intermittent | Andersen RAAS Quartz | IMPROVE TOR w/ Adjustment | 0.19 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC2 PM2.5 LC | 88325 | 836 | Intermittent | URG MASS450 Quartz WINS | IMPROVE TOR w/ Adjustment | 0.083 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC2 PM2.5 LC | 88325 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE TOR w/STN Urban Adjustment | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC2 PM2.5 LC | 88325 | 846 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE_A w/CSN urban adjustment | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC2 PM2.5 LC | 88325 | 854 | Intermittent | R&P MDL2300 PM2.5 Seq Spec Quartz | IMPROVE TOR w/ Adjustment | 0.139 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC2 PM2.5 LC | 88325 | 856 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | IMPROVE TOR w/ Adjustment | 0.083 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC2 PM2.5 LC | 88325 | 858 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | IMPROVE TOR w/ Adjustment | 0.083 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC2 PM2.5 LC | 88325 | 876 | Intermittent | URG MASS450 Quartz VSCC | IMPROVE TOR w/ Adjustment | 0.083 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC3 CSN Unadjusted PM2.5 LC TOT | 88334 | 145 | Intermittent | RP Partisol Model 2000 PM2.5 FRM Air Sampler-# | STN TOT | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC3 CSN Unadjusted PM2.5 LC TOT | 88334 | 803 | Intermittent | IMPROVE | STN TOT | 0.021 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC3 CSN Unadjusted PM2.5 LC TOT | 88334 | 809 | Intermittent | IMPROVE Module C with Cyclone Inlet-Quartz Filter | STN TOT | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC3 CSN Unadjusted PM2.5 LC TOT | 88334 | 813 | Intermittent | Met One SASS Quartz | STN TOT | 0.245 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC3 CSN Unadjusted PM2.5 LC TOT | 88334 | 823 | Intermittent | Andersen RAAS Quartz | STN TOT | 0.224 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC3 CSN Unadjusted PM2.5 LC TOT | 88334 | 833 | Intermittent | URG MASS450 Quartz WINS | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC3 CSN Unadjusted PM2.5 LC TOT | 88334 | 843 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC3 CSN Unadjusted PM2.5 LC TOT | 88334 | 847 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC3 CSN Unadjusted PM2.5 LC TOT | 88334 | 853 | Intermittent | R&P MDL2300 PM2.5 Seq Spec Quartz | STN TOT | 0.163 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC3 CSN Unadjusted PM2.5 LC TOT | 88334 | 873 | Intermittent | URG MASS450 Quartz VSCC | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC3 CSN Unadjusted PM2.5 LC TOT | 88334 | 899 | Intermittent | No Method-None | STN TOT | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC3 CSN_Rev Unadjusted PM2.5 LC | 88376 | 816 | Intermittent | Met One SASS/SuperSASS Quartz | IMPROVE_A | 0.4 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC3 CSN_Rev Unadjusted PM2.5 LC | 88376 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE TOR | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC3 CSN_Rev Unadjusted PM2.5 LC | 88376 | 841 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC3 CSN_Rev Unadjusted PM2.5 LC | 88376 | 843 | Intermittent | Met One SASS 22 LPM Quartz | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC3 CSN_Rev Unadjusted PM2.5 LC | 88376 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC3 CSN_Rev Unadjusted PM2.5 LC | 88376 | 892 | Intermittent | Model 2025 PM2.5 Sequential Quartz VSCC | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC3 CSN_rev Unadjusted PM10 LC | 85376 | 888 | Intermittent | Model 2025 PM10 Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| OC3 CSN_rev Unadjusted PM10-2.5 LC | 86376 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| OC3 PM2.5 LC | 88326 | 804 | Intermittent | IMPROVE | IMPROVE TOR w/ Adjustment | 0.06 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC3 PM2.5 LC | 88326 | 809 | Intermittent | IMPROVE Module C with Cyclone Inlet-Quartz Filter | IMPROVE TOR w/Adjustment | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC3 PM2.5 LC | 88326 | 814 | Intermittent | Met One SASS Quartz | IMPROVE TOR w/ Adjustment | 0.686 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC3 PM2.5 LC | 88326 | 816 | Intermittent | Met One SASS/SuperSASS Quartz | IMPROVE_A TOR w/ Adjustment | 0.002 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC3 PM2.5 LC | 88326 | 817 | Intermittent | Met One SASS Quartz | IMPROVE TOR w/o Adjustment | 0.686 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC3 PM2.5 LC | 88326 | 824 | Intermittent | Andersen RAAS Quartz | IMPROVE TOR w/ Adjustment | 0.627 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC3 PM2.5 LC | 88326 | 836 | Intermittent | URG MASS450 Quartz WINS | IMPROVE TOR w/ Adjustment | 0.274 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC3 PM2.5 LC | 88326 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE TOR w/STN Urban Adjustment | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC3 PM2.5 LC | 88326 | 846 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE_A w/CSN urban adjustment | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC3 PM2.5 LC | 88326 | 854 | Intermittent | R&P MDL2300 PM2.5 Seq Spec Quartz | IMPROVE TOR w/ Adjustment | 0.457 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC3 PM2.5 LC | 88326 | 856 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | IMPROVE TOR w/ Adjustment | 0.274 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC3 PM2.5 LC | 88326 | 858 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | IMPROVE TOR w/ Adjustment | 0.274 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC3 PM2.5 LC | 88326 | 876 | Intermittent | URG MASS450 Quartz VSCC | IMPROVE TOR w/ Adjustment | 0.274 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC4 CSN Unadjusted PM2.5 LC TOT | 88335 | 145 | Intermittent | RP Partisol Model 2000 PM2.5 FRM Air Sampler-# | STN TOT | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC4 CSN Unadjusted PM2.5 LC TOT | 88335 | 803 | Intermittent | IMPROVE | STN TOT | 0.021 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC4 CSN Unadjusted PM2.5 LC TOT | 88335 | 809 | Intermittent | IMPROVE Module C with Cyclone Inlet-Quartz Filter | STN TOT | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC4 CSN Unadjusted PM2.5 LC TOT | 88335 | 813 | Intermittent | Met One SASS Quartz | STN TOT | 0.245 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC4 CSN Unadjusted PM2.5 LC TOT | 88335 | 823 | Intermittent | Andersen RAAS Quartz | STN TOT | 0.224 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC4 CSN Unadjusted PM2.5 LC TOT | 88335 | 833 | Intermittent | URG MASS450 Quartz WINS | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC4 CSN Unadjusted PM2.5 LC TOT | 88335 | 843 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC4 CSN Unadjusted PM2.5 LC TOT | 88335 | 847 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC4 CSN Unadjusted PM2.5 LC TOT | 88335 | 853 | Intermittent | R&P MDL2300 PM2.5 Seq Spec Quartz | STN TOT | 0.163 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC4 CSN Unadjusted PM2.5 LC TOT | 88335 | 873 | Intermittent | URG MASS450 Quartz VSCC | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC4 CSN Unadjusted PM2.5 LC TOT | 88335 | 899 | Intermittent | No Method-None | STN TOT | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC4 CSN_Rev Unadjusted PM2.5 LC | 88377 | 816 | Intermittent | Met One SASS/SuperSASS Quartz | IMPROVE_A | 0.4 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC4 CSN_Rev Unadjusted PM2.5 LC | 88377 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE TOR | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC4 CSN_Rev Unadjusted PM2.5 LC | 88377 | 841 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC4 CSN_Rev Unadjusted PM2.5 LC | 88377 | 843 | Intermittent | Met One SASS 22 LPM Quartz | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC4 CSN_Rev Unadjusted PM2.5 LC | 88377 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC4 CSN_Rev Unadjusted PM2.5 LC | 88377 | 892 | Intermittent | Model 2025 PM2.5 Sequential Quartz VSCC | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC4 CSN_rev Unadjusted PM10 LC | 85377 | 888 | Intermittent | Model 2025 PM10 Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| OC4 CSN_rev Unadjusted PM10-2.5 LC | 86377 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| OC4 PM2.5 LC | 88327 | 804 | Intermittent | IMPROVE | IMPROVE TOR w/ Adjustment | 0.023 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC4 PM2.5 LC | 88327 | 809 | Intermittent | IMPROVE Module C with Cyclone Inlet-Quartz Filter | IMPROVE TOR w/Adjustment | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC4 PM2.5 LC | 88327 | 814 | Intermittent | Met One SASS Quartz | IMPROVE TOR w/ Adjustment | 0.27 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC4 PM2.5 LC | 88327 | 816 | Intermittent | Met One SASS/SuperSASS Quartz | IMPROVE_A TOR w/ Adjustment | 0.002 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC4 PM2.5 LC | 88327 | 817 | Intermittent | Met One SASS Quartz | IMPROVE TOR w/o Adjustment | 0.27 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC4 PM2.5 LC | 88327 | 824 | Intermittent | Andersen RAAS Quartz | IMPROVE TOR w/ Adjustment | 0.246 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC4 PM2.5 LC | 88327 | 836 | Intermittent | URG MASS450 Quartz WINS | IMPROVE TOR w/ Adjustment | 0.108 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC4 PM2.5 LC | 88327 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE TOR w/STN Urban Adjustment | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC4 PM2.5 LC | 88327 | 846 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE_A w/CSN urban adjustment | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OC4 PM2.5 LC | 88327 | 854 | Intermittent | R&P MDL2300 PM2.5 Seq Spec Quartz | IMPROVE TOR w/ Adjustment | 0.18 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC4 PM2.5 LC | 88327 | 856 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | IMPROVE TOR w/ Adjustment | 0.108 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC4 PM2.5 LC | 88327 | 858 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | IMPROVE TOR w/ Adjustment | 0.108 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OC4 PM2.5 LC | 88327 | 876 | Intermittent | URG MASS450 Quartz VSCC | IMPROVE TOR w/ Adjustment | 0.108 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OCH PM2.5 LC TOT | 88322 | 804 | Intermittent | IMPROVE | 11*(H-0.25*Sulfur)) | 0.086 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OCH PM2.5 LC TOT | 88322 | 814 | Intermittent | Met One SASS Quartz | 11*(H-0.25*Sulfur)) | 0.992 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OCH PM2.5 LC TOT | 88322 | 824 | Intermittent | Andersen RAAS Quartz | 11*(H-0.25*Sulfur)) | 0.907 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OCH PM2.5 LC TOT | 88322 | 836 | Intermittent | URG MASS450 Quartz WINS | 11*(H-0.25*Sulfur)) | 0.397 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OCH PM2.5 LC TOT | 88322 | 854 | Intermittent | R&P MDL2300 PM2.5 Seq Spec Quartz | 11*(H-0.25*Sulfur)) | 0.662 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OCH PM2.5 LC TOT | 88322 | 856 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | 11*(H-0.25*Sulfur)) | 0.397 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OCH PM2.5 LC TOT | 88322 | 858 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | 11*(H-0.25*Sulfur)) | 0.397 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OCH PM2.5 LC TOT | 88322 | 876 | Intermittent | URG MASS450 Quartz VSCC | 11*(H-0.25*Sulfur)) | 0.397 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OCX Carbon PM2.5 LC | 88304 | 813 | Intermittent | Met One SASS Quartz | Thermal Optical Transmittance | 0.134 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OCX Carbon PM2.5 LC | 88304 | 823 | Intermittent | Andersen RAAS Quartz | Thermal Optical Transmittance | 0.134 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OCX Carbon PM2.5 LC | 88304 | 833 | Intermittent | URG MASS450 Quartz WINS | Thermal Optical Transmittance | 0.134 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OCX Carbon PM2.5 LC | 88304 | 843 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | Thermal Optical Transmittance | 0.134 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OCX Carbon PM2.5 LC | 88304 | 847 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | Thermal Optical Transmittance | 0.134 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OCX Carbon PM2.5 LC | 88304 | 853 | Intermittent | R&P MDL2300 PM2.5 Seq Spec Quartz | Thermal Optical Transmittance | 0.09782 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OCX Carbon PM2.5 LC | 88304 | 873 | Intermittent | URG MASS450 Quartz VSCC | Thermal Optical Transmittance | 0.134 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OCX2 Carbon PM2.5 LC | 88311 | 813 | Intermittent | Met One SASS Quartz | Thermal Optical Transmittance | 0.146 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OCX2 Carbon PM2.5 LC | 88311 | 823 | Intermittent | Andersen RAAS Quartz | Thermal Optical Transmittance | 0.134 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OCX2 Carbon PM2.5 LC | 88311 | 833 | Intermittent | URG MASS450 Quartz WINS | Thermal Optical Transmittance | 0.059 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OCX2 Carbon PM2.5 LC | 88311 | 843 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | Thermal Optical Transmittance | 0.059 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OCX2 Carbon PM2.5 LC | 88311 | 847 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | Thermal Optical Transmittance | 0.059 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OCX2 Carbon PM2.5 LC | 88311 | 853 | Intermittent | R&P MDL2300 PM2.5 Seq Spec Quartz | Thermal Optical Transmittance | 0.09782 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OCX2 Carbon PM2.5 LC | 88311 | 873 | Intermittent | URG MASS450 Quartz VSCC | Thermal Optical Transmittance | 0.059 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OP CSN PM2.5 LC TOT | 88336 | 145 | Intermittent | RP Partisol Model 2000 PM2.5 FRM Air Sampler-# | STN TOT | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OP CSN PM2.5 LC TOT | 88336 | 803 | Intermittent | IMPROVE | STN TOT | 0.021 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OP CSN PM2.5 LC TOT | 88336 | 809 | Intermittent | IMPROVE Module C with Cyclone Inlet-Quartz Filter | STN TOT | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OP CSN PM2.5 LC TOT | 88336 | 813 | Intermittent | Met One SASS Quartz | STN TOT | 0.245 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OP CSN PM2.5 LC TOT | 88336 | 823 | Intermittent | Andersen RAAS Quartz | STN TOT | 0.224 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OP CSN PM2.5 LC TOT | 88336 | 833 | Intermittent | URG MASS450 Quartz WINS | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OP CSN PM2.5 LC TOT | 88336 | 843 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | STN TOT | 0.098 | -50.0 | 2 | R | Micrograms/cubic meter (LC) | ||||
| OP CSN PM2.5 LC TOT | 88336 | 847 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | STN TOT | 0.098 | -50.0 | 2 | R | Micrograms/cubic meter (LC) | ||||
| OP CSN PM2.5 LC TOT | 88336 | 853 | Intermittent | R&P MDL2300 PM2.5 Seq Spec Quartz | STN TOT | 0.163 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OP CSN PM2.5 LC TOT | 88336 | 873 | Intermittent | URG MASS450 Quartz VSCC | STN TOT | 0.098 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OP CSN PM2.5 LC TOT | 88336 | 899 | Intermittent | No Method-None | STN TOT | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OP CSN_Rev Unadjusted PM2.5 LC TOR | 88378 | 816 | Intermittent | Met One SASS/SuperSASS Quartz | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OP CSN_Rev Unadjusted PM2.5 LC TOR | 88378 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE TOR | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OP CSN_Rev Unadjusted PM2.5 LC TOR | 88378 | 842 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE_A TOR | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OP CSN_Rev Unadjusted PM2.5 LC TOR | 88378 | 843 | Intermittent | Met One SASS 22 LPM Quartz | IMPROVE_A TOR | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OP CSN_Rev Unadjusted PM2.5 LC TOR | 88378 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OP CSN_Rev Unadjusted PM2.5 LC TOR | 88378 | 892 | Intermittent | Model 2025 PM2.5 Sequential Quartz VSCC | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OP CSN_Rev Unadjusted PM2.5 LC TOT | 88388 | 816 | Intermittent | Met One SASS Quartz | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OP CSN_Rev Unadjusted PM2.5 LC TOT | 88388 | 826 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE_A TOT | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OP CSN_Rev Unadjusted PM2.5 LC TOT | 88388 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE TOT | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OP CSN_Rev Unadjusted PM2.5 LC TOT | 88388 | 843 | Intermittent | Met One SASS 22 LPM Quartz | IMPROVE_TOT | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OP CSN_Rev Unadjusted PM2.5 LC TOT | 88388 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OP CSN_Rev Unadjusted PM2.5 LC TOT | 88388 | 892 | Intermittent | Model 2025 PM2.5 Sequential Quartz VSCC | IMPROVE_A | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OP CSN_rev Unadjusted PM10-2.5 LC TOR | 86378 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| OP CSN_rev Unadjusted PM10-2.5 LC TOT | 86388 | 883 | Intermittent | Model 2025 Dichot Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| OP PM2.5 LC TOR | 88328 | 804 | Intermittent | IMPROVE | IMPROVE TOR w/ Adjustment | 0.017 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OP PM2.5 LC TOR | 88328 | 809 | Intermittent | IMPROVE Module C with Cyclone Inlet-Quartz Filter | IMPROVE TOR w/Adjustment | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OP PM2.5 LC TOR | 88328 | 814 | Intermittent | Met One SASS Quartz | IMPROVE TOR w/ Adjustment | 0.196 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OP PM2.5 LC TOR | 88328 | 816 | Intermittent | Met One SASS/SuperSASS Quartz | IMPROVE_A TOR w/ Adjustment | 0.002 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OP PM2.5 LC TOR | 88328 | 817 | Intermittent | Met One SASS Quartz | IMPROVE TOR w/o Adjustment | 0.196 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OP PM2.5 LC TOR | 88328 | 824 | Intermittent | Andersen RAAS Quartz | IMPROVE TOR w/ Adjustment | 0.179 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OP PM2.5 LC TOR | 88328 | 830 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE_A TOR w/CSN urban adjustment | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OP PM2.5 LC TOR | 88328 | 836 | Intermittent | URG MASS450 Quartz WINS | IMPROVE TOR w/ Adjustment | 0.078 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OP PM2.5 LC TOR | 88328 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE TOR w/STN Urban Adjustment | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OP PM2.5 LC TOR | 88328 | 854 | Intermittent | R&P MDL2300 PM2.5 Seq Spec Quartz | IMPROVE TOR w/ Adjustment | 0.131 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OP PM2.5 LC TOR | 88328 | 856 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | IMPROVE TOR w/ Adjustment | 0.078 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OP PM2.5 LC TOR | 88328 | 858 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | IMPROVE TOR w/ Adjustment | 0.078 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OP PM2.5 LC TOR | 88328 | 876 | Intermittent | URG MASS450 Quartz VSCC | IMPROVE TOR w/ Adjustment | 0.078 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OP PM2.5 LC TOT | 88379 | 813 | Intermittent | Met One SASS Quartz | STN TOT | 0.245 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OP PM2.5 LC TOT | 88379 | 816 | Intermittent | Met One SASS Quartz | IMPROVE_A TOT w/ Adjustment | 0.002 | 2 | R | Micrograms/cubic meter (LC) | |||||
| OP PM2.5 LC TOT | 88379 | 828 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE_A TOT w/CSN urban adjustment | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| OP PM2.5 LC TOT | 88379 | 838 | Intermittent | URG 3000N w/Pall Quartz filter and Cyclone Inlet | IMPROVE_A TOT w/CSN urban adjustment | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Octachlorobiphenyl (TSP) STP | 17816 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 2.0 | 0.0 | 0 | R | Pg/cubic meter(25 C) | ||||
| Octanal | 43525 | 102 | Continuous | Cartridge-DNPH-on silica | HPLC Ultraviolet Absorption | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Octanal | 43525 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Op CSN_rev Unadjusted PM10 LC TOR | 85378 | 888 | Intermittent | Model 2025 PM10 Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Op CSN_rev Unadjusted PM10 LC TOT | 85388 | 888 | Intermittent | Model 2025 PM10 Sequential Quartz | IMPROVE_A | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Optical EC PM2.5 LC TOT | 88316 | 895 | Continuous | Sunset Labs | Optical absorption at 660nm | 0.2 | 2 | Micrograms/cubic meter (LC) | ||||||
| Optical EC PM2.5 LC TOT | 88316 | 898 | Continuous | Aerosol Magee AE33 Aethalometer | Converted from BC at 880nm | 0.2 | 2 | Micrograms/cubic meter (LC) | ||||||
| Optical EC PM2.5 STP TOT | 84316 | 867 | Continuous | Sunset Labs | TOT | 0.2 | 0.0 | 2 | Micrograms/cubic meter (20 C) | |||||
| Optical EC PM2.5 STP TOT | 84316 | 895 | Continuous | Sunset Labs | Optical absorption at 660nm | 0.2 | 0.0 | 2 | Micrograms/cubic meter (20 C) | |||||
| Organic Carbon Extinction PM2.5 LC | 88346 | 899 | Intermittent | Unknown-Unknown | # | 0.002 | 3 | Inverse Megameters | ||||||
| Organic Carbon Mass PM2.5 LC | 88350 | 805 | Intermittent | IMPROVE Calculation of Organic Mass by Carbon (OMCf) | 1.8 * OCf | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Organic Carbon Mass PM2.5 LC | 88350 | 899 | Intermittent | Unknown-Unknown | # | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Organic Carbon PM2.5 LC | 88351 | 896 | Continuous | Aerosol Magee CASS (Carbonaceous Aerosol Speciation Sampler) | Total Carbon - Black Carbon at 880nm | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Organic Fraction (SP) | 21102 | 071 | Intermittent | BUCKET | GRAVIMETRIC (APCA) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Organic Fraction (SP) | 21102 | 081 | Intermittent | BUCKET | GRAVIMETRIC (ASTM) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Organic carbon PM10 STP | 82305 | 108 | Intermittent | HI-VOL-SA/GMW1200 | TOR (DRI Thermal-optical reflectance) | 0.2 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Outdoor Temperature | 62101 | 020 | Continuous | INSTRUMENTAL | SPOT READING | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 021 | Continuous | INSTRUMENTAL | SPOT READING LEVEL 1 | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 022 | Continuous | INSTRUMENTAL | SPOT READING LEVEL 2 | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 023 | Continuous | INSTRUMENTAL | SPOT READING LEVEL 3 | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 030 | Continuous | Instrumental | TVA Last 5-min. average | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 031 | Continuous | Instrumental | TVA Last 5-min. average level 1 | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 032 | Continuous | Instrumental | TVA Last 5-min. average level 2 | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 033 | Continuous | Instrumental | TVA Last 5-min. average level 3 | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 034 | Continuous | Instrumental | TVA Last 5-min. average level 4 | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 040 | Continuous | INSTRUMENTAL | ELECTRONIC OR MACHINE AVG. | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 041 | Continuous | INSTRUMENTAL | ELEC. OR MACH. AVG. LEVEL 1 | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 042 | Continuous | INSTRUMENTAL | ELEC. OR MACH. AVG. LEVEL 2 | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 043 | Continuous | INSTRUMENTAL | ELEC. OR MACH. AVG. LEVEL 3 | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 044 | Continuous | Instrumental | Electronic or machine average level 4 | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 050 | Continuous | Instrumental | Visual average | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 051 | Continuous | Instrumental | Visual average level 1 | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 052 | Continuous | Instrumental | Visual average level 2 | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 053 | Continuous | Instrumental | VIsual average level 3 | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 059 | Continuous | Instrumental | Vaisala HMP 155 | -60.0 | 1 | R | Degrees Fahrenheit | |||||
| Outdoor Temperature | 62101 | 060 | Continuous | Instrumental | Vaisala 435C RH/AT Sensor | -60.0 | -60.0 | 150.0 | 1 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 061 | Continuous | Instrumental | Met One 083D | 0.1 | -60.0 | 150.0 | 1 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 062 | Continuous | Instrumental | R & P TEOM 1400ab | 0.5 | -60.0 | 150.0 | 1 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 063 | Continuous | Instrumental | Rotronic HC2-S3 | -58.0 | -58.0 | 212.0 | 0 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 066 | Continuous | Instrumental | Virtual Temperature | 0.1 | 1 | R | Degrees Fahrenheit | |||||
| Outdoor Temperature | 62101 | 069 | Continuous | Instrumental | Met One AIO2 Sonic Weather Sensor | -60.0 | -60.0 | 150.0 | 1 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 101 | Continuous | Instrumental Hygrothermograph | Manual reduction of graph trace | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 130 | Continuous | Instrumental | RM Young | -40.0 | -40.0 | 140.0 | 1 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 201 | Continuous | Instrumental | Shielded Thermistor | -60.0 | -60.0 | 150.0 | 1 | R | Degrees Fahrenheit | |||
| Outdoor Temperature | 62101 | 59 | Continuous | Instrumental | Vaisala HMP 155 | -60.0 | 1 | R | Degrees Fahrenheit | |||||
| Outdoor Temperature | 62101 | 803 | Continuous | Instrumental | Off Site temperature sensor | -60.0 | -60.0 | 150.0 | 1 | R | Degrees Fahrenheit | |||
| Oxides of nitrogen (NOx) | 42603 | 011 | Continuous | INSTRUMENTAL | COLORIMETRIC | 10.0 | -5.0 | 1200.0 | 1 | T | Parts per billion | |||
| Oxides of nitrogen (NOx) | 42603 | 013 | Continuous | INSTRUMENTAL | COLORIMETRIC | 10.0 | -5.0 | 1200.0 | 1 | T | Parts per billion | |||
| Oxides of nitrogen (NOx) | 42603 | 014 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | 10.0 | -5.0 | 1200.0 | 1 | T | Parts per billion | |||
| Oxides of nitrogen (NOx) | 42603 | 021 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0677-021 | MONITOR LABS 8440E | 10.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 022 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0777-022 | BENDIX 8101-C | 10.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 025 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0977-025 | CSI 1600 | 10.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 031 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-1078-031 | MELOY NA530R | 10.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 034 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0179-034 | BECKMAN 952A | 10.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 035 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0179-035 | THERMO ELECTRON 14B/E | 10.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 037 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0279-037 | THERMO ELECTRON 14D/E | 10.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 038 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0479-038 | BENDIX 8101B | 10.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 040 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0879-040 | PHILIPS PW9762/02 | 10.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 042 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0280-042 | MONITOR LABS 8840 | 10.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 051 | Continuous | INSTRUMENTAL | TECO 17 CHEMILUMINESCENCE | 1.0 | -5.0 | 1200.0 | 1 | T | Parts per billion | |||
| Oxides of nitrogen (NOx) | 42603 | 074 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-1289-074 | THERMO ENVIRON. INST. MODEL 42 | 10.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 075 | Continuous | LOW LEVEL NOX INSTRUMENTAL | TECO 42S CHEMILUMINESCENCE | 0.05 | -5.0 | 1200.0 | 1 | T | Parts per billion | |||
| Oxides of nitrogen (NOx) | 42603 | 082 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0691-082 | ADVANCED POLL INSTR MODEL 200 | 10.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 083 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0991-083 | MONITOR LAB 8841 | 10.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 089 | Continuous | INSTRUMENTAL | GAS PHASE CHEMILUMINESCENCE | 2.7 | -5.0 | 1200.0 | 1 | T | Parts per billion | |||
| Oxides of nitrogen (NOx) | 42603 | 090 | Continuous | Instrumental | Gas Phase Chemiluminescence | FRM | RFNA-1292-090 | LEAR SIEGLER MCC ML9841 | 10.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 091 | Intermittent | GAS-BUBBLER | COLORIMETRIC | 2.7 | -5.0 | 1200.0 | 1 | T | Parts per billion | |||
| Oxides of nitrogen (NOx) | 42603 | 099 | Continuous | INSTRUMENTAL | GAS PHASE CHEMILUMINESCENCE | FRM | RFNA-1104-099 | API MODEL 200A/E NO ANALYZER | 5.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 111 | Continuous | Instrumental | Chemiluminescence | 5.0 | -5.0 | 1200.0 | 1 | T | Parts per billion | |||
| Oxides of nitrogen (NOx) | 42603 | 121 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-0798-121 | DDK CORP MODEL GLN-114E | 5.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 146 | Continuous | E. S. A. Model AC32M | Chemiluminescent | FRM | RFNA-0202-146 | Environnement S. A. Model AC32M Chem NOX Analyzer | 5.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 152 | Continuous | Instrumental | Chemiluminescent | FRM | RFNA-0804-152 | SIR S.A. Model S-5012 | 5.0 | -5.0 | 400.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 157 | Continuous | Instrumental | Chemiluminescence | FRM | RFNA-0506-157 | Horiba APNA-370 | 5.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 163 | Continuous | Instrumental | Chemiluminescence | FRM | RFNA-0706-163 | Seres Model NOx 2000 G | 5.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 171 | Continuous | Instrumental | Chemiluminescence | FRM | RFNA-0508-171 | DKK-TOA Corp Model GLN-314E | 5.0 | -5.0 | 1200.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 186 | Continuous | Instrumental | Chemiluminescence | FRM | RFNA-0809-186 | Ecotech Serinus 40 Oxides of Nitrogen Analyzer | 5.0 | -5.0 | 500.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 200 | Continuous | Teledyne-API Model 200EUP or T200UP | Photolytic-Chemiluminescence | FEM | EQNA-0512-200 | Teledyne API Chemiluminescence Nitrogen Oxides Analyzer Automated | 0.1 | -5.0 | 2000.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 241 | Continuous | Teledyne-API Model T200P Chemiluminescence | Photolytic-Chemiluminescence | FEM | EQNA-1016-241 | Teledyne API Chemiluminescence Nitrogen Oxides Analyzer Automated | 0.4 | -5.0 | 4000.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 243 | Continuous | 2B Technologies, Model 405 nm | UV-absorbance at 405 nm | FEM | EQNA-0217-243 | 2B Technologies, Model 405 nm | 1.0 | -5.0 | 500.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 256 | Continuous | Instrumental - Teledyne API - Model N500 | Cavity-Attenuated Phase-Shift (CAPS) spectroscopy Nitrogen Oxides Analyzer | FEM | EQNA-0320-256 | T-API N500 CAPS Nitrogen Oxides Analyzer | 0.1 | -5.0 | 1000.0 | 1 | T | Parts per billion |
| Oxides of nitrogen (NOx) | 42603 | 574 | Continuous | Instrumental | Chemiluminescence Thermo Electron 42C-Y, 42i-Y | 0.05 | -5.0 | 1000.0 | 1 | T | Parts per billion | |||
| Oxides of nitrogen (NOx) | 42603 | 590 | Continuous | Instrumental | Chemiluminescence Ecotech EC9841T | 0.05 | -5.0 | 2000.0 | 1 | T | Parts per billion | |||
| Oxides of nitrogen (NOx) | 42603 | 591 | Continuous | Instrumental | Chemiluminescence Ecotech EC9843 | 0.05 | -5.0 | 2000.0 | 1 | T | Parts per billion | |||
| Oxides of nitrogen (NOx) | 42603 | 599 | Continuous | Instrumental | Chemiluminescence Teledyne API 200 EU/501 | 0.05 | -5.0 | 2000.0 | 1 | T | Parts per billion | |||
| Ozone | 44201 | 003 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFOA-1075-003 | MELOY 0A325-2R | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 004 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFOA-1075-004 | MELOY 0A350-2R | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 007 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFOA-0176-007 | BENDIX 8002 | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 011 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million | |||
| Ozone | 44201 | 014 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFOA-1076-014 | MCMILLAN 1100-1 | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 015 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE RHODAMINE B DYE | FRM | RFOA-1076-015 | MCMILLAN 1100-2 | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 016 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFOA-1076-016 | MCMILLAN 1100-3 | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 017 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFOA-1176-017 | MONITOR LABS 8410E | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 019 | Continuous | INSTRUMENTAL | ULTRA VIOLET | FEM | EQOA-0577-019 | DASIBI 1003-AH--PC--RS | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 020 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFOA-0577-020 | BECKMAN 950A | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 023 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE RHODAMINE B DYE | FEM | EQOA-0777-023 | PHILIPS PW9771 | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 036 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFOA-0279-036 | CSI 2000 | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 047 | Continuous | INSTRUMENTAL | ULTRA VIOLET | FEM | EQOA-0880-047 | THERMO ELECTRON 49 | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 053 | Continuous | INSTRUMENTAL | ULTRA VIOLET | FEM | EQOA-0881-053 | MONITOR LABS 8810 | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 055 | Continuous | INSTRUMENTAL | ULTRA VIOLET | FEM | EQOA-0382-055 | PCI OZONE CORP. LC-12 | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 056 | Continuous | INSTRUMENTAL | ULTRA VIOLET | FEM | EQOA-0383-056 | DASIBI 1008-AH | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 078 | Continuous | INSTRUMENTAL | ULTRA VIOLET | FEM | EQOA-0990-078 | ENVIRONICS SERIES 300 | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 087 | Continuous | INSTRUMENTAL | ULTRA VIOLET ABSORPTION | FEM | EQOA-0992-087 | MODEL 400 OZONE ANALYZER | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 091 | Continuous | INSTRUMENTAL | ULTRAVIOLET RADIATION ABSORBTN | FEM | EQOA-0193-091 | LEAR SIEGLER ML9810 | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 103 | Continuous | INSTRUMENTAL | OPEN PATH O3 ANALYZER | FEM | EQOA-0495-103 | OPSI MODEL AR 500 O3 ANALYZER | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 105 | Continuous | INSTRUMENTAL | UV PHOTOMETRIC | FEM | EQOA-0895-105 | ENVIRONMENT SA MODEL Q341M | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 112 | Continuous | INSTRUMENTAL | ULTRAVIOLET ABSORPTION | FEM | EQOA-0196-112 | HORIBA APOA-360 | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 134 | Continuous | Instrumental | Ultra Violet Photometry | FEM | EQOA-0200-134 | DKK MDL GUX-113E | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 137 | Continuous | Instrumental | Open Path o3 Analyzer | FEM | EQOA-0400-137 | SANOA Longpath | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 148 | Continuous | Instrumental | Ultra violet Photometric | FEM | EQOA-0206-148 | Environnement S.A. Model O342M UV Ozone Analyzer | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 160 | Continuous | INSTRUMENTAL | ULTRAVIOLET ABSORPTION | FEM | EQOA-0506-160 | HORIBA APOA-370 | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 161 | Continuous | INSTRUMENTAL | ULTRAVIOLET ABSORPTION | FEM | EQOA-0506-161 | Seres Model OZ 2000 G | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 164 | Continuous | Instrumental | Photometric O3 Analyzer | FEM | EQOA-0207-164 | SIR S A Model S-5014 | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 165 | Continuous | Instrumental | Ultraviolet Absorption | FEM | EQOA-0407-165 | Tanabyte Models 722,723,724,725,726 | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 169 | Continuous | Instrumental | DKK-TOA Model GUX-313E | FEM | EQOA-1107-169 | DKK-TOA Model GUX313E | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 187 | Continuous | Instrumental | Ecotech Serinus 10 | FEM | EQOA-0809-187 | Ecotech Serinus 10 Ozone Analyzer | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 190 | Continuous | Instrumental | UV absorption photometry/UV 2B model 202 and 205 | FEM | EQOA-0410-190 | 2B Technologies Model 202 Ozone Monitor | 0.003 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 199 | Continuous | Instrumental | Chemiluminescence API Model 265E and T265 | FEM | EQOA-0611-199 | Teledyne API Model 265E and T265 | 0.0006 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 214 | Continuous | INSTRUMENTAL | UV absorption photometry | FEM | EQOA-0410-214 | Teledyne API Model T204 | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 215 | Continuous | INSTRUMENTAL | UV absorption photometry | FEM | EQOA-0410-215 | 2B Technologies Model 211 | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 218 | Continuous | INSTRUMENTAL | UV absorption photometry | FEM | EQOA-0410-218 | 2B Technologies Model 106-L or 106OEM-L | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 222 | Continuous | INSTRUMENTAL | UV absorption photometry | FEM | EQOA-0415-222 | Sutron Model 6030 | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 225 | Continuous | INSTRUMENTAL | UV absorption photometry | FEM | EQOA-0410-225 | Environment S.A. Model 42e | 0.005 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 227 | Continuous | Instrumental | UV absorption photometry/2B Personal Ozone Monitor | FEM | EQOA-0815-227 | 2B Technologies POM | 0.004 | -0.004 | 0.5 | 3 | T | Parts per million |
| Ozone | 44201 | 901 | Continuous | Instrumental | Ultra Violet 2B Model 202 | 0.0015 | -0.004 | 0.5 | 4 | T | Parts per million | |||
| PH (precip) | 65302 | 081 | Intermittent | PRECIP | GLASS ELECTRODE | 0.1 | 0.0 | 2 | R | pH Units | ||||
| PH (precip) | 65302 | 082 | Intermittent | PRECIP | FIELD TEST | 0.1 | 0.0 | 2 | R | pH Units | ||||
| PM 2.5 Carbon at 470 nm | 88360 | 878 | Continuous | Met One BC-1054 Black Carbon Monitor | Optical Absorption | 0.1 | 2 | Micrograms/cubic meter (LC) | ||||||
| PM 2.5 Carbon at 470 nm | 88360 | 894 | Continuous | Magee AE33/ TAPI M633 Aethalometer | Optical Absorption | 0.2 | -1.9 | 2 | Micrograms/cubic meter (LC) | |||||
| PM 2.5 Carbon at 520 nm | 88361 | 894 | Continuous | Magee AE33/ TAPI M633 Aethalometer | Optical Absorption | 0.2 | -1.9 | 2 | Micrograms/cubic meter (LC) | |||||
| PM 2.5 Carbon at 590 nm | 88362 | 878 | Continuous | Met One BC-1054 Black Carbon Monitor | Optical Absorption | 0.1 | 2 | Micrograms/cubic meter (LC) | ||||||
| PM 2.5 Carbon at 590 nm | 88362 | 894 | Continuous | Magee AE33/ TAPI M633 Aethalometer | Optical Absorption | 0.2 | -1.9 | 2 | Micrograms/cubic meter (LC) | |||||
| PM 2.5 Carbon at 660 nm | 88363 | 878 | Continuous | Met One BC-1054 Black Carbon Monitor | Optical Absorption | 0.1 | 2 | Micrograms/cubic meter (LC) | ||||||
| PM 2.5 Carbon at 660 nm | 88363 | 894 | Continuous | Magee AE33/ TAPI M633 Aethalometer | Optical Absorption | 0.2 | -1.9 | 2 | Micrograms/cubic meter (LC) | |||||
| PM 2.5 Carbon at 935 nm | 88367 | 875 | Continuous | Met One BC-1050 Black Carbon Monitor | Optical Absorption | 0.002 | -1.0 | 1000.0 | 4 | Micrograms/cubic meter (LC) | ||||
| PM1 - Local Conditions | 87111 | 236 | Continuous | Teledyne T640 at 5.0 LPM | Broadband Spectroscopy | 0.1 | 0.0 | 10000.0 | 1 | Micrograms/cubic meter (LC) | ||||
| PM1 - Local Conditions | 87111 | 238 | Continuous | Teledyne T640x at 16.67 LPM | Broadband Spectroscopy | 0.1 | 0.0 | 10000.0 | 1 | Micrograms/cubic meter (LC) | ||||
| PM1 - Local Conditions | 87111 | 636 | Continuous | Teledyne T640 at 5.0 LPM w/Network Data Alignment enabled | Broadband Spectroscopy | 0.1 | 0.0 | 10000.0 | 1 | Micrograms/cubic meter (LC) | ||||
| PM1 - Local Conditions | 87111 | 638 | Continuous | Teledyne T640X at 16.67 LPM w/Network Data Alignment enabled | Broadband spectroscopy | 0.1 | 0.0 | 10000.0 | 1 | Micrograms/cubic meter (LC) | ||||
| PM10 - LC | 85101 | 062 | Intermittent | HI-VOL-WEDDING-INLET | GRAVIMETRIC | FRM | RFPS-1087-062 | WEDDING & ASSOC HI-VOL | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 063 | Intermittent | HI-VOL-SA/GMW1200 | GRAVIMETRIC | FRM | RFPS-1287-063 | SIERRA-ANDERSEN/GMW 1200 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 064 | Intermittent | HI-VOL-SA/GMW-321-B | GRAVIMETRIC | FRM | RFPS-1287-064 | SIERRA-ANDERSEN/GMW-321-B | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 065 | Intermittent | HI-VOL-SA/GMW-321-C | GRAVIMETRIC | FRM | RFPS-1287-065 | SIERRA-ANDERSEN/GMW-321-C | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 071 | Intermittent | OREGON-DEQ-MED-VOL | GRAVIMETRIC-QUARTZ FILTERS | FRM | RFPS-0389-071 | OREGON-DEQ-MED-VOLUME SAMPLER | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 073 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-INLT | GRAVIMETRIC | FRM | RFPS-0789-073 | MODL SA241-SA241M-G241-ORG241M | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 076 | Continuous | INSTRMENTL-ANDRSEN-SA246B-INLT | BETA-ATTENUATION | FEM | EQPM-0990-076 | ANDERSEN MODEL FH621-N PM10 | 4.0 | -50.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 079 | Continuous | INSTRUMENTAL-R&P SA246B-INLET | TEOM-GRAVIMETRIC | FEM | EQPM-1090-079 | RUPRCHT&PATSHNCK TEOM SER 1400 | -50.0 | -50.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 081 | Continuous | INSTRUMENTAL-WEDDING-AUTOMATIC | BETA-RAY-ATTENUATION | FEM | EQPM-0391-08 | WEDDING & ASS. PM-10 AUTOMATED | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 098 | Intermittent | R&P Model 2000 Partisol | GRAVIMETRIC | FRM | RFPS-0694-098 | R & P PARTISOL 2000 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 122 | Continuous | INSTRUMENT MET ONE 4 MODELS | BETA ATTENUATION | FEM | EQPM-0798-122 | MODELS BAM 1020-GBAM 1020- ETC | 4.0 | -10.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 124 | Intermittent | BGI Inc. Model PQ100 PM10 | Gravimetric | FRM | RFPS-1298-124 | BGI Model PQ100 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 125 | Intermittent | BGI Inc. Model PQ200 PM10 | Gravimetric | FRM | RFPS-1298-125 | BGI Model PQ200 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 126 | Intermittent | R - P Co Partisol Model 2000 | Gravimetric | FRM | RFPS-1298-126 | R - P Model 2000 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 127 | Intermittent | R - P Co Partisol Model 2025 | Gravimetric | FRM | RFPS-1298-127 | R - P Model 2025 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 130 | Intermittent | Andersen RAAS10-100 Single channel | Gravimetric | FRM | RFPS-0699-130 | Andersen Model RAAS10-100 Single Channel | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 131 | Intermittent | Andersen RAAS10-200 S-Channel | Gravimetric | FRM | RFPS-0699-131 | Andersen Model RAAS10-200 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 132 | Intermittent | Andersen RAAS10-300 M-channel | Gravimetric | FRM | RFPS-0699-132 | Andersen Model RAAS10-300 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 141 | Intermittent | Tisch Environ Model-6070 PM10 Hi-Vol | Gravimetric | FRM | RFPS-0202-141 | Tisch Environ. Model TE-6060 Hi-Vol SSI | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 150 | Continuous | T A Series FH 62 C14 Continuous | Gravimetric | FEM | EQPM-1102-150 | Thermo Andersen FH 62 C14 Continuous | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 162 | Intermittent | Hi Vol SSI Ecotech Model 3000 | Gravimetric | FRM | RFPS-0706-162 | Ecotech Model 3000 PM10 Hi vol Sampler | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 179 | Continuous | Thermo Scientific | Gravimetric | 4.0 | 0 | T | Micrograms/cubic meter (LC) | |||||
| PM10 - LC | 85101 | 195 | Continuous | GRIMM EDM Model 180 with naphion dryer | Laser Light Scattering | 0.1 | 0.0 | 1500.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM10 - LC | 85101 | 196 | Continuous | GRIMM EDM Model 264 with heated inlet | Laser Light Scattering | 0.1 | 0.0 | 1500.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM10 - LC | 85101 | 197 | Intermittent | Thermo Partisol Model 2000-D Dichot | Gravimetric | FEM | EQPS-311-197 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) | |
| PM10 - LC | 85101 | 198 | Intermittent | Thermo Partisol Model 2025-D Seq | Gravimetric | 4.0 | 0 | T | Micrograms/cubic meter (LC) | |||||
| PM10 - LC | 85101 | 205 | Intermittent | API 602 BAM | Gravimetric | EQPM-0912-205 | 4.0 | -10.0 | 1500.0 | 1 | T | Micrograms/cubic meter (LC) | ||
| PM10 - LC | 85101 | 208 | Continuous | Thermo Scientific 1405-DF Dichotomous TEOM FDMS | FDMS Gravimetric | FEM | EQPM-1013-208 | Thermo Scientific 1405-DF FDMS Dichotomous FEM | 2.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 209 | Continuous | Met One BAM-1022 Mass Monitor | Beta Attenuation | 5.0 | -10.0 | 975.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM10 - LC | 85101 | 216 | Intermittent | Tisch Model TE-Wilbur10 Low-Volume Sampler | Gravimetric | FRM | RFPS-0714-216 | Tisch Model TE-Wilbur10 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 226 | Continuous | Met One E-BAM PLUS | Beta Attenuation | FEM | EQPM-1215-226 | Met One E-BAM PLUS PM10 | 10.0 | -15.0 | 10000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 231 | Intermittent | Met One E-FRM PM10 | Gravimetric | FRM | RFPS-0216-231 | Met One E-FRM PM10 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 236 | Continuous | Teledyne API T640 at 5.0 LPM | Broadband spectroscopy | 0.1 | 0.0 | 10000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM10 - LC | 85101 | 239 | Continuous | Teledyne API T640X at 16.67 LPM | Broadband spectroscopy | FEM | EQPM-0516-239 | T-API T640X at 16.67 LPM | 0.1 | 0.0 | 10000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 246 | Intermittent | Met One E-SEQ-FRM PM10 | Gravimetric | FRM | RFPS-0717-246 | Met One E-SEQ-FRM PM10 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 636 | Continuous | Teledyne API T640 at 5.0 LPM w/Network Data Alignment enabled | Broadband spectroscopy | 0.1 | 0.0 | 10000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM10 - LC | 85101 | 639 | Continuous | Teledyne API T640X at 16.67 LPM w/Network Data Alignment enabled | Broadband spectroscopy | FEM | EQPM-0516-239 | T-API T640X at 16.67 LPM w/Network Data Alignment enabled | 0.1 | 0.0 | 10000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM10 - LC | 85101 | 734 | Continuous | Met One E-BAM | Beta Attenuation | 10.0 | -15.0 | 10000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM10 - LC | 85101 | 773 | Intermittent | LO-VOL-DICHOT-INTERIM | GRAVIMETRIC | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) | |||
| PM10 - LC | 85101 | 785 | Intermittent | DICHOTOMOUS APPROVED PM10 REFR | GRAVIMETRIC | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) | |||
| PM10 - LC | 85101 | 790 | Continuous | Virtual Impactor | FDMS-Gravimetric 1405-DF | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM10 - LC | 85101 | 808 | Intermittent | IMPROVE Module D with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | GRAVIMETRIC | 0.002 | 3 | T | Micrograms/cubic meter (LC) | |||||
| PM10 - LC | 85101 | 900 | Intermittent | BGI Inc. frmOMNI | Gravimetric | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (LC) | |||
| PM10 Total 0-10um STP | 81102 | 001 | Intermittent | LO-VOL-SA244E | GRAVIMETRIC | 1.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 002 | Intermittent | LO-VOL-GMW9200 | GRAVIMETRIC | 1.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 003 | Intermittent | LO-VOL-WA10-DICHOT | GRAVIMETRIC | 1.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 004 | Intermittent | LO-VOL-SA246B-DICHOT | GRAVIMETRIC | 1.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 011 | Continuous | DUSTTRAK 8530 | LIGHT-SCATTERING LASER PHOTOMETER | 0.001 | 0.0 | 400.0 | 2 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 012 | Continuous | DUSTTRAK 8533 | LIGHT-SCATTERING LASER PHOTOMETER | 0.001 | 0.0 | 150.0 | 2 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 025 | Intermittent | MED-VOL-SA254 | GRAVIMETRIC | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 026 | Intermittent | MED-VOL-GMW9100 | GRAVIMETRIC | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 040 | Continuous | WEDDING-AUTOMATED-PM10 SAMPLER | BETA-GAUGE | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 041 | Continuous | BAM-102-CONTINUOUS MONITOR | BETA-ATTENUATION | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 051 | Intermittent | HI-VOL-SA321 | GRAVIMETRIC | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 052 | Intermittent | HI-VOL-SA321A | GRAVIMETRIC | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 053 | Intermittent | HI-VOL-GMW9000 | GRAVIMETRIC | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 054 | Intermittent | HI-VOL-W10 | GRAVIMETRIC | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 055 | Intermittent | HI-VOL-W10-(W/MAINT.AC.PORT) | GRAVIMETRIC | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 056 | Intermittent | HI-VOL-SA321G-(321-W/OILSHIM) | GRAVIMETRIC | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 057 | Intermittent | HI-VOL-SA321AG(321A-W/OILSHIM) | GRAVIMETRIC | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 058 | Intermittent | HI-VOL-SA321B | GRAVIMETRIC | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 059 | Intermittent | HI-VOL-SA1200 | GRAVIMETRIC | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 062 | Intermittent | HI-VOL-WEDDING-INLET | GRAVIMETRIC | FRM | RFPS-1087-062 | WEDDING & ASSOC HI-VOL | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 063 | Intermittent | HI-VOL SA/GMW-1200 | GRAVIMETRIC | FRM | RFPS-1287-063 | GMW Model 1200 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 064 | Intermittent | HI-VOL-SA/GMW-321-B | GRAVIMETRIC | FRM | RFPS-1287-064 | SIERRA-ANDERSEN/GMW 321-B | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 065 | Intermittent | HI-VOL-SA/GMW-321-C | GRAVIMETRIC | FRM | RFPS-1287-065 | SIERRA-ANDERSEN/GMW 321-C | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 071 | Intermittent | OREGON-DEQ-MED-VOL | GRAVIMETRIC-QUARTZ FILTERS | FRM | RFPS-0389-071 | OREGON DEQ MED VOLUME SAMPLER | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 073 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-INLT | GRAVIMETRIC | FRM | RFPS-0789-073 | MODL SA241-SA241M-G241-ORG241M | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 076 | Continuous | INSTRMENTL-ANDRSEN-SA246B-INLT | BETA-ATTENUATION | FEM | EQPM-0990-076 | ANDERSEN MODEL FH62I-N PM10 | 4.0 | -50.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 079 | Continuous | INSTRUMENTAL-R&P SA246B-INLET | TEOM-GRAVIMETRIC | FEM | EQPM-1090-079 | RUPRCHT&PATSHNCK TEOM SER 1400 | -50.0 | -50.0 | 13000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 081 | Continuous | INSTRUMENTAL-WEDDING-AUTOMATIC | BETA-RAY-ATTENUATION | FEM | EQPM-0391-081 | WEDDING & ASS. PM-10 AUTOMATED | -10.0 | -10.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 098 | Intermittent | R&P Model 2000 Partisol | GRAVIMETRIC | FRM | RFPS-0694-098 | R & P PARTISOL 2000 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 122 | Continuous | INSTRUMENT MET ONE 4 MODELS | BETA ATTENUATION | FEM | EQPM-0798-122 | MODELS BAM 1020-GBAM 1020- ETC | 4.0 | -5.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 124 | Intermittent | BGI Inc. Model PQ100 PM10 | Gravimetric | FRM | RFPS-1298-124 | BGI Model PQ100 PM10 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 125 | Intermittent | BGI Inc. Model PQ200 PM10 | Gravimetric | FRM | RFPS-1298-125 | BGI Model PQ200 PM10 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 126 | Intermittent | R - P Co Partisol Model 2000 | Gravimetric | FRM | RFPS-1298-126 | R - P Model 2000 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 127 | Intermittent | R - P Co Partisol Model 2025 | Gravimetric | FRM | RFPS-1298-127 | R - P Model 2025 | 4.0 | 0.0 | 17000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 130 | Intermittent | Andersen RAAS10-100 Single channel | Gravimetric | FRM | RFPS-0699-130 | Andersen Model RAAS10-100 Single Channel | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 131 | Intermittent | Andersen RAAS10-200 S-Channel | Gravimetric | FRM | RFPS-0699-131 | Andersen Model RAAS10-200 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 132 | Intermittent | Andersen RAAS10-300 M-channel | Gravimetric | FRM | RFPS-0699-132 | Andersen Model RAAS10-300 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 141 | Intermittent | Tisch Environ Model-6070 PM10 Hi-Vol | Gravimetric | FRM | RFPS-0202-141 | Tisch Environ. Model TE-6060 Hi-Vol SSI | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 150 | Continuous | T A Series FH 62 C14 Continuous | Beta Attenuation | FEM | EQPM-1102-150 | Thermo Andersen FH 62 C14 Continuous | 4.0 | -50.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 151 | Continuous | Environnement S.A. Model MP101M | Beta Attenuation | FEM | EQPM-0404-151 | Environnement S.A. Model MP101M | 4.0 | -50.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 156 | Continuous | Instrument DKK_TOA | Beta Attenuation | FEM | EQPM-0905-156 | DKK_TOA Models FPM_222/222C, FPM223/223C, DUB-222(S)/223(S) | 4.0 | -50.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 162 | Intermittent | Hi Vol SSI Ecotech Model 3000 | Gravimetric | FRM | RFPS-0706-162 | Ecotech Model 3000 PM10 Hi vol Sampler | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 193 | Continuous | OPSIS Model SM200 PM10 Monitor | Beta Attenuation | FEM | EQPM-0810-193 | OPSIS Model SM200 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 197 | Intermittent | Thermo Partisol Model 2000-D Dichot | GRAVIMETRIC | FEM | EQPS-311-197 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |
| PM10 Total 0-10um STP | 81102 | 198 | Intermittent | Thermo Partisol Model 2025-D Dichot | GRAVIMETRIC | FEM | EQPS-0311-198 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |
| PM10 Total 0-10um STP | 81102 | 205 | Intermittent | AP 602 BAM | Gravimetric | FEM | EQPM-0912-205 | T-API M602 Beta | 4.0 | -10.0 | 1500.0 | 1 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 208 | Continuous | Thermo Scientific 1405-DF Dichotomous TEOM FDMS | FDMS Gravimetric | FEM | EQPM-1013-208 | Thermo Scientific 1405-DF FDMS Dichotomous FEM | 2.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 216 | Intermittent | Tisch Model TE-Wilbur10 Low-Volume Sampler | Gravimetric | FRM | RFPS-0714-216 | Tisch Model TE-Wilbur10 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 226 | Continuous | Met One E-BAM PLUS | Beta Attenuation | FEM | EQPM-1215-226 | Met One E-BAM PLUS PM10 | 10.0 | -15.0 | 10000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 231 | Intermittent | Met One E-FRM PM10 | Gravimetric | FRM | RFPS-0216-231 | Met One E-FRM PM10 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 239 | Continuous | Teledyne API T640X at 16.67 LPM | Broadband spectroscopy | FEM | EQPM-0516-239 | T-API T640X at 16.67 LPM | 0.1 | 0.0 | 10000.0 | 1 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 246 | Intermittent | Met One E-SEQ-FRM | Gravimetric | FRM | RFPS-0717-246 | Met One E-SEQ-FRM PM10 | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 639 | Continuous | Teledyne API T640X at 16.67 LPM w/Network Data Alignment enabled | Broadband spectroscopy | FEM | EQPM-0516-239 | T-API T640X at 16.67 LPM w/Network Data Alignment enabled | 0.1 | 0.0 | 10000.0 | 1 | T | Micrograms/cubic meter (25 C) |
| PM10 Total 0-10um STP | 81102 | 702 | Intermittent | INTERIM PM10 | GRAVIMETRIC | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 771 | Intermittent | INTERIM PM10 | GRAVIMETRIC | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 772 | Intermittent | INTERIM PM10 | GRAVIMETRIC | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 773 | Intermittent | LO-VOL-DICHOT-INTERIM | GRAVIMETRIC | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 774 | Intermittent | HI-VOL INTERIM 15 MICRON | GRAVIMETRIC | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 790 | Continuous | Virtual Impactor | FDMS-Gravimetric 1405-DF | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 792 | Continuous | Virtual Impactor | Gravimetric 1405-D | -10.0 | 1 | T | Micrograms/cubic meter (25 C) | |||||
| PM10 Total 0-10um STP | 81102 | 879 | Continuous | INSTRUMENTAL-R&P SA246B-Inlet (Tx Modification) | TEOM-GRAVIMETRIC w/Tx modification | -50.0 | -50.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10 Total 0-10um STP | 81102 | 900 | Intermittent | BGI Inc. frmOMNI at 5 lpm | Gravimetric | 4.0 | 0.0 | 5000.0 | 0 | T | Micrograms/cubic meter (25 C) | |||
| PM10-2.5 - Local Conditions | 86101 | 173 | Intermittent | BGI Inc Model PQ200 PM10-2.5 Sampler Pair | Paired Gravimetric Difference | FRM | RFPS-1208-173 | BGI Inc. Model PQ200 Sampler Pair | 3.0 | -3.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM10-2.5 - Local Conditions | 86101 | 175 | Intermittent | Thermo Scientific Partisol Model 2000 Sampler Pair | Paired Gravimetric | FRM | RFPS-0509-175 | Thermo Scientific Partisol Model 2000 Sampler Pair | 3.0 | -3.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM10-2.5 - Local Conditions | 86101 | 176 | Intermittent | Thermo Scientific Partisol-Plus Model 2025 Sequential Sampler Pair | Paired Gravimetric | FRM | RFPS-0509-176 | Thermo Scientific Partisol-Plus Model 2025 Sequential sampler pair | 3.0 | -3.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM10-2.5 - Local Conditions | 86101 | 178 | Intermittent | Thermo Scientific Partisol 2000-D Dichotomous Sampler | Dichotomous Gravimetric | FEM | EQPS-0509-178 | Thermo Scientific Partisol 2000-D Dichotomous Sampler | 3.0 | -3.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM10-2.5 - Local Conditions | 86101 | 180 | Intermittent | Thermo Scientific Partisol-Plus 2025-D Dichotomous Sequential Sampler | Dichotomous Gravimetric | FEM | EQPS-0509-180 | Thermo Scientific Partisol-Plus 2025-D Dichotomous Sequential Sampler | 3.0 | -3.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM10-2.5 - Local Conditions | 86101 | 185 | Continuous | Met One BAM-1020 System | Paired Beta Difference | FEM | EQPM-0709-185 | Met One BAM-1020 System | 3.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM10-2.5 - Local Conditions | 86101 | 206 | Continuous | Teledyne 602 Beta PLUS Monitor | Paired Beta Difference | FEM | EQPM-0912-206 | Teledyne 602 Beta PLUS Monitor | 3.0 | -10.0 | 1500.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM10-2.5 - Local Conditions | 86101 | 207 | Continuous | Thermo Scientific 1405-DF Dichotomous FDMS | FDMS Gravimetric | FEM | EQPM-1013-207 | Thermo Scientific 1405-DF Dichotomous FDMS | 2.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM10-2.5 - Local Conditions | 86101 | 208 | Continuous | Thermo Scientific 14015-D | Gravimetric | 2.0 | 1 | T | Micrograms/cubic meter (LC) | |||||
| PM10-2.5 - Local Conditions | 86101 | 220 | Intermittent | Tisch Model TE-Wilbur PM10-2.5 Low-Volume Sampler Pair | Paired Gravimetric | FRM | RFPS-1014-220 | Tisch Model TE-Wilbur PM10-2.5 Sampler Pair | 3.0 | -3.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM10-2.5 - Local Conditions | 86101 | 232 | Intermittent | Met One E-FRM PM10-2.5 Sampler Pair | Paired Gravimetric | FRM | RFPS-0316-232 | Met One E-FRM PM10-2.5 Sampler Pair | 3.0 | -3.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM10-2.5 - Local Conditions | 86101 | 236 | Continuous | Teledyne API T640 at 5.0 LPM | Broadband spectroscopy | 0.1 | 0.0 | 10000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM10-2.5 - Local Conditions | 86101 | 240 | Continuous | Teledyne API T640X at 16.67 LPM | Broadband spectroscopy | FEM | EQPM-0516-240 | T-API T640X at 16.67 LPM | 0.1 | 0.0 | 10000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM10-2.5 - Local Conditions | 86101 | 247 | Intermittent | Met One E-SEQ-FRM PM10-2.5 sampler pair | Paired Gravimetric | FRM | RFPS-0717-247 | Met One E-SEQ-FRM PM10-2.5 sampler pair | 3.0 | -3.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM10-2.5 - Local Conditions | 86101 | 636 | Continuous | Teledyne API T640 at 5.0 LPM w/Network Data Alignment enabled | Broadband spectroscopy | 0.1 | 0.0 | 10000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM10-2.5 - Local Conditions | 86101 | 640 | Continuous | Teledyne API T640X at 16.67 LPM w/Network Data Alignment enabled | Broadband spectroscopy | FEM | EQPM-0516-240 | T-API T640X at 16.67 LPM w/Network Data Alignment enabled | 0.1 | 0.0 | 10000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM10-2.5 - Local Conditions | 86101 | 805 | Intermittent | IMPROVE | IMPROVE | 1.0 | -15.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| PM10-2.5 STP | 81103 | 001 | Intermittent | LO-VOL-SA244E | GRAVIMETRIC | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| PM10-2.5 STP | 81103 | 002 | Intermittent | LO-VOL-GMW9200 | GRAVIMETRIC | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| PM10-2.5 STP | 81103 | 003 | Intermittent | LO-VOL-WA10-DICHOT | GRAVIMETRIC | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| PM10-2.5 STP | 81103 | 004 | Intermittent | LO-VOL-SA246B-DICHOT | GRAVIMETRIC | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| PM10-2.5 STP | 81103 | 073 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-INLT | GRAVIMETRIC | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| PM10-2.5 STP | 81103 | 079 | Continuous | INSTRUMENTAL-R&P-SA246B-INLET | TEOM-GRAVIMETRIC | -50.0 | -50.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| PM10-2.5 STP | 81103 | 180 | Intermittent | Lo-Vol/ Glass/Fiber Filter | Gravimetric | 1.0 | 0 | R | Micrograms/cubic meter (25 C) | |||||
| PM10-2.5 STP | 81103 | 805 | Intermittent | IMPROVE | IMPROVE | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| PM2.5 - Local Conditions | 88101 | 116 | Intermittent | BGI Model PQ200 PM2.5 Sampler w/WINS | GRAVIMETRIC | FRM | RFPS-0498-116 | BGI INC Model PQ200 PM2.5 | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 117 | Intermittent | R & P Model 2000 PM2.5 Sampler w/WINS | GRAVIMETRIC | FRM | RFPS-0498-117 | R & P CO Model 2000 PM-2.5 | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 118 | Intermittent | R & P Model 2025 PM2.5 Sequential w/WINS | GRAVIMETRIC | FRM | RFPS-0498-118 | R & P CO PLUS MODEL 2025PM SEQ | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 119 | Intermittent | Andersen RAAS2.5-100 PM2.5 SAM w/WINS | GRAVIMETRIC | FRM | RFPS-0598-119 | Andersen RAAS2.5-100 PM2.5 SAM | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 120 | Intermittent | Andersen RAAS2.5-300 PM2.5 SEQ w/WINS | GRAVIMETRIC | FRM | RFPS-0598-120 | Andersen RAAS2.5-300 PM2.5 SEQ | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 123 | Intermittent | Thermo Env Model 605 CAPS | Gravimetric | FRM | RFPS-1098-123 | THERMO ENVIR MODEL 605 CAPS | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 128 | Intermittent | Andersen RAAS2.5-2000PM2.5 Aud w/WINS | Gravimetric | FRM | RFPS-0299-128 | Andersen RAAS2.5-200 PM2.5 Audit | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 129 | Intermittent | R & P Model 2000 PM-2.5 Audit w/WINS | GRAVIMETRIC | FRM | RFPS-0499-129 | R & P CO Model 2000 PM-2.5 Audit | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 135 | Intermittent | URG-MASS100 Single PM2.5 Sampler | GRAVIMETRIC | FRM | RFPS-0400-135 | URG MASS100 Single PM2.5 Sampler | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 136 | Intermittent | URG-MASS300 Sequential PM2.5 Sampler | GRAVIMETRIC | FRM | RFPS-0400-136 | URG MASS300 Sequential PM2.5 Sampler | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 142 | Intermittent | BGI Models PQ200-VSCC or PQ200A-VSCC | Gravimetric | FRM | RFPS-1006-142 | BGI Models PQ200-VSCC or PQ200A-VSCC | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 143 | Intermittent | R & P Model 2000 PM-2.5 Air Sampler w/VSCC | Gravimetric | FRM | RFPS-1006-143 | R & P Model 2000 Air Sampler with BGI VSCC | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 144 | Intermittent | R & P Model 2000 PM-2.5 Audit Sampler w/VSCC | Gravimetric | FRM | RFPS-1006-144 | R & P Model 2000 Audit Sampler with BGI VSCC | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 145 | Intermittent | R & P Model 2025 PM-2.5 Sequential Air Sampler w/VSCC | Gravimetric | FRM | RFPS-1006-145 | R & P Model 2025 Sequential Air Sampler with BGI VSCC | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 153 | Intermittent | Thermo Electron Model RAAS2.5-100 w/VSCC | Gravimetric | FRM | RFPS-1006-153 | Thermo Electron RAAS2.5-100 with BGI VSCC | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 154 | Intermittent | Thermo Electron Model RAAS2.5-200 Audit w/VSCC | Gravimetric | FRM | RFPS-10060154 | Thermo Electron RAAS2.5-200 Audit with BGI VSCC | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 155 | Intermittent | Thermo Electron Model RAAS2.5-300 Sequential w/VSCC | Gravimetric | FRM | RFPS-1006-155 | Thermo Electron RAAS2.5-300 Sequential with BGI VSCC | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 170 | Continuous | Met One BAM-1020 Mass Monitor w/VSCC | Beta Attenuation | FEM | EQPM-0308-170 | Met One BAM-1020 PM2.5 VSCC FEM | 5.0 | -10.0 | 975.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 177 | Intermittent | Thermo Scientific Partisol 2000-D Dichot. | Gravimetric | FEM | EQPS-0509-177 | Thermo Scientific Partisol 2000-D Dichot. | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 179 | Intermittent | Thermo Scientific Dichot. Partisol-Plus Model 2025-D Seq | Gravimetric | FEM | EQPS-0509-179 | Thermo Scientific Dichot. Partisol-Plus Model 2025-D Seq | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 181 | Continuous | Thermo Scientific TEOM 1400 FDMS or 1405 8500C FDMS w/VSCC | FDMS Gravimetric | FEM | EQPM-0609-181 | Thermo Scientific 1400a with Series 8500C FDMS VSCC FEM | 2.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 182 | Continuous | Thermo Scientific TEOM 1405-DF Dichotomous FDMS | FDMS Gravimetric | FEM | EQPM-0609-182 | Thermo Scientific 1405-DF FDMS Dichotomous FEM | 2.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 183 | Continuous | Thermo Scientific 5014i or FH62C14-DHS w/VSCC | Beta Attenuation | FEM | EQPM-0609-183 | Thermo Scientific 5014i or FH62C14-DHS VSCC FEM | 2.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 184 | Continuous | Thermo Scientific Model 5030 SHARP w/VSCC | Beta Attenuation | FEM | EQPM-0609-184 | Thermo Scientific Model 5030 SHARP VSCC FEM | 2.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 195 | Continuous | GRIMM EDM Model 180 with naphion dryer | Laser Light Scattering | FEM | EQPM-0311-195 | GRIMM EDM Model 180 for FEM | 0.1 | 0.0 | 1500.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 203 | Continuous | Opsis SM200-Dust Monitor w/VSCC | Beta Attenuation | FEM | EQPM-0812-203 | Opsis SM200-Dust Monitor VSCC FEM | 2.0 | -10.0 | 1000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 204 | Continuous | Teledyne Model 602 Beta plus w/VSCC | Beta Attenuation | FEM | EQPM-0912-204 | Teledyne Model 602 Beta plus VSCC FEM | 2.0 | -10.0 | 1500.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 209 | Continuous | Met One BAM-1022 Mass Monitor w/ VSCC or TE-PM2.5C | Beta Attenuation | FEM | EQPM-1013-209 | Met One BAM-1022 PM2.5 w/ VSCC or TE-PM2.5C FEM | 5.0 | -10.0 | 975.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 219 | Intermittent | Tisch Model TE-Wilbur2.5 Low-Volume Sampler | Gravimetric | FRM | RFPS-1014-219 | Tisch Model TE-Wilbur2.5 | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 221 | Intermittent | Met One E-FRM PM2.5 with WINS | Gravimetric | FRM | RFPS-0315-221 | Met One E-FRM PM2.5 with WINS | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 235 | Intermittent | Met One E-FRM PM2.5 with URG-2000-30EGN cyclone | Gravimetric | FEM | EQPS-0316-235 | Met One E-FRM PM2.5 with URG-2000-30EGN cyclone | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 236 | Continuous | Teledyne T640 at 5.0 LPM | Broadband spectroscopy | FEM | EQPM-0516-236 | T-API T640 at 5.0 LPM | 0.1 | 0.0 | 10000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 238 | Continuous | Teledyne T640X at 16.67 LPM | Broadband spectroscopy | FEM | EQPM-0516-238 | T-API T640X at 16.67 LPM | 0.1 | 0.0 | 10000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 245 | Intermittent | Met One E-SEQ-FRM PM2.5 with WINS | Gravimetric | FRM | RFPS-0717-245 | Met One E-SEQ-FRM PM2.5 with WINS | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 521 | Intermittent | Met One E-FRM PM2.5 with VSCC | Gravimetric | FRM | RFPS-0315-221 | Met One E-FRM PM2.5 with VSCC | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 545 | Intermittent | Met One E-SEQ-FRM PM2.5 with VSCC | Gravimetric | FRM | RFPS-0717-245 | Met One E-SEQ-FRM PM2.5 with VSCC | 2.0 | 0.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 581 | Continuous | Thermo Scientific 1405-F FDMS w/VSCC | FDMS Gravimetric | FEM | EQPM-0609-181 | Thermo Scientific 1405-F FDMS w/VSCC FEM | 2.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 636 | Continuous | Teledyne T640 at 5.0 LPM w/Network Data Alignment enabled | Broadband spectroscopy | FEM | EQPM-0516-236 | T-API T640 at 5.0 LPM w/Network Data Alignment enabled | 0.1 | 0.0 | 10000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 638 | Continuous | Teledyne T640X at 16.67 LPM w/Network Data Alignment enabled | Broadband spectroscopy | FEM | EQPM-0516-238 | T-API T640X at 16.67 LPM w/Network Data Alignment enabled | 0.1 | 0.0 | 10000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 736 | Continuous | Teledyne T640 at 5.0 LPM (Corrected) | Broadband spectroscopy | FEM | EQPM-0516-236 | T-API T640 at 5.0 LPM (Corrected) | 0.1 | 0.0 | 10000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 - Local Conditions | 88101 | 738 | Continuous | Teledyne T640X at 16.67 LPM (Corrected) | Broadband spectroscopy | FEM | EQPM-0516-238 | T-API T640X at 16.67 LPM (Corrected) | 0.1 | 0.0 | 10000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 Carbon at 430 nm | 88396 | 848 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | R & P Model 2025 PM2.5 Sequential Quartz VSCC | 0.025 | 5 | Micrograms/cubic meter (LC) | ||||||
| PM2.5 Carbon at 430 nm | 88396 | 878 | Continuous | Met One BC-1054 Black Carbon Monitor | Optical Absorption | 0.1 | 2 | Micrograms/cubic meter (LC) | ||||||
| PM2.5 Carbon at 525 nm | 88397 | 878 | Continuous | Met One BC-1054 Black Carbon Monitor | Optical Absorption | 0.1 | 2 | Micrograms/cubic meter (LC) | ||||||
| PM2.5 Carbon at 565 nm | 88398 | 878 | Continuous | Met One BC-1054 Black Carbon Monitor | Optical Absorption | 0.1 | 2 | Micrograms/cubic meter (LC) | ||||||
| PM2.5 Carbon at 700 nm | 88399 | 878 | Continuous | Met One BC-1054 Black Carbon Monitor | Optical Absorption | 0.1 | 2 | Micrograms/cubic meter (LC) | ||||||
| PM2.5 Raw Data | 88501 | 116 | Intermittent | BGI Model PQ200 PM2.5 Sampler w/WINS | GRAVIMETRIC | FRM | RFPS-0498-116 | BGI INC Model PQ200 PM2.5 | 2.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |
| PM2.5 Raw Data | 88501 | 117 | Intermittent | R & P Model 2000 PM2.5 Sampler w/WINS | GRAVIMETRIC | FRM | RFPS-0498-117 | R & P CO Model 2000 PM-2.5 | 2.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |
| PM2.5 Raw Data | 88501 | 118 | Intermittent | R & P MODEL 2025 PM2.5 SEQUNTL | GRAVIMETRIC | 2.0 | 500.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| PM2.5 Raw Data | 88501 | 119 | Intermittent | Andersen RAAS2.5-100 PM2.5 SAM w/WINS | GRAVIMETRIC | FRM | RFPS-0598-119 | Andersen RAAS2.5-100 PM2.5 SAM | 2.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |
| PM2.5 Raw Data | 88501 | 120 | Intermittent | Andersen RAAS2.5-300 PM2.5 SEQ w/WINS | GRAVIMETRIC | FRM | RFPS-0598-120 | Andersen RAAS2.5-300 PM2.5 SEQ | 2.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |
| PM2.5 Raw Data | 88501 | 142 | Intermittent | BGI Models PQ200-VSCC or PQ200A-VSCC | Gravimetric | FRM | RFPS-1006-142 | BGI Models PQ200-VSCC or PQ200A-VSCC | 2.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |
| PM2.5 Raw Data | 88501 | 143 | Intermittent | Thermo 2000 | Gravimetric | 2.0 | 1 | T | Micrograms/cubic meter (LC) | |||||
| PM2.5 Raw Data | 88501 | 145 | Intermittent | R & P Model 2025 PM-2.5 Sequential Air Sampler w/VSCC | Gravimetric | FRM | RFPS-1006-145 | R & P Model 2025 Sequential Air Sampler with BGI VSCC | 2.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |
| PM2.5 Raw Data | 88501 | 170 | Continuous | Met-One BAM-1020W/PM2.5 SCC | Beta Attenuation | 2.0 | 975.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| PM2.5 Raw Data | 88501 | 177 | Intermittent | Thermo Scientific Partisol 2000-D Dichot. | Gravimetric | FEM | EQPS-0509-177 | Thermo Scientific Partisol 2000-D Dichot. | 2.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |
| PM2.5 Raw Data | 88501 | 178 | Intermittent | Thermo Scientific 1405 TEOM | Gravimetric | 2.0 | 1 | T | Micrograms/cubic meter (LC) | |||||
| PM2.5 Raw Data | 88501 | 179 | Intermittent | Thermo Scientific Dichot. Partisol-Plus | Grvimetric | 2.0 | 1 | T | Micrograms/cubic meter (LC) | |||||
| PM2.5 Raw Data | 88501 | 203 | Continuous | Opsis SM200-Dust Monitor w/VSCC | Beta Attenuation | FEM | EQPM-0812-203 | Opsis SM200-Dust Monitor VSCC FEM | 2.0 | -10.0 | 1000.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 Raw Data | 88501 | 204 | Continuous | Teledyne Model 602 Beta plus w/VSCC | Beta Attenuation | FEM | EQPM-0912-204 | Teledyne Model 602 Beta plus VSCC FEM | 2.0 | -10.0 | 1500.0 | 1 | T | Micrograms/cubic meter (LC) |
| PM2.5 Raw Data | 88501 | 701 | Continuous | PM2.5 SCC w/No Correction Factor | TEOM Gravimetric 50 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 702 | Continuous | PM2.5 SCC w/Correction Factor | TEOM Gravimetric 50 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 703 | Continuous | PM2.5 SCC w/No Correction Factor | TEOM Gravimetric 30 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 704 | Continuous | PM2.5 SCC w/Correction Factor | TEOM Gravimetric 30 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 705 | Continuous | PM2.5 SCC w/Correction Factor | TEOM Gravimetric 40 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 706 | Continuous | PM2.5 SCC w/No Correction Factor | TEOM Gravimetric 40 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 711 | Continuous | PM2.5 SSI w/No Correction Factor | TEOM Gravimetric 50 deg C | -10.0 | -50.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 712 | Continuous | PM2.5 SSI w/Correction Factor | TEOM Gravimetric 50 deg C | -10.0 | -50.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 713 | Continuous | PM2.5 SSI w/Correction Factor | TEOM Gravimetric 30 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 715 | Continuous | PM2.5 VSCC w/No Correction Factor | TEOM Gravimetric 30 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 716 | Continuous | PM2.5 VSCC w/No Correction Factor | TEOM Gravimetric 50 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 721 | Continuous | PM2.5 WINS w/No Correction Factor | TEOM Gravimetric 50 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 722 | Continuous | PM2.5 WINS w/Correction Factor | TEOM Gravimetric 50 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 723 | Continuous | PM2.5 WINS w/No Correction Factor | TEOM Gravimetric 30 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 731 | Continuous | Met-One BAM-1020 W/PM2.5 SCC | Beta Attenuation | 3.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 732 | Continuous | Met-One BAM W/PM2.5 WINS | Beta Attenuation | 3.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 733 | Continuous | Met-One BAM W/PM2.5 VSCC | Beta Attenuation | 3.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 734 | Continuous | Met-One E- BAM W/PM2.5 SCC | Beta Attenuation | 6.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 735 | Continuous | Met-One E- Sampler W/PM2.5 at 2 LPM | Light Scatter at 670 nm | 1.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 740 | Continuous | PM2.5 SCC | CAMMS Mass pressure drop | 3.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| PM2.5 Raw Data | 88501 | 750 | Continuous | Andersen BAM w/PM2.5 SCC | Beta Attenuation | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 751 | Continuous | Andersen BAM w/PM2.5 SSI | Beta Attenuation | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 752 | Continuous | Andersen BAM w/PM2.5 WINS | Beta Attenuation | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 753 | Continuous | Andersen BAM w/PM2.5 VSCC | Beta Attenuation | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 760 | Continuous | PM2.5 SCC | FDMS-Gravimetric | 0.06 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 761 | Continuous | PM2.5 VSCC | FDMS-Gravimetric | 0.06 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 787 | Continuous | AUTOMATED WINS 2.5UM IMPACTOR | BETA GUAGE | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 789 | Continuous | AUTOMATED WINS 2.5UM IMPACTOR | TEOM-GRAVIMETRIC | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 790 | Continuous | Virtual Impactor | FDMS-Gravimetric 1405-DF | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Raw Data | 88501 | 791 | Continuous | OTHR AUTOMATD 2.5 MASS CONCENT | SURROGATE MEASURE | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 STP | 81104 | 001 | Intermittent | LO-VOL-SA244E | GRAVIMETRIC | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| PM2.5 STP | 81104 | 002 | Intermittent | LO-VOL-GMW9200 | GRAVIMETRIC | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| PM2.5 STP | 81104 | 003 | Intermittent | LO-VOL-WA10-DICHOT | GRAVIMETRIC | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| PM2.5 STP | 81104 | 004 | Intermittent | LO-VOL-SA246B-DICHOT | GRAVIMETRIC | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| PM2.5 STP | 81104 | 062 | Intermittent | HI-VOL-WEDDING-INLET | GRAVIMETRIC | 4.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| PM2.5 STP | 81104 | 064 | Intermittent | HI-VOL-SA/GMW-321-B | GRAVIMETRIC | 4.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| PM2.5 STP | 81104 | 073 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-INLT | GRAVIMETRIC | 4.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| PM2.5 STP | 81104 | 076 | Continuous | INSTRMENTL-ANDRSEN-SA246B-INLT | BETA-ATTENUATION | 4.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| PM2.5 STP | 81104 | 079 | Continuous | INSTRUMENTAL-R&P-SA246B INLET | TEOM-GRAVIMETRIC | -50.0 | -50.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| PM2.5 STP | 81104 | 098 | Intermittent | HI-VOL | GRAVIMETRIC | 4.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| PM2.5 STP | 81104 | 731 | Continuous | Met-One BAM W/PM2.5 SCC | Beta Attenuation | 3.0 | -10.0 | 5000.0 | 1 | R | Micrograms/cubic meter (25 C) | |||
| PM2.5 STP | 81104 | 732 | Continuous | Met-One BAM W/PM2.5 WINS | Beta Attenuation | 3.0 | -10.0 | 5000.0 | 1 | R | Micrograms/cubic meter (25 C) | |||
| PM2.5 Total Atmospheric | 88500 | 181 | Continuous | PM2.5 VSCC | FRMS Gravimetric | 1.0 | 1 | T | Micrograms/cubic meter (LC) | |||||
| PM2.5 Total Atmospheric | 88500 | 701 | Continuous | PM2.5 SCC w/No Correction Factor | TEOM Gravimetric 50 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Total Atmospheric | 88500 | 702 | Continuous | PM2.5 SCC w/Correction Factor | TEOM Gravimetric 50 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Total Atmospheric | 88500 | 703 | Continuous | PM2.5 SCC w/No Correction Factor | TEOM Gravimetric 30 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Total Atmospheric | 88500 | 704 | Continuous | PM2.5 SCC w/Correction Factor | TEOM Gravimetric 30 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Total Atmospheric | 88500 | 711 | Continuous | PM2.5 SSI w/No Correction Factor | TEOM Gravimetric 50 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Total Atmospheric | 88500 | 715 | Continuous | PM2.5 VSCC w/No Correction Factor | TEOM Gravimetric 30 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Total Atmospheric | 88500 | 721 | Continuous | PM2.5 WINS w/No Correction Factor | TEOM Gravimetric 50 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Total Atmospheric | 88500 | 723 | Continuous | PM2.5 WINS w/No Correction Factor | TEOM Gravimetric 30 deg C | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Total Atmospheric | 88500 | 740 | Continuous | PM2.5 SCC | CAMMS Mass pressure drop | 3.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | ||||
| PM2.5 Total Atmospheric | 88500 | 760 | Continuous | PM2.5 SCC | FDMS-Gravimetric | 0.06 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Total Atmospheric | 88500 | 761 | Continuous | PM2.5 VSCC | FDMS-Gravimetric | 0.06 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Total Atmospheric | 88500 | 789 | Continuous | AUTOMATED WINS 2.5UM IMPACTOR | TEOM-GRAVIMETRIC | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Total Atmospheric | 88500 | 790 | Continuous | Virtual Impactor | FDMS-Gravimetric 1405-DF | -10.0 | -10.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Volatile Channel | 88503 | 181 | Continuous | PM2.5 VSCC | FRMS Gravimetric | -100.0 | 1 | T | Micrograms/cubic meter (LC) | |||||
| PM2.5 Volatile Channel | 88503 | 760 | Continuous | PM2.5 SCC | FDMS-Gravimetric | -100.0 | -100.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Volatile Channel | 88503 | 761 | Continuous | PM2.5 VSCC | FDMS-Gravimetric | -100.0 | -100.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| PM2.5 Volatile Channel | 88503 | 790 | Continuous | Virtual Impactor | FDMS-Gravimetric 1405-DF | -100.0 | -100.0 | 5000.0 | 1 | T | Micrograms/cubic meter (LC) | |||
| Palladium (TSP) STP | 12151 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.163 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Palladium PM10 STP | 82127 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 15.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Palladium PM10 STP | 82127 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 15.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Palladium PM10 STP | 82127 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 15.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Palladium PM2.5 LC | 88151 | 811 | Intermittent | Met One SASS Teflon | Energy dispersive XRF | 0.01476 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Paraffins (alkanes) | 16115 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Particle Light Scatter | 88347 | 011 | Continuous | Instrumental | Nephelometer | 0.1 | 1 | Inverse Megameters | ||||||
| Particle Light Scatter | 88347 | 812 | Continuous | Ecotech M9003/ Aurora | Nephelometry | 0.1 | 1 | Inverse Megameters | ||||||
| Particle Number, 100-200 nm | 87100 | 031 | Continuous | TSI 3031 Ultrafine Particle Monitor | Electrical Mobility | 0.0 | 0.0 | 1000000.0 | 1 | Count per cm^3 | ||||
| Particle Number, 20-30 nm | 87020 | 031 | Continuous | TSI 3031 Ultrafine Particle Monitor | Electrical Mobility | 0.0 | 0.0 | 1000000.0 | 1 | Count per cm^3 | ||||
| Particle Number, 30-50 nm | 87030 | 031 | Continuous | TSI 3031 Ultrafine Particle Monitor | Electrical Mobility | 0.0 | 0.0 | 1000000.0 | 1 | Count per cm^3 | ||||
| Particle Number, 50-70 nm | 87050 | 031 | Continuous | TSI 3031 Ultrafine Particle Monitor | Electrical Mobility | 0.0 | 0.0 | 1000000.0 | 1 | Count per cm^3 | ||||
| Particle Number, 70-100 nm | 87070 | 031 | Continuous | TSI 3031 Ultrafine Particle Monitor | Electrical Mobility | 0.0 | 0.0 | 1000000.0 | 1 | Count per cm^3 | ||||
| Particle Number, > 200 nm | 87200 | 031 | Continuous | TSI 3031 Ultrafine Particle Monitor | Electrical Mobility | 0.0 | 0.0 | 1000000.0 | 1 | Count per cm^3 | ||||
| Particle Number, Total Count | 87101 | 173 | Continuous | T-API 651/TSI 3783 at 3.0 lpm with 7 nm min. detectable particle (D50) | Water-Based Condensation particle counter | 0.0 | 0.0 | 1.0e+20 | 1 | Count per cm^3 | ||||
| Particulate Nitrate (TSP) LC | 22307 | 900 | Intermittent | Teflon CASTNET-style 3-stage filter pack | Ion Chromatography EPA Modified Method 300.0 | 0.01 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Peak Wind Gust | 61105 | 020 | Continuous | INSTRUMENTAL | SPOT READING | 1.0 | 0.0 | 0 | R | Knots | ||||
| Peak Wind Gust | 61105 | 066 | Continuous | Instrumental | RM Young Ultrasonic Anemometer Model 81000 | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Peak Wind Gust | 61105 | 068 | Continuous | Instrumental | RM Young Ultrasonic Anemometer Model 86004 | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Peak Wind Gust | 61105 | 069 | Continuous | Instrumental | Met One AIO2 Sonic Weather Sensor | 0.1 | 1 | R | Knots | |||||
| Pentachlorobenzene (TSP) STP | 17803 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 10.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Pentachlorobenzene (TSP) STP | 17803 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 25.7 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Pentachlorobiphenyl (TSP) STP | 17813 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 2.0 | 0.0 | 0 | R | Pg/cubic meter(25 C) | ||||
| Pentachloroethane (TSP) STP | 16795 | 110 | Intermittent | SS-Canister-Pressurized | GC/MS | 2.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Pentachloroethane (TSP) STP | 16795 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 44.4 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Pentachloroethane (TSP) STP | 16795 | 176 | Intermittent | 6L Subatm SS Canister | Entech Precon GC/MS | 0.24 | -0.24 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Pentachloronitrobenzene (TSP) STP | 17725 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 36.0 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Pentachlorophenol (TSP) STP | 17808 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 10.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Pentachlorophenol (TSP) STP | 17808 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 37.7 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Pentachlorophenol (TSP) STP | 17808 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Peroxyactyl nitrate | 44301 | 011 | Continuous | INSTRUMENTAL | ELECTRON CAPTURE GAS CHROMATOGRAPH | 0.1 | -0.1 | 1 | R | Parts per billion | ||||
| Perylene (TSP) STP | 17212 | 092 | Intermittent | HI-VOL | THIN LAYER CHROMATOGRAPHY | 0.2 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Perylene (TSP) STP | 17212 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Perylene (TSP) STP | 17212 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00023 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Perylene (TSP) STP | 17212 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.0824 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| Perylene (TSP) STP | 17212 | 119 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS-SIM Modified TO-13A | 0.08 | 4 | R | Nanograms/cubic meter (25 C) | |||||
| Phenacetin (TSP) STP | 16796 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 23.8 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Phenanthrene (TSP) STP | 17150 | 101 | Intermittent | HI-VOL/PUF-XAD | GC-MS-SIM | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Phenanthrene (TSP) STP | 17150 | 102 | Intermittent | HI-VOL/PUF CARTRIDGE | TO-13- EPA610- EPA625 | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Phenanthrene (TSP) STP | 17150 | 103 | Intermittent | Hi-Vol/PUF Cartridge | Micro Wave Extraction GC/MS | 0.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Phenanthrene (TSP) STP | 17150 | 104 | Intermittent | Hi-Vol/PUF Cartridge | Accelerated solvent extraction GC-MS | 0.28 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Phenanthrene (TSP) STP | 17150 | 105 | Intermittent | Hi Vol/PUF | GC/MS TO-13A | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Phenanthrene (TSP) STP | 17150 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Phenanthrene (TSP) STP | 17150 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 28.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Phenanthrene (TSP) STP | 17150 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00012 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Phenanthrene (TSP) STP | 17150 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.102 | 0.0 | 3 | R | Nanograms/cubic meter (25 C) | ||||
| Phenanthrene (TSP) STP | 17150 | 119 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS-SIM Modified TO-13A | 0.102 | 0.0 | 3 | R | Nanograms/cubic meter (25 C) | ||||
| Phenanthrene (TSP) STP | 17150 | 904 | Intermittent | SKC Pump XAD-2 SORBENT Tube | HPLC Fluorescence/UV NIOSH 5506 | 170.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Phenanthrene (TSP) STP | 17150 | 909 | Intermittent | SKC Pump XAD-2 SORBENT Tube | GC/MS NIOSH 5515 REAC SOP 1817 | 4170.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Phenol | 45300 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Phenol | 45300 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Phenol | 45300 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Phenol (TSP) STP | 16797 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 40.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Phenol (TSP) STP | 16797 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.0474 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| Phenol (TSP) STP | 16797 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Phosphate (TSP) STP | 12345 | 091 | Intermittent | HI-VOL | MOLYBDATE-STANNOUS CHLORIDE | 0.5 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Phosphate (TSP) STP | 12345 | 094 | Intermittent | HI-VOL | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.5 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Phosphoric acid | 42307 | 101 | Intermittent | SILICA GEL TUBE | IC SCAN | 2.0 | -2.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Phosphorotrithioic acid,S,S,S-tributylester | 43167 | 167 | Intermittent | GMW HI VOL 2000H | FINNIGAN MAGNUM GC/MS | 3.0 | -3.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Phosphorus (TSP) STP | 12152 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Phosphorus (TSP) STP | 12152 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Phosphorus (TSP) STP | 12152 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Phosphorus (TSP) STP | 12152 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.015 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Phosphorus (precip) | 65152 | 085 | Intermittent | ANDERSON RAINFALL BUCKET | EMISSION SPECTRA ICAP | 0.05 | 0.0 | 2 | R | Milligrams/liter | ||||
| Phosphorus PM10 LC | 85152 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 0.015 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Phosphorus PM10 LC | 85152 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 0.00251 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Phosphorus PM10 STP | 82152 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.015 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Phosphorus PM10 STP | 82152 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Phosphorus PM10 STP | 82152 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Phosphorus PM10 STP | 82152 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Phosphorus PM10-2.5 LC | 86152 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00251 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Phosphorus PM10-2.5 STP | 83152 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.015 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Phosphorus PM2.5 LC | 88152 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Phosphorus PM2.5 LC | 88152 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Phosphorus PM2.5 LC | 88152 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Phosphorus PM2.5 LC | 88152 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.00627 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Phosphorus PM2.5 LC | 88152 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00251 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Phosphorus PM2.5 LC | 88152 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00251 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Phosphorus PM2.5 LC | 88152 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00251 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Phosphorus PM2.5 LC | 88152 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00251 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Phosphorus PM2.5 LC | 88152 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00251 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Phosphorus PM2.5 LC | 88152 | 871 | Intermittent | URG MASS400 TeflonVSCC | Energy Dispersive XRF | 0.00251 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Phosphorus PM2.5 LC | 88152 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00251 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Phosphorus PM2.5 LC | 88152 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Phosphorus PM2.5 STP | 84152 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.015 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Pinene & p-ethytoluene | 43188 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Platinum (TSP) LC | 14108 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.229 | 3 | Micrograms/cubic meter (LC) | ||||||
| Platinum (TSP) STP | 12150 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Platinum PM10 LC | 85108 | 820 | Continuous | Cooper Environmental Services (CES) XACT 625 | X-ray fluorescence (XRF) | 0.229 | 3 | Nanograms/cubic meter (LC) | ||||||
| Platinum PM2.5 LC | 88141 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 0.229 | 3 | Micrograms/cubic meter (LC) | ||||||
| Polonium-210 (TSP) STP | 12153 | 096 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.002 | 0.0 | 2 | R | Picocuries/cubic meter | ||||
| Polychlorinated biphenyls (PCBs) | 17833 | 120 | Intermittent | Hi Vol XAD-2/PUF | TO-13A/SW-846 Method 1668 | 3.33 | 0.0 | 50.0 | 2 | R | Pg/cubic meter(25 C) | |||
| Polycyclic organic matter (TSP) STP | 17199 | 101 | Intermittent | Hi Vol/PUF | GC/MS | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Polynuclear aromatic hydrocarbons (TSP) STP | 17202 | 013 | Continuous | Instrumental PAS-2000 | UV Radiation | 0.1 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Polynuclear aromatic hydrocarbons (TSP) STP | 17202 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Potassium (TSP) STP | 12180 | 045 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.2559 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Potassium (TSP) STP | 12180 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.003 | 0.0 | 100.0 | 3 | R | Micrograms/cubic meter (25 C) | |||
| Potassium (TSP) STP | 12180 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.03 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Potassium (TSP) STP | 12180 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Potassium (TSP) STP | 12180 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Potassium (TSP) STP | 12180 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Potassium (TSP) STP | 12180 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Potassium (TSP) STP | 12180 | 905 | Intermittent | SKC Pump Filter | ICP/AES NIOSH 7300 | 13.89 | 2 | R | Micrograms/cubic meter (25 C) | |||||
| Potassium (TSP) STP | 12180 | 910 | Intermittent | SKC Pump Filter | MOd NISH 7300/6010B SOP 1813 | 1.4444 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Potassium (precip) | 65312 | 082 | Intermittent | PRECIP | ATOMIC ABSORPTION | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Potassium (precip) | 65312 | 083 | Intermittent | PRECIP | FLAME EMISSION | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Potassium (precip) | 65312 | 084 | Intermittent | PRECIP | X-RAY FLUORESCENCE | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Potassium (precip) | 65312 | 085 | Intermittent | ANDERSON RAINFALL BUCKET | EMISSION SPECTRA ICAP | 0.6 | 0.0 | 2 | R | Milligrams/liter | ||||
| Potassium (precip) | 65312 | 086 | Intermittent | ANDERSON RAINFALL BUCKET | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.05 | 0.0 | 2 | R | Milligrams/liter | ||||
| Potassium Ion PM10 LC | 85303 | 890 | Intermittent | Model 2025 PM10 Sequential Teflon | Ion Chromatography | 0.012 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Potassium Ion PM10-2.5 LC | 86303 | 885 | Intermittent | Model 2025 Dichot Sequential Teflon | Ion Chromatography | 0.012 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Potassium Ion PM2.5 LC | 88303 | 812 | Intermittent | Met One SASS/SuperSASS Nylon | Ion Chromatography | 0.014 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Potassium Ion PM2.5 LC | 88303 | 822 | Intermittent | Andersen RAAS Nylon | Ion Chromatography | 0.013 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Potassium Ion PM2.5 LC | 88303 | 834 | Intermittent | URG MASS400 Teflon WINS | Ion Chromatography | 0.006 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Potassium Ion PM2.5 LC | 88303 | 844 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | Ion Chromatography | 0.012 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Potassium Ion PM2.5 LC | 88303 | 845 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | ION CHROMATOGRAPHY | 0.012 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Potassium Ion PM2.5 LC | 88303 | 849 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | ION CHROMATOGRAPHY | 0.012 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Potassium Ion PM2.5 LC | 88303 | 850 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | Atomic Absorption | 0.00625 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Potassium Ion PM2.5 LC | 88303 | 852 | Intermittent | R&P MDL2300 PM2.5 SEQ SPEC NYL | ION CHROMATOGRAPHY | 0.00949 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Potassium Ion PM2.5 LC | 88303 | 874 | Intermittent | URG MASS400 TeflonVSCC | Ion Chromatography | 0.006 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Potassium Ion PM2.5 LC | 88303 | 885 | Intermittent | Model 2025 Dichot Sequential Teflon | Ion Chromatography | 0.012 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Potassium PM10 LC | 85180 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 3.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Potassium PM10 LC | 85180 | 820 | Continuous | Cooper Environmental Services model Xact 620 | X-ray fluorescence (XRF) | 0.811 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Potassium PM10 LC | 85180 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 1.37 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Potassium PM10 LC | 85180 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 13.9 | 0.0 | 99999.99999 | 1 | R | Nanograms/cubic meter (LC) | |||
| Potassium PM10 LC | 85180 | 902 | Intermittent | BGI Inc. frmOMNI | ICP-AES | 34.7 | 0.0 | 99999.99999 | 1 | R | Nanograms/cubic meter (LC) | |||
| Potassium PM10 LC | 85180 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 4.2 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Potassium PM10 LC | 85180 | 904 | Intermittent | BGI PQ200/200A | ICP-AES | 10.4 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Potassium PM10 LC | 85180 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 4.2 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Potassium PM10 LC | 85180 | 906 | Intermittent | R & P Partisol 2000 | ICP-AES | 10.4 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Potassium PM10 STP | 82180 | 062 | Intermittent | HI-VOL-WEDDING-INLET | GRAVIMETRIC | 4000.0 | 0.0 | -3 | R | Nanograms/cubic meter (25 C) | ||||
| Potassium PM10 STP | 82180 | 069 | Intermittent | HIVOL-SA/GMW-321-B | EMISSION SPECTRA ICAP | 255.9 | 0.0 | -2 | R | Nanograms/cubic meter (25 C) | ||||
| Potassium PM10 STP | 82180 | 085 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 1.7 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Potassium PM10 STP | 82180 | 092 | Intermittent | HI-VOL-SA/GMW-321-B | ATOMIC ABSORPTION | 30.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Potassium PM10 STP | 82180 | 102 | Intermittent | HI-VOL-SA/GMW1200 | ION CHROMATOGRAPH CONDUCTIMETRIC | 30.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Potassium PM10 STP | 82180 | 106 | Intermittent | HI-VOL-Wedding Inlet | Emission Spectra ICAP | 150.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Potassium PM10 STP | 82180 | 107 | Intermittent | HI-VOL-SA/GMW-321-B | Emission Spectra ICAP | 205.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Potassium PM10 STP | 82180 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 3.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Potassium PM10 STP | 82180 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 29.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Potassium PM10 STP | 82180 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 29.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Potassium PM10 STP | 82180 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 29.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Potassium PM10-2.5 LC | 86180 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00137 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Potassium PM10-2.5 STP | 83180 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Potassium PM2.5 LC | 88180 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Potassium PM2.5 LC | 88180 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Potassium PM2.5 LC | 88180 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Potassium PM2.5 LC | 88180 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.00341 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Potassium PM2.5 LC | 88180 | 820 | Continuous | Cooper Environmental Services (CES) XACT 625 | X-ray Fluorescence (XRF) Instrumentation | 2.366 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Potassium PM2.5 LC | 88180 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00137 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Potassium PM2.5 LC | 88180 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00137 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Potassium PM2.5 LC | 88180 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00137 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Potassium PM2.5 LC | 88180 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00137 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Potassium PM2.5 LC | 88180 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00137 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Potassium PM2.5 LC | 88180 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00137 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Potassium PM2.5 LC | 88180 | 880 | Intermittent | Andersen RAAS Quartz | Atomic Absorption | 0.03 | 50.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Potassium PM2.5 LC | 88180 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00137 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Potassium PM2.5 LC | 88180 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Potassium PM2.5 LC | 88180 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 0.0139 | 5000.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Potassium PM2.5 LC | 88180 | 902 | Intermittent | BGI Inc. frmOMNI | ICP-AES | 0.0347 | 5000.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Potassium PM2.5 LC | 88180 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0042 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Potassium PM2.5 LC | 88180 | 904 | Intermittent | BGI PQ200/200A | ICP-AES | 0.0104 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Potassium PM2.5 LC | 88180 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.0042 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Potassium PM2.5 LC | 88180 | 906 | Intermittent | R & P Partisol 2000 | ICP-AES | 0.0104 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Potassium PM2.5 STP | 84180 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Potassium TSP LC | 14180 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 2.366 | 3 | Micrograms/cubic meter (LC) | ||||||
| Potassium TSP LC | 14180 | 900 | Intermittent | Teflon CASTNET-style 3-stage filter pack | Inductively Coupled Plasma - Optical Emission Spectrometry (ICP-OES) EPA Modified Method 6010B | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Pronamide (TSP) STP | 16798 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 29.4 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Propane | 43204 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 104 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-FID | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| Propane | 43204 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.47594 | -0.47594 | 4 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.78 | -0.78 | 2 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 174 | Continuous | Passivated Canister | Cryogenic Preconcentration GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propane | 43204 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propane | 43204 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propane | 43204 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propane | 43204 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propane | 43204 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propane | 43204 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propane | 43204 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propane | 43204 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propane | 43204 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propane | 43204 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propane | 43204 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propane | 43204 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propionaldehyde | 43504 | 102 | Intermittent | CARTRIDGE-DNPH-ON-SILICA | HPLC ULTRAVIOLET ABSORPTION | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| Propionaldehyde | 43504 | 114 | Intermittent | CARTRIDGE-DNPH-SILICA-SEP-PAK | HPLC-PHOTODIODE ARRAY | 0.085 | -0.085 | 2 | R | Parts per billion Carbon | ||||
| Propionaldehyde | 43504 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.3 | -0.3 | 2 | R | Parts per billion Carbon | ||||
| Propionaldehyde | 43504 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propionaldehyde | 43504 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propionaldehyde | 43504 | 156 | Intermittent | Cartridge DNPH on Silica, Heated O3 Denuder | HPLC Photo Diode Array | 0.246 | -0.246 | 1 | R | Parts per billion Carbon | ||||
| Propionaldehyde | 43504 | 165 | Intermittent | ATEC2400 W/Waters Silica DNPH | HP LC-1050 W/Diode Array Detector | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| Propionaldehyde | 43504 | 166 | Intermittent | ATEC 2400 W/Waters Silica DNPH | TO-11 Dionex DX-300 Ion Chrmtg | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| Propionaldehyde | 43504 | 179 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | Liquid Chromatography w/diode array detection | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| Propionaldehyde | 43504 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propionitrile | 43606 | 116 | Intermittent | MIXED SORBENT CARTRIDGE-2 | GC/MS | 29.4 | -29.4 | 1 | Parts per billion Carbon | |||||
| Propylene | 43205 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 113 | Intermittent | SS-Canister_Pressurized | Capillary GC ITD Mass Spectro | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 29.4 | -29.4 | 1 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| Propylene | 43205 | 141 | Continuous | IR Spectrometer | Spectra reference matching with PLS | 5.7 | -5.7 | 1 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.3939 | -0.3939 | 4 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 1.34 | -1.34 | 2 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.3 | -0.3 | 2 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 174 | Continuous | Passivated Canister | Cryogenic Preconcentration GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 176 | Intermittent | 6L Subatm SS Canister | Entech Precon GC/MS | 0.177 | -0.177 | 3 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.39 | -0.39 | 2 | R | Parts per billion Carbon | ||||
| Propylene | 43205 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propylene | 43205 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propylene | 43205 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propylene | 43205 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propylene | 43205 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propylene | 43205 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propylene | 43205 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propylene | 43205 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propylene | 43205 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propylene | 43205 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propylene | 43205 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propylene | 43205 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Propylene oxide | 43602 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 1.2 | -1.2 | 1 | R | Parts per billion Carbon | ||||
| Propylene oxide | 43602 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Propylene oxide | 43602 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propylene oxide | 43602 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Propyne | 43144 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.76 | -0.76 | 2 | R | Parts per billion Carbon | ||||
| Propyne | 43144 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Propyne | 43144 | 124 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| Propyne | 43144 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Propyne | 43144 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Pyrene (TSP) STP | 17204 | 092 | Intermittent | HI-VOL | THIN LAYER CHROMATOGRAPHY | 0.2 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Pyrene (TSP) STP | 17204 | 101 | Intermittent | HI-VOL/PUF-XAD | GC-MS-SIM | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Pyrene (TSP) STP | 17204 | 102 | Intermittent | HI-VOL/PUF CARTRIDGE | TO-13- EPA610- EPA625 | 0.1 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Pyrene (TSP) STP | 17204 | 103 | Intermittent | Hi-Vol/PUF Cartridge | Micro Wave Extraction GC/MS | 0.11 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Pyrene (TSP) STP | 17204 | 104 | Intermittent | Hi-Vol/PUF Cartridge | Accelerated solvent extraction GC-MS | 0.37 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Pyrene (TSP) STP | 17204 | 105 | Intermittent | Hi Vol/PUF | GC/MS TO-13A | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Pyrene (TSP) STP | 17204 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Pyrene (TSP) STP | 17204 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 26.9 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Pyrene (TSP) STP | 17204 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00016 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| Pyrene (TSP) STP | 17204 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.0474 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| Pyrene (TSP) STP | 17204 | 119 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS-SIM Modified TO-13A | 0.0474 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| Pyrene (TSP) STP | 17204 | 904 | Intermittent | SKC Pump XAD-2 SORBENT Tube | HPLC Fluorescence/UV NIOSH 5506 | 170.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Pyrene (TSP) STP | 17204 | 909 | Intermittent | SKC Pump XAD-2 SORBENT Tube | GC/MS NIOSH 5515 REAC SOP 1817 | 4120.0 | 0 | R | Nanograms/cubic meter (25 C) | |||||
| Pyridine (TSP) STP | 16799 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 58.7 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Radioactivity rainfall | 65305 | 091 | Intermittent | BUCKET | PROPORTIONAL COUNTER | 0.01 | 0.0 | 2 | R | Picocuries/cubic meter | ||||
| Radium-226 (TSP) STP | 12187 | 096 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.002 | 0.0 | 2 | R | Picocuries/cubic meter | ||||
| Radium-228 (TSP) STP | 12188 | 096 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.002 | 0.0 | 2 | R | Picocuries/cubic meter | ||||
| Radon | 43776 | 001 | Continuous | PYLON AP-5 | SCINTILLATOR | 0.001 | -0.001 | 1 | R | Picocuries/Liter | ||||
| Rain 24hr total | 65101 | 091 | Intermittent | BUCKET | STANDARD NWS RAIN GAGE | 0.01 | 0.0 | 2 | R | Inches (rainfall) | ||||
| Rain/melt precipitation | 65102 | 011 | Intermittent | BUCKET | CONTINUOUS OR INCREMENTAL | 0.01 | 0.0 | 2 | R | Inches (rainfall) | ||||
| Rain/melt precipitation | 65102 | 012 | Intermittent | BUCKET | TVA-RECORDING GAGE | 0.01 | 0.0 | 2 | R | Inches (rainfall) | ||||
| Rain/melt precipitation | 65102 | 013 | Intermittent | TIPPING BUCKET | METONE 8 HEATD RAIN GAUGE 375 | 0.01 | 0.0 | 2 | R | Inches (rainfall) | ||||
| Rain/melt precipitation | 65102 | 014 | Continuous | Heated Tipping Bucket | Instrument | 0.01 | 0.0 | 2 | R | Inches (rainfall) | ||||
| Rain/melt precipitation | 65102 | 015 | Intermittent | Tipping Bucket | METONE 8 Non HEATD RAIN GAUGE 375ss | 0.01 | 2 | R | Inches (rainfall) | |||||
| Rain/melt precipitation | 65102 | 060 | Continuous | Instrumental | Vaisala 444A Tipping Bucket | 0.01 | 0.0 | 2 | R | Inches (rainfall) | ||||
| Reactive oxides of nitrogen (NOy) | 42600 | 074 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | FRM | RFNA-1289-074 | THERMO ENVIRON. INST. MODEL 42 | 0.5 | -5.0 | 500.0 | 1 | T | Parts per billion |
| Reactive oxides of nitrogen (NOy) | 42600 | 075 | Continuous | LOW LEVEL NOX INSTRUMENTAL | TECO 42S CHEMILUMINESCENCE | 0.05 | -5.0 | 500.0 | 1 | T | Parts per billion | |||
| Reactive oxides of nitrogen (NOy) | 42600 | 082 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | 0.5 | -5.0 | 500.0 | 1 | T | Parts per billion | |||
| Reactive oxides of nitrogen (NOy) | 42600 | 090 | Continuous | INSTRUMENTAL | GAS-PHASE CHEMILUMINESCENCE | 5.0 | -5.0 | 500.0 | 1 | T | Parts per billion | |||
| Reactive oxides of nitrogen (NOy) | 42600 | 099 | Continuous | INSTRUMENTAL | GAS PHASE CHEMILUMINESCENCE | FRM | RFNA-1104-099 | API MODEL 200A NO ANALYZER | 0.5 | -5.0 | 500.0 | 1 | T | Parts per billion |
| Reactive oxides of nitrogen (NOy) | 42600 | 674 | Continuous | Instrumental | Chemiluminescence Thermo Electron 42C-Y, 42i-Y | 0.05 | -5.0 | 1000.0 | 1 | T | Parts per billion | |||
| Reactive oxides of nitrogen (NOy) | 42600 | 690 | Continuous | Instrumental | Chemiluminescence Ecotech EC9841T | 0.05 | -5.0 | 500.0 | 1 | T | Parts per billion | |||
| Reactive oxides of nitrogen (NOy) | 42600 | 691 | Continuous | Instrumental | Chemiluminescence Ecotech EC9843 | 0.05 | -5.0 | 500.0 | 1 | T | Parts per billion | |||
| Reactive oxides of nitrogen (NOy) | 42600 | 699 | Continuous | Instrumental | Chemiluminescence Teledyne API 200 EU/501 | 0.05 | -5.0 | 520.0 | 1 | T | Parts per billion | |||
| Reconstructed Mass PM2.5 LC | 88401 | 819 | Intermittent | Calculated from Met One SASS/SuperSASS (Teflon and Nylon) and URG 3000N (Quartz) | RCFM = 4.125*[88169]+1.29*[88306]+[88348]+1.8*[88203]+[88321]+1.4*[88320] | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Reconstructed Mass PM2.5 LC | 88401 | 899 | Intermittent | Unknown-Unknown | # | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Relative Humidity | 68110 | 118 | Intermittent | R & P Model 2025 PM2.5 Sequential | Relative Humidity sensor | 1.0 | 0.0 | 100.0 | 0 | R | Percent relative humidity | |||
| Relative Humidity | 62201 | 011 | Continuous | INSTRUMENTAL | HYGROTHERMOGRAPH ELEC OR MACH AVG | 1.0 | 0.0 | 100.0 | 0 | R | Percent relative humidity | |||
| Relative Humidity | 62201 | 012 | Continuous | INSTRUMENTAL | HYGROSCOPIC PLASTIC FILM | 1.0 | 0.0 | 100.0 | 0 | R | Percent relative humidity | |||
| Relative Humidity | 62201 | 013 | Continuous | INSTRUMENTAL | HYGROTHERMOGRAPH | 1.0 | 0.0 | 100.0 | 0 | R | Percent relative humidity | |||
| Relative Humidity | 62201 | 014 | Continuous | Instrumental | Hygromer C94 Probe | 1.0 | 0.0 | 100.0 | 0 | R | Percent relative humidity | |||
| Relative Humidity | 62201 | 015 | Continuous | Instrumental | Thin film capacitive sensor | 1.0 | 0.0 | 100.0 | 1 | R | Percent relative humidity | |||
| Relative Humidity | 62201 | 020 | Continuous | INSTRUMENTAL | COMPUTED(INDIRECT) | 1.0 | 0.0 | 100.0 | 0 | R | Percent relative humidity | |||
| Relative Humidity | 62201 | 021 | Continuous | INSTRUMENTAL | COMPUTED(INDIRECT) LEVEL 1 | 1.0 | 0.0 | 100.0 | 0 | R | Percent relative humidity | |||
| Relative Humidity | 62201 | 022 | Continuous | INSTRUMENTAL | COMPUTED(INDIRECT) LEVEL 2 | 1.0 | 0.0 | 100.0 | 0 | R | Percent relative humidity | |||
| Relative Humidity | 62201 | 023 | Continuous | INSTRUMENTAL | COMPUTED(INDIRECT) LEVEL 3 | 1.0 | 0.0 | 100.0 | 0 | R | Percent relative humidity | |||
| Relative Humidity | 62201 | 059 | Continuous | Instrumental | Vaisala HMP 155 | 0.1 | 1 | R | Percent relative humidity | |||||
| Relative Humidity | 62201 | 060 | Continuous | Instrumental | Vaisala 435C RH/AT Sensor | 0.1 | 0.0 | 100.0 | 1 | R | Percent relative humidity | |||
| Relative Humidity | 62201 | 061 | Continuous | Instrumental | Met One 083D | 1.0 | 0.0 | 100.0 | 0 | R | Percent relative humidity | |||
| Relative Humidity | 62201 | 063 | Continuous | Instrumental | Rotronic HC2-S3 | 1.0 | 0.0 | 100.0 | 0 | R | Percent relative humidity | |||
| Relative Humidity | 62201 | 069 | Continuous | Instrumental | Met One AIO2 Sonic Weather Sensor | 1.0 | 0 | R | Percent relative humidity | |||||
| Relative Humidity | 62201 | 130 | Continuous | Intrumental | RM Young | 1.0 | 0.0 | 100.0 | 1 | R | Percent relative humidity | |||
| Relative Humidity | 62201 | 720 | Intermittent | INSTRUMENTAL- | COMPUTED(INDIRECT) | 0.002 | 3 | R | Percent relative humidity | |||||
| Relative Humidity | 62201 | 899 | Intermittent | Unknown-Unknown | # | 0.002 | 3 | R | Percent relative humidity | |||||
| Relative Humidity Factor | 62202 | 720 | Intermittent | INSTRUMENTAL- | COMPUTED(INDIRECT) | 0.002 | 3 | Percent relative humidity | ||||||
| Respirable part | 31101 | 091 | Intermittent | CYCLONE | GRAVIMETRIC | 20.0 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Retene (TSP) STP | 17158 | 106 | Intermittent | HI-Vol/PUF & XAD-2 | TO-13- EPA610- EPA625 | 0.3 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Retene (TSP) STP | 17158 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.0502 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| Retene (TSP) STP | 17158 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.0593 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| Retene (TSP) STP | 17158 | 119 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS-SIM Modified TO-13A | 0.05 | 4 | R | Nanograms/cubic meter (25 C) | |||||
| Rubber cracking | 72401 | 091 | Intermittent | RUBBER STRIP | OPTICAL EVALUATION | 1.0 | 0.0 | 0 | R | Microns/week | ||||
| Rubidium (TSP) LC | 14176 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.344 | 3 | Micrograms/cubic meter (LC) | ||||||
| Rubidium (TSP) STP | 12176 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.03 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Rubidium (TSP) STP | 12176 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Rubidium (TSP) STP | 12176 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Rubidium (TSP) STP | 12176 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Rubidium PM10 LC | 85176 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Rubidium PM10 LC | 85176 | 820 | Continuous | Cooper Environmental Services (CES) XACT 625 | X-ray fluorescence (XRF) | 0.344 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Rubidium PM10 LC | 85176 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 0.87 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Rubidium PM10 LC | 85176 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.01 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Rubidium PM10 STP | 82176 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Rubidium PM10 STP | 82176 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Rubidium PM10 STP | 82176 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Rubidium PM10 STP | 82176 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Rubidium PM10-2.5 LC | 86176 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00087 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Rubidium PM10-2.5 STP | 83176 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Rubidium PM2.5 LC | 88176 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Rubidium PM2.5 LC | 88176 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Rubidium PM2.5 LC | 88176 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Rubidium PM2.5 LC | 88176 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.00217 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Rubidium PM2.5 LC | 88176 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 0.344 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Rubidium PM2.5 LC | 88176 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00087 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Rubidium PM2.5 LC | 88176 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00087 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Rubidium PM2.5 LC | 88176 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00087 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Rubidium PM2.5 LC | 88176 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00087 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Rubidium PM2.5 LC | 88176 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00087 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Rubidium PM2.5 LC | 88176 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00087 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Rubidium PM2.5 LC | 88176 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00087 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Rubidium PM2.5 LC | 88176 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Rubidium PM2.5 STP | 84176 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| SANDWICH - Adjusted Aluminum | 91119 | 102 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | Modified SANDWICH Model | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SANDWICH - Adjusted Ammonium | 91110 | 102 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | Modified SANDWICH Model | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SANDWICH - Adjusted Calcium | 91118 | 102 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | Modified SANDWICH Model | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SANDWICH - Adjusted Elemental Carbon (EC) | 91113 | 102 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | Modified SANDWICH Model | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SANDWICH - Adjusted Iron | 91116 | 102 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | Modified SANDWICH Model | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SANDWICH - Adjusted Nitrate | 91109 | 102 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | Modified SANDWICH Model | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SANDWICH - Adjusted Organic Carbon Mass | 91112 | 102 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | Modified SANDWICH Model | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SANDWICH - Adjusted Salt | 91114 | 102 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | Modified SANDWICH Model | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SANDWICH - Adjusted Silicon | 91115 | 102 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | Modified SANDWICH Model | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SANDWICH - Adjusted Sulfate | 91108 | 102 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | Modified SANDWICH Model | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SANDWICH - Adjusted Titanium | 91117 | 102 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | Modified SANDWICH Model | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SANDWICH - Adjusted Water | 91111 | 102 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | Modified SANDWICH Model | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SANDWICH - Ammonium for mass balance | 91102 | 101 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | SANDWICH Model | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SANDWICH - Crustal Mass | 91123 | 103 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | SANDWICH Major Components | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SANDWICH - Filter Contamination Mass | 91124 | 103 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | SANDWICH Major Components | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SANDWICH - Nitrate Mass | 91121 | 103 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | SANDWICH Major Components | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SANDWICH - Raw Crustal Component Mass | 91106 | 101 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | SANDWICH Model | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SANDWICH - Raw Nitrate | 91101 | 101 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | SANDWICH Model | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SANDWICH - Raw Organic Carbon Mass | 91104 | 101 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | SANDWICH Model | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SANDWICH - Raw Salt | 91107 | 101 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | SANDWICH Model | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SANDWICH - Raw Total Carbonaceous Mass | 91105 | 101 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | SANDWICH Model | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SANDWICH - Raw Water | 91103 | 101 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | SANDWICH Model | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SANDWICH - Sulfate Mass | 91120 | 103 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | SANDWICH Major Components | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SANDWICH - Total Carbonaceous Mass - material balance | 91122 | 103 | Intermittent | PM2.5 Chemical Speciation Network (CSN) | SANDWICH Major Components | 0.0001 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| SO2 max 5-min avg | 42406 | 005 | Continuous | INSTRUMENTAL | SEC DERIV SPECTROSCOPY | FEM | EQSA-1275-005 | LEAR SIEGLER SM1000 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 006 | Continuous | INSTRUMENTAL | FLAME PHOTOMETRIC | FEM | EQSA-1275-006 | MELOY SA185-2A | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 009 | Continuous | INSTRUMENTAL | PULSED FLUORESCENT | FEM | EQSA-0276-009 | Thermo Electron 43 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 010 | Continuous | INSTRUMENTAL | COULOMETRIC | FEM | EQSA 0676-010 | PHILIPS PW9755 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 020 | Continuous | INSTRUMENTAL | PULSED FLUORESCENT | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| SO2 max 5-min avg | 42406 | 024 | Continuous | INSTRUMENTAL | CONDUCTANCE | FEM | EQSA-0877-024 | ASARCO 500 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 029 | Continuous | INSTRUMENTAL | ULTRA VIOLET STIMULATED FLUORESCNC | FEM | EQSA-0678-029 | BECKMAN 953 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 030 | Continuous | INSTRUMENTAL | FLAME PHOTOMETRIC | FEM | EQSA-1078-030 | BENDIX 8303 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 032 | Continuous | INSTRUMENTAL | FLAME PHOTOMETRIC | FEM | EQSA-1078-032 | MELOY SA285E | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 039 | Continuous | INSTRUMENTAL | ULTRA VIOLET STIMULATED FLUORESCNC | FEM | EQSA-0779-039 | MONITOR LABS 8850 | 2.0 | -4.0 | 10000.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 046 | Continuous | INSTRUMENTAL | ULTRA VIOLET STIMULATED FLUORESCNC | FEM | EQSA-0580-046 | MELOY SA700 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 049 | Continuous | INSTRUMENTAL | SEC DERIV SPECTROSCOPY | FEM | EQSA-1280-049 | LEAR SIEGLER AM2020 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 060 | Continuous | INSTRUMENTAL | PULSED FLUORESCENT | FEM | EQSA-0486-060 | THERMO ELECTRON 43A, 43B,43C | 2.0 | -4.0 | 10000.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 061 | Continuous | INSTRUMENTAL | ULTRA VIOLET FLUORESCENCE | FEM | EQSA-1086-061 | DASIBI 4108 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 075 | Continuous | INSTRUMENTAL | ULTRA VIOLET STIMULATED FLUORESCNC | FEM | EQSA-0390-075 | MONITOR LABS 8850S | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 077 | Continuous | INSTRUMENTAL | FLUORESCENCE DETECTION | FEM | EQSA-0990-007 | ADV POLL INST INC MODEL 100 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 084 | Continuous | INSTRUMENTAL | UV FLUORESCENCE | FEM | EQSA-0292-084 | ENVIRON. SA MDL AF21M | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 092 | Continuous | AUTOMATED ANALYZER | ULTRAVIOLET FLUORESCENCE | FEM | EQAS-0193-092 | MONITOR LABS 9850 & 9850B | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 100 | Continuous | INSTRUMENTAL | ULTRAVIOLET FLUORESCENCE | FEM | EQSA-0495-100 | API Model 100A SO2 Analyzer | 0.4 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 101 | Continuous | INSTRUMENTAL | OPEN PATH SO2 ANALYZER | FEM | EQSA-0495-101 | OPSIS MODEL AR 500 SYSTEM | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 114 | Continuous | Instrumental | Pulsed UV Fluorescence | FEM | EQSA-0197-114 | HORIBA APSA-360 OR APSA-360ACE | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 115 | Continuous | Instrumental | Ultraviolet Fluorescent Analyzer | FEM | EQSA-0701-115 | DKK CORP MODEL GFS-32 AMB SO2 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 133 | Continuous | Instrumental | Ultra Violet Fluorescence | FEM | EQSA-0100-133 | DKK MDl GFS-112E | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 138 | Continuous | Instrumental | Open Path SO2 Analyzer | FEM | EQOA-0400-138 | SANOA Longpath | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 149 | Continuous | Instrumental | UV Fluorescence | FEM | EQOA-0802-149 | Environnement S.A. AF22M SO2 Analyzer | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 159 | Continuous | Instrumental | Pulsed UV Fluorescence | FEM | EQSA-0506-159 | HORIBA APSA-370 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 166 | Continuous | Instrumental | U V Fluorescence | FEM | EQSA-0507-166 | SIR S A Model S-5001 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 168 | Continuous | Instrumental | DKK-TOA Corp ModelGFS-312E | FEM | EQSA-1107-168 | DKK-TOA Model GFS-312E | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 188 | Continuous | Instrumental | Ecotech Serinus 50 | FEM | EQSA-0809-188 | Ecotech Serinus 50 SO2 Analyzer | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 237 | Continuous | Instrumental | Sutron or Sabio Model 6020 UV Fluorescence | FRM | RFSA-0616-237 | Sutron or Sabio Model 6020 UV Fluorescence | 0.3 | -4.0 | 500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 511 | Continuous | INSTRUMENTAL | COULOMETRIC | FEM | EQSA-0876-011 | PHILIPS PW9700 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 513 | Continuous | INSTRUMENTAL | FLAME PHOTOMETRIC | FEM | EQSA-0876-013 | MONITOR LABS 8450 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 560 | Continuous | INSTRUMENTAL | PULSED FLUORESCENT | FEM | EQSA-0486-060 | THERMO ELECTRON 43C-TLE | 0.2 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 592 | Continuous | Instrumental | Ultraviolet Fluorescence EC9850T | FEM | EQSA-0193-092 | Ecotech EC9850T | 0.2 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| SO2 max 5-min avg | 42406 | 600 | Continuous | Instrumental | Ultraviolet Fluorescence API 100 EU | FEM | EQSA-0495-100 | Teledyne API 100 EU | 0.2 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Safrole (TSP) STP | 16801 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 29.5 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Samarium (TSP) STP | 12162 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.04 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Samarium (TSP) STP | 12162 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Samarium (TSP) STP | 12162 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Samarium PM2.5 LC | 88162 | 811 | Intermittent | Met One SASS Teflon | Energy Dispersive XRF | 0.00617 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Samarium PM2.5 LC | 88162 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00247 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Samarium PM2.5 LC | 88162 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00247 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Samarium PM2.5 LC | 88162 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00247 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Samarium PM2.5 LC | 88162 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00247 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Samarium PM2.5 LC | 88162 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00247 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Samarium PM2.5 LC | 88162 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00247 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sample Flow Rate CV - Nylon Filter | 68112 | 812 | Intermittent | MetOne SASS/SuperSASS Nylon | Sample Flow Rate CV | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate CV - Quartz Filter | 68113 | 810 | Intermittent | Met One SASS/SuperSASS Teflon | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate CV - Quartz Filter | 68113 | 816 | Intermittent | Met One SASS/SuperSASS Quartz | Sample Flow Rate CV | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate CV - Quartz Filter | 68113 | 838 | Intermittent | URG3000N | Sample Flow Rate CV | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate CV - Teflon Filter | 68111 | 810 | Intermittent | Met One SASS/SuperSASS Teflon | Sample Flow Rate CV | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 116 | Intermittent | BGI Model PQ200 PM2.5 Sampler | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 117 | Intermittent | R & P Model 2000 PM2.5 Sampler | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 118 | Intermittent | R & P Model 2025 PM2.5 Sequent | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 119 | Intermittent | Anderson RAAS2.5-100 Sampler | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 120 | Intermittent | Anderson RAAS2.5-300 PM2.5 Seq | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 123 | Intermittent | Thermo Env Model 605 CAPS | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 126 | Intermittent | R - P Co Partisol Model 2000 | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 127 | Intermittent | R - P Co Partisol Model 2025 | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 128 | Intermittent | Andersen RAAS2.5-200 PM2.5 Aud | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 129 | Intermittent | R & P Co Model 2000 PM-2.5 Audit | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 135 | Intermittent | URG-MASS100 Single PM2.5 Sampler | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 136 | Intermittent | URG-MASS300 Sequential PM2.5 Sampler | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 142 | Intermittent | BGI Models PQ200-VSCC or PQ200A-VSCC | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 143 | Intermittent | R & P Model 2000 PM-2.5 FEM Air Sampler | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 144 | Intermittent | R & P Model 2000 PM-2.5 FEM Audit Sampler | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 145 | Intermittent | R & P Model 2025 PM-2.5 FEM Sequential Air Sampler | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 153 | Intermittent | Thermo Electron Model RAAS2.5-100 w/VSCC | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 154 | Intermittent | Thermo Electron Model RAAS2.5-200 Audit w/VSCC | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 155 | Intermittent | Thermo Electron Model RAAS2.5-300 Sequential w/VSCC | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 545 | Intermittent | Met One E-SEQ-FRM with VSCC | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 780 | Continuous | INSTRUMENTAL | CALCULATION | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 810 | Intermittent | Met One SASS/SuperSASS Teflon | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 812 | Intermittent | Met One SASS/SuperSASS Nylon | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 838 | Intermittent | URG 3000N | Calculation | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 850 | Intermittent | R&P MDL2300 PM2.5 SEQ SPEC | CALCULATION | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Flow Rate- CV | 68101 | 901 | Intermittent | BGI Inc. frmOMNI | CALCULATION | 0.1 | 0.0 | 20.0 | 1 | R | Percent | |||
| Sample Max Baro Pressure | 68107 | 116 | Intermittent | BGI Model PQ200 PM2.5 Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 117 | Intermittent | R & P Model 2000 PM2.5 Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 118 | Intermittent | R & P Model 2025 PM2.5 Sequent | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 119 | Intermittent | Anderson RAAS2.5-100 Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 120 | Intermittent | Anderson RAAS2.5-300 PM2.5 Seq | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 123 | Intermittent | Thermo Env Model 605 CAPS | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 126 | Intermittent | R - P Co Partisol Model 2000 | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 127 | Intermittent | R - P Co Partisol Model 2025 | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 128 | Intermittent | Andersen RAAS2.5-200 PM2.5 Aud | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 129 | Intermittent | R&P CO Model 2000 PM-2.5 Audit | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 135 | Intermittent | URG-MASS100 Single PM2.5 Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 136 | Intermittent | URG-MASS300 Sequential PM2.5 Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 142 | Intermittent | BGI Models PQ200-VSCC or PQ200A-VSCC | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 143 | Intermittent | R & P Model 2000 PM-2.5 FEM Air Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 144 | Intermittent | R & P Model 2000 PM-2.5 FEM Audit Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 145 | Intermittent | R & P Model 2025 PM-2.5 FEM Sequential Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 153 | Intermittent | Thermo Electron Model RAAS2.5-100 w/VSCC | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 154 | Intermittent | Thermo Electron Model RAAS2.5-200 Audit w/VSCC | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 155 | Intermittent | Thermo Electron Model RAAS2.5-300 Sequential w/VSCC | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 545 | Intermittent | Met One E-SEQ-FRM with VSCC | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 780 | Continuous | INSTRUMENTAL | BAROMETRIC SENSOR | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 810 | Intermittent | Met One SASS/SuperSASS | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 820 | Intermittent | Andersen RAAS | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 830 | Intermittent | URG MASS400 WINS | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 850 | Intermittent | R&P MDL2300 PM2.5 SEQ SPEC | BAROMETRIC SENSOR | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 870 | Intermittent | URG MASS400 VSCC | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Max Baro Pressure | 68107 | 901 | Intermittent | BGI Inc. frmOMNI | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 116 | Intermittent | BGI Model PQ200 PM2.5 Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 117 | Intermittent | R & P Model 2000 PM2.5 Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 118 | Intermittent | R & P Model 2025 PM2.5 Sequent | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 119 | Intermittent | Anderson RAAS2.5-100 Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 120 | Intermittent | Anderson RAAS2.5-300 PM2.5 Seq | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 123 | Intermittent | Thermo Env Model 605 CAPS | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 126 | Intermittent | R - P Co Partisol Model 2000 | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 127 | Intermittent | R - P Co Partisol Model 2025 | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 128 | Intermittent | Andersen RAAS2.5-200 PM2.5 Aud | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 129 | Intermittent | R&P CO Model 2000 PM-2.5 Audit | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 135 | Intermittent | URG-MASS100 Single PM2.5 Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 136 | Intermittent | URG-MASS300 Sequential PM2.5 Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 142 | Intermittent | BGI Models PQ200-VSCC or PQ200A-VSCC | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 143 | Intermittent | R & P Model 2000 PM-2.5 FEM Air Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 144 | Intermittent | R & P Model 2000 PM-2.5 FEM Audit Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 145 | Intermittent | R & P Model 2025 PM-2.5 FEM Sequential AIr Sampler | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 153 | Intermittent | Thermo Electron Model RAAS2.5-100 w/VSCC | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 154 | Intermittent | Thermo Electron Model RAAS2.5-200 Audit w/VSCC | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 155 | Intermittent | Thermo Electron Model RAAS2.5-300 Sequential w/VSCC | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 545 | Intermittent | Met One E-SEQ-FRM with VSCC | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 780 | Continuous | INSTRUMENTAL | BAROMETRIC SENSOR | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 810 | Intermittent | Met One SASS/SuperSASS | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 820 | Intermittent | Andersen RAAS | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 830 | Intermittent | URG MASS400 WINS | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 850 | Intermittent | R&P MDL2300 PM2.5 SEQ SPEC | BAROMETRIC SENSOR | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 870 | Intermittent | URG MASS400 VSCC | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Min Baro Pressure | 68106 | 901 | Intermittent | BGI Inc. frmOMNI | Barometric Sensor | 450.0 | 450.0 | 850.0 | 0 | R | Millimeters (mercury) | |||
| Sample Volume | 68102 | 116 | Intermittent | BGI Model PQ200 PM2.5 Sampler | Calculation | 8.0 | 0.0 | 25.2 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 117 | Intermittent | R & P Model 2000 PM2.5 Sampler | Calculation | 8.0 | 0.0 | 25.2 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 118 | Intermittent | R & P Model 2025 PM2.5 Sequent | Calculation | 8.0 | 0.0 | 25.2 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 119 | Intermittent | Anderson RAAS2.5-100 Sampler | Calculation | 8.0 | 0.0 | 25.2 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 120 | Intermittent | Anderson RAAS2.5-300 PM2.5 Seq | Calculation | 8.0 | 0.0 | 25.2 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 123 | Intermittent | Thermo Env Model 605 CAPS | Calculation | 8.0 | 0.0 | 25.2 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 126 | Intermittent | R - P Co Partisol Model 2000 | Calculation | 8.0 | 0.0 | 25.2 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 127 | Intermittent | R - P Co Partisol Model 2025 | Calculation | 8.0 | 0.0 | 25.2 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 128 | Intermittent | Andersen RAAS2.5-200 PM2.5 Aud | Calculation | 8.0 | 0.0 | 25.2 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 129 | Intermittent | R & P Co Model 2000 PM-2.5 Audit | Calculation | 8.0 | 0.0 | 25.2 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 135 | Intermittent | URG-MASS100 Single PM2.5 Sampler | Calculation | 8.0 | 0.0 | 25.2 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 136 | Intermittent | URG-MASS300 Sequential PM2.5 Sampler | Calculation | 8.0 | 0.0 | 25.2 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 142 | Intermittent | BGI Models PQ200-VSCC or PQ200A-VSCC | Calculation | 8.0 | 0.0 | 25.2 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 143 | Intermittent | R & P Model 2000 PM-2.5 FEM Air Sampler | Calculation | 8.0 | 0.0 | 25.2 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 144 | Intermittent | R & P Model 2000 PM-2.5 FEM Audit Sampler | Calculation | 8.0 | 0.0 | 25.2 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 145 | Intermittent | R & P Model 2025 PM-2.5 FEM Sequential Air Sampler | Calculation | 8.0 | 0.0 | 25.2 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 153 | Intermittent | Thermo Electron Model RAAS2.5-100 w/VSCC | Calculation | 8.0 | 0.0 | 25.2 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 154 | Intermittent | Thermo Electron Model RAAS2.5-200 Audit w/VSCC | Calculation | 8.0 | 0.0 | 25.2 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 155 | Intermittent | Thermo Electron Model RAAS2.5-300 Sequential w/VSCC | Calculation | 8.0 | 0.0 | 25.2 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 545 | Intermittent | Met One E-SEQ-FRM with VSCC | Calculation | 8.0 | 0.0 | 25.2 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 780 | Continuous | INSTRUMENTAL | CALCULATION | 8.0 | 0.0 | 25.2 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 810 | Intermittent | Met One SASS/SuperSASS Teflon | Calculation | 1.0 | 0.0 | 25.0 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 812 | Intermittent | Met One SASS/SuperSASS Nylon | Calculation | 1.0 | 0.0 | 25.0 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 838 | Intermittent | URG 3000N | Calculation | 1.0 | 0.0 | 50.0 | 1 | R | Cubic meter | |||
| Sample Volume | 68102 | 850 | Intermittent | R&P MDL2300 PM2.5 SEQ SPEC | CALCULATION | 8.0 | 0.0 | 25.2 | 1 | R | Cubic meter | |||
| Sample Volume - Nylon Filter | 68115 | 812 | Intermittent | MetOne SASS/SuperSASS Nylon | Sample Volume | 1.0 | 0.0 | 25.0 | 1 | R | Cubic meter | |||
| Sample Volume - Quartz Filter | 68116 | 810 | Intermittent | Met One SASS/SuperSASS Teflon | Calculation | 1.0 | 0.0 | 35.0 | 1 | R | Cubic meter | |||
| Sample Volume - Quartz Filter | 68116 | 816 | Intermittent | Met One SASS Quartz | Sample Volume | 1.0 | 0.0 | 35.0 | 1 | R | Cubic meter | |||
| Sample Volume - Quartz Filter | 68116 | 838 | Intermittent | URG3000N | Sample Volume | 1.0 | 0.0 | 35.0 | 1 | R | Cubic meter | |||
| Sample Volume - Teflon Filter | 68114 | 810 | Intermittent | MetOne SASS/SuperSASS Teflon | Sample Volume | 1.0 | 0.0 | 25.0 | 1 | R | Cubic meter | |||
| Scandium (TSP) STP | 12163 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Scandium (TSP) STP | 12163 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Scandium PM2.5 LC | 88163 | 811 | Intermittent | Met One SASS Teflon | Energy Dispersive XRF | 0.00243 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Scandium PM2.5 LC | 88163 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00097 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Scandium PM2.5 LC | 88163 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00097 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Scandium PM2.5 LC | 88163 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00097 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Scandium PM2.5 LC | 88163 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00097 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Scandium PM2.5 LC | 88163 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00097 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Scandium PM2.5 LC | 88163 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00097 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sea Salt (PM2.5) | 88395 | 805 | Intermittent | IMPROVE Calculation of Sea Salt (SSf) | Calculation | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Selenium (TSP) LC | 14154 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0109 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Selenium (TSP) LC | 14154 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 3.0e-05 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Selenium (TSP) LC | 14154 | 310 | Intermittent | LO-VOL | ICP-MS | 0.005 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Selenium (TSP) LC | 14154 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.141 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Selenium (TSP) LC | 14154 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0004 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Selenium (TSP) STP | 12154 | 045 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.0128 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Selenium (TSP) STP | 12154 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0109 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Selenium (TSP) STP | 12154 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.0056 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Selenium (TSP) STP | 12154 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.1 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Selenium (TSP) STP | 12154 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.03 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Selenium (TSP) STP | 12154 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 2.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Selenium (TSP) STP | 12154 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Selenium (TSP) STP | 12154 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Selenium (TSP) STP | 12154 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Selenium (TSP) STP | 12154 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.005 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Selenium (TSP) STP | 12154 | 905 | Intermittent | SKC Pump Filter | ICP/AES NIOSH 7300 | 3.47 | 2 | R | Micrograms/cubic meter (25 C) | |||||
| Selenium (TSP) STP | 12154 | 910 | Intermittent | SKC Pump Filter | MOd NISH 7300/6010B SOP 1813 | 0.0309 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Selenium PM10 LC | 85154 | 110 | Intermittent | Hi-Vol SA/GMW1200 | ICP/MS | 37.5 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Selenium PM10 LC | 85154 | 202 | Intermittent | R&P Model 2000 PM10 Teflon | ICP/MS | 0.346 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Selenium PM10 LC | 85154 | 204 | Intermittent | Wedding & Ass. Model 600 PM10 HiVol | ICP-MS | 0.02 | 0.0 | 10000.0 | 2 | R | Nanograms/cubic meter (LC) | |||
| Selenium PM10 LC | 85154 | 216 | Intermittent | Tisch Model TE-Wilbur10 Low-Volume Sampler | ICP-MS | 0.4 | 5 | R | Nanograms/cubic meter (LC) | |||||
| Selenium PM10 LC | 85154 | 501 | Intermittent | Tisch Environmental 6000 Series | ICP-MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (LC) | ||||
| Selenium PM10 LC | 85154 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Selenium PM10 LC | 85154 | 820 | Continuous | Cooper Environmental Services model Xact 620 | X-ray fluorescence (XRF) | 0.032 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Selenium PM10 LC | 85154 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 0.85 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Selenium PM10 LC | 85154 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 1.4 | 0.0 | 99999.99999 | 1 | R | Nanograms/cubic meter (LC) | |||
| Selenium PM10 LC | 85154 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.4 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Selenium PM10 LC | 85154 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.4 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Selenium PM10 LC | 85154 | 907 | Intermittent | R & P Partisol 2025 Teflon | ICPMS | 0.26 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Selenium PM10 LC | 85154 | 908 | Intermittent | MET ONE E-SEQ-FRM | ICP-MS | 0.0386 | 4 | R | Nanograms/cubic meter (LC) | |||||
| Selenium PM10 LC | 85154 | 911 | Intermittent | ARA low-volume sampler | ICP-MS | 0.4 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Selenium PM10 STP | 82154 | 069 | Intermittent | HIVOL-SA/GMW-321-B | EMISSION SPECTRA ICAP | 12.8 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Selenium PM10 STP | 82154 | 085 | Intermittent | HI-VOL-SA-GMW-1200 | EMISSION SPECTRA ICAP | 12.8 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Selenium PM10 STP | 82154 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | |||||
| Selenium PM10 STP | 82154 | 096 | Intermittent | Med-Vol SA254 TFE | X-ray fluorescence | 100.0 | 0.0 | -2 | R | Nanograms/cubic meter (25 C) | ||||
| Selenium PM10 STP | 82154 | 102 | Intermittent | HI-VOL-SA/GMW1200 | ATOMIC ABSORPTION | 10.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Selenium PM10 STP | 82154 | 103 | Intermittent | HI-VOL-WEDDING-INLET | ATOMIC ABSORPTION | 10.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Selenium PM10 STP | 82154 | 105 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 30.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Selenium PM10 STP | 82154 | 106 | Intermittent | HI-VOL-Wedding Inlet | Emission Spectra ICAP | 14.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Selenium PM10 STP | 82154 | 107 | Intermittent | HI-VOL-SA/GMW-321-B | Emission Spectra ICAP | 17.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Selenium PM10 STP | 82154 | 110 | Intermittent | Hi-Vol SA/GMW1200 Quartz | ICP/MS | 0.04 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Selenium PM10 STP | 82154 | 113 | Intermittent | Hi Vol Anderson IP1076 | ICP/MS | 0.03 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Selenium PM10 STP | 82154 | 201 | Intermittent | R&P Model 2000 PM10 Quartz | ICP/MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Selenium PM10 STP | 82154 | 202 | Intermittent | R&P Model 2000 PM10 Teflon | ICP/MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Selenium PM10 STP | 82154 | 203 | Intermittent | R&P Model 2025 PM10 Teflon | ICP/MS | 1.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Selenium PM10 STP | 82154 | 204 | Intermittent | Wedding & Ass. Model 600 PM10 HiVol | ICP-MS | 0.27 | 0.0 | 10000.0 | 2 | R | Nanograms/cubic meter (25 C) | |||
| Selenium PM10 STP | 82154 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Selenium PM10 STP | 82154 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 5.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Selenium PM10 STP | 82154 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 5.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Selenium PM10 STP | 82154 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 5.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Selenium PM10 STP | 82154 | 908 | Intermittent | MET ONE E-SEQ-FRM | ICP-MS | 0.0386 | 4 | R | Nanograms/cubic meter (25 C) | |||||
| Selenium PM10-2.5 LC | 86154 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00085 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Selenium PM10-2.5 STP | 83154 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Selenium PM2.5 LC | 88154 | 118 | Intermittent | R & P Model 2025 PM2.5 Sequential w/WINS | ICP/MS | 0.00042 | 5.0 | 5 | R | Micrograms/cubic meter (LC) | ||||
| Selenium PM2.5 LC | 88154 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Selenium PM2.5 LC | 88154 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Selenium PM2.5 LC | 88154 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Selenium PM2.5 LC | 88154 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.00212 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Selenium PM2.5 LC | 88154 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 0.141 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Selenium PM2.5 LC | 88154 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00085 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Selenium PM2.5 LC | 88154 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00251 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Selenium PM2.5 LC | 88154 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00085 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Selenium PM2.5 LC | 88154 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00085 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Selenium PM2.5 LC | 88154 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00085 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Selenium PM2.5 LC | 88154 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00251 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Selenium PM2.5 LC | 88154 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00085 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Selenium PM2.5 LC | 88154 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Selenium PM2.5 LC | 88154 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 0.0014 | 5000.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Selenium PM2.5 LC | 88154 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0004 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Selenium PM2.5 LC | 88154 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.0004 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Selenium PM2.5 LC | 88154 | 908 | Intermittent | R & P Partisol 2000 | X-Ray Fluorescence | 0.0006 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Selenium PM2.5 STP | 84154 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Silica (precip) | 65551 | 085 | Intermittent | ANDERSON RAINFALL BUCKET | EMISSION SPECTRA ICAP | 0.05 | 0.0 | 2 | R | Milligrams/liter | ||||
| Silica PM10 STP | 82551 | 002 | Intermittent | HI-VOL-SA/GMW-1200 | X-RAY DIFFRACTION | 0.012 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Silicon (TSP) STP | 12165 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Silicon (TSP) STP | 12165 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.1 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Silicon (TSP) STP | 12165 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Silicon (TSP) STP | 12165 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Silicon (TSP) STP | 12165 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Silicon PM10 LC | 85165 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Silicon PM10 LC | 85165 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 0.00302 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Silicon PM10 STP | 82165 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Silicon PM10-2.5 LC | 86165 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00302 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Silicon PM10-2.5 STP | 83165 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Silicon PM2.5 LC | 88165 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Silicon PM2.5 LC | 88165 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Silicon PM2.5 LC | 88165 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Silicon PM2.5 LC | 88165 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.00753 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Silicon PM2.5 LC | 88165 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00302 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Silicon PM2.5 LC | 88165 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00302 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Silicon PM2.5 LC | 88165 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00302 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Silicon PM2.5 LC | 88165 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00302 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Silicon PM2.5 LC | 88165 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00302 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Silicon PM2.5 LC | 88165 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00302 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Silicon PM2.5 LC | 88165 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00302 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Silicon PM2.5 LC | 88165 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Silicon PM2.5 STP | 84165 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Silver (SP) | 22166 | 101 | Intermittent | NADP BUCKET: DRY SIDE | ATOMIC ABSORPTION | 1.0e-05 | 0.0 | 5 | R | Grams/sq meter/month | ||||
| Silver (TSP) LC | 14166 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0022 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Silver (TSP) LC | 14166 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 4.327 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Silver (TSP) STP | 12166 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0022 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Silver (TSP) STP | 12166 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.0003 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Silver (TSP) STP | 12166 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.0003 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Silver (TSP) STP | 12166 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Silver (TSP) STP | 12166 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Silver (TSP) STP | 12166 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.173 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Silver (TSP) STP | 12166 | 905 | Intermittent | SKC Pump Filter | ICP/AES NIOSH 7300 | 0.35 | 2 | R | Micrograms/cubic meter (25 C) | |||||
| Silver (TSP) STP | 12166 | 910 | Intermittent | SKC Pump Filter | MOd NISH 7300/6010B SOP 1813 | 0.0141 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Silver (precip) | 65166 | 085 | Intermittent | ANDERSON RAINFALL BUCKET | EMISSION SPECTRA ICAP | 0.01 | 0.0 | 3 | R | Milligrams/liter | ||||
| Silver PM10 LC | 85166 | 820 | Continuous | Cooper Environmental Services model Xact 620 | X-ray fluorescence (XRF) | 0.821 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Silver PM10 LC | 85166 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 4.2 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Silver PM10 LC | 85166 | 907 | Intermittent | R & P Partisol 2025 Teflon | ICPMS | 0.26 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Silver PM10 STP | 82166 | 092 | Intermittent | HI-VOL-SA/GMW-321-B | ATOMIC ABSORPTION | 10.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Silver PM10 STP | 82166 | 102 | Intermittent | HI-VOL-SA/GMW1200 | ATOMIC ABSORPTION | 10.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Silver PM10 STP | 82166 | 105 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 10.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Silver PM10 STP | 82166 | 106 | Intermittent | HI-VOL-Wedding Inlet | Emission Spectra ICAP | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Silver PM10 STP | 82166 | 107 | Intermittent | HI-VOL-SA/GMW-321B | EMISSION SPECTRA ICAP | 10.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Silver PM10 STP | 82166 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 15.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Silver PM10 STP | 82166 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 15.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Silver PM10 STP | 82166 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 15.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Silver PM10-2.5 LC | 86166 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.0042 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Silver PM2.5 LC | 88166 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.01048 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Silver PM2.5 LC | 88166 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 4.327 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Silver PM2.5 LC | 88166 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.0042 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Silver PM2.5 LC | 88166 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.0042 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Silver PM2.5 LC | 88166 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.0042 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Silver PM2.5 LC | 88166 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.0042 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Silver PM2.5 LC | 88166 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.0042 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Silver PM2.5 LC | 88166 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.0042 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Silver PM2.5 LC | 88166 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.0042 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Silver tarnishing | 72101 | 091 | Intermittent | SILVER PLATE | REFLECTANCE | 1.0 | 0.0 | 0 | R | % Loss in reflectance/ month | ||||
| Size fractionated particulate | 81101 | 011 | Continuous | GCA BETA TAPE | RESPIRABLE BETA RADIATION ATTENUA | 10.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Size fractionated particulate | 81101 | 012 | Continuous | GCA BETA TAPE | TOTAL BETA RADIATION ATTENUATION | 10.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Size fractionated particulate | 81101 | 051 | Intermittent | DICHOTOMOUS | 15-2.5 GRAVIMETRIC | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Size fractionated particulate | 81101 | 052 | Intermittent | DICHOTOMOUS | 2.5-0 GRAVIMETRIC | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Size fractionated particulate | 81101 | 053 | Intermittent | DICHOTOMOUS | TOTAL GRAVIMETRIC | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Size fractionated particulate | 81101 | 054 | Intermittent | DICHOTOMOUS | 15-3.5 GRAVIMETRIC | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Size fractionated particulate | 81101 | 055 | Intermittent | DICHOTOMOUS | 3.5-0 GRAVIMETRIC | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Size fractionated particulate | 81101 | 056 | Intermittent | DICHOTOMOUS | TOTAL GRAVIMETRIC | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Size fractionated particulate | 81101 | 057 | Intermittent | ANDERSON SSI | GRAVIMETRIC TOTAL < 15 | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Size fractionated particulate | 81101 | 060 | Intermittent | ANDERSON SSI | GRAVIMETRIC TOTAL < 10 | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Size fractionated particulate | 81101 | 061 | Intermittent | DICHOTOMOUS | GRAVIMETRIC TOTAL < 10 | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Size fractionated particulate | 81101 | 062 | Intermittent | DICHOTOMOUS | 10-2.5 GRAVIMETRIC | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Size fractionated particulate | 81101 | 063 | Intermittent | DICHOTOMOUS | 2.5-0 GRAVIMETRIC | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Size fractionated particulate | 81101 | 064 | Intermittent | DICHOT EMSL-MOD-GMW | GRAVIMETRIC TOTAL < 10 | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Size fractionated particulate | 81101 | 065 | Intermittent | DICHOT EMSL-MOD-GMW | 10-2.5 GRAVIMETRIC | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Size fractionated particulate | 81101 | 066 | Intermittent | DICHOT EMSL-MOD-GMW | 2.5-0 GRAVIMETRIC | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Size fractionated particulate | 81101 | 783 | Intermittent | SEQUENT SAMPLR WINS 2.5UM IMP | GRAVIMETRIC | 2.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Smoke | 11204 | 001 | Intermittent | MANUAL | GEMS SMOKE GENERIC METHOD | 1.0 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Smoke | 11204 | 091 | Continuous | SMOKE-SHADE | REFLECTANCE | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Sodium (TSP) STP | 12184 | 045 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.0213 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Sodium (TSP) STP | 12184 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.0002 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Sodium (TSP) STP | 12184 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Sodium (TSP) STP | 12184 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Sodium (TSP) STP | 12184 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 1.695 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Sodium (TSP) STP | 12184 | 905 | Intermittent | SKC Pump Filter | ICP/AES NIOSH 7300 | 34.72 | 2 | R | Micrograms/cubic meter (25 C) | |||||
| Sodium (TSP) STP | 12184 | 910 | Intermittent | SKC Pump Filter | MOd NISH 7300/6010B SOP 1813 | 4.7569 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Sodium (precip) | 65311 | 082 | Intermittent | PRECIP | ATOMIC ABSORPTION | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Sodium (precip) | 65311 | 083 | Intermittent | PRECIP | FLAME EMISSION | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Sodium (precip) | 65311 | 085 | Intermittent | ANDERSON RAINFALL BUCKET | EMISSION SPECTRA ICAP | 0.05 | 0.0 | 3 | R | Milligrams/liter | ||||
| Sodium (precip) | 65311 | 086 | Intermittent | ANDERSON RAINFALL BUCKET | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.04 | 0.0 | 2 | R | Milligrams/liter | ||||
| Sodium Ion (TSP) LC | 12302 | 900 | Intermittent | Teflon CASTNET-style 3-stage filter pack | Inductively Coupled Plasma - Optical Emission Spectrometry (ICP-OES) EPA Modified Method 6010B | 0.001 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sodium Ion PM10 LC | 85302 | 890 | Intermittent | Model 2025 PM10 Sequential Teflon | Ion Chromatography | 24.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Sodium Ion PM10-2.5 LC | 86302 | 885 | Intermittent | Model 2025 Dichot Sequential Teflon | Ion Chromatography | 0.024 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Sodium Ion Pm2.5 LC | 88302 | 812 | Intermittent | Met One SASS/SuperSASS Nylon | Ion Chromatography | 0.03 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Sodium Ion Pm2.5 LC | 88302 | 813 | Intermittent | Met One SASS Quartz | Ion Chromatography | 0.03 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Sodium Ion Pm2.5 LC | 88302 | 822 | Intermittent | Andersen RAAS Nylon | Ion Chromatography | 0.028 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Sodium Ion Pm2.5 LC | 88302 | 834 | Intermittent | URG MASS400 Teflon WINS | Ion Chromatography | 0.012 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Sodium Ion Pm2.5 LC | 88302 | 844 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | Ion Chromatography | 0.024 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Sodium Ion Pm2.5 LC | 88302 | 845 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | ION CHROMATOGRAPHY | 0.024 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Sodium Ion Pm2.5 LC | 88302 | 849 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | ION CHROMATOGRAPHY | 0.024 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Sodium Ion Pm2.5 LC | 88302 | 850 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | Atomic Absorption | 0.00625 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Sodium Ion Pm2.5 LC | 88302 | 852 | Intermittent | R&P MDL2300 PM2.5 SEQ SPEC NYL | ION CHROMATOGRAPHY | 0.02044 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Sodium Ion Pm2.5 LC | 88302 | 874 | Intermittent | URG MASS400 Teflon VSCC | Ion Chromatography | 0.012 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Sodium Ion Pm2.5 LC | 88302 | 885 | Intermittent | Model 2025 Dichot Sequential Teflon | Ion Chromatography | 0.024 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sodium PM10 LC | 85184 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 20.5 | 0.0 | 1 | Nanograms/cubic meter (LC) | |||||
| Sodium PM10 LC | 85184 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 6.9 | 0.0 | 99999.99999 | 1 | Nanograms/cubic meter (LC) | ||||
| Sodium PM10 LC | 85184 | 902 | Intermittent | BGI Inc. frmOMNI | ICP-AES | 69.4 | 0.0 | 99999.99999 | 1 | Nanograms/cubic meter (LC) | ||||
| Sodium PM10 LC | 85184 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 2.1 | 0.0 | 1 | Nanograms/cubic meter (LC) | |||||
| Sodium PM10 LC | 85184 | 904 | Intermittent | BGI PQ200/200A | ICP-AES | 20.8 | 1 | Nanograms/cubic meter (LC) | ||||||
| Sodium PM10 LC | 85184 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 2.1 | 1 | Nanograms/cubic meter (LC) | ||||||
| Sodium PM10 LC | 85184 | 906 | Intermittent | R & P Partisol 2000 | ICP-AES | 20.8 | 1 | Nanograms/cubic meter (LC) | ||||||
| Sodium PM10 STP | 82184 | 069 | Intermittent | HIVOL-SA/GMW-321-B | EMISSION SPECTRA ICAP | 21.3 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Sodium PM10 STP | 82184 | 085 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 21.3 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Sodium PM10 STP | 82184 | 106 | Intermittent | HI-VOL-Wedding Inlet | Emission Spectra ICAP | 1750.0 | 0.0 | -1 | R | Nanograms/cubic meter (25 C) | ||||
| Sodium PM10 STP | 82184 | 107 | Intermittent | HI-VOL-SA/GMW-321-B | Emission Spectra ICAP | 1769.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Sodium PM10-2.5 LC | 86184 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.0205 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Sodium PM2.5 LC | 88184 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sodium PM2.5 LC | 88184 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sodium PM2.5 LC | 88184 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sodium PM2.5 LC | 88184 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.05107 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sodium PM2.5 LC | 88184 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.0205 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sodium PM2.5 LC | 88184 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.0205 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sodium PM2.5 LC | 88184 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.0205 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sodium PM2.5 LC | 88184 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.0205 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sodium PM2.5 LC | 88184 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.0205 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sodium PM2.5 LC | 88184 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.0205 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sodium PM2.5 LC | 88184 | 880 | Intermittent | Andersen RAAS Quartz | Atomic Absorption | 0.007 | 50.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Sodium PM2.5 LC | 88184 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.0205 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Sodium PM2.5 LC | 88184 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sodium PM2.5 LC | 88184 | 901 | Intermittent | BGI Inc. frmOMNI | ICP-MS | 0.0069 | 5000.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Sodium PM2.5 LC | 88184 | 902 | Intermittent | BGI Inc. frmOMNI | ICP-AES | 0.0694 | 5000.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Sodium PM2.5 LC | 88184 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.0021 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Sodium PM2.5 LC | 88184 | 904 | Intermittent | BGI PQ200/200A | ICP-AES | 0.0208 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Sodium PM2.5 LC | 88184 | 905 | Intermittent | R & P Partisol 2000 | ICP-MS | 0.0021 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Sodium PM2.5 LC | 88184 | 906 | Intermittent | R & P Partisol 2000 | ICP-AES | 0.0208 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Soil Extinction PM2.5 LC | 88349 | 899 | Intermittent | Unknown-Unknown | # | 0.002 | 3 | Inverse Megameters | ||||||
| Soil PM2.5 LC | 88348 | 805 | Intermittent | IMPROVE Calculation of Fine Soil | 2.2*[Al]+2.49*[Si]+1.63*[Ca]+2.42*[Fe]+1.94*[Ti] | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Soil PM2.5 LC | 88348 | 818 | Intermittent | Calculated from Met One SASS/SuperSASS Teflon | Soil = 2.2*[88104]+2.49*[88165]+1.63*[88111]+2.42*[88126)+1.94*[88161] | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Soil PM2.5 LC | 88348 | 899 | Intermittent | Unknown-Unknown | # | 0.002 | 3 | Micrograms/cubic meter (LC) | ||||||
| Soil Temperature | 62108 | 041 | Continuous | Instrumental | Thermistor Electronic Average | -60.0 | -60.0 | 150.0 | 1 | R | Degrees Fahrenheit | |||
| Soil index (COH) | 11201 | 081 | Continuous | TAPE-SAMPLER | TRANSMITTANCE | 0.01 | 0.0 | 2 | R | COHS/1,000 linear feet | ||||
| Soil index (RUD) | 11202 | 091 | Continuous | TAPE-SAMPLER | REFLECTANCE | 0.01 | 0.0 | 2 | R | RUDS/10,000 linear feet | ||||
| Soil index (ug/m3) | 11205 | 071 | Continuous | TAPE-SAMPLER | TRANSMITTANCE+INTERNAL REFLECT | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Solar radiation | 63301 | 011 | Continuous | INSTRUMENTAL | PYRANOMETER | 0.01 | -0.015 | 2 | R | Langleys/minute | ||||
| Solar radiation | 63301 | 012 | Continuous | INSTRUMENTAL | TVA PYRANOMETER-AVG 5 MIN READINGS | 0.01 | -0.015 | 2 | R | Langleys/minute | ||||
| Solar radiation | 63301 | 013 | Continuous | INSTRUMENTAL | TVA SOLARIMETER-AVG.5 MIN. READING | 0.01 | -0.015 | 2 | R | Langleys/minute | ||||
| Solar radiation | 63301 | 014 | Continuous | INSTRUMENTAL | SOLARIMETER | 0.01 | -0.015 | 2 | R | Langleys/minute | ||||
| Solar radiation | 63301 | 015 | Continuous | INSTRUMENTAL | PYRHELIOMETER | 0.01 | -0.015 | 2 | R | Langleys/minute | ||||
| Solar radiation | 63301 | 016 | Continuous | Instrumental | Thermopile Sensor | 0.001 | -0.015 | 3 | R | Langleys/minute | ||||
| Solar radiation | 63301 | 060 | Continuous | Instrumental | Vaisala 441A Pyronometer | 0.01 | -0.015 | 2 | R | Langleys/minute | ||||
| Std Dev Hz Wind Direction | 61106 | 020 | Continuous | INSTRUMENTAL | ARITHMETIC STANDARD DEVIATION | 1.0 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Std Dev Hz Wind Direction | 61106 | 021 | Continuous | INSTRUMENTAL | ARITH STD DEV LEVEL 1 | 1.0 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Std Dev Hz Wind Direction | 61106 | 022 | Continuous | INSTRUMENTAL | ARITH STD DEV LEVEL 2 | 1.0 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Std Dev Hz Wind Direction | 61106 | 023 | Continuous | INSTRUMENTAL | ARITH STD DEV LEVEL 3 | 1.0 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Std Dev Hz Wind Direction | 61106 | 030 | Continuous | INSTRUMENTAL | TVA AVERAGE SIGMA METER | 1.0 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Std Dev Hz Wind Direction | 61106 | 031 | Continuous | INSTRUMENTAL | TVA AVERAGE SIGMA METER LEVEL 1 | 1.0 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Std Dev Hz Wind Direction | 61106 | 032 | Continuous | INSTRUMENTAL | TVA AVERAGE SIGMA METER LEVEL 2 | 1.0 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Std Dev Hz Wind Direction | 61106 | 033 | Continuous | INSTRUMENTAL | TVA AVERAGE SIGMA METER LEVEL 3 | 1.0 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Std Dev Hz Wind Direction | 61106 | 034 | Continuous | INSTRUMENTAL | TVA AVERAGE SIGMA METER LEVEL 4 | 1.0 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Std Dev Hz Wind Direction | 61106 | 050 | Continuous | Instrumental | Electronic or Machine average | 1.0 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Std Dev Hz Wind Direction | 61106 | 063 | Continuous | Instrumental | Climatronics | 0.1 | 0.0 | 1 | R | Degrees Compass | ||||
| Std Dev Hz Wind Direction | 61106 | 064 | Continuous | Instrumental | AutoMet | 0.1 | 0.0 | 1 | R | Degrees Compass | ||||
| Std Dev Hz Wind Direction | 61106 | 066 | Continuous | Instrumental | RM Young Ultrasonic Anemometer Model 81000 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Std Dev Hz Wind Direction | 61106 | 068 | Continuous | Instrumental | RM Young Ultrasonic Anemometer Model 86004 | 0.1 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Std Dev Hz Wind Direction | 61106 | 127 | Continuous | Instrumental | ACOUSTIC SOUNDER | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Std Dev Hz Wind Speed | 61111 | 020 | Continuous | INSTRUMENTAL | ARITHMETIC STANDARD DEVIATION | 0.1 | 0.0 | 1 | R | Knots | ||||
| Std Dev Hz Wind Speed | 61111 | 021 | Continuous | INSTRUMENTAL | ARITH STD DEV LEVEL 1 | 0.1 | 0.0 | 1 | R | Knots | ||||
| Std Dev Hz Wind Speed | 61111 | 022 | Continuous | INSTRUMENTAL | ARITH STD DEV LEVEL 2 | 0.1 | 0.0 | 1 | R | Knots | ||||
| Std Dev Hz Wind Speed | 61111 | 023 | Continuous | INSTRUMENTAL | ARITH STD DEV LEVEL 3 | 0.1 | 0.0 | 1 | R | Knots | ||||
| Std Dev Hz Wind Speed | 61111 | 063 | Continuous | Instrumental | Climatronics | 0.1 | 0.0 | 1 | R | Knots | ||||
| Std Dev Hz Wind Speed | 61111 | 064 | Continuous | Instrumental | AutoMet | 0.1 | 0.0 | 1 | R | Knots | ||||
| Std Dev Vt Wind Direction | 61107 | 020 | Continuous | INSTRUMENTAL | ARITHMETIC STANDARD DEVIATION | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Std Dev Vt Wind Direction | 61107 | 021 | Continuous | INSTRUMENTAL | ARITH STD DEV LEVEL 1 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Std Dev Vt Wind Direction | 61107 | 022 | Continuous | INSTRUMENTAL | ARITH STD DEV LEVEL 2 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Std Dev Vt Wind Direction | 61107 | 023 | Continuous | INSTRUMENTAL | ARITH STD DEV LEVEL 3 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Std Dev Vt Wind Direction | 61107 | 030 | Continuous | INSTRUMENTAL | TVA AVERAGE SIGMA METER | 1.0 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Std Dev Vt Wind Direction | 61107 | 031 | Continuous | INSTRUMENTAL | TVA AVERAGE SIGMA METER LEVEL 1 | 1.0 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Std Dev Vt Wind Direction | 61107 | 032 | Continuous | INSTRUMENTAL | TVA AVERAGE SIGMA METER LEVEL 2 | 1.0 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Std Dev Vt Wind Direction | 61107 | 033 | Continuous | INSTRUMENTAL | TVA AVERAGE SIGMA METER LEVEL 3 | 1.0 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Std Dev Vt Wind Direction | 61107 | 034 | Continuous | INSTRUMENTAL | TVA AVERAGE SIGMA METER LEVEL 4 | 1.0 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Std Dev Vt Wind Speed | 61110 | 020 | Continuous | INSTRUMENTAL | ARITHMETIC STANDARD DEVIATION | 0.1 | 0.0 | 1 | R | Knots | ||||
| Std Dev Vt Wind Speed | 61110 | 021 | Continuous | INSTRUMENTAL | ARITH STD DEV LEVEL 1 | 0.1 | 0.0 | 1 | R | Knots | ||||
| Std Dev Vt Wind Speed | 61110 | 022 | Continuous | INSTRUMENTAL | ARITH STD DEV LEVEL 2 | 0.1 | 0.0 | 1 | R | Knots | ||||
| Std Dev Vt Wind Speed | 61110 | 023 | Continuous | INSTRUMENTAL | ARITH STD DEV LEVEL 3 | 0.1 | 0.0 | 1 | R | Knots | ||||
| Std Dev Vt Wind Speed | 61110 | 066 | Continuous | Instrumental | RM Young Ultrasonic Anemometer Model 81000 | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Std Dev Vt Wind Speed | 61110 | 127 | Continuous | INSTRUMENTAL | ACOUSTIC SOUNDER | 0.1 | 0.0 | 1 | R | Knots | ||||
| Steel corrosion | 72201 | 091 | Intermittent | STEEL PANEL | GRAVIMETRIC | 1.0 | 0.0 | 0 | R | Microns/year | ||||
| Strong Acids (precip) | 65306 | 081 | Intermittent | PRECIP | COULOMETRIC TITRATION | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Strontium (TSP) STP | 12168 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.2 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Strontium (TSP) STP | 12168 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.02 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Strontium (TSP) STP | 12168 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Strontium (TSP) STP | 12168 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Strontium (TSP) STP | 12168 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Strontium (TSP) STP | 12168 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.005 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Strontium - 88 (TSP) | 11355 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Strontium PM10 LC | 85168 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Strontium PM10 LC | 85168 | 820 | Continuous | Cooper Environmental Services (CES) XACT 625 | X-ray fluorescence (XRF) | 0.447 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Strontium PM10 LC | 85168 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 1.01 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Strontium PM10 LC | 85168 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.13 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Strontium PM10 LC | 85168 | 907 | Intermittent | R & P Partisol 2025 Teflon | ICPMS | 0.26 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Strontium PM10 STP | 82168 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Strontium PM10 STP | 82168 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 3.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Strontium PM10 STP | 82168 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 3.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Strontium PM10 STP | 82168 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 3.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Strontium PM10-2.5 LC | 86168 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00101 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Strontium PM10-2.5 STP | 83168 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Strontium PM2.5 LC | 88168 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Strontium PM2.5 LC | 88168 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Strontium PM2.5 LC | 88168 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Strontium PM2.5 LC | 88168 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.00251 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Strontium PM2.5 LC | 88168 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 0.447 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Strontium PM2.5 LC | 88168 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00101 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Strontium PM2.5 LC | 88168 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00101 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Strontium PM2.5 LC | 88168 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00101 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Strontium PM2.5 LC | 88168 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00101 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Strontium PM2.5 LC | 88168 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00101 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Strontium PM2.5 LC | 88168 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00101 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Strontium PM2.5 LC | 88168 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00101 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Strontium PM2.5 LC | 88168 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Strontium PM2.5 STP | 84168 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Strontium(TSP) LC | 14168 | 310 | Intermittent | LO-VOL | ICP-MS | 0.005 | 5 | Micrograms/cubic meter (LC) | ||||||
| Strontium(TSP) LC | 14168 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.447 | 3 | Micrograms/cubic meter (LC) | ||||||
| Styrene | 45220 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 1.6 | -1.6 | 1 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.8 | -0.8 | 2 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 111 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-FID | 1.6 | -1.6 | 1 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 117 | Intermittent | TENAX SORBENT CARTRIDGE | GC/MS | 0.24 | -0.24 | 2 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 119 | Intermittent | PERSONAL PUMP MOLECULAR SIEVE | GC/MS | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.48 | -0.48 | 2 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 1.99729 | -1.99729 | 4 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.77 | -0.77 | 2 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 151 | Intermittent | 6L PRESSURIZED CANISTER | CAPILLARY GC-ECD/PID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 168 | Intermittent | 6L PRESSURIZED CANISTER | PACKED COLUMN GC - ECD/PID | 0.8 | -0.8 | 2 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 169 | Intermittent | TEDLAR BAG | PACKED COLUMN GC - ECD/PID | 0.8 | -0.8 | 2 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.16 | -0.16 | 2 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 204 | Continuous | Instrumental | Process Analyzer GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 205 | Continuous | Preconcentration trap | GC Dual FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.16 | -0.16 | 3 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.64 | -0.64 | 2 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Styrene | 45220 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Styrene | 45220 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Styrene | 45220 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Styrene | 45220 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Styrene | 45220 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Styrene | 45220 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Styrene | 45220 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Styrene | 45220 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Styrene | 45220 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Styrene | 45220 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Styrene | 45220 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Styrene | 45220 | 903 | Intermittent | SKC Pump Charcoal Tube | GC/FID NIOSH 1501 | 5.48 | -5.48 | 2 | R | Parts per billion Carbon | ||||
| Styrene | 45220 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 4.13 | -4.13 | 2 | R | Parts per billion Carbon | ||||
| Styrene and o-xylene | 45110 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Sulfate (SP) | 22403 | 071 | Intermittent | BUCKET | TURBIDIMETRIC (APCA) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Sulfate (SP) | 22403 | 072 | Intermittent | BUCKET | METHYLTHYMOL BLUE (APCA) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Sulfate (SP) | 22403 | 073 | Intermittent | BUCKET | BARIUM SULFATE (APCA) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Sulfate (SP) | 22403 | 081 | Intermittent | BUCKET | TURBIDIMETRIC (ASTM) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Sulfate (SP) | 22403 | 082 | Intermittent | BUCKET | METHYLTHYMOL BLUE (ASTM) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Sulfate (SP) | 22403 | 083 | Intermittent | BUCKET | BARIUM SULFATE (ASTM) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Sulfate (TSP) LC | 14403 | 096 | Intermittent | HI-VOL | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.5 | 0.0 | 1 | R | Micrograms/cubic meter (LC) | ||||
| Sulfate (TSP) LC | 14403 | 900 | Intermittent | Teflon CASTNET-style 3-stage filter pack | Ion Chromatography EPA Modified Method 300.0 | 0.011 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sulfate (TSP) STP | 12403 | 091 | Intermittent | HI-VOL | COLORIMETRIC | 0.5 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfate (TSP) STP | 12403 | 092 | Intermittent | HI-VOL | TURBIDIMETRIC | 0.5 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfate (TSP) STP | 12403 | 093 | Intermittent | HI-VOL | METHYLTHYMOL BLUE | 1.0 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfate (TSP) STP | 12403 | 096 | Intermittent | HI-VOL | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.5 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfate (TSP) STP | 12403 | 900 | Intermittent | Teflon CASTNET-style 3-stage filter pack | Ion Chromatography EPA Mehtod 300.0 | 0.033 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfate (precip) | 65322 | 015 | Intermittent | ANDERSON RAINFALL BUCKET | AUTO MTB VIA TRAACS 800 | 5.0 | 0.0 | 1 | R | Milligrams/liter | ||||
| Sulfate (precip) | 65322 | 081 | Intermittent | PRECIP | COLORIMETRIC | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Sulfate (precip) | 65322 | 082 | Intermittent | PRECIP | PHOTOMETRIC TITRATION | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Sulfate (precip) | 65322 | 083 | Intermittent | PRECIP | CONDUCTIMETRIC TITRATION | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Sulfate (precip) | 65322 | 084 | Intermittent | PRECIP | NEPHELOMETRIC | 1.0 | 0.0 | 1 | R | Milligrams/liter | ||||
| Sulfate (precip) | 65322 | 085 | Intermittent | PRECIP | X-RAY FLUORESCENCE | 0.01 | 0.0 | 2 | R | Milligrams/liter | ||||
| Sulfate (precip) | 65322 | 086 | Intermittent | ANDERSON RAINFALL BUCKET | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.07 | 0.0 | 2 | R | Milligrams/liter | ||||
| Sulfate PM10 LC | 85403 | 890 | Intermittent | Model 2025 PM10 Sequential Teflon | Ion Chromatography | 0.01 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Sulfate PM10 STP | 82403 | 062 | Intermittent | HI-VOL-WEDDING-INLET | GRAVIMETRIC | 4.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfate PM10 STP | 82403 | 091 | Intermittent | HI-VOL-SA/GMW-321-B | COLORIMETRIC | 0.05 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfate PM10 STP | 82403 | 093 | Intermittent | HI-VOL-SA/GMW-321-B | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.5 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfate PM10 STP | 82403 | 102 | Intermittent | HI-VOL-SA/GMW1200 | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.5 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfate PM10 STP | 82403 | 103 | Intermittent | HI-VOL-WEDDING-INLET | ION CHROMATOGRAPH CONDUCTIMETRIC | 0.5 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfate PM10-2.5 LC | 86403 | 885 | Intermittent | Model 2025 Dichot Sequential Teflon | Ion Chromatography | 0.01 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Sulfate PM2.5 LC | 88403 | 803 | Intermittent | IMPROVE Module B with Cyclone Inlet and Glycerin-Nylon Filter, 4.9 sq. cm. | Ion Chromatography | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sulfate PM2.5 LC | 88403 | 805 | Intermittent | IMPROVE Module B with Cyclone Inlet and Na2CO3-Nylon Filter, 17.4 sq. cm. | Ion Chromatography | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sulfate PM2.5 LC | 88403 | 806 | Intermittent | IMPROVE Module B with Cyclone Inlet and Na2CO3-Nylon Filter, 4.9 sq. cm. | Ion Chromatography | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sulfate PM2.5 LC | 88403 | 807 | Intermittent | IMPROVE Module B with Cyclone Inlet and Glycerin/Na2CO3-Nylon Filter, 10.8 sq. cm. | Ion Chromatography | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sulfate PM2.5 LC | 88403 | 812 | Intermittent | Met One SASS/SuperSASS Nylon | Ion Chromatography | 0.012 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Sulfate PM2.5 LC | 88403 | 822 | Intermittent | Andersen RAAS Nylon | Ion Chromatography | 0.011 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Sulfate PM2.5 LC | 88403 | 834 | Intermittent | URG MASS400 Teflon WINS | Ion Chromatography | 0.005 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Sulfate PM2.5 LC | 88403 | 844 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | Ion Chromatography | 0.01 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Sulfate PM2.5 LC | 88403 | 845 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | ION CHROMATOGRAPHY | 0.01 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Sulfate PM2.5 LC | 88403 | 848 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | Ion Chromatography | 0.01 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Sulfate PM2.5 LC | 88403 | 849 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | ION CHROMATOGRAPHY | 0.01 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Sulfate PM2.5 LC | 88403 | 852 | Intermittent | R&P MDL2300 PM2.5 SEQ SPEC NYL | ION CHROMATOGRAPHY | 0.00803 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Sulfate PM2.5 LC | 88403 | 853 | Intermittent | RP Partisol Model 2300 PM2.5 Seq SSampler - Quartz-# | Thermal Optical Reflectance | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sulfate PM2.5 LC | 88403 | 862 | Continuous | R&P MODEL 8400S | FLASH VAPORIZATION/FLUORESCENCE | 0.2 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Sulfate PM2.5 LC | 88403 | 874 | Intermittent | URG MASS400 Teflon VSCC | Ion Chromatography | 0.005 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Sulfate PM2.5 LC | 88403 | 875 | Continuous | Thermo Electron Model 5020 Sulfate Particulate Analyzer | Catalytic thermal reduct/Pulsed Fluorescence | 0.5 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Sulfate PM2.5 LC | 88403 | 876 | Intermittent | R & P Model 2300 PM2.5 Sequential Teflon | Ion Chromatography | 0.01 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Sulfate PM2.5 LC | 88403 | 878 | Intermittent | Andersen RAAS Quartz | Ion Chromatography | 0.0625 | 50.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Sulfate PM2.5 LC | 88403 | 885 | Intermittent | Model 2025 Dichot Sequential Teflon | Ion Chromatography | 0.01 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sulfate PM2.5 LC | 88403 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sulfate PM2.5 STP | 82453 | 050 | Intermittent | ANNULAR DIFFUSION DENUDER | ION CHROMATOGRAPH | 0.004 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfate PM2.5 STP | 82453 | 062 | Intermittent | HI-VOL-WEDDING-INLET | GRAVIMETRIC | 4.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfate PM2.5 STP | 82453 | 064 | Intermittent | HI-VOL-SA/GMW-321-B | GRAVIMETRIC | 4.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfation rate | 42410 | 071 | Intermittent | LEAD-PLATE | GRAVIMETRIC (HUEY) | 0.1 | -0.1 | 1 | R | Mg S03/100 sq cm/day | ||||
| Sulfation rate | 42410 | 072 | Intermittent | LEAD-PLATE | COLORIMETRIC (HUEY) | 0.1 | -0.1 | 1 | R | Mg S03/100 sq cm/day | ||||
| Sulfation rate | 42410 | 073 | Intermittent | LEAD-PLATE | TURBIDIMETRIC (HUEY) | 0.1 | -0.1 | 1 | R | Mg S03/100 sq cm/day | ||||
| Sulfation rate | 42410 | 074 | Intermittent | LEAD-PLATE | POTASSIUM CARBONATE (HUEY) | 0.1 | -0.1 | 1 | R | Mg S03/100 sq cm/day | ||||
| Sulfation rate | 42410 | 075 | Intermittent | LEAD-PLATE | TITRIMETRIC (HUEY) | 0.1 | -0.1 | 1 | R | Mg S03/100 sq cm/day | ||||
| Sulfation rate | 42410 | 081 | Intermittent | RAC-CANDLE | GRAVIMETRIC | 0.1 | -0.1 | 1 | R | Mg S03/100 sq cm/day | ||||
| Sulfation rate | 42410 | 082 | Intermittent | RAC-CANDLE | COLORIMETRIC | 0.1 | -0.1 | 1 | R | Mg S03/100 sq cm/day | ||||
| Sulfation rate | 42410 | 083 | Intermittent | RAC-CANDLE | TITRIMETRIC | 0.1 | -0.1 | 1 | R | Mg S03/100 sq cm/day | ||||
| Sulfation rate | 42410 | 084 | Intermittent | RAC-CANDLE | TURBIMETRIC | 0.1 | -0.1 | 1 | R | Mg S03/100 sq cm/day | ||||
| Sulfation rate | 42410 | 091 | Intermittent | LEAD-CANDLE | GRAVIMETRIC (NASN) | 0.1 | -0.1 | 1 | R | Mg S03/100 sq cm/day | ||||
| Sulfation rate | 42410 | 092 | Intermittent | LEAD-CANDLE | COLORIMETRIC (NASN) | 0.1 | -0.1 | 1 | R | Mg S03/100 sq cm/day | ||||
| Sulfation rate | 42410 | 093 | Intermittent | LEAD CANDLE | TITRIMETRIC (NASN) | 0.1 | -0.1 | 1 | R | Mg S03/100 sq cm/day | ||||
| Sulfation rate | 42410 | 094 | Intermittent | LEAD-CANDLE | POTASSIUM CARBONATE (NASN) | 0.1 | -0.1 | 1 | R | Mg S03/100 sq cm/day | ||||
| Sulfation rate | 42410 | 095 | Intermittent | LEAD-CANDLE | TURBIMETRIC (NASN) | 0.1 | -0.1 | 1 | R | Mg S03/100 sq cm/day | ||||
| Sulfur (TSP) STP | 12169 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.03 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfur (TSP) STP | 12169 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfur (TSP) STP | 12169 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfur (TSP) STP | 12169 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfur (TSP) STP | 12169 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfur PM10 LC | 85169 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Sulfur PM10 LC | 85169 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 0.00265 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Sulfur PM10 STP | 82169 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfur PM10 STP | 82169 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfur PM10 STP | 82169 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfur PM10 STP | 82169 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfur PM10-2.5 LC | 86169 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00265 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Sulfur PM10-2.5 STP | 83169 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfur PM2.5 LC | 88169 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sulfur PM2.5 LC | 88169 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sulfur PM2.5 LC | 88169 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sulfur PM2.5 LC | 88169 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.00662 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sulfur PM2.5 LC | 88169 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00265 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sulfur PM2.5 LC | 88169 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00265 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sulfur PM2.5 LC | 88169 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00265 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sulfur PM2.5 LC | 88169 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00265 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sulfur PM2.5 LC | 88169 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00265 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sulfur PM2.5 LC | 88169 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00265 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sulfur PM2.5 LC | 88169 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00265 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Sulfur PM2.5 LC | 88169 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sulfur PM2.5 STP | 84169 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfur dioxide | 42401 | 001 | Intermittent | MANUAL | GENERIC METHOD CODE FOR GEMS/AIR | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | 005 | Continuous | INSTRUMENTAL | SEC DERIV SPECTROSCOPY | FEM | EQSA-1275-005 | LEAR SIEGLER SM1000 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 006 | Continuous | INSTRUMENTAL | FLAME PHOTOMETRIC | FEM | EQSA-1275-006 | MELOY SA185-2A | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 009 | Continuous | INSTRUMENTAL | PULSED FLUORESCENT | FEM | EQSA-0276-009 | THERMO ELECTRON 43 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 010 | Continuous | INSTRUMENTAL | COULOMETRIC | FEM | EQSA 0676-010 | PHILIPS PW9755 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 011 | Continuous | INSTRUMENTAL | WEST-GAEKE COLORIMETRIC | 10.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | 013 | Continuous | INSTRUMENTAL | CONDUCTIMETRIC | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | 014 | Continuous | INSTRUMENTAL | COULOMETRIC | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | 016 | Continuous | INSTRUMENTAL | FLAME PHOTOMETRIC | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | 018 | Intermittent | WILSON-IMPINGR | HYDROGEN PEROXIDE NAOH TITRATION | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | 019 | Continuous | INSTRUMENTAL | CATALYST-FLAME PHOTOMETRIC | 1.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | 020 | Continuous | INSTRUMENTAL | PULSED FLUORESCENT | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | 021 | Continuous | INSTRUMENTAL | SEC DERIV SPECTROSCOPY | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | 022 | Continuous | INSTRUMENTAL | CONDUCTANCE ASARCO | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | 023 | Continuous | INSTRUMENTAL | ULTRA VIOLET STIMULATED FLUORESCNC | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | 024 | Continuous | INSTRUMENTAL | CONDUCTANCE | FEM | EQSA-0877-024 | ASARCO 500 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 029 | Continuous | INSTRUMENTAL | ULTRA VIOLET STIMULATED FLUORESCNC | FEM | EQSA-0678-029 | BECKMAN 953 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 030 | Continuous | INSTRUMENTAL | FLAME PHOTOMETRIC | FEM | EQSA-1078-030 | BENDIX 8303 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 031 | Continuous | INSTRUMENTAL | CHEMILUMINESCENCE | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | 032 | Continuous | INSTRUMENTAL | FLAME PHOTOMETRIC | FEM | EQSA-1078-032 | MELOY SA285E | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 033 | Continuous | DAVIS-INST | SEQUENTIAL-CONDUCTIMETRIC | 10.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | 039 | Continuous | INSTRUMENTAL | ULTRA VIOLET STIMULATED FLUORESCNC | FEM | EQSA-0779-039 | MONITOR LABS 8850 | 2.0 | -4.0 | 10000.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 046 | Continuous | INSTRUMENTAL | ULTRA VIOLET STIMULATED FLUORESCNC | FEM | EQSA-0580-046 | MELOY SA700 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 049 | Continuous | INSTRUMENTAL | SEC DERIV SPECTROSCOPY | FEM | EQSA-1280-049 | LEAR SIEGLER AM2020 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 050 | Intermittent | ANNULAR DIFFUSION DENUDER | ION CHROMATOGRAPH | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | 059 | Continuous | INSTRUMENTAL | PULSED FLUORESCENT | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | 060 | Continuous | INSTRUMENTAL | PULSED FLUORESCENT | FEM | EQSA-0486-060 | THERMO ELECTRON 43A, 43B, 43C | 2.0 | -4.0 | 10000.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 061 | Continuous | INSTRUMENTAL | ULTRA VIOLET FLUORESCENCE | FEM | EQSA-1086-061 | DASIBI 4108 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 075 | Continuous | INSTRUMENTAL | ULTRA VIOLET STIMULATED FLUORESCNC | FEM | EQSA-0390-075 | MONITOR LABS 8850S | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 077 | Continuous | INSTRUMENTAL | FLUORESCENCE DETECTION | FEM | EQSA-0990-077 | ADV POLL INST INC MODEL 100 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 084 | Continuous | INSTRUMENTAL | UV FLUORESCENCE | FEM | EQSA-0292-084 | ENVIRON. SA MDL AF21M | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 091 | Intermittent | GAS-BUBBLER | PARAROSANILINE-SULFAMIC ACID | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | 092 | Continuous | AUTOMATED ANALYZER | ULTRAVIOLET FLUORESCENCE | FEM | EQAS-0193-092 | MONITOR LABS 9850 & 9850B | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 094 | Intermittent | GAS-BUBBLER | HYDROGEN PEROXIDE | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | 095 | Intermittent | MANUAL | POLAROGRAPHIC | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | 096 | Intermittent | WILSON-IMPINGR | HYDROGEN PEROXIDE NAOH TITRATION | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | 098 | Intermittent | TGS METHOD ORIFICE | GAS BUBBLER | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | 100 | Continuous | INSTRUMENTAL | ULTRAVIOLET FLUORESCENCE | FEM | EQSA-0495-100 | API MODEL 100 A SO2 ANALYZER | 0.4 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 101 | Continuous | INSTRUMENTAL | OPEN PATH SO2 ANALYZER | FEM | EQSA-0495-101 | OPSIS MODEL AR 500 SYSTEM | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 114 | Continuous | Instrumental | Pulsed UV Fluorescence | FEM | EQSA-0197-114 | HORIBA APSA-360 OR APSA-360ACE | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 115 | Continuous | Instrumental | Ultraviolet Fluorescent Analyzer | FEM | EQSA-0701-115 | DKK CORP MODEL GFS-32 AMB SO2 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 133 | Continuous | Instrumental | Ultra Violet Fluorescence | FEM | EQSA-0100-133 | DKK MDl GFS-112E | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 138 | Continuous | Instrumental | Open Path SO2 Analyzer | FEM | EQOA-0400-138 | SANOA Longpath | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 149 | Continuous | Instrumental | UV Fluorescence | FEM | EQOA-0802-149 | Environnement S.A. AF22M SO2 Analyzer | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 159 | Continuous | Instrumental | Pulsed UV Fluorescence | FEM | EQSA-0506-159 | HORIBA APSA-370 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 166 | Continuous | Instrumental | U V Fluorescence | FEM | EQSA-0507-166 | SIR S A Model S-5001 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 168 | Continuous | Instrumental | DKK-TOA Corp ModelGFS-312E | FEM | EQSA-1107-168 | DKK-TOA Model GFS-312E | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 188 | Continuous | Instrumental | Ecotech Serinus 50 | FEM | EQSA-0809-188 | Ecotech Serinus 50 SO2 Analyzer | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 194 | Continuous | Instrumental | SERES Model SF 2000 G - UV Fluorescence | FEM | EQSA-0810-194 | SERES Model SF 2000 G Sulfur Dioxide Analyzer | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 237 | Continuous | Instrumental | Sutron or Sabio Model 6020 UV Fluorescence | FRM | RFSA-0616-237 | Sutron or Sabio Model 6020 UV Fluorescence | 0.3 | -4.0 | 500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 511 | Continuous | INSTRUMENTAL | COULOMETRIC | FEM | EQSA-0876-011 | PHILIPS PW9700 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 513 | Continuous | INSTRUMENTAL | FLAME PHOTOMETRIC | FEM | EQSA-0876-013 | MONITOR LABS 8450 | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 560 | Continuous | INSTRUMENTAL | Pulsed Fluorescent 43C-TLE/43i-TLE | FEM | EQSA-0486-060 | Thermo Electron 43c-TLE/43i-TLE | 0.2 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 592 | Continuous | Instrumental | Ultraviolet Fluorescence EC9850T | FEM | EQSA-0193-092 | Ecotech EC9850T | 0.2 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 600 | Continuous | Instrumental | Ultraviolet Fluorescence API 100 EU | FEM | EQSA-0495-100 | Teledyne API 100 EU | 0.2 | -4.0 | 1500.0 | 1 | T | Parts per billion |
| Sulfur dioxide | 42401 | 801 | Intermittent | GAS-BUBBLER | PARAROSANILINE-SULFAMIS TEMP. CONT | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | 811 | Intermittent | IMPROVE Module D with Cyclone Inlet-Quartz Filter, 2.2 sq. cm. | Ion Chromatography | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | 850 | Intermittent | RP Partisol Model 2300 PM2.5 Seq SSampler-# | CALCULATED | 2.0 | -4.0 | 1500.0 | 1 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | 900 | Intermittent | Cellulose & Nylon CASTNET-style 3-stage filter pack | Ion Chromatography EPA Mehtod 300.0 | 0.026 | -4.0 | 1500.0 | 3 | T | Parts per billion | |||
| Sulfur dioxide | 42401 | FBA | Continuous | Gas calibrator with independent flow rate transfer standards | Audit using challenge gas standard | 0.0 | 0.0 | 1500.0 | 4 | T | Parts per billion | |||
| Sulfur dioxide (LC) | 42403 | 900 | Intermittent | Nylon and cellulose CASTNET-style 3-stage filter pack | Ion Chromatography EPA Modified Method 300.0 | 0.015 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Sulfuric acid | 42306 | 101 | Intermittent | SILICA GEL TUBE | IC SCAN | 2.0 | -2.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Sulfuric acid (TSP) STP | 12402 | 091 | Intermittent | HI-VOL | PH METER | 0.01 | 0.0 | 2 | R | pH Units | ||||
| Sum of PAMS target compounds | 43000 | 001 | Continuous | INSTRUMENTAL | FLAME IONIZATION | 200.0 | -200.0 | 0 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 011 | Continuous | INSTRUMENTAL | FLAME IONIZATION | 1.0 | -1.0 | 0 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 012 | Intermittent | 6L SS CANISTER-PRESSURIZED | CRYOGENIC PRECON FLAME IONI(PDFID) | 0.02 | -0.02 | 1 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 013 | Continuous | INSTRUMENTAL | PHOTO IONIZATION | 20.0 | -20.0 | 0 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 1.0 | -1.0 | 0 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 124 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID | 1000.0 | -1000.0 | 0 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 33.0 | -33.0 | 0 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 100.0 | -100.0 | 0 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 1.0 | -1.0 | 0 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.1 | -0.1 | 4 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON GC/MS | 100.0 | -100.0 | 0 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 160 | Continuous | INSTRUMENTAL | 8202/8202A:NMOC CAL GAS = METHANE | 100.0 | -100.0 | 0 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 161 | Continuous | INSTRUMENTAL | 8202/8202A:NMOC CAL GAS = PROPANE | 100.0 | -100.0 | 0 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 162 | Continuous | INSTRUMENTAL | 8202/8202A:NMOC CAL GAS = HEXANE | 100.0 | -100.0 | 0 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 163 | Intermittent | 6L-SS-CANISTER-PRESSURIZED | CRYOGEN PRECON FID:SUM OF SPECIES | 100.0 | -100.0 | 0 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 164 | Continuous | INSTRUMENTAL | TEI 55:NMOC CAL GAS = PROPANE | 100.0 | -100.0 | 0 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 200 | Continuous | INSTRUMENTAL | SUM OF PEAKS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Sum of PAMS target compounds | 43000 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 99999.0 | 4 | R | Parts per billion Carbon | |||
| Sum of PAMS target compounds | 43000 | 300 | Continuous | MISC COLLECTION METHODS WITH | SEPARATION OTHER THAN BY GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Survey Data PM10 LC | 85100 | 100 | Continuous | Instrumental TSI (Automatic) | Dust Track 8532 | 0.0 | 1 | Micrograms/cubic meter (LC) | ||||||
| Suspended particulate (TSP) | 11101 | 001 | Intermittent | MANUAL | GENERIC GEMS METHOD | 0.1 | 0.0 | 10000.0 | 1 | R | Micrograms/cubic meter (25 C) | |||
| Suspended particulate (TSP) | 11101 | 075 | Intermittent | LEAD-PLATE | TITRIMETRIC(HUEY) | 0.1 | 0.0 | 10000.0 | 1 | R | Micrograms/cubic meter (25 C) | |||
| Suspended particulate (TSP) | 11101 | 077 | Intermittent | MANUAL | BRAZIL PARTICULATE SAMPLER | 1.0 | 0.0 | 10000.0 | 0 | R | Micrograms/cubic meter (25 C) | |||
| Suspended particulate (TSP) | 11101 | 078 | Intermittent | MANUAL | THAILAND PARTICULATE SAMPLER | 0.1 | 0.0 | 10000.0 | 1 | R | Micrograms/cubic meter (25 C) | |||
| Suspended particulate (TSP) | 11101 | 079 | Continuous | Instrumental R&P M1400A TSP HD | TEOM-Gravimetric | -10.0 | -10.0 | 10000.0 | 0 | R | Micrograms/cubic meter (25 C) | |||
| Suspended particulate (TSP) | 11101 | 091 | Intermittent | HI-VOL | GRAVIMETRIC | FRM | RFP-1171-001 | REFERENCE METHOD | 1.0 | 0.0 | 10000.0 | 0 | R | Micrograms/cubic meter (25 C) |
| Suspended particulate (TSP) | 11101 | 092 | Intermittent | MEMBRANE-SAMPLER | GRAVIMETRIC | 1.0 | 0.0 | 10000.0 | 0 | R | Micrograms/cubic meter (25 C) | |||
| Suspended particulate (TSP) | 11101 | 093 | Intermittent | MILLIPORE-FILTER | BETA ABSORPTION | 1.0 | 0.0 | 10000.0 | 1 | R | Micrograms/cubic meter (25 C) | |||
| Suspended particulate (TSP) | 11101 | 094 | Intermittent | CASSETTE | GRAVIMETRIC | 20.0 | 0.0 | 10000.0 | 1 | R | Micrograms/cubic meter (25 C) | |||
| Suspended particulate (TSP) | 11101 | 095 | Intermittent | HOFFMAN-HI-VOL | GRAVIMETRIC | 1.0 | 0.0 | 10000.0 | 0 | R | Micrograms/cubic meter (25 C) | |||
| Suspended particulate (TSP) | 11101 | 802 | Intermittent | HI-VOL | GRAVIMETRIC | FRM | RFP-1171-001 | REFERENCE METHOD | 1.0 | 0.0 | 10000.0 | 0 | R | Micrograms/cubic meter (25 C) |
| Suspended particulate (TSP) LC | 11102 | 091 | Intermittent | HI-VOL | GRAVIMETRIC | FRM | RFP-1171-001 | REFERENCE METHOD | 1.0 | 0.0 | 10000.0 | 0 | R | Micrograms/cubic meter (LC) |
| Tantalum (TSP) STP | 12170 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Tantalum (TSP) STP | 12170 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Tantalum PM2.5 LC | 88170 | 811 | Intermittent | Met One SASS Teflon | Energy Dispersive XRF | 0.01954 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Tantalum PM2.5 LC | 88170 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00784 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Tantalum PM2.5 LC | 88170 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00784 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Tantalum PM2.5 LC | 88170 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00784 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Tantalum PM2.5 LC | 88170 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00784 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Tantalum PM2.5 LC | 88170 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00784 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Tantalum PM2.5 LC | 88170 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00784 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Tellurium and compounds as Te (TSP) STP | 12171 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.09 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Temperature 24-Hr Max | 62104 | 081 | Continuous | INSTRUMENTAL | HYGROTHERMOGRAPH | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Temperature 24-Hr Min | 62105 | 081 | Continuous | INSTRUMENTAL | HYGROTHERMOGRAPH | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Temperature Difference | 62106 | 021 | Continuous | Instrumental | Spot reading level 2 - level 1 | -100.0 | -100.0 | 1 | R | Temp Difference, Centigrade | ||||
| Temperature Difference | 62106 | 031 | Continuous | Instrumental | Spot reading level 3 - level 1 | -100.0 | -100.0 | 1 | R | Temp Difference, Centigrade | ||||
| Temperature Difference | 62106 | 032 | Continuous | Instrumental | Spot reading level 3 - level 2 | -100.0 | -100.0 | 1 | R | Temp Difference, Centigrade | ||||
| Temperature Difference | 62106 | 041 | Continuous | Instrumental | Electronic or machine average level 2 - level 1 | -100.0 | -100.0 | 1 | R | Temp Difference, Centigrade | ||||
| Temperature Difference | 62106 | 042 | Continuous | Instrumental | Electronic or machine average level 3 - level 1 | -100.0 | -100.0 | 1 | R | Temp Difference, Centigrade | ||||
| Temperature Difference | 62106 | 043 | Continuous | Instrumental | Electronic or machine average level 3 - level 2 | -100.0 | -100.0 | 1 | R | Temp Difference, Centigrade | ||||
| Temperature Difference | 62106 | 044 | Continuous | Instrumental | Electronic or machine average level 4 - level 1 | -10.0 | -10.0 | 1 | R | Temp Difference, Centigrade | ||||
| Terbium (TSP) STP | 12172 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Terbium (TSP) STP | 12172 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Terbium PM2.5 LC | 88172 | 811 | Intermittent | Met One SASS Teflon | Energy Dispersive XRF | 0.00752 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Terbium PM2.5 LC | 88172 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00302 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Terbium PM2.5 LC | 88172 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00302 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Terbium PM2.5 LC | 88172 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00302 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Terbium PM2.5 LC | 88172 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00302 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Terbium PM2.5 LC | 88172 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00302 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Terbium PM2.5 LC | 88172 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00302 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Tert-amyl methyl ether | 43373 | 101 | Intermittent | Canister Subambient Pressure | Multi Detector GC | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| Tert-amyl methyl ether | 43373 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Tert-amyl methyl ether | 43373 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 1.2 | -1.2 | 2 | R | Parts per billion Carbon | ||||
| Tert-amyl methyl ether | 43373 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Tert-amyl methyl ether | 43373 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| Tert-amyl methyl ether | 43373 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | Entech Precon- GC/FID/MSD | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| Tert-amyl methyl ether | 43373 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.54 | -0.54 | 2 | R | Parts per billion Carbon | ||||
| Tert-amyl methyl ether | 43373 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tert-amyl methyl ether | 43373 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tert-amyl methyl ether | 43373 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tert-amyl methyl ether | 43373 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tert-amyl methyl ether | 43373 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tert-amyl methyl ether | 43373 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tert-amyl methyl ether | 43373 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tert-amyl methyl ether | 43373 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tert-amyl methyl ether | 43373 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tert-amyl methyl ether | 43373 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tert-amyl methyl ether | 43373 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tert-amyl methyl ether | 43373 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tetrachlorobenzene (TSP) STP | 17802 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 10.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Tetrachlorobiphenyl (TSP) STP | 17812 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 2.0 | 0.0 | 0 | R | Pg/cubic meter(25 C) | ||||
| Tetrachloroethylene | 43817 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 18.0 | -18.0 | 0 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 105 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.4 | -0.4 | 1 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.4 | -0.4 | 1 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 107 | Intermittent | TEDLAR-BAG-24-HR-SAMPLE | GC - ELECTRON CAPTURE DETECTOR | 0.02 | -0.02 | 3 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 115 | Intermittent | TENAX TRAP AC PUMP | HEAT DESORPTION GC MASS SPEC | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.08 | -0.08 | 3 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 117 | Intermittent | TENAX SORBENT CARTRIDGE | GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 118 | Intermittent | TENAX SORBENT CARTRIDGE | GC-FID/ECD | 0.02 | -0.02 | 3 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 121 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/ELECTRON;GC ECD | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.033 | -0.033 | 2 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| Tetrachloroethylene | 43817 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.61 | -0.61 | 2 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 151 | Intermittent | 6L PRESSURIZED CANISTER | CAPILLARY GC-ECD/PID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 168 | Intermittent | 6L PRESSURIZED CANISTER | PACKED COLUMN GC - ECD/PID | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 169 | Intermittent | TEDLAR BAG | PACKED COLUMN GC - ECD/PID | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.04 | -0.04 | 3 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.18 | -0.18 | 2 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tetrachloroethylene | 43817 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tetrachloroethylene | 43817 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tetrachloroethylene | 43817 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tetrachloroethylene | 43817 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tetrachloroethylene | 43817 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tetrachloroethylene | 43817 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tetrachloroethylene | 43817 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tetrachloroethylene | 43817 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tetrachloroethylene | 43817 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tetrachloroethylene | 43817 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tetrachloroethylene | 43817 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Tetrachloroethylene | 43817 | 901 | Intermittent | SKC Pump Charcoal Tube | GC/FID NIOSH 1003 | 1.45 | -1.45 | 2 | R | Parts per billion Carbon | ||||
| Tetrachloroethylene | 43817 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.17 | -0.17 | 2 | R | Parts per billion Carbon | ||||
| Tetrachlorophenol (TSP) STP | 17807 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 10.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Tetradecanal | 43523 | 102 | Continuous | Cartridge-DNPH-on silica | HPLC Ultraviolet Absorption | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Thallium (TSP) LC | 14173 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 2.0e-05 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Thallium (TSP) LC | 14173 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 3.0e-05 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Thallium (TSP) LC | 14173 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.184 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Thallium (TSP) STP | 12173 | 045 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.0064 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Thallium (TSP) STP | 12173 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 2.0e-05 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Thallium (TSP) STP | 12173 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.01 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Thallium (TSP) STP | 12173 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.1 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Thallium (TSP) STP | 12173 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.06 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Thallium (TSP) STP | 12173 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 3.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Thallium (TSP) STP | 12173 | 905 | Intermittent | SKC Pump Filter | ICP/AES NIOSH 7300 | 1.74 | 2 | R | Micrograms/cubic meter (25 C) | |||||
| Thallium (TSP) STP | 12173 | 910 | Intermittent | SKC Pump Filter | MOd NISH 7300/6010B SOP 1813 | 0.0722 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Thallium (precip) | 65173 | 085 | Intermittent | ANDERSON RAINFALL BUCKET | EMISSION SPECTRA ICAP | 0.05 | 0.0 | 3 | R | Milligrams/liter | ||||
| Thallium PM10 LC | 85173 | 089 | Intermittent | LOW-VOL | ICP/MS W/QUARTZ FILTER | 2.0e-05 | 0.0 | 3 | R | Nanograms/cubic meter (LC) | ||||
| Thallium PM10 LC | 85173 | 820 | Continuous | Cooper Environmental Services model Xact 620 | X-ray fluorescence (XRF) | 0.046 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Thallium PM10 LC | 85173 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.001 | 5 | R | Nanograms/cubic meter (LC) | |||||
| Thallium PM10 STP | 82173 | 069 | Intermittent | HIVOL-SA/GMW-321-B | EMISSION SPECTRA ICAP | 6.4 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Thallium PM10 STP | 82173 | 085 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 6.4 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Thallium PM10 STP | 82173 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | |||||
| Thallium PM10 STP | 82173 | 106 | Intermittent | HI-VOL-Wedding Inlet | Emission Spectra ICAP | 28.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Thallium PM10 STP | 82173 | 107 | Intermittent | HI-VOL-SA/GMW-321-B | Emission Spectra ICAP | 28.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Thallium PM2.5 LC | 88173 | 089 | Intermittent | LOW-VOL | ICP/MS W/QUARTZ FILTER | 2.0e-05 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Thallium PM2.5 LC | 88173 | 811 | Intermittent | Met One SASS Teflon | Energy Dispersive XRF | 0.00752 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Thallium PM2.5 LC | 88173 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 0.184 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Thorium (TSP) LC | 14174 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 1.596 | 3 | Micrograms/cubic meter (LC) | ||||||
| Thorium PM10 LC | 85174 | 820 | Continuous | Cooper Environmental Services (CES) XACT 625 | X-ray fluorescence (XRF) | 1.596 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Thorium PM10 LC | 85174 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.004 | 5 | R | Nanograms/cubic meter (LC) | |||||
| Thorium PM2.5 LC | 88174 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 1.596 | 3 | Micrograms/cubic meter (LC) | ||||||
| Thorium-230 (TSP) STP | 12138 | 096 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.002 | 0.0 | 2 | R | Picocuries/cubic meter | ||||
| Thorium-232 (TSP) STP | 12139 | 096 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.002 | 0.0 | 2 | R | Picocuries/cubic meter | ||||
| Tin (TSP) LC | 14160 | 090 | Intermittent | HI-VOL | Emission Spectra ICAP | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (LC) | ||||
| Tin (TSP) LC | 14160 | 310 | Intermittent | LO-VOL | ICP-MS | 0.01 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Tin (TSP) LC | 14160 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 7.455 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Tin (TSP) STP | 12160 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.02 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Tin (TSP) STP | 12160 | 091 | Intermittent | HI-VOL | EMISSION SPECTRA MUFFLE FURNACE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Tin (TSP) STP | 12160 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Tin (TSP) STP | 12160 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Tin (TSP) STP | 12160 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.06 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Tin (TSP) STP | 12160 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Tin (TSP) STP | 12160 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Tin (TSP) STP | 12160 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.004 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Tin (TSP) STP | 12160 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.01 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Tin - 117 (TSP) | 11356 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.01 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Tin - 120 (TSP) | 11361 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.0014 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Tin PM10 LC | 85160 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 3.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Tin PM10 LC | 85160 | 820 | Continuous | Cooper Environmental Services model Xact 620 | X-ray fluorescence (XRF) | 2.543 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Tin PM10 LC | 85160 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 7.17 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Tin PM10 LC | 85160 | 907 | Intermittent | R & P Partisol 2025 Teflon | ICPMS | 0.26 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Tin PM10 STP | 82160 | 069 | Intermittent | HIVOL-SA/GMW-321-B | Emission Spectra ICAP | 9.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Tin PM10 STP | 82160 | 106 | Intermittent | HI-VOL-Wedding Inlet | Emission Spectra ICAP | 8.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Tin PM10 STP | 82160 | 107 | Intermittent | HI-VOL-SA/GMW-321-B | Emission Spectra ICAP | 11.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Tin PM10 STP | 82160 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 3.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Tin PM10 STP | 82160 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 18.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Tin PM10 STP | 82160 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 18.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Tin PM10 STP | 82160 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 18.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Tin PM10-2.5 LC | 86160 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00717 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Tin PM10-2.5 STP | 83160 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Tin PM2.5 LC | 88160 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.01787 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Tin PM2.5 LC | 88160 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 7.455 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Tin PM2.5 LC | 88160 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00717 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Tin PM2.5 LC | 88160 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00717 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Tin PM2.5 LC | 88160 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00717 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Tin PM2.5 LC | 88160 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00717 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Tin PM2.5 LC | 88160 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00717 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Tin PM2.5 LC | 88160 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00717 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Tin PM2.5 LC | 88160 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00717 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Tin PM2.5 STP | 84160 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Titanium (TSP) LC | 14161 | 310 | Intermittent | LO-VOL | ICP-MS | 0.005 | 5 | Micrograms/cubic meter (LC) | ||||||
| Titanium (TSP) LC | 14161 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.38 | 3 | Micrograms/cubic meter (LC) | ||||||
| Titanium (TSP) STP | 12161 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.0036 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Titanium (TSP) STP | 12161 | 091 | Intermittent | HI-VOL | EMISSION SPECTRA MUFFLE FURNACE | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Titanium (TSP) STP | 12161 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Titanium (TSP) STP | 12161 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Titanium (TSP) STP | 12161 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.004 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Titanium (TSP) STP | 12161 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Titanium (TSP) STP | 12161 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Titanium (TSP) STP | 12161 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.01 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Titanium (TSP) STP | 12161 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Titanium PM10 LC | 85161 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 10.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Titanium PM10 LC | 85161 | 820 | Continuous | Cooper Environmental Services model Xact 620 | X-ray fluorescence (XRF) | 0.177 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Titanium PM10 LC | 85161 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 0.83 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Titanium PM10 STP | 82161 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 10.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Titanium PM10 STP | 82161 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 1.8 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Titanium PM10 STP | 82161 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 1.8 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Titanium PM10 STP | 82161 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 1.8 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Titanium PM10-2.5 LC | 86161 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00083 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Titanium PM10-2.5 STP | 83161 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.01 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Titanium PM2.5 LC | 88161 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Titanium PM2.5 LC | 88161 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Titanium PM2.5 LC | 88161 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Titanium PM2.5 LC | 88161 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.00208 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Titanium PM2.5 LC | 88161 | 820 | Continuous | Cooper Environmental Services (CES) XACT 625 | X-ray Fluorescence(XRF) Instrumentation | 0.38 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Titanium PM2.5 LC | 88161 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00083 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Titanium PM2.5 LC | 88161 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00083 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Titanium PM2.5 LC | 88161 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00083 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Titanium PM2.5 LC | 88161 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00083 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Titanium PM2.5 LC | 88161 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00083 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Titanium PM2.5 LC | 88161 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00083 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Titanium PM2.5 LC | 88161 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00083 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Titanium PM2.5 LC | 88161 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Titanium PM2.5 STP | 84161 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.01 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Tolualdehydes | 45504 | 102 | Intermittent | DNPH-COATED CARTRIDGE | HPLC (TO-14) | 0.57 | -0.57 | 1 | R | Parts per billion Carbon | ||||
| Tolualdehydes | 45504 | 130 | Intermittent | DNPH-COATED CARTRIDGE | HPLC (TO-14) | 0.57 | -0.57 | 1 | R | Parts per billion Carbon | ||||
| Tolualdehydes | 45504 | 156 | Intermittent | Cartridge DNPH on Silica, Heated O3 Denuder | HPLC Photo Diode Array | 0.328 | -0.328 | 1 | R | Parts per billion Carbon | ||||
| Tolualdehydes | 45504 | 165 | Intermittent | ATEC 2400 W/Waters Silica DNPH | HP LC-1050 W/Diode Array Detector | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| Tolualdehydes | 45504 | 166 | Intermittent | ATEC 2400 W/Waters Silica DNPH | TO-11 Dionex DX-300 Ion Chrmtg | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| Tolualdehydes | 45504 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 133.0 | -133.0 | 0 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 092 | Continuous | Tenax/GR/Trap | Thermal Desorber GC/PID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 1.89 | -1.89 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 104 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-FID | 0.7 | -0.7 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 2.1 | -2.1 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 108 | Intermittent | TEDLAR-BAG-24-HR-SAMPLE | GC PHOTOIONIZATION DETECTOR | 0.7 | -0.7 | 3 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.7 | -0.7 | 2 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 111 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-FID | 2.1 | -2.1 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 115 | Intermittent | TENAX TRAP AC PUMP | HEAT DESORPTION GC MASS SPEC | 0.7 | -0.7 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.7 | -0.7 | 3 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 117 | Intermittent | TENAX SORBENT CARTRIDGE | GC/MS | 2.8 | -2.8 | 2 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 118 | Intermittent | TENAX SORBENT CARTRIDGE | GC-FID/ECD | 0.07 | -0.07 | 3 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 119 | Intermittent | PERSONAL PUMP MOLECULAR SIEVE | GC/MS | 0.07 | -0.07 | 2 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 134 | Continuous | Semi-Continuous Analyzer | GC/PID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.35 | -0.35 | 2 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.85155 | -0.85155 | 4 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 144 | Intermittent | 3 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.47 | -0.47 | 2 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 151 | Intermittent | 6L PRESSURIZED CANISTER | CAPILLARY GC-ECD/PID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.35 | -0.35 | 2 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 157 | Continuous | Instrumental Open Path | UV OPSIS Model AR 500 | 14.0 | -14.0 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 168 | Intermittent | 6L PRESSURIZED CANISTER | PACKED COLUMN GC - ECD/PID | 1.4 | -1.4 | 2 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 169 | Intermittent | TEDLAR BAG | PACKED COLUMN GC - ECD/PID | 1.4 | -1.4 | 2 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.28 | -0.28 | 2 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.14 | -0.14 | 3 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.84 | -0.84 | 2 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Toluene | 45202 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Toluene | 45202 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Toluene | 45202 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Toluene | 45202 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Toluene | 45202 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Toluene | 45202 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Toluene | 45202 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Toluene | 45202 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Toluene | 45202 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Toluene | 45202 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Toluene | 45202 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Toluene | 45202 | 903 | Intermittent | SKC Pump Charcoal Tube | GC/FID NIOSH 1501 | 4.7 | -4.7 | 2 | R | Parts per billion Carbon | ||||
| Toluene | 45202 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.93 | -0.93 | 2 | R | Parts per billion Carbon | ||||
| Total Carbon PM10 STP | 82116 | 062 | Intermittent | HI-VOL-WEDDING-INLET | GRAVIMETRIC | 4.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Total Carbon PM10 STP | 82116 | 102 | Intermittent | HI-VOL-SA/GMW1200 | TOTAL ORGANIC CARBON ANALYZER | 1.0 | 0.0 | 0 | R | Micrograms/cubic meter (25 C) | ||||
| Total Carbon PM10 STP | 82116 | 108 | Intermittent | HI-VOL-SA/GMW1200 | TOR (DRI Thermal-optical reflectance) | 0.2 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Total Carbon PM2.5 LC | 88312 | 813 | Intermittent | Met One SASS Quartz | STN TOT | 0.245 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Total Carbon PM2.5 LC | 88312 | 860 | Continuous | R&P MODEL 5400 | THERMAL OXIDATION/CO2 DETECTION | 0.2 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Total Carbon PM2.5 LC | 88312 | 867 | Continuous | Sunset Labs | TOT | 0.2 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Total Carbon PM2.5 LC | 88312 | 897 | Continuous | Aerosol Magee Total Carbon Analyzer TCA-08 | Thermal Desorption | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Total Carbon PM2.5 STP | 84312 | 867 | Continuous | Sunset Labs | TOT | 0.2 | 0.0 | 2 | Micrograms/cubic meter (20 C) | |||||
| Total NMOC (non-methane organic compound) | 43102 | 011 | Continuous | INSTRUMENTAL | FLAME IONIZATION | 1.0 | -1.0 | 20000.0 | 0 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 012 | Intermittent | 6L SS CANISTER-PRESSURIZED | CRYOGENIC PRECON FLAME IONI(PDFID) | 0.2 | -0.2 | 20000.0 | 1 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 013 | Continuous | INSTRUMENTAL | PHOTO IONIZATION | 20.0 | -20.0 | 20000.0 | 0 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 091 | Intermittent | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 20000.0 | 1 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 20000.0 | 2 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 20000.0 | 1 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 20000.0 | 1 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 20000.0 | 1 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 124 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID | 1.0 | -1.0 | 20000.0 | 1 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 20000.0 | 2 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.01 | -0.01 | 20000.0 | 2 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 20000.0 | 1 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 20000.0 | 1 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 20000.0 | 1 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 20000.0 | 1 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.4 | -0.4 | 20000.0 | 2 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| Total NMOC (non-methane organic compound) | 43102 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.1 | -0.1 | 4 | R | Parts per billion Carbon | ||||
| Total NMOC (non-methane organic compound) | 43102 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 20000.0 | 1 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Total NMOC (non-methane organic compound) | 43102 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 20000.0 | 1 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 20000.0 | 1 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 160 | Continuous | INSTRUMENTAL | 8202/8202A:NMOC CAL GAS = METHANE | 0.1 | -0.1 | 20000.0 | 2 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 161 | Continuous | INSTRUMENTAL | 8202/8202A:NMOC CAL GAS = PROPANE | 0.1 | -0.1 | 20000.0 | 2 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 162 | Continuous | INSTRUMENTAL | 8202/8202A:NMOC CAL GAS = HEXANE | 0.1 | -0.1 | 20000.0 | 2 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 163 | Intermittent | 6L-SS-CANISTER-PRESSURIZED | CRYOGEN PRECON FID:SUM OF SPECIES | 0.1 | -0.1 | 20000.0 | 2 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 164 | Continuous | INSTRUMENTAL | TEI 55:NMOC CAL GAS = PROPANE | 0.1 | -0.1 | 20000.0 | 2 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 173 | Continuous | Passivated Canister | Cryogenic Preconcentration FID | 0.1 | -0.1 | 20000.0 | 2 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 20000.0 | 1 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 200 | Continuous | INSTRUMENTAL | SUM OF PEAKS | 0.1 | -0.1 | 30000.0 | 2 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 20000.0 | 4 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 20000.0 | 4 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 20000.0 | 4 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 20000.0 | 4 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 20000.0 | 4 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 20000.0 | 4 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 20000.0 | 4 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 20000.0 | 4 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 20000.0 | 4 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 20000.0 | 4 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 20000.0 | 4 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 20000.0 | 4 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 233 | Continuous | preconcentrator trap/thermal desorber | CAS AirmOzone - factor adjusted | 0.5 | -1.0 | 20000.0 | 4 | R | Parts per billion Carbon | |||
| Total NMOC (non-methane organic compound) | 43102 | 300 | Continuous | MISC COLLECTION METHODS WITH | SEPARATION OTHER THAN BY GC/FID | 0.1 | -0.1 | 20000.0 | 2 | R | Parts per billion Carbon | |||
| Total Nitrate (NO3 + HNO3) LC | 12307 | 900 | Intermittent | Teflon + Nylon CASTNET-style 3-stage filter pack | Ion Chromatography EPA Method 300.0 | 0.01 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Total Nitrate PM10 LC | 85306 | 886 | Intermittent | Model 2025 PM10 Sequential | Mathematical Total | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Total Nitrate PM10-2.5 LC | 86306 | 881 | Intermittent | Model 2025 Dichot Sequential | Mathematical Total | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Total Nitrate PM2.5 LC | 88306 | 803 | Intermittent | IMPROVE Module B with Cyclone Inlet and Glycerin-Nylon Filter, 4.9 sq. cm. | Ion Chromatography | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Total Nitrate PM2.5 LC | 88306 | 805 | Intermittent | IMPROVE Module B with Cyclone Inlet and Na2CO3-Nylon Filter, 17.4 sq. cm. | Ion Chromatography | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Total Nitrate PM2.5 LC | 88306 | 806 | Intermittent | IMPROVE Module B with Cyclone Inlet and Na2CO3-Nylon Filter, 4.9 sq. cm. | Ion Chromatography | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Total Nitrate PM2.5 LC | 88306 | 807 | Intermittent | IMPROVE Module B with Cyclone Inlet and Glycerin/Na2CO3-Nylon Filter, 10.8 sq. cm. | Ion Chromatography | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Total Nitrate PM2.5 LC | 88306 | 812 | Intermittent | Met One SASS/SuperSASS Nylon | Ion Chromatography | 0.008 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Total Nitrate PM2.5 LC | 88306 | 822 | Intermittent | Andersen RAAS Nylon | Ion Chromatography | 0.008 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Total Nitrate PM2.5 LC | 88306 | 835 | Intermittent | URG MASS400 WINS | Mathematical Total | 0.003 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Total Nitrate PM2.5 LC | 88306 | 844 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz | Ion Chromatography | 0.006 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Total Nitrate PM2.5 LC | 88306 | 848 | Intermittent | R & P Model 2025 PM2.5 Sequential Quartz VSCC | Ion Chromatography | 0.006 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Total Nitrate PM2.5 LC | 88306 | 852 | Intermittent | R&P MDL2300 PM2.5 SEQ SPEC NYL | ION CHROMATOGRAPHY | 0.00584 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Total Nitrate PM2.5 LC | 88306 | 853 | Intermittent | RP Partisol Model 2300 PM2.5 Seq SSampler - Quartz-# | Thermal Optical Reflectance | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Total Nitrate PM2.5 LC | 88306 | 861 | Continuous | R&P MODEL 8400N | FLASH VAPORIZATION/CHEMILUMINESCENCE | 0.2 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Total Nitrate PM2.5 LC | 88306 | 875 | Intermittent | URG MASS400 VSCC | Mathematical Total | 0.003 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Total Nitrate PM2.5 LC | 88306 | 881 | Intermittent | Model 2025 Dichot Sequential | Mathematical Total | 0.003 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Total Nitrate PM2.5 LC | 88306 | 891 | Intermittent | Model 2025 PM2.5 Sequential | Mathematical Total | 0.003 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Total Nitrate PM2.5 LC | 88306 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Total Oxidants | 44101 | 011 | Continuous | INSTRUMENTAL | TOT OX-0.2(NO+NO2) | 0.01 | -0.01 | 2 | R | Parts per million | ||||
| Total Oxidants | 44101 | 014 | Continuous | INSTRUMENTAL | COLORIMETRIC NEUTRAL KI | 0.01 | -0.01 | 2 | R | Parts per million | ||||
| Total Oxidants | 44101 | 015 | Continuous | INSTRUMENTAL | COULOMETRIC NEUTRAL KI | 0.01 | -0.01 | 2 | R | Parts per million | ||||
| Total Oxidants | 44101 | 016 | Continuous | INSTRUMENTAL | COULOMETRIC KBR & KI SOLUTION | 0.004 | -0.004 | 3 | R | Parts per million | ||||
| Total Oxidants | 44101 | 083 | Intermittent | GAS-BUBBLER | NEUTRAL BUFFERED KI | 0.0025 | -0.0025 | 3 | R | Parts per million | ||||
| Total Weight Ash (SP) | 21116 | 071 | Intermittent | BUCKET | GRAVIMETRIC (APCA) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Total Weight Ash (SP) | 21116 | 081 | Intermittent | BUCKET | GRAVIMETRIC (ASTM) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Total chlorinated hydrocarbons | 43800 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Total chlorinated hydrocarbons | 43800 | 104 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-FID | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Total dustfall (SP) | 21101 | 051 | Intermittent | BUCKET | GRAVIMETRIC | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Total dustfall (SP) | 21101 | 071 | Intermittent | BUCKET | GRAVIMETRIC (APCA) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Total dustfall (SP) | 21101 | 081 | Intermittent | BUCKET | GRAVIMETRIC (ASTM) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Total dustfall (SP) | 21101 | 101 | Intermittent | NADP BUCKET: DRY & WET SIDE | GRAVIMETRIC | 0.0086 | 0.0 | 4 | R | Grams/sq meter/month | ||||
| Total heptachlorodibenzo-p-dioxin (TSP) STP | 17823 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 0.05 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Total heptachlorodibenzofuran (TSP) STP | 17829 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 0.05 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Total hexachlorodibenzo-p-dioxin (TSP) STP | 17822 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 0.05 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Total hexachlorodibenzofuran (TSP) STP | 17828 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 0.05 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Total hydrocarbons | 43101 | 011 | Continuous | INSTRUMENTAL | FLAME IONIZATION | 200.0 | -200.0 | 70000.0 | 0 | R | Parts per billion Carbon | |||
| Total hydrocarbons | 43101 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.1 | -0.1 | 70000.0 | 1 | R | Parts per billion Carbon | |||
| Total hydrocarbons | 43101 | 104 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-FID | 0.1 | -0.1 | 70000.0 | 1 | R | Parts per billion Carbon | |||
| Total hydrocarbons | 43101 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 70000.0 | 1 | R | Parts per billion Carbon | |||
| Total hydrocarbons | 43101 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 70000.0 | 1 | R | Parts per billion Carbon | |||
| Total hydrocarbons | 43101 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.01 | -0.01 | 70000.0 | 2 | R | Parts per billion Carbon | |||
| Total hydrocarbons | 43101 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 70000.0 | 1 | R | Parts per billion Carbon | |||
| Total hydrocarbons | 43101 | 160 | Continuous | INSTRUMENTAL | 8202/8202A:NMOC CAL GAS = METHANE | 0.1 | -0.1 | 70000.0 | 1 | R | Parts per billion Carbon | |||
| Total hydrocarbons | 43101 | 161 | Continuous | INSTRUMENTAL | 8202/8202A:NMOC CAL GAS = PROPANE | 0.1 | -0.1 | 99999.0 | 2 | R | Parts per billion Carbon | |||
| Total hydrocarbons | 43101 | 162 | Continuous | INSTRUMENTAL | 8202/8202A:NMOC CAL GAS = HEXANE | 0.1 | -0.1 | 70000.0 | 2 | R | Parts per billion Carbon | |||
| Total hydrocarbons | 43101 | 164 | Continuous | INSTRUMENTAL | TEI 55:NMOC CAL GAS = PROPANE | 0.1 | -0.1 | 70000.0 | 2 | R | Parts per billion Carbon | |||
| Total non-asbestos fibers | 11125 | 907 | Intermittent | MCE Filter | Modified TEM AHERA | 0.005 | 0.0 | 3 | R | Structures/Cu Cm | ||||
| Total octachlorodibenzo-p-dioxin (TSP) STP | 17824 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 0.05 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Total octachlorodibenzofuran (TSP) STP | 17830 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 0.05 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Total pentachlorodibenzo-p-dioxin (TSP) STP | 17821 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 0.05 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Total pentachlorodibenzofuran (TSP) STP | 17827 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 0.05 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Total polynuclear hydrocarbons | 11104 | 091 | Intermittent | HI-VOL | PIPERONYL CHLORIDE | 0.2 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Total reduced sulfur | 43911 | 020 | Continuous | INSTRUMENTAL | PULSED FLUORESCENT | 0.02 | -0.02 | 3 | R | Parts per million | ||||
| Total reduced sulfur | 43911 | 039 | Continuous | INSTRUMENTAL | ULTRA VIOLET STIMULATED FLUORESCNC | 0.02 | -0.02 | 3 | R | Parts per million | ||||
| Total reduced sulfur | 43911 | 060 | Continuous | INSTRUMENTAL | PULSED FLUORESCENT | 0.02 | -0.02 | 5.0 | 3 | R | Parts per million | |||
| Total sulfur | 42269 | 009 | Continuous | INSTRUMENTAL | PULSED FLUORESCENT | 0.02 | -0.02 | 3 | R | Parts per million | ||||
| Total sulfur | 42269 | 016 | Continuous | INSTRUMENTAL | FLAME PHOTOMETRIC | 0.02 | -0.02 | 2 | R | Parts per million | ||||
| Total sulfur | 42269 | 039 | Continuous | INSTRUMENTAL | ULTRA VIOLET STIMULATED FLUORESCNC | 0.02 | -0.02 | 3 | R | Parts per million | ||||
| Total sulfur | 42269 | 061 | Continuous | INSTRUMENTAL | UV FLUORESCENCE | 0.02 | -0.02 | 3 | R | Parts per million | ||||
| Total tetachlorodibenzo-p-dioxin (TSP) STP | 17820 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 0.05 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Total tetrachlorodibenzofuran (TSP) STP | 17826 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 0.05 | 0.0 | 2 | R | Pg/cubic meter(25 C) | ||||
| Trans-Crotonaldehyde | 43516 | 102 | Intermittent | Cartridge-DNPH-on-Silica | HPLC Ultraviolet Absorption | 0.052 | -0.052 | 3 | R | Parts per billion Carbon | ||||
| Trans-Crotonaldehyde | 43516 | 114 | Intermittent | CARTRIDGE-DNPH-SILICA-SEP-PAK | HPLC-PHOTODIODE ARRAY | 0.085 | -0.085 | 2 | R | Parts per billion Carbon | ||||
| Trans-Crotonaldehyde | 43516 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Trans-Crotonaldehyde | 43516 | 130 | Intermittent | DNPH-COATED CARTRIDGE | HPLC (TO-14) | 0.88 | -0.88 | 1 | R | Parts per billion Carbon | ||||
| Trans-Crotonaldehyde | 43516 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Trans-Crotonaldehyde | 43516 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Trans-Crotonaldehyde | 43516 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Trans-Crotonaldehyde | 43516 | 156 | Intermittent | Cartridge DNPH on Silica, Heated O3 Denuder | HPLC Photo Diode Array | 0.3 | -0.3 | 1 | R | Parts per billion Carbon | ||||
| Trans-Crotonaldehyde | 43516 | 165 | Intermittent | ATEC 2400 W/Waters Silica DNPH | HP LC-1050 W/Diode Array Detector | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| Trans-Crotonaldehyde | 43516 | 166 | Intermittent | ATEC 2400 W/Waters Silica DNPH | TO-11 Dionex DX-300 Ion Chrmtg | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| Trans-Crotonaldehyde | 43516 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Trans-Crotonaldehyde | 43516 | 179 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | Liquid Chromatography w/diode array detection | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Trans-Crotonaldehyde | 43516 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Trichlorobenzene (TSP) STP | 17801 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 10.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Trichlorobiphenyl (TSP) STP | 17811 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 2.0 | 0.0 | 0 | R | Pg/cubic meter(25 C) | ||||
| Trichloroethylene | 43824 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 3.4 | -3.4 | 0 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.008 | -0.008 | 2 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.02 | -0.02 | 1 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 105 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.4 | -0.4 | 1 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.38 | -0.38 | 1 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 107 | Intermittent | TEDLAR-BAG-24-HR-SAMPLE | GC - ELECTRON CAPTURE DETECTOR | 0.04 | -0.04 | 3 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.04 | -0.04 | 1 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 115 | Intermittent | TENAX TRAP AC PUMP | HEAT DESORPTION GC MASS SPEC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.04 | -0.04 | 3 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 117 | Intermittent | TENAX SORBENT CARTRIDGE | GC/MS | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 118 | Intermittent | TENAX SORBENT CARTRIDGE | GC-FID/ECD | 0.02 | -0.02 | 3 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 121 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/ELECTRON;GC ECD | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.6 | -0.6 | 2 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 151 | Intermittent | 6L PRESSURIZED CANISTER | CAPILLARY GC-ECD/PID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 168 | Intermittent | 6L PRESSURIZED CANISTER | PACKED COLUMN GC - ECD/PID | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 169 | Intermittent | TEDLAR BAG | PACKED COLUMN GC - ECD/PID | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.04 | -0.04 | 3 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.16 | -0.16 | 2 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichloroethylene | 43824 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichloroethylene | 43824 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichloroethylene | 43824 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichloroethylene | 43824 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichloroethylene | 43824 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichloroethylene | 43824 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichloroethylene | 43824 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichloroethylene | 43824 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichloroethylene | 43824 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichloroethylene | 43824 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichloroethylene | 43824 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichloroethylene | 43824 | 906 | Intermittent | SKC Pump Charcoal Tube | GC/FID NIOSH 1022 | 1.57 | -1.57 | 2 | R | Parts per billion Carbon | ||||
| Trichloroethylene | 43824 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.19 | -0.19 | 2 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 105 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 1 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 121 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/ELECTRON;GC ECD | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.033 | -0.033 | 2 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/MS/FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.4 | -0.4 | 2 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.05 | -0.05 | 2 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.02 | -0.02 | 3 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.07 | -0.07 | 2 | R | Parts per billion Carbon | ||||
| Trichlorofluoromethane | 43811 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichlorofluoromethane | 43811 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichlorofluoromethane | 43811 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichlorofluoromethane | 43811 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichlorofluoromethane | 43811 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichlorofluoromethane | 43811 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichlorofluoromethane | 43811 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichlorofluoromethane | 43811 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichlorofluoromethane | 43811 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichlorofluoromethane | 43811 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichlorofluoromethane | 43811 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichlorofluoromethane | 43811 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Trichlorophenol (TSP) STP | 17806 | 101 | Intermittent | HI-VOL/PUF | GC-MS | 10.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Tridecanal | 43526 | 102 | Continuous | Cartridge-DNPH-on silica | HPLC Ultraviolet Absorption | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Tridecene | 43142 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.85 | -0.85 | 2 | R | Parts per billion Carbon | ||||
| Tridecene | 43142 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Tridecene | 43142 | 124 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| Tridecene | 43142 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Tungsten (TSP) STP | 12178 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Tungsten (TSP) STP | 12178 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Tungsten PM2.5 LC | 88186 | 811 | Intermittent | Met One SASS Teflon | Energy Dispersive XRF | 0.0138 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Tungsten PM2.5 LC | 88186 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00554 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Tungsten PM2.5 LC | 88186 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00554 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Tungsten PM2.5 LC | 88186 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00554 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Tungsten PM2.5 LC | 88186 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00554 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Tungsten PM2.5 LC | 88186 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00554 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Tungsten PM2.5 LC | 88186 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00554 | 3 | R | Micrograms/cubic meter (LC) | |||||
| UV Carbon PM 2.5 at 375 nm | 88366 | 875 | Continuous | Met One BC-1050 Black Carbon Monitor | Optical Absorption | 0.002 | -1.0 | 1000.0 | 4 | Micrograms/cubic meter (LC) | ||||
| UV Carbon PM2.5 STP | 84314 | 866 | Continuous | Magee Scientific AE21ER Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| UV Carbon PM2.5 STP | 84314 | 867 | Continuous | Magee Scientific AE21HS Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| UV Carbon PM2.5 STP | 84314 | 876 | Continuous | Magee Scientific AE22ER Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| UV Carbon PM2.5 STP | 84314 | 877 | Continuous | Magee Scientific AE22HS Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| UV Carbon PM2.5 STP | 84314 | 894 | Continuous | Magee Scientific TAPI M633 Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| UV Carbon PM2.5 at 370 nm | 88314 | 866 | Continuous | Magee AE21ER Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (LC) | ||||
| UV Carbon PM2.5 at 370 nm | 88314 | 867 | Continuous | Magee AE21HS Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (LC) | ||||
| UV Carbon PM2.5 at 370 nm | 88314 | 875 | Continuous | Met One BC-1050 Black Carbon Monitor | Optical Absorption | 2.0 | 2 | R | Micrograms/cubic meter (LC) | |||||
| UV Carbon PM2.5 at 370 nm | 88314 | 876 | Continuous | Magee AE22ER Aethalometer | Optical absorpton | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (LC) | ||||
| UV Carbon PM2.5 at 370 nm | 88314 | 877 | Continuous | Magee AE22HS Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (LC) | ||||
| UV Carbon PM2.5 at 370 nm | 88314 | 878 | Continuous | Met One BC-1054 Black Carbon Monitor | Optical Absorption | 0.1 | 2 | R | Micrograms/cubic meter (LC) | |||||
| UV Carbon PM2.5 at 370 nm | 88314 | 879 | Continuous | Met One BC-1060 Portable | Optical Absorption | 0.1 | 2 | R | Micrograms/cubic meter (LC) | |||||
| UV Carbon PM2.5 at 370 nm | 88314 | 894 | Continuous | Magee AE33/AE36 TAPI M633 Aethalometer | Optical absorption | 0.2 | -1.9 | 2 | R | Micrograms/cubic meter (LC) | ||||
| UV Carbon at 370 nm (TSP) | 14314 | 880 | Continuous | Met One C-12 at 1Lpm | Optical Absorption | 0.1 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Ultraviolet radiation | 63302 | 011 | Continuous | INSTRUMENTAL | UV RADIOMETER (PHOTOMETER) | 0.01 | 0.0 | 2 | R | Langleys/minute | ||||
| Ultraviolet radiation (type B) | 63304 | 011 | Continuous | INSTRUMENTAL | PYRANOMETER (AVERAGE HOURLY) | 2.0e-05 | 0.0 | 5 | R | Watts/sq meter | ||||
| Undecanal | 43527 | 102 | Continuous | Cartridge-DNPH-on silica | HPLC Ultraviolet Absorption | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Unidentified VOC | 43131 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Unidentified VOC | 43131 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Unidentified VOC | 43131 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Unidentified VOC | 43131 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Unidentified VOC | 43131 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Unidentified VOC | 43131 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.74 | -0.74 | 2 | R | Parts per billion Carbon | ||||
| Unidentified VOC | 43131 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Unidentified VOC | 43131 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Uranium (TSP) STP | 12179 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Uranium PM10 LC | 85179 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 0.001 | 0.0 | 3 | R | Nanograms/cubic meter (LC) | ||||
| Uranium PM10 LC | 85179 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 0.001 | 5 | R | Nanograms/cubic meter (LC) | |||||
| Uranium PM10 STP | 82179 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Uranium PM10-2.5 STP | 83179 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Uranium PM2.5 LC | 88179 | 811 | Intermittent | Met One SASS Teflon | Energy Dispersive XRF | 0.00217 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Uranium PM2.5 STP | 84179 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Valeraldehyde | 43518 | 102 | Intermittent | Cartridge-DNPH-on silica | HPLC Ultraviolet Absorption | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Valeraldehyde | 43518 | 114 | Intermittent | CARTRIDGE-DNPH-SILICA-SEP-PAK | HPLC-PHOTODIODE ARRAY | 0.085 | -0.085 | 2 | R | Parts per billion Carbon | ||||
| Valeraldehyde | 43518 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Valeraldehyde | 43518 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Valeraldehyde | 43518 | 130 | Intermittent | DNPH-COATED CARTRIDGE | HPLC (TO-14) | 2.85 | -2.85 | 1 | R | Parts per billion Carbon | ||||
| Valeraldehyde | 43518 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Valeraldehyde | 43518 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Valeraldehyde | 43518 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Valeraldehyde | 43518 | 156 | Intermittent | Cartridge DNPH on Silica, Heated O3 Denuder | HPLC Photo Diode Array | 0.315 | -0.315 | 1 | R | Parts per billion Carbon | ||||
| Valeraldehyde | 43518 | 165 | Intermittent | ATEC 2400 W/Waters Silica DNPH | HP LC-1050 W/Diode Array Detector | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| Valeraldehyde | 43518 | 166 | Intermittent | ATEC 2400 W/Waters Silica DNPH | TO-11 Dionex DX-300 Ion Chrmtg | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| Valeraldehyde | 43518 | 179 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | Liquid Chromatography w/diode array detection | 0.05 | -0.05 | 2 | R | Parts per billion Carbon | ||||
| Valeraldehyde | 43518 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Vanadium (TSP) LC | 14164 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0025 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Vanadium (TSP) LC | 14164 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 3.0e-05 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Vanadium (TSP) LC | 14164 | 310 | Intermittent | LO-VOL | ICP-MS | 0.01 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Vanadium (TSP) LC | 14164 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.29 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Vanadium (TSP) STP | 12164 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0109 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Vanadium (TSP) STP | 12164 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.003 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Vanadium (TSP) STP | 12164 | 091 | Intermittent | HI-VOL | EMISSION SPECTRA MUFFLE FURNACE | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Vanadium (TSP) STP | 12164 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Vanadium (TSP) STP | 12164 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Vanadium (TSP) STP | 12164 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Vanadium (TSP) STP | 12164 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 3.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Vanadium (TSP) STP | 12164 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Vanadium (TSP) STP | 12164 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Vanadium (TSP) STP | 12164 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Vanadium (TSP) STP | 12164 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.01 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Vanadium (TSP) STP | 12164 | 905 | Intermittent | SKC Pump Filter | ICP/AES NIOSH 7300 | 0.35 | 2 | R | Micrograms/cubic meter (25 C) | |||||
| Vanadium (TSP) STP | 12164 | 910 | Intermittent | SKC Pump Filter | MOd NISH 7300/6010B SOP 1813 | 0.0308 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Vanadium (precip) | 65164 | 085 | Intermittent | ANDERSON RAINFALL BUCKET | EMISSION SPECTRA ICAP | 0.005 | 0.0 | 3 | R | Milligrams/liter | ||||
| Vanadium - 51 (TSP) | 11362 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.0014 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Vanadium PM10 LC | 85164 | 110 | Intermittent | Hi-Vol SA/GMW1200 | ICP/MS | 0.04 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Vanadium PM10 LC | 85164 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 4.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Vanadium PM10 LC | 85164 | 820 | Continuous | Cooper Environmental Services model Xact 620 | X-ray fluorescence (XRF) | 0.137 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Vanadium PM10 LC | 85164 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 0.6 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Vanadium PM10 LC | 85164 | 907 | Intermittent | R & P Partisol 2025 Teflon | ICPMS | 0.26 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Vanadium PM10 STP | 82164 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | |||||
| Vanadium PM10 STP | 82164 | 096 | Intermittent | Med-Vol SA254 TFE | X-ray fluorescence | 100.0 | 0.0 | -2 | R | Nanograms/cubic meter (25 C) | ||||
| Vanadium PM10 STP | 82164 | 105 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Vanadium PM10 STP | 82164 | 106 | Intermittent | HI-VOL-WEDDING-INLET | EMISSION SPECTRA ICAP | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Vanadium PM10 STP | 82164 | 107 | Intermittent | HI-VOL-SA/GMW-321B | EMISSION SPECTRA ICAP | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Vanadium PM10 STP | 82164 | 109 | Intermittent | Hi Vol SA/GMW 321B | ICP/MS | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Vanadium PM10 STP | 82164 | 201 | Intermittent | R&P Model 2000 PM10 Quartz | ICP/MS | 0.02 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Vanadium PM10 STP | 82164 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 4.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Vanadium PM10 STP | 82164 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 0.09 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Vanadium PM10 STP | 82164 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 0.09 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Vanadium PM10 STP | 82164 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 0.09 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Vanadium PM10-2.5 LC | 86164 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.0006 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Vanadium PM10-2.5 STP | 83164 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.004 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Vanadium PM2.5 LC | 88164 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Vanadium PM2.5 LC | 88164 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Vanadium PM2.5 LC | 88164 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Vanadium PM2.5 LC | 88164 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.0015 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Vanadium PM2.5 LC | 88164 | 820 | Continuous | Cooper Environmental Service(CES) XACT 625 | X-ray flouroescence (XRF) Instrumentation | 0.29 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Vanadium PM2.5 LC | 88164 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.0006 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Vanadium PM2.5 LC | 88164 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.0006 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Vanadium PM2.5 LC | 88164 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.0006 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Vanadium PM2.5 LC | 88164 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.0006 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Vanadium PM2.5 LC | 88164 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.0006 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Vanadium PM2.5 LC | 88164 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.0006 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Vanadium PM2.5 LC | 88164 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.0006 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Vanadium PM2.5 LC | 88164 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Vanadium PM2.5 LC | 88164 | 908 | Intermittent | R & P Partisol 2000 | X-Ray Fluorescence | 0.0002 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Vanadium PM2.5 STP | 84164 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.004 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Vert Wind Direction | 61112 | 050 | Continuous | INSTRUMENTAL | ELECTRONIC OR MACHINE AVERAGE | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Vert Wind Direction | 61112 | 051 | Continuous | INSTRUMENTAL | ELEC. OR MACH. AVG. LEVEL 1 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Vert Wind Direction | 61112 | 052 | Continuous | INSTRUMENTAL | ELEC. OR MACH. AVG. LEVEL 2 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Vert Wind Direction | 61112 | 053 | Continuous | INSTRUMENTAL | ELEC. OR MACH. AVG. LEVEL 3 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Vert Wind Direction | 61112 | 066 | Continuous | Instrumental | RM Young Ultrasonic Anemometer Model 81000 | 1.0 | -60.0 | 60.0 | 0 | R | Degrees Compass | |||
| Vertical Wind Speed | 61109 | 020 | Continuous | Instrumental | Electronic or machine average | -20.0 | -20.0 | 1 | R | Knots | ||||
| Vertical Wind Speed | 61109 | 021 | Continuous | Instrumental | Electronic or machine average level 1 | -20.0 | -20.0 | 1 | R | Knots | ||||
| Vertical Wind Speed | 61109 | 022 | Continuous | Instrumental | Electronic or machine average level 2 | -20.0 | -20.0 | 1 | R | Knots | ||||
| Vertical Wind Speed | 61109 | 023 | Continuous | Instrumental | Electronic or machine average level 3 | -20.0 | -20.0 | 1 | R | Knots | ||||
| Vertical Wind Speed | 61109 | 066 | Continuous | Instrumental | RM Young Ultrasonic Anemometer Model 81000 | -20.0 | -20.0 | 1 | R | Knots | ||||
| Vinyl acetate | 43447 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Vinyl acetate | 43447 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Vinyl acetate | 43447 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Vinyl acetate | 43447 | 113 | Intermittent | SS-Canister_Pressurized | Capillary GC ITD Mass Spectro | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Vinyl acetate | 43447 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Vinyl acetate | 43447 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Vinyl acetate | 43447 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Vinyl acetate | 43447 | 150 | Intermittent | SS 6L - PRESSURIZED CANISTER | CRYOGENIC PRECON:GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Vinyl acetate | 43447 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Vinyl acetate | 43447 | 176 | Intermittent | 6L Subatm SS Canister | Entech Precon GC/MS | 0.048 | -0.048 | 2 | R | Parts per billion Carbon | ||||
| Vinyl acetate | 43447 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.04 | -0.04 | 3 | R | Parts per billion Carbon | ||||
| Vinyl acetate | 43447 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Vinyl acetate | 43447 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Vinyl bromide | 43861 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Vinyl bromide | 43861 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Vinyl bromide | 43861 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Vinyl bromide | 43861 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Vinyl bromide | 43861 | 150 | Intermittent | SS 6-L Pressurized Canister | Cryogenic Precon: GC/MS | 0.1 | 1 | R | Parts per billion Carbon | |||||
| Vinyl bromide | 43861 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Vinyl bromide | 43861 | 176 | Intermittent | 6L Subatm SS Canister | Entech Precon GC/MS | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 7.0 | -7.0 | 0 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.02 | -0.02 | 1 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.8 | -0.8 | 1 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESSURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.8 | -0.8 | 1 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.033 | -0.033 | 2 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.45 | -0.45 | 2 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 169 | Intermittent | TEDLAR BAG | PACKED COLUMN GC - ECD/PID | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 170 | Intermittent | Adsorption tube Carbotrap 300 (Supelco) | Thermal Desorption GC/MSD | 0.16 | -0.16 | 2 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.04 | -0.04 | 3 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.18 | -0.18 | 2 | R | Parts per billion Carbon | ||||
| Vinyl chloride | 43860 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Vinyl chloride | 43860 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Vinyl chloride | 43860 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Vinyl chloride | 43860 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Vinyl chloride | 43860 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Vinyl chloride | 43860 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Vinyl chloride | 43860 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Vinyl chloride | 43860 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Vinyl chloride | 43860 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Vinyl chloride | 43860 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Vinyl chloride | 43860 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Vinyl chloride | 43860 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| Virtual Temperature | 62102 | 066 | Continuous | RM Young 81000 | Sonic Temperature | -60.0 | 1 | R | Degrees Fahrenheit | |||||
| Virtual Temperature | 62102 | 128 | Continuous | RADAR PROFILER | RADAR PROFILER | -60.0 | -60.0 | 150.0 | 0 | R | Degrees Fahrenheit | |||
| Visibility | 63101 | 011 | Continuous | INSTRUMENTAL | FOG VISIOMETER | 0.1 | 0.0 | 1 | R | Miles (visibility) | ||||
| Visibility | 63101 | 012 | Intermittent | VIDEO OR STILL CAMERA | MANUAL READING | 0.1 | 0.0 | 1 | R | Miles (visibility) | ||||
| Visibility | 63101 | 013 | Intermittent | Instrumental Belfort 6230-A | Forward Scatter Principal | 0.1 | 0.0 | 1 | R | Miles (visibility) | ||||
| Volatile Nitrate PM2.5 LC | 88309 | 832 | Intermittent | URG MASS400 Nylon WINS | Ion Chromatography | 0.003 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Volatile Nitrate PM2.5 LC | 88309 | 872 | Intermittent | URG MASS400 Nylon VCSS | Ion Chromatography | 0.003 | 2 | R | Micrograms/cubic meter (LC) | |||||
| Volatile Nitrate PM2.5 LC | 88309 | 882 | Intermittent | Model 2025 Dichot Sequential Nylon | Ion Chromatography | 0.003 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Volatile Nitrate PM2.5 LC | 88309 | 893 | Intermittent | Model 2025 PM2.5 Sequential Teflon Nylon | Ion Chromatography | 0.0006 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Volatile nitrate PM10 LC | 85309 | 887 | Intermittent | Model 2025 PM10 Sequential Nylon | Ion Chromatography | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Volatile nitrate PM10-2.5 LC | 86309 | 882 | Intermittent | Model 2025 Dichot Sequential Nylon | Ion Chromatography | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Volatile organic compounds | 43104 | 001 | Intermittent | SS CANISTER SUBAMBIENT PRESSURE | VARIAN GC ION TRAP SINGLE DETECTOR | 1.0 | -1.0 | 0 | R | Parts per billion Carbon | ||||
| Volume (precip) | 65301 | 081 | Intermittent | PRECIP | VOLUMETRIC | 0.01 | 0.0 | 2 | R | Millimeters (rainfall) | ||||
| Water Inso Ash (SP) | 21118 | 071 | Intermittent | BUCKET | GRAVIMETRIC (APCA) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Water Inso Ash (SP) | 21118 | 081 | Intermittent | BUCKET | GRAVIMETRIC (ASTM) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Water Insol Wt (SP) | 21115 | 051 | Intermittent | BUCKET | JACOBS METHOD | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Water Insol Wt (SP) | 21115 | 071 | Intermittent | BUCKET | GRAVIMETRIC (APCA) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Water Insol Wt (SP) | 21115 | 081 | Intermittent | BUCKET | GRAVIMETRIC (ASTM) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Water Sol Ash (SP) | 21117 | 071 | Intermittent | BUCKET | GRAVIMETRIC (APCA) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Water Sol Ash (SP) | 21117 | 081 | Intermittent | BUCKET | GRAVIMETRIC (ASTM) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Water Sol Weight (SP) | 21114 | 071 | Intermittent | BUCKET | GRAVIMETRIC (APCA) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Water Sol Weight (SP) | 21114 | 081 | Intermittent | BUCKET | GRAVIMETRIC (ASTM) | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Wind Direction - Resultant | 61104 | 020 | Continuous | INSTRUMENTAL | VECTOR SUMMATION | 0.1 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Wind Direction - Resultant | 61104 | 021 | Continuous | INSTRUMENTAL | VECTOR SUMMATION LEVEL 1 | 0.1 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Wind Direction - Resultant | 61104 | 022 | Continuous | INSTRUMENTAL | VECTOR SUMMATION LEVEL 2 | 0.1 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Wind Direction - Resultant | 61104 | 023 | Continuous | INSTRUMENTAL | VECTOR SUMMATION LEVEL 3 | 0.1 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Wind Direction - Resultant | 61104 | 024 | Continuous | INSTRUMENTAL | VECTOR SUMMATION LEVEL 4 | 0.1 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Wind Direction - Resultant | 61104 | 060 | Continuous | Instrumental | Vaisala WS425 | 0.1 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Wind Direction - Resultant | 61104 | 061 | Continuous | Instrumental | Met One Sonic Anemometer Model 50.5 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Resultant | 61104 | 063 | Continuous | Instrumental | Climatronics | 0.1 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Wind Direction - Resultant | 61104 | 064 | Continuous | Instrumental | AutoMet | 0.1 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Wind Direction - Resultant | 61104 | 065 | Continuous | Instrumental | RM Young Model 05305 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Resultant | 61104 | 066 | Continuous | Instrumental | RM Young Ultrasonic Anemometer Model 81000 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Resultant | 61104 | 067 | Continuous | Instrumental | RM Young Model 05103 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Resultant | 61104 | 068 | Continuous | Instrumental | RM Young Ultrasonic Anemometer Model 86004 | 0.1 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Wind Direction - Resultant | 61104 | 069 | Continuous | Instrumental | Met One AIO2 Sonic Weather Sensor | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Resultant | 61104 | 071 | Continuous | Instrumental | Met One Sonic Anemometer Model 30.5 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Resultant | 61104 | 080 | Continuous | INSTRUMENTAL | VECTOR SUMMATION | 0.1 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Wind Direction - Resultant | 61104 | 081 | Continuous | INSTRUMENTAL | VECTOR SUMMATION LEVEL 1 | 0.1 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Wind Direction - Resultant | 61104 | 082 | Continuous | INSTRUMENTAL | VECTOR SUMMATION LEVEL 2 | 0.1 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Wind Direction - Resultant | 61104 | 083 | Continuous | INSTRUMENTAL | VECTOR SUMMATION LEVEL 3 | 0.1 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Wind Direction - Resultant | 61104 | 127 | Continuous | Instrumental | ACOUSTIC SOUNDER | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Resultant | 61104 | 128 | Continuous | RADAR PROFILER | RADAR PROFILER | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Resultant | 61104 | 129 | Continuous | Ultrasonic Wind sensor MD1425A | Vector Average Data Logger | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Resultant | 61104 | 130 | Continuous | RM Young Ultrasonic Wind Sensor | Vector Average Data Logger | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 020 | Continuous | INSTRUMENTAL | SPOT READING | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 021 | Continuous | INSTRUMENTAL | SPOT READING LEVEL 1 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 022 | Continuous | INSTRUMENTAL | SPOT READING LEVEL 2 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 023 | Continuous | INSTRUMENTAL | SPOT READING LEVEL 3 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 024 | Continuous | MODEL 425AH | ULTRA SONIC WIND SENSOR | 0.1 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 030 | Continuous | INSTRUMENTAL | TVA PREVAILING AVERAGE | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 031 | Continuous | INSTRUMENTAL | TVA PREVAILING AVERAGE LEVEL 1 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 032 | Continuous | INSTRUMENTAL | TVA PREVAILING AVERAGE LEVEL 2 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 033 | Continuous | INSTRUMENTAL | TVA PREVAILING AVERAGE LEVEL 3 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 034 | Continuous | INSTRUMENTAL | TVA PREVAILING AVERAGE LEVEL 4 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 040 | Continuous | INSTRUMENTAL | VISUAL AVERAGE | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 041 | Continuous | INSTRUMENTAL | VISUAL AVERAGE LEVEL 1 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 042 | Continuous | INSTRUMENTAL | VISUAL AVERAGE LEVEL 2 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 043 | Continuous | INSTRUMENTAL | VISUAL AVERAGE LEVEL 3 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 050 | Continuous | INSTRUMENTAL | ELECTRONIC OR MACHINE AVERAGE | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 051 | Continuous | INSTRUMENTAL | ELEC. OR MACH. AVG. LEVEL 1 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 052 | Continuous | INSTRUMENTAL | ELEC. OR MACH. AVG. LEVEL 2 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 053 | Continuous | INSTRUMENTAL | ELEC. OR MACH. AVG. LEVEL 3 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 060 | Continuous | Instrumental | Vaisala 425 AH Sonic Sensor | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 061 | Continuous | Instrumental | Met One Sonic Anemometer Model 50.5 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 062 | Continuous | Instrumental | RM Young Sonic Anemometer 85004 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 063 | Continuous | Instrumental | Climatronics | 1.0 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 064 | Continuous | Instrumental | AutoMet | 1.0 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 065 | Continuous | Instrumental | RM Young Model 05305 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 066 | Continuous | Instrumental | RM Young Ultrasonic Anemometer Model 81000 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 068 | Continuous | Instrumental | RM Young Ultrasonic Anemometer Model 86004 | 0.1 | 0.0 | 360.0 | 1 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 069 | Continuous | Instrumental | Met One AIO2 Sonic Weather Sensor | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Direction - Scalar | 61102 | 071 | Continuous | Instrumental | Met One Sonic Anemometer Model 30.5 | 1.0 | 0.0 | 360.0 | 0 | R | Degrees Compass | |||
| Wind Speed - Resultant | 61103 | 020 | Continuous | INSTRUMENTAL | VECTOR SUMMATION | 0.1 | 0.0 | 1 | R | Knots | ||||
| Wind Speed - Resultant | 61103 | 021 | Continuous | INSTRUMENTAL | VECTOR SUMMATION LEVEL 1 | 0.1 | 0.0 | 1 | R | Knots | ||||
| Wind Speed - Resultant | 61103 | 022 | Continuous | INSTRUMENTAL | VECTOR SUMMATION LEVEL 2 | 0.1 | 0.0 | 1 | R | Knots | ||||
| Wind Speed - Resultant | 61103 | 023 | Continuous | INSTRUMENTAL | VECTOR SUMMATION LEVEL 3 | 0.1 | 0.0 | 1 | R | Knots | ||||
| Wind Speed - Resultant | 61103 | 024 | Continuous | INSTRUMENTAL | VECTOR SUMMATION LEVEL 4 | 0.1 | 0.0 | 1 | R | Knots | ||||
| Wind Speed - Resultant | 61103 | 025 | Continuous | Instrumental | VECTOR SUMMATION LEVEL 4 | 0.1 | 1 | R | Knots | |||||
| Wind Speed - Resultant | 61103 | 060 | Continuous | Instrumental | Vaisala WS425 | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Resultant | 61103 | 061 | Continuous | Instrumental | Met One Sonic Anemometer Model 50.5 | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Resultant | 61103 | 063 | Continuous | Instrumental | Climatronics | 0.1 | 0.0 | 1 | R | Knots | ||||
| Wind Speed - Resultant | 61103 | 064 | Continuous | Instrumental | AutoMet | 0.1 | 0.0 | 1 | R | Knots | ||||
| Wind Speed - Resultant | 61103 | 065 | Continuous | Instrumental | RM Young Model 05305 | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Resultant | 61103 | 066 | Continuous | Instrumental | RM Young Ultrasonic Anemometer Model 81000 | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Resultant | 61103 | 067 | Continuous | Instrumental | RM Young Model 05103 | 0.1 | 0.0 | 200.0 | 1 | R | Knots | |||
| Wind Speed - Resultant | 61103 | 068 | Continuous | Instrumental | RM Young Ultrasonic Anemometer Model 86004 | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Resultant | 61103 | 069 | Continuous | Instrumental | Met One AIO2 Sonic Weather Sensor | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Resultant | 61103 | 071 | Continuous | Instrumental | Met One Sonic Anemometer Model 30.5 | 0.1 | 0.0 | 117.0 | 1 | R | Knots | |||
| Wind Speed - Resultant | 61103 | 080 | Continuous | INSTRUMENTAL | VECTOR SUMMATION | 0.1 | 0.0 | 1 | R | Knots | ||||
| Wind Speed - Resultant | 61103 | 081 | Continuous | INSTRUMENTAL | VECTOR SUMMATION LEVEL 1 | 0.1 | 0.0 | 1 | R | Knots | ||||
| Wind Speed - Resultant | 61103 | 082 | Continuous | INSTRUMENTAL | VECTOR SUMMATION LEVEL 2 | 0.1 | 0.0 | 1 | R | Knots | ||||
| Wind Speed - Resultant | 61103 | 083 | Continuous | INSTRUMENTAL | VECTOR SUMMATION LEVEL 3 | 0.1 | 0.0 | 1 | R | Knots | ||||
| Wind Speed - Resultant | 61103 | 127 | Continuous | INSTRUMENTAL | ACOUSTIC SOUNDER | 0.1 | 0.0 | 1 | R | Knots | ||||
| Wind Speed - Resultant | 61103 | 128 | Continuous | INSTRUMENTAL | RADAR PROFILER | 0.1 | 0.0 | 1 | R | Knots | ||||
| Wind Speed - Resultant | 61103 | 129 | Continuous | Ultrasonic Wind Sensor MD1425A | Vector Average Data Logger | 0.1 | 0.0 | 1 | R | Knots | ||||
| Wind Speed - Resultant | 61103 | 130 | Continuous | RM Young Ultrasonic Wind Sensor | Vector Average Data Logger | 0.1 | 0.0 | 136.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 020 | Continuous | INSTRUMENTAL | SPOT READING | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 021 | Continuous | INSTRUMENTAL | SPOT READING LEVEL 1 | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 022 | Continuous | INSTRUMENTAL | SPOT READING LEVEL 2 | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 023 | Continuous | INSTRUMENTAL | SPOT READING LEVEL 3 | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 024 | Continuous | MODEL 425AH | ULTRA SONIC WIND SENSOR | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 030 | Continuous | INSTRUMENTAL | TVA ARITHMETIC AVERAGE | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 031 | Continuous | INSTRUMENTAL | TVA ARITHMETIC AVERAGE LEVEL 1 | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 032 | Continuous | INSTRUMENTAL | TVA ARITHMETIC AVERAGE LEVEL 2 | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 033 | Continuous | INSTRUMENTAL | TVA ARITHMETIC AVERAGE LEVEL 3 | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 034 | Continuous | INSTRUMENTAL | TVA ARITHMETIC AVERAGE LEVEL 4 | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 040 | Continuous | INSTRUMENTAL | VISUAL AVERAGE | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 041 | Continuous | INSTRUMENTAL | VISUAL AVERAGE LEVEL 1 | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 042 | Continuous | INSTRUMENTAL | VISUAL AVERAGE LEVEL 2 | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 043 | Continuous | INSTRUMENTAL | VISUAL AVERAGE LEVEL 3 | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 050 | Continuous | INSTRUMENTAL | ELECTRONIC OR MACHINE AVG. | 0.6 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 051 | Continuous | INSTRUMENTAL | ELEC. OR MACH. AVG. LEVEL 1 | 0.6 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 052 | Continuous | INSTRUMENTAL | ELEC. OR MACH. AVG. LEVEL 2 | 0.6 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 053 | Continuous | INSTRUMENTAL | ELEC. OR MACH. AVG. LEVEL 3 | 0.6 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 060 | Continuous | Instrumental | Vaisala 425 AH Sonic Sensor | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 061 | Continuous | Instrumental | Met One Sonic Anemometer Model 50.5 | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 062 | Continuous | Instrumental | RM Young Sonic Anemometer 85004 | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 063 | Continuous | Instrumental | Climatronics | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 064 | Continuous | Instrumental | AutoMet | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 065 | Continuous | Instrumental | RM Young Model 05305 | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 066 | Continuous | Instrumental | RM Young Ultrasonic Anemometer Model 81000 | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 068 | Continuous | Instrumental | RM Young Ultrasonic Anemometer Model 86004 | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 069 | Continuous | Instrumental | Met One AIO2 Sonic Weather Sensor | 0.1 | 0.0 | 90.0 | 1 | R | Knots | |||
| Wind Speed - Scalar | 61101 | 071 | Continuous | Instrumental | Met One Sonic Anemometer Model 30.5 | 0.1 | 0.0 | 117.0 | 1 | R | Knots | |||
| Windblown particulate | 11114 | 091 | Intermittent | STICKY PAPER | OPTICAL EVALUATION | 1.0 | 0.0 | 0 | R | Particles/sq millimeter/week | ||||
| Xylene(s) | 45102 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.32 | -0.32 | 2 | R | Parts per billion Carbon | ||||
| Xylene(s) | 45102 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 1.6 | -1.6 | 1 | R | Parts per billion Carbon | ||||
| Xylene(s) | 45102 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Xylene(s) | 45102 | 111 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-FID | 1.6 | -1.6 | 1 | R | Parts per billion Carbon | ||||
| Xylene(s) | 45102 | 115 | Intermittent | TENAX TRAP AC PUMP | HEAT DESORPTION GC MASS SPEC | 0.8 | -0.8 | 1 | R | Parts per billion Carbon | ||||
| Xylene(s) | 45102 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| Xylene(s) | 45102 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.24 | -0.24 | 2 | R | Parts per billion Carbon | ||||
| Yttrium (TSP) LC | 14183 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.541 | 3 | Micrograms/cubic meter (LC) | ||||||
| Yttrium (TSP) STP | 12183 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Yttrium (TSP) STP | 12183 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Yttrium (TSP) STP | 12183 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Yttrium (TSP) STP | 12183 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Yttrium PM10 LC | 85183 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Yttrium PM10 LC | 85183 | 820 | Continuous | Cooper Environmental Services (CES) XACT 625 | X-ray fluorescence (XRF) | 0.541 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Yttrium PM10 STP | 82183 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Yttrium PM10 STP | 82183 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Yttrium PM10 STP | 82183 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Yttrium PM10 STP | 82183 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 2.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Yttrium PM10-2.5 STP | 83183 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Yttrium PM2.5 LC | 88183 | 811 | Intermittent | Met One SASS Teflon | Energy Dispersive XRF | 0.00304 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Yttrium PM2.5 LC | 88183 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 0.541 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Yttrium PM2.5 LC | 88183 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00122 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Yttrium PM2.5 LC | 88183 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00122 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Yttrium PM2.5 LC | 88183 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00122 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Yttrium PM2.5 LC | 88183 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00122 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Yttrium PM2.5 LC | 88183 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00122 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Yttrium PM2.5 LC | 88183 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00122 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Yttrium PM2.5 STP | 84183 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Zinc (SP) | 22167 | 092 | Intermittent | BUCKET | ATOMIC ABSORPTION | 0.5 | 0.0 | 1 | R | Grams/sq meter/month | ||||
| Zinc (SP) | 22167 | 101 | Intermittent | NADP BUCKET: DRY SIDE | ATOMIC ABSORPTION | 3.0e-05 | 0.0 | 5 | R | Grams/sq meter/month | ||||
| Zinc (TSP) LC | 14167 | 045 | Intermittent | Hi-Vol | Emission Spectra ICAP (ICP-OES) EPA 1.03M HNO3/2.23M HCl sonicate 50 min at 100C | 0.0075 | 0.0 | 100.0 | 3 | R | Micrograms/cubic meter (LC) | |||
| Zinc (TSP) LC | 14167 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.003 | 0.0 | 3 | R | Micrograms/cubic meter (LC) | ||||
| Zinc (TSP) LC | 14167 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.0133 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Zinc (TSP) LC | 14167 | 310 | Intermittent | LO-VOL | ICP-MS | 0.005 | 5 | R | Micrograms/cubic meter (LC) | |||||
| Zinc (TSP) LC | 14167 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-ray fluorescence (XRF) | 0.231 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zinc (TSP) STP | 12167 | 089 | Intermittent | HI-VOL | ICP/MS W/QUARTZ FILTER | 0.2187 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Zinc (TSP) STP | 12167 | 090 | Intermittent | HI-VOL | EMISSION SPECTRA ICAP | 0.0133 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Zinc (TSP) STP | 12167 | 091 | Intermittent | HI-VOL | EMISSION SPECTRA MUFFLE FURNACE | 0.1 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Zinc (TSP) STP | 12167 | 092 | Intermittent | HI-VOL | ATOMIC ABSORPTION | 0.0002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Zinc (TSP) STP | 12167 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.1 | 0.0 | 1 | R | Micrograms/cubic meter (25 C) | ||||
| Zinc (TSP) STP | 12167 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Zinc (TSP) STP | 12167 | 108 | Intermittent | Hi-Vol | ICP Mass Spec w Glass Filters | 3.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Zinc (TSP) STP | 12167 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Zinc (TSP) STP | 12167 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Zinc (TSP) STP | 12167 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Zinc (TSP) STP | 12167 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Zinc (TSP) STP | 12167 | 905 | Intermittent | SKC Pump Filter | ICP/AES NIOSH 7300 | 1.74 | 2 | R | Micrograms/cubic meter (25 C) | |||||
| Zinc (TSP) STP | 12167 | 910 | Intermittent | SKC Pump Filter | MOd NISH 7300/6010B SOP 1813 | 0.0729 | 0.0 | 4 | R | Micrograms/cubic meter (25 C) | ||||
| Zinc (precip) | 65338 | 101 | Intermittent | NADP BUCKET: WET SIDE | ATOMIC ABSORPTION | 0.036 | 0.0 | 4 | R | Ug/sq meter/hour | ||||
| Zinc - 64 (TSP) | 11360 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.0014 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Zinc - 66 (TSP) | 11357 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Zinc PM10 LC | 85167 | 110 | Intermittent | Hi-Vol SA/GMW1200 | ICP/MS | 0.04 | 1 | R | Nanograms/cubic meter (LC) | |||||
| Zinc PM10 LC | 85167 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Zinc PM10 LC | 85167 | 820 | Continuous | Cooper Environmental Services model Xact 620 | X-ray fluorescence (XRF) | 0.043 | 3 | R | Nanograms/cubic meter (LC) | |||||
| Zinc PM10 LC | 85167 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 0.58 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Zinc PM10 LC | 85167 | 903 | Intermittent | BGI PQ200/200A | ICP-MS | 4.91 | 2 | R | Nanograms/cubic meter (LC) | |||||
| Zinc PM10 STP | 82167 | 092 | Intermittent | HI-VOL-SA/GMW-321-B | ATOMIC ABSORPTION | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Zinc PM10 STP | 82167 | 096 | Intermittent | Med-Vol SA254 TFE | X-ray fluorescence | 100.0 | 0.0 | -2 | R | Nanograms/cubic meter (25 C) | ||||
| Zinc PM10 STP | 82167 | 101 | Intermittent | HI-VOL-SA321A | ATOMIC ABSORPTION | 0.2 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Zinc PM10 STP | 82167 | 102 | Intermittent | HI-VOL-SA/GMW1200 | ATOMIC ABSORPTION | 0.2 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Zinc PM10 STP | 82167 | 103 | Intermittent | HI-VOL-WEDDING-INLET | ATOMIC ABSORPTION | 0.2 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Zinc PM10 STP | 82167 | 104 | Intermittent | HI-VOL-SA321A | EMISSION SPECTRA ICAP | 13.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Zinc PM10 STP | 82167 | 105 | Intermittent | HI-VOL-SA/GMW-1200 | EMISSION SPECTRA ICAP | 13.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Zinc PM10 STP | 82167 | 106 | Intermittent | HI-VOL-WEDDING-INLET | EMISSION SPECTRA ICAP | 13.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Zinc PM10 STP | 82167 | 107 | Intermittent | HI-VOL-SA/GMW-321B | EMISSION SPECTRA ICAP | 13.3 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Zinc PM10 STP | 82167 | 109 | Intermittent | Hi Vol SA/GMW 321B | ICP/MS | 0.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Zinc PM10 STP | 82167 | 110 | Intermittent | Hi-Vol SA/GMW1200 Quartz | ICP/MS | 0.04 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| Zinc PM10 STP | 82167 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Zinc PM10 STP | 82167 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 0.6 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Zinc PM10 STP | 82167 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 0.6 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Zinc PM10 STP | 82167 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 0.6 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| Zinc PM10-2.5 LC | 86167 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00058 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Zinc PM10-2.5 STP | 83167 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Zinc PM2.5 LC | 88167 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zinc PM2.5 LC | 88167 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zinc PM2.5 LC | 88167 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zinc PM2.5 LC | 88167 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.00145 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zinc PM2.5 LC | 88167 | 820 | Continuous | COOPER ENVIRONMENTAL SERVICES (CES) XACT 625 | X-RAY FLUORESCENCE XRF INSTRUMENTATION | 0.231 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zinc PM2.5 LC | 88167 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00058 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zinc PM2.5 LC | 88167 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00058 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zinc PM2.5 LC | 88167 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00058 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zinc PM2.5 LC | 88167 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00058 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zinc PM2.5 LC | 88167 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00058 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zinc PM2.5 LC | 88167 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00058 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zinc PM2.5 LC | 88167 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00058 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Zinc PM2.5 LC | 88167 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zinc PM2.5 STP | 84167 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Zirconium (TSP) STP | 12185 | 095 | Intermittent | HI-VOL | EMISSION SPECTRA (LOW TEMP ASH) | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Zirconium (TSP) STP | 12185 | 096 | Intermittent | HI-VOL | X-RAY FLUORESCENCE | 0.01 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| Zirconium (TSP) STP | 12185 | 114 | Intermittent | OR Med-Vol TSP Teflon | X-ray Fluorescence | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Zirconium (TSP) STP | 12185 | 115 | Intermittent | OR Med-Vol TSP Teflon | ICP/MS | 1.0e-05 | 0.0 | 5 | R | Micrograms/cubic meter (25 C) | ||||
| Zirconium (TSP) STP | 12185 | 304 | Intermittent | LO-VOL-XONTECH 920 or 924- TEFLON | X-RAY FLUORESCENCE | 0.002 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Zirconium (TSP) STP | 12185 | 305 | Intermittent | Lo-Vol-Xontech 920 or 924, Teflon | ICP/Mass Spectrometer | 0.005 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Zirconium PM10 LC | 85185 | 817 | Intermittent | R&P FRM PM2.5 mod for PM10 | X-ray Fluorescence | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (LC) | ||||
| Zirconium PM10 LC | 85185 | 889 | Intermittent | Model 2025 PM10 Sequential Teflon | Energy Dispersive XRF | 1.44 | 0.0 | 1 | R | Nanograms/cubic meter (LC) | ||||
| Zirconium PM10 STP | 82185 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 1.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Zirconium PM10 STP | 82185 | 304 | Intermittent | Hi-Vol-SA/GMW-1200 | X-Ray Fluorescence | 13.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Zirconium PM10 STP | 82185 | 305 | Intermittent | Hi-Vol-SA/GMW-321B | X-Ray Fluorescence | 13.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Zirconium PM10 STP | 82185 | 306 | Intermittent | Hi-Vol-Wedding Inlet | X-Ray Fluorescence | 13.0 | 0.0 | 0 | R | Nanograms/cubic meter (25 C) | ||||
| Zirconium PM10-2.5 LC | 86185 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00144 | 0.0 | 4 | R | Micrograms/cubic meter (LC) | ||||
| Zirconium PM10-2.5 STP | 83185 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| Zirconium PM2.5 LC | 88185 | 800 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zirconium PM2.5 LC | 88185 | 801 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 3.5 sq. cm. | X-Ray Fluorescence | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zirconium PM2.5 LC | 88185 | 802 | Intermittent | IMPROVE Module A with Cyclone Inlet-Teflon Filter, 2.2 sq. cm. | Proton Induced X-Ray Excitation | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zirconium PM2.5 LC | 88185 | 811 | Intermittent | Met One SASS/SuperSASS Teflon | Energy Dispersive XRF | 0.00359 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zirconium PM2.5 LC | 88185 | 821 | Intermittent | Andersen RAAS Teflon | Energy Dispersive XRF | 0.00144 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zirconium PM2.5 LC | 88185 | 831 | Intermittent | URG MASS400 Teflon WINS | Energy Dispersive XRF | 0.00144 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zirconium PM2.5 LC | 88185 | 841 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon | Energy Dispersive XRF | 0.00144 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zirconium PM2.5 LC | 88185 | 846 | Intermittent | R & P Model 2025 PM2.5 Sequential Teflon VSCC | Energy Dispersive XRF | 0.00144 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zirconium PM2.5 LC | 88185 | 851 | Intermittent | R&P MDL 2300 PM2.5 SEQ SPEC TEF | ENERGY DISPERSIVE XREF | 0.00144 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zirconium PM2.5 LC | 88185 | 871 | Intermittent | URG MASS400 Teflon VSCC | Energy Dispersive XRF | 0.00144 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zirconium PM2.5 LC | 88185 | 884 | Intermittent | Model 2025 Dichot Sequential Teflon | Energy Dispersive XRF | 0.00144 | 4 | R | Micrograms/cubic meter (LC) | |||||
| Zirconium PM2.5 LC | 88185 | 899 | Intermittent | No Method-None | None | 0.002 | 3 | R | Micrograms/cubic meter (LC) | |||||
| Zirconium PM2.5 STP | 84185 | 303 | Intermittent | LO-VOL-DICHOTOMOUS-SA246B-IN | X-RAY FLUORESCENCE | 0.001 | 0.0 | 3 | R | Micrograms/cubic meter (25 C) | ||||
| alpha.-Pinene | 43256 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| alpha.-Pinene | 43256 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| alpha.-Pinene | 43256 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| alpha.-Pinene | 43256 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| alpha.-Pinene | 43256 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| alpha.-Pinene | 43256 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| alpha.-Pinene | 43256 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| alpha.-Pinene | 43256 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| alpha.-Pinene | 43256 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| alpha.-Pinene | 43256 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| alpha.-Pinene | 43256 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| alpha.-Pinene | 43256 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| alpha.-Pinene | 43256 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| alpha.-Pinene | 43256 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.96 | -0.96 | 2 | R | Parts per billion Carbon | ||||
| alpha.-Pinene | 43256 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| alpha.-Pinene | 43256 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| alpha.-Pinene | 43256 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| alpha.-Pinene | 43256 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| alpha.-Pinene | 43256 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| alpha.-Pinene | 43256 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| alpha.-Pinene | 43256 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| alpha.-Pinene | 43256 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| alpha.-Pinene | 43256 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| alpha.-Pinene | 43256 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| alpha.-Pinene | 43256 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| alpha.-Pinene | 43256 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| alpha.-Pinene | 43256 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| alpha.-Pinene | 43256 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| alpha.-Pinene | 43256 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| alpha.-Pinene | 43256 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| alpha.-Pinene | 43256 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| beta.-Pinene | 43257 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| beta.-Pinene | 43257 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| beta.-Pinene | 43257 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| beta.-Pinene | 43257 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| beta.-Pinene | 43257 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| beta.-Pinene | 43257 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| beta.-Pinene | 43257 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| beta.-Pinene | 43257 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| beta.-Pinene | 43257 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| beta.-Pinene | 43257 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| beta.-Pinene | 43257 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| beta.-Pinene | 43257 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| beta.-Pinene | 43257 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| beta.-Pinene | 43257 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.87 | -0.87 | 2 | R | Parts per billion Carbon | ||||
| beta.-Pinene | 43257 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| beta.-Pinene | 43257 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| beta.-Pinene | 43257 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| beta.-Pinene | 43257 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| beta.-Pinene | 43257 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| beta.-Pinene | 43257 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| beta.-Pinene | 43257 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| beta.-Pinene | 43257 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| beta.-Pinene | 43257 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| beta.-Pinene | 43257 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| beta.-Pinene | 43257 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| beta.-Pinene | 43257 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| beta.-Pinene | 43257 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| beta.-Pinene | 43257 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| beta.-Pinene | 43257 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| beta.-Pinene | 43257 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| beta.-Pinene | 43257 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| beta.Pinene & 1,2,3- trimethylbenzene | 43189 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| bis (2-chloroethyl)ether (TSP) STP | 16767 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 35.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| bis (2-chloroethyl)ether (TSP) STP | 16767 | 117 | Intermittent | Hi Vol/PUF | GCMS TO-13 | 0.00016 | 0.0 | 5 | R | Nanograms/cubic meter (25 C) | ||||
| bis(2-chloroethoxy)methane (TSP) STP | 16768 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 34.7 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| bis(2-chloroisopropyl)ether (TSP) STP | 16769 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 27.8 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| bis(2-ethylhexyl)phthalate (TSP) STP | 16770 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 24.3 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| cis-1,2-Dichloroethene | 43839 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| cis-1,2-Dichloroethene | 43839 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.2 | -0.2 | 1 | R | Parts per billion Carbon | ||||
| cis-1,2-Dichloroethene | 43839 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| cis-1,2-Dichloroethene | 43839 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| cis-1,2-Dichloroethene | 43839 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| cis-1,2-Dichloroethene | 43839 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| cis-1,2-Dichloroethene | 43839 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| cis-1,2-Dichloroethene | 43839 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| cis-1,2-Dichloroethene | 43839 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-1,2-Dichloroethene | 43839 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| cis-1,2-Dichloroethene | 43839 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| cis-1,2-Dichloroethene | 43839 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.04 | -0.04 | 3 | R | Parts per billion Carbon | ||||
| cis-1,2-Dichloroethene | 43839 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.16 | -0.16 | 2 | R | Parts per billion Carbon | ||||
| cis-1,2-Dichloroethene | 43839 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-1,2-Dichloroethene | 43839 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-1,2-Dichloroethene | 43839 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-1,2-Dichloroethene | 43839 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-1,2-Dichloroethene | 43839 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-1,2-Dichloroethene | 43839 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-1,2-Dichloroethene | 43839 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-1,2-Dichloroethene | 43839 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-1,2-Dichloroethene | 43839 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-1,2-Dichloroethene | 43839 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-1,2-Dichloroethene | 43839 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-1,2-Dichloroethene | 43839 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-1,2-Dimethylcyclopentane | 43393 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| cis-1,3-Dichloropropene | 43831 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 6.0 | -6.0 | 0 | R | Parts per billion Carbon | ||||
| cis-1,3-Dichloropropene | 43831 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| cis-1,3-Dichloropropene | 43831 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.66 | -0.66 | 1 | R | Parts per billion Carbon | ||||
| cis-1,3-Dichloropropene | 43831 | 105 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| cis-1,3-Dichloropropene | 43831 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| cis-1,3-Dichloropropene | 43831 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.3 | -0.3 | 2 | R | Parts per billion Carbon | ||||
| cis-1,3-Dichloropropene | 43831 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.3 | -0.3 | 2 | R | Parts per billion Carbon | ||||
| cis-1,3-Dichloropropene | 43831 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| cis-1,3-Dichloropropene | 43831 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| cis-1,3-Dichloropropene | 43831 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| cis-1,3-Dichloropropene | 43831 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| cis-1,3-Dichloropropene | 43831 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-1,3-Dichloropropene | 43831 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| cis-1,3-Dichloropropene | 43831 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| cis-1,3-Dichloropropene | 43831 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-1,3-Dichloropropene | 43831 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.3 | -0.3 | 2 | R | Parts per billion Carbon | ||||
| cis-1,3-Dichloropropene | 43831 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| cis-1,3-Dichloropropene | 43831 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| cis-1,3-Dichloropropene | 43831 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| cis-1,3-Dichloropropene | 43831 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.09 | -0.09 | 2 | R | Parts per billion Carbon | ||||
| cis-1,3-Dichloropropene | 43831 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.06 | -0.06 | 3 | R | Parts per billion Carbon | ||||
| cis-1,3-Dichloropropene | 43831 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.27 | -0.27 | 2 | R | Parts per billion Carbon | ||||
| cis-1,3-Dichloropropene | 43831 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-1,3-Dichloropropene | 43831 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-1,3-Dichloropropene | 43831 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-1,3-Dichloropropene | 43831 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-1,3-Dichloropropene | 43831 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-1,3-Dichloropropene | 43831 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-1,3-Dichloropropene | 43831 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-1,3-Dichloropropene | 43831 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-1,3-Dichloropropene | 43831 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-1,3-Dichloropropene | 43831 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-1,3-Dichloropropene | 43831 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-1,3-Dichloropropene | 43831 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Butene | 43217 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Butene | 43217 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Butene | 43217 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Butene | 43217 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Butene | 43217 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Butene | 43217 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Butene | 43217 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| cis-2-Butene | 43217 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Butene | 43217 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| cis-2-Butene | 43217 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Butene | 43217 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Butene | 43217 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Butene | 43217 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| cis-2-Butene | 43217 | 141 | Continuous | IR Spectrometer | Spectra reference matching with PLS | 6.0 | -6.0 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Butene | 43217 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.52384 | -0.52384 | 4 | R | Parts per billion Carbon | ||||
| cis-2-Butene | 43217 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Butene | 43217 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| cis-2-Butene | 43217 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| cis-2-Butene | 43217 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| cis-2-Butene | 43217 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Butene | 43217 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Butene | 43217 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| cis-2-Butene | 43217 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Butene | 43217 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Butene | 43217 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Butene | 43217 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Butene | 43217 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Butene | 43217 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Butene | 43217 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Butene | 43217 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Butene | 43217 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Butene | 43217 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Butene | 43217 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Butene | 43217 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Butene | 43217 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Hexene | 43290 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Hexene | 43290 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Hexene | 43290 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Hexene | 43290 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Hexene | 43290 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Hexene | 43290 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Hexene | 43290 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| cis-2-Hexene | 43290 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Hexene | 43290 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| cis-2-Hexene | 43290 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Hexene | 43290 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Hexene | 43290 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Hexene | 43290 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.29 | -0.29 | 2 | R | Parts per billion Carbon | ||||
| cis-2-Hexene | 43290 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Hexene | 43290 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Hexene | 43290 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Hexene | 43290 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Hexene | 43290 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| cis-2-Hexene | 43290 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Hexene | 43290 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Hexene | 43290 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Hexene | 43290 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Hexene | 43290 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Hexene | 43290 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Hexene | 43290 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Hexene | 43290 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Hexene | 43290 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Hexene | 43290 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Hexene | 43290 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Hexene | 43290 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Pentene | 43227 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Pentene | 43227 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Pentene | 43227 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Pentene | 43227 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Pentene | 43227 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Pentene | 43227 | 124 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Pentene | 43227 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Pentene | 43227 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| cis-2-Pentene | 43227 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Pentene | 43227 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| cis-2-Pentene | 43227 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Pentene | 43227 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Pentene | 43227 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Pentene | 43227 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| cis-2-Pentene | 43227 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.57456 | -0.57456 | 4 | R | Parts per billion Carbon | ||||
| cis-2-Pentene | 43227 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Pentene | 43227 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.4 | -0.4 | 2 | R | Parts per billion Carbon | ||||
| cis-2-Pentene | 43227 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Pentene | 43227 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Pentene | 43227 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Pentene | 43227 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Pentene | 43227 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| cis-2-Pentene | 43227 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-2-Pentene | 43227 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Pentene | 43227 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Pentene | 43227 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Pentene | 43227 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Pentene | 43227 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Pentene | 43227 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Pentene | 43227 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Pentene | 43227 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Pentene | 43227 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Pentene | 43227 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Pentene | 43227 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Pentene | 43227 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| cis-2-Pentene & 2-methylpentane | 43349 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-3-Hexene | 43254 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-3-Hexene | 43254 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-4-Methyl-2-pentene | 43286 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis-Crotonaldehyde | 43520 | 102 | Continuous | Cartridge-DNPH-on silica | HPLC Ultraviolet Absorption | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| cis/trans-2-Butene | 43148 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis/trans-2-Hexene | 43149 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| cis/trans-2-Pentene | 43150 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| dichlorofluoromethane | 43360 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.026 | -0.026 | 3 | Parts per billion Carbon | |||||
| m & p-Tolualdehyde | 45506 | 102 | Intermittent | CARTRIDGE-DNPH-ON-SILICA | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m & p-Tolualdehyde | 45506 | 114 | Intermittent | CARTRIDGE-DNPH-SILICA-SEP-PAK | HPLC-PHOTODIODE ARRAY | 0.085 | -0.085 | 2 | R | Parts per billion Carbon | ||||
| m & p-Tolualdehyde | 45506 | 156 | Intermittent | Cartridge DNPH on Silica, Heated O3 Denuder | HPLC Photo Diode Array | 0.175 | -0.175 | 2 | R | Parts per billion Carbon | ||||
| m & p-Tolualdehyde | 45506 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m and p-Cresol (TSP) STP | 16786 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 42.2 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| m and p-Cresol (TSP) STP | 16786 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.0474 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| m and p-Cresol (TSP) STP | 16786 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| m(and p)-Ethyltoluene | 43379 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m(and p)-Ethyltoluene | 43379 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| m(and p)-Xylene & bromoform | 45111 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m(and p)-Xylene & bromoform | 45111 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Cresol (TSP) STP | 17302 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | 0.0 | 2 | Nanograms/cubic meter (25 C) | |||||
| m-Diethylbenzene | 45218 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Diethylbenzene | 45218 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Diethylbenzene | 45218 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Diethylbenzene | 45218 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Diethylbenzene | 45218 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| m-Diethylbenzene | 45218 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| m-Diethylbenzene | 45218 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| m-Diethylbenzene | 45218 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Diethylbenzene | 45218 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| m-Diethylbenzene | 45218 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Diethylbenzene | 45218 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| m-Diethylbenzene | 45218 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 2.19044 | -2.19044 | 4 | R | Parts per billion Carbon | ||||
| m-Diethylbenzene | 45218 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Diethylbenzene | 45218 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Diethylbenzene | 45218 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Diethylbenzene | 45218 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Diethylbenzene | 45218 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Diethylbenzene | 45218 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| m-Diethylbenzene | 45218 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Diethylbenzene | 45218 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Diethylbenzene | 45218 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Diethylbenzene | 45218 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Diethylbenzene | 45218 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Diethylbenzene | 45218 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Diethylbenzene | 45218 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Diethylbenzene | 45218 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Diethylbenzene | 45218 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Diethylbenzene | 45218 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Diethylbenzene | 45218 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Diethylbenzene | 45218 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Diethylbenzene | 45218 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Ethyltoluene | 45212 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Ethyltoluene | 45212 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Ethyltoluene | 45212 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Ethyltoluene | 45212 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| m-Ethyltoluene | 45212 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| m-Ethyltoluene | 45212 | 124 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| m-Ethyltoluene | 45212 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| m-Ethyltoluene | 45212 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| m-Ethyltoluene | 45212 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Ethyltoluene | 45212 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| m-Ethyltoluene | 45212 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Ethyltoluene | 45212 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| m-Ethyltoluene | 45212 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 2.25865 | -2.25865 | 4 | R | Parts per billion Carbon | ||||
| m-Ethyltoluene | 45212 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Ethyltoluene | 45212 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Ethyltoluene | 45212 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Ethyltoluene | 45212 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Ethyltoluene | 45212 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Ethyltoluene | 45212 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| m-Ethyltoluene | 45212 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Ethyltoluene | 45212 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Ethyltoluene | 45212 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Ethyltoluene | 45212 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Ethyltoluene | 45212 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Ethyltoluene | 45212 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Ethyltoluene | 45212 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Ethyltoluene | 45212 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Ethyltoluene | 45212 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Ethyltoluene | 45212 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Ethyltoluene | 45212 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Ethyltoluene | 45212 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Ethyltoluene | 45212 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m-Tolualdehyde | 45508 | 156 | Intermittent | Cartridge DNPH on Silica, Heated O3 Denuder | HPLC Photo Diode Array | 0.328 | -0.328 | 1 | R | Parts per billion Carbon | ||||
| m-Tolualdehyde | 45508 | 165 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | HP LC-1050 W/DIODE ARRAY DETECTOR | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| m-Tolualdehyde | 45508 | 166 | Intermittent | ATEC 2400 W/Waters Silica DNPH | TO-11 Dionex DX-300 Ion Chrmtg | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| m-Tolualdehyde | 45508 | 179 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | Liquid Chromatography w/diode array detection | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| m-Tolualdehyde | 45508 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Xylene | 45205 | 104 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-FID | 0.8 | -0.8 | 1 | R | Parts per billion Carbon | ||||
| m-Xylene | 45205 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 1.6 | -1.6 | 1 | R | Parts per billion Carbon | ||||
| m-Xylene | 45205 | 108 | Intermittent | TEDLAR-BAG-24-HR-SAMPLE | GC PHOTOIONIZATION DETECTOR | 0.8 | -0.8 | 3 | R | Parts per billion Carbon | ||||
| m-Xylene | 45205 | 109 | Intermittent | SS-CANISTER SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.8 | -0.8 | 2 | R | Parts per billion Carbon | ||||
| m-Xylene | 45205 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.8 | -0.8 | 1 | R | Parts per billion Carbon | ||||
| m-Xylene | 45205 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| m-Xylene | 45205 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| m-Xylene | 45205 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Xylene | 45205 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Xylene | 45205 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| m-Xylene | 45205 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 2 | R | Parts per billion Carbon | ||||
| m-Xylene | 45205 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| m-Xylene | 45205 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Xylene | 45205 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| m-Xylene | 45205 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Xylene | 45205 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Xylene | 45205 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Xylene | 45205 | 151 | Intermittent | 6L PRESSURIZED CANISTER | CAPILLARY GC-ECD/PID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| m-Xylene | 45205 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m-Xylene | 45205 | 168 | Intermittent | 6L PRESSURIZED CANISTER | PACKED COLUMN GC - ECD/PID | 1.0 | -1.0 | 2 | R | Parts per billion Carbon | ||||
| m-Xylene | 45205 | 169 | Intermittent | TEDLAR BAG | PACKED COLUMN GC - ECD/PID | 1.0 | -1.0 | 2 | R | Parts per billion Carbon | ||||
| m-Xylene | 45205 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.16 | -0.16 | 3 | R | Parts per billion Carbon | ||||
| m/p Ethyltoluene | 45116 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 092 | Continuous | Tenax/GR/Trap | Thermal Desorber GC/PID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 102 | Intermittent | CARTRIDGE-DNPH-ON-SILICA | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 108 | Intermittent | TEDLAR-BAG-24-HR-SAMPLE | GC PHOTOIONIZATION DETECTOR | 0.8 | -0.8 | 3 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.8 | -0.8 | 2 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 117 | Intermittent | TENAX SORBENT CARTRIDGE | GC/MS | 3.2 | -3.2 | 2 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 118 | Intermittent | TENAX SORBENT CARTRIDGE | GC-FID/ECD | 0.08 | -0.08 | 3 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 119 | Intermittent | PERSONAL PUMP MOLECULAR SIEVE | GC/MS | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 134 | Continuous | Semi-Continuous Analyzer | GC/PID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.48 | -0.48 | 2 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 1.34709 | -1.34709 | 4 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 144 | Intermittent | 3 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.68 | -0.68 | 2 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 151 | Intermittent | 6L PRESSURIZED CANISTER | CAPILLARY GC-ECD/PID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.8 | -0.8 | 2 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 168 | Intermittent | 6L PRESSURIZED CANISTER | PACKED COLUMN GC - ECD/PID | 4.8 | -4.8 | 2 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 169 | Intermittent | TEDLAR BAG | PACKED COLUMN GC - ECD/PID | 4.8 | -4.8 | 2 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.4 | -0.4 | 2 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.16 | -0.16 | 3 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.54 | -0.54 | 2 | R | Parts per billion Carbon | ||||
| m/p Xylene | 45109 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m/p Xylene | 45109 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m/p Xylene | 45109 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m/p Xylene | 45109 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m/p Xylene | 45109 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m/p Xylene | 45109 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m/p Xylene | 45109 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m/p Xylene | 45109 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m/p Xylene | 45109 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m/p Xylene | 45109 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m/p Xylene | 45109 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m/p Xylene | 45109 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| m/p Xylene | 45109 | 903 | Intermittent | SKC Pump Charcoal Tube | GC/FID NIOSH 1501 | 8.78 | -8.78 | 2 | R | Parts per billion Carbon | ||||
| n-Amyl alcohol | 43307 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Amyl alcohol | 43307 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Amyl alcohol | 43307 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Amyl alcohol | 43307 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Amyl alcohol | 43307 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Amyl alcohol | 43307 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Amyl alcohol | 43307 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Amyl alcohol | 43307 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Amyl alcohol | 43307 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Amyl alcohol | 43307 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Amyl alcohol | 43307 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Amyl alcohol | 43307 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Amyl alcohol | 43307 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Amyl alcohol | 43307 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Amyl alcohol | 43307 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Amyl alcohol | 43307 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butane | 43212 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 104 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| n-Butane | 43212 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.52688 | -0.52688 | 4 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 1.65 | -1.65 | 2 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 176 | Intermittent | 6L SUBAMBIENT SS-CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Butane | 43212 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butane | 43212 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butane | 43212 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butane | 43212 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butane | 43212 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butane | 43212 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butane | 43212 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butane | 43212 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butane | 43212 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butane | 43212 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butane | 43212 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butane | 43212 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl acrylate | 43440 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Butyl acrylate | 43440 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl acrylate | 43440 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl acrylate | 43440 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl acrylate | 43440 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl acrylate | 43440 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl acrylate | 43440 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl acrylate | 43440 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl acrylate | 43440 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl acrylate | 43440 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl acrylate | 43440 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl acrylate | 43440 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl acrylate | 43440 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl alcohol | 43305 | 119 | Intermittent | PERSONAL PUMP MOLECULAR SIEVE | GC/MS | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| n-Butyl alcohol | 43305 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Butyl alcohol | 43305 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Butyl alcohol | 43305 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 7.92 | -7.92 | 2 | R | Parts per billion Carbon | ||||
| n-Butyl alcohol | 43305 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Butyl alcohol | 43305 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Butyl alcohol | 43305 | 150 | Intermittent | SS 6L - PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Butyl alcohol | 43305 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl alcohol | 43305 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl alcohol | 43305 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl alcohol | 43305 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl alcohol | 43305 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl alcohol | 43305 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl alcohol | 43305 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl alcohol | 43305 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl alcohol | 43305 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl alcohol | 43305 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl alcohol | 43305 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Butyl alcohol | 43305 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Decane | 43238 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 124 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.6 | -0.6 | 2 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 4.27655 | -4.27655 | 4 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.92 | -0.92 | 2 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 176 | Intermittent | 6L SUBAMBIENT SS-CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Decane | 43238 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Decane | 43238 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Decane | 43238 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Decane | 43238 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Decane | 43238 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Decane | 43238 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Decane | 43238 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Decane | 43238 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Decane | 43238 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Decane | 43238 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Decane | 43238 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Decane | 43238 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Decane | 43238 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.89 | -0.89 | 2 | R | Parts per billion Carbon | ||||
| n-Decane & 1,2,4-trimethylbenzene | 43348 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Dodecane | 43141 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.85 | -0.85 | 2 | R | Parts per billion Carbon | ||||
| n-Dodecane | 43141 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Dodecane | 43141 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| n-Dodecane | 43141 | 124 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| n-Dodecane | 43141 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| n-Dodecane | 43141 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Dodecane | 43141 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| n-Dodecane | 43141 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.9533 | -0.9533 | 4 | R | Parts per billion Carbon | ||||
| n-Dodecane | 43141 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Dodecane | 43141 | 149 | Intermittent | 6L Subatm CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Dodecane | 43141 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Dodecane | 43141 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Dodecane | 43141 | 202 | Continuous | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Dodecane | 43141 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Dodecane | 43141 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Dodecane | 43141 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Dodecane | 43141 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Dodecane | 43141 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Dodecane | 43141 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Dodecane | 43141 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Dodecane | 43141 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Dodecane | 43141 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Dodecane | 43141 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Dodecane | 43141 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Dodecane | 43141 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Dodecane | 43141 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.9 | -0.9 | 2 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 113 | Intermittent | SS-Canister_Pressurized | Capillary GC ITD Mass Spectro | 0.07 | -0.07 | 2 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 116 | Intermittent | MIXED SORBENT CARTRIDGE2 | GC/MS | 29.4 | -29.4 | 1 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.42 | -0.42 | 2 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.45033 | -0.45033 | 4 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.93 | -0.93 | 2 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Heptane | 43232 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Heptane | 43232 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Heptane | 43232 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Heptane | 43232 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Heptane | 43232 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Heptane | 43232 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Heptane | 43232 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Heptane | 43232 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Heptane | 43232 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Heptane | 43232 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Heptane | 43232 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Heptane | 43232 | 902 | Intermittent | SKC Pump Charcoal Tube | GC/FID NIOSH 1500 | 3.35 | -3.35 | 2 | R | Parts per billion Carbon | ||||
| n-Heptane | 43232 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 1.09 | -1.09 | 2 | R | Parts per billion Carbon | ||||
| n-Hexadecane | 16210 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.59 | 0.0 | 2 | R | Micrograms/cubic meter (25 C) | ||||
| n-Hexane | 43231 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 104 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 113 | Intermittent | SS-Canister_Pressurized | Capillary GC ITD Mass Spectro | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 117 | Intermittent | TENAX SORBENT CARTRIDGE | GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 118 | Intermittent | TENAX SORBENT CARTRIDGE | GC-FID/ECD | 0.01 | -0.01 | 3 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.36 | -0.36 | 2 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.29283 | -0.29283 | 4 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.12 | -0.12 | 2 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.24 | -0.24 | 2 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.04 | -0.04 | 3 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Hexane | 43231 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Hexane | 43231 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Hexane | 43231 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Hexane | 43231 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Hexane | 43231 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Hexane | 43231 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Hexane | 43231 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Hexane | 43231 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Hexane | 43231 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Hexane | 43231 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Hexane | 43231 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Hexane | 43231 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Hexane | 43231 | 902 | Intermittent | SKC Pump Charcoal Tube | GC/FID NIOSH 1500 | 3.08 | -3.08 | 2 | R | Parts per billion Carbon | ||||
| n-Hexylbenzene | 45234 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Hexylbenzene | 45234 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.54 | -0.54 | 2 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 2.26451 | -2.26451 | 4 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.94 | -0.94 | 2 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 176 | Intermittent | 6L SUBAMBIENT SS-CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Nonane | 43235 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Nonane | 43235 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Nonane | 43235 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Nonane | 43235 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Nonane | 43235 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Nonane | 43235 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Nonane | 43235 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Nonane | 43235 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Nonane | 43235 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Nonane | 43235 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Nonane | 43235 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Nonane | 43235 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Nonane | 43235 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 1.06 | -1.06 | 2 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.48 | -0.48 | 2 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.69788 | -0.69788 | 4 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.8 | -0.8 | 2 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.4 | -0.4 | 2 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 176 | Intermittent | 6L SUBAMBIENT SS-CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.1 | -1.04 | 1 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Octane | 43233 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Octane | 43233 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Octane | 43233 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Octane | 43233 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Octane | 43233 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Octane | 43233 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Octane | 43233 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Octane | 43233 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Octane | 43233 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Octane | 43233 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Octane | 43233 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Octane | 43233 | 902 | Intermittent | SKC Pump Charcoal Tube | GC/FID NIOSH 1500 | 3.44 | -3.44 | 2 | R | Parts per billion Carbon | ||||
| n-Octane | 43233 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 1.4 | -1.4 | 2 | R | Parts per billion Carbon | ||||
| n-Octane & trans-1,3-dichloropropylene | 43130 | 012 | Intermittent | 6L SS CANISTER-PRESSURIZED | PDFID - NMOC | 0.7 | -0.7 | 1 | R | Parts per billion Carbon | ||||
| n-Octane & trans-1,3-dichloropropylene | 43130 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| n-Pentadecane | 43260 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.98 | -0.98 | 2 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 104 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.5 | -0.5 | 2 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| n-Pentane | 43220 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.60941 | -0.60941 | 4 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.58 | -0.58 | 2 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 176 | Intermittent | 6L SUBAMBIENT SS-CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Pentane | 43220 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Pentane | 43220 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Pentane | 43220 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Pentane | 43220 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Pentane | 43220 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Pentane | 43220 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Pentane | 43220 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Pentane | 43220 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Pentane | 43220 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Pentane | 43220 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Pentane | 43220 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Pentane | 43220 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Pentane | 43220 | 902 | Intermittent | SKC Pump Charcoal Tube | GC/FID NIOSH 1500 | 2.68 | -2.68 | 2 | R | Parts per billion Carbon | ||||
| n-Pinene & benzaldehyde | 43323 | 102 | Intermittent | CARTRIDGE-DNPH-ON-SILICA | HPLC ULTRAVIOLET ABSORPTION | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| n-Propyl acetate | 43434 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Propyl acetate | 43434 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Propyl acetate | 43434 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Propyl acetate | 43434 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Propyl acetate | 43434 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Propyl acetate | 43434 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propyl acetate | 43434 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propyl acetate | 43434 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propyl acetate | 43434 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propyl acetate | 43434 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propyl acetate | 43434 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propyl acetate | 43434 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propyl acetate | 43434 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propyl acetate | 43434 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propyl acetate | 43434 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propyl acetate | 43434 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propyl acetate | 43434 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propyl alcohol | 43303 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Propyl alcohol | 43303 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Propyl alcohol | 43303 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Propyl alcohol | 43303 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Propyl alcohol | 43303 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Propyl alcohol | 43303 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propyl alcohol | 43303 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propyl alcohol | 43303 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propyl alcohol | 43303 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propyl alcohol | 43303 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propyl alcohol | 43303 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propyl alcohol | 43303 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propyl alcohol | 43303 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propyl alcohol | 43303 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propyl alcohol | 43303 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propyl alcohol | 43303 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propyl alcohol | 43303 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propylbenzene | 45209 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Propylbenzene | 45209 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Propylbenzene | 45209 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Propylbenzene | 45209 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Propylbenzene | 45209 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| n-Propylbenzene | 45209 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 3 | R | Parts per billion Carbon | ||||
| n-Propylbenzene | 45209 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Propylbenzene | 45209 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Propylbenzene | 45209 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| n-Propylbenzene | 45209 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Propylbenzene | 45209 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Propylbenzene | 45209 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Propylbenzene | 45209 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.54 | -0.54 | 2 | R | Parts per billion Carbon | ||||
| n-Propylbenzene | 45209 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 2.85747 | -2.85747 | 4 | R | Parts per billion Carbon | ||||
| n-Propylbenzene | 45209 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Propylbenzene | 45209 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.93 | -0.93 | 2 | R | Parts per billion Carbon | ||||
| n-Propylbenzene | 45209 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Propylbenzene | 45209 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Propylbenzene | 45209 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Propylbenzene | 45209 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Propylbenzene | 45209 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Propylbenzene | 45209 | 176 | Intermittent | 6L SUBAMBIENT SS-CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Propylbenzene | 45209 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Propylbenzene | 45209 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propylbenzene | 45209 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propylbenzene | 45209 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propylbenzene | 45209 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propylbenzene | 45209 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propylbenzene | 45209 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propylbenzene | 45209 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propylbenzene | 45209 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propylbenzene | 45209 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propylbenzene | 45209 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propylbenzene | 45209 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Propylbenzene | 45209 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Tetradecane | 43259 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Tetradecane | 43259 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.78 | -0.78 | 2 | R | Parts per billion Carbon | ||||
| n-Tridecane | 43143 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.85 | -0.85 | 2 | R | Parts per billion Carbon | ||||
| n-Tridecane | 43143 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| n-Tridecane | 43143 | 124 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| n-Tridecane | 43143 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Tridecane | 43143 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Tridecane | 43143 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.95 | -0.95 | 2 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 124 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.77 | -0.77 | 2 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 2.18391 | -2.18391 | 4 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 1.61 | -1.61 | 2 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon - GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 176 | Intermittent | 6L SUBAMBIENT SS-CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| n-Undecane | 43954 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Undecane | 43954 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Undecane | 43954 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Undecane | 43954 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Undecane | 43954 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Undecane | 43954 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Undecane | 43954 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Undecane | 43954 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Undecane | 43954 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Undecane | 43954 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Undecane | 43954 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Undecane | 43954 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| n-Undecane | 43954 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.79 | -0.79 | 2 | R | Parts per billion Carbon | ||||
| o-Cresol (TSP) STP | 17301 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 45.7 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| o-Cresol (TSP) STP | 17301 | 118 | Intermittent | Hi Vol/PUF-XAD-2 | GCMS TO-13 | 0.0474 | 0.0 | 4 | R | Nanograms/cubic meter (25 C) | ||||
| o-Cresol (TSP) STP | 17301 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | 0.0 | 2 | R | Nanograms/cubic meter (25 C) | ||||
| o-Diethylbenzene | 45217 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Diethylbenzene | 45217 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Ethyltoluene | 45211 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Ethyltoluene | 45211 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Ethyltoluene | 45211 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE;C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Ethyltoluene | 45211 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Ethyltoluene | 45211 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| o-Ethyltoluene | 45211 | 124 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| o-Ethyltoluene | 45211 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| o-Ethyltoluene | 45211 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| o-Ethyltoluene | 45211 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Ethyltoluene | 45211 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| o-Ethyltoluene | 45211 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Ethyltoluene | 45211 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.54 | -0.54 | 2 | R | Parts per billion Carbon | ||||
| o-Ethyltoluene | 45211 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 3.57181 | -3.57181 | 4 | R | Parts per billion Carbon | ||||
| o-Ethyltoluene | 45211 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Ethyltoluene | 45211 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Ethyltoluene | 45211 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Ethyltoluene | 45211 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Ethyltoluene | 45211 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Ethyltoluene | 45211 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| o-Ethyltoluene | 45211 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Ethyltoluene | 45211 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Ethyltoluene | 45211 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Ethyltoluene | 45211 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Ethyltoluene | 45211 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Ethyltoluene | 45211 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Ethyltoluene | 45211 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Ethyltoluene | 45211 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Ethyltoluene | 45211 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Ethyltoluene | 45211 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Ethyltoluene | 45211 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Ethyltoluene | 45211 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Ethyltoluene | 45211 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Tolualdehyde | 45505 | 102 | Intermittent | CARTRIDGE-DNPH-ON-SILICA | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Tolualdehyde | 45505 | 114 | Intermittent | CARTRIDGE-DNPH-SILICA-SEP-PAK | HPLC-PHOTODIODE ARRAY | 0.085 | -0.085 | 2 | R | Parts per billion Carbon | ||||
| o-Tolualdehyde | 45505 | 156 | Intermittent | Cartridge DNPH on Silica, Heated O3 Denuder | HPLC Photo Diode Array | 0.175 | -0.175 | 2 | R | Parts per billion Carbon | ||||
| o-Tolualdehyde | 45505 | 165 | Intermittent | ATEC 2400 W/Waters Silica DNPH | HP LC-1050 W/Diode Array Detector | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| o-Tolualdehyde | 45505 | 166 | Intermittent | ATEC 2400 W/Waters Silica DNPH | TO-11 Dionex DX-300 Ion Chrmtg | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| o-Tolualdehyde | 45505 | 179 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | Liquid Chromatography w/diode array detection | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| o-Tolualdehyde | 45505 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Toluidine (TSP) STP | 17710 | 116 | Intermittent | Hi Vol/XAD-2 | GC/MS | 37.6 | 0.0 | 1 | R | Nanograms/cubic meter (25 C) | ||||
| o-Xylene | 45204 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 092 | Continuous | Tenax/GR/Trap | Thermal Desorber GC/PID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 1.6 | -1.6 | 1 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 108 | Intermittent | TEDLAR-BAG-24-HR-SAMPLE | GC PHOTOIONIZATION DETECTOR | 0.8 | -0.8 | 3 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.8 | -0.8 | 2 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 117 | Intermittent | TENAX SORBENT CARTRIDGE | GC/MS | 0.8 | -0.8 | 1 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 118 | Intermittent | TENAX SORBENT CARTRIDGE | GC-FID/ECD | 0.08 | -0.08 | 3 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 119 | Intermittent | PERSONAL PUMP MOLECULAR SIEVE | GC/MS | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 134 | Continuous | Semi-Continuous Analyzer | GC/PID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.72 | -0.72 | 2 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 1.87895 | -1.87895 | 4 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 144 | Intermittent | 3 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.74 | -0.74 | 2 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 151 | Intermittent | 6L PRESSURIZED CANISTER | CAPILLARY GC-ECD/PID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.4 | -0.4 | 2 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 168 | Intermittent | 6L PRESSURIZED CANISTER | PACKED COLUMN GC - ECD/PID | 0.8 | -0.8 | 2 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 169 | Intermittent | TEDLAR BAG | PACKED COLUMN GC - ECD/PID | 0.8 | -0.8 | 2 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.16 | -0.16 | 2 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.16 | -0.16 | 3 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.96 | -0.96 | 2 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Xylene | 45204 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Xylene | 45204 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Xylene | 45204 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Xylene | 45204 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Xylene | 45204 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Xylene | 45204 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Xylene | 45204 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Xylene | 45204 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Xylene | 45204 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Xylene | 45204 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Xylene | 45204 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| o-Xylene | 45204 | 903 | Intermittent | SKC Pump Charcoal Tube | GC/FID NIOSH 1501 | 4.47 | -4.47 | 2 | R | Parts per billion Carbon | ||||
| o-Xylene | 45204 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 1.02 | -1.02 | 2 | R | Parts per billion Carbon | ||||
| o-Xylene & 1,1,2,2-tetrachloroethane | 45112 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| o-Xylene & 1,1,2,2-tetrachloroethane | 45112 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Cresol (TSP) STP | 17303 | 178 | Intermittent | Hi Vol PUF/XAD | GC-MS | 0.5 | 0.0 | 2 | Nanograms/cubic meter (25 C) | |||||
| p-Diethylbenzene | 45219 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Diethylbenzene | 45219 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Diethylbenzene | 45219 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| p-Diethylbenzene | 45219 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Diethylbenzene | 45219 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Diethylbenzene | 45219 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| p-Diethylbenzene | 45219 | 124 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| p-Diethylbenzene | 45219 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| p-Diethylbenzene | 45219 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| p-Diethylbenzene | 45219 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Diethylbenzene | 45219 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| p-Diethylbenzene | 45219 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Diethylbenzene | 45219 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| p-Diethylbenzene | 45219 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 1.87871 | -1.87871 | 4 | R | Parts per billion Carbon | ||||
| p-Diethylbenzene | 45219 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Diethylbenzene | 45219 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Diethylbenzene | 45219 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Diethylbenzene | 45219 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Diethylbenzene | 45219 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Diethylbenzene | 45219 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| p-Diethylbenzene | 45219 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Diethylbenzene | 45219 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Diethylbenzene | 45219 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Diethylbenzene | 45219 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Diethylbenzene | 45219 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Diethylbenzene | 45219 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Diethylbenzene | 45219 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Diethylbenzene | 45219 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Diethylbenzene | 45219 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Diethylbenzene | 45219 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Diethylbenzene | 45219 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Diethylbenzene | 45219 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Diethylbenzene | 45219 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Ethyltoluene | 45213 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.9 | -0.9 | 1 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 29.4 | -29.4 | 1 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 124 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID | 1.0 | -1.0 | 1 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.54 | -0.54 | 2 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 3.295 | -3.295 | 4 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.02 | -0.02 | 2 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.18 | -0.18 | 3 | R | Parts per billion Carbon | ||||
| p-Ethyltoluene | 45213 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Ethyltoluene | 45213 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Ethyltoluene | 45213 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Ethyltoluene | 45213 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Ethyltoluene | 45213 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Ethyltoluene | 45213 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Ethyltoluene | 45213 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Ethyltoluene | 45213 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Ethyltoluene | 45213 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Ethyltoluene | 45213 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Ethyltoluene | 45213 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Ethyltoluene | 45213 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| p-Tolualdehyde | 45507 | 114 | Intermittent | CARTRIDGE-DNPH-SILICA-SEP-PAK | HPLC-PHOTODIODE ARRAY | 0.085 | -0.085 | 2 | R | Parts per billion Carbon | ||||
| p-Tolualdehyde | 45507 | 156 | Intermittent | Cartridge DNPH on Silica, Heated O3 Denuder | HPLC Photo Diode Array | 0.1326 | -0.1326 | 2 | R | Parts per billion Carbon | ||||
| p-Tolualdehyde | 45507 | 165 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | HP LC-1050 W/DIODE ARRAY DETECTOR | 0.03 | -0.03 | 2 | R | Parts per billion Carbon | ||||
| p-Tolualdehyde | 45507 | 166 | Intermittent | ATEC 2400 W/Waters Silica DNPH | TO-11 Dionex DX-300 Ion Chrmtg | 0.003 | -0.003 | 2 | R | Parts per billion Carbon | ||||
| p-Tolualdehyde | 45507 | 179 | Intermittent | ATEC 2400 W/WATERS SILICA DNPH | Liquid Chromatography w/diode array detection | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| p-Tolualdehyde | 45507 | 202 | Intermittent | SILICA-DNPH-CART-KI O3 SCRUB | HPLC ULTRAVIOLET ABSORPTION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Xylene | 45206 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 32.0 | -32.0 | 0 | R | Parts per billion Carbon | ||||
| p-Xylene | 45206 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Xylene | 45206 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 1.6 | -1.6 | 1 | R | Parts per billion Carbon | ||||
| p-Xylene | 45206 | 108 | Intermittent | TEDLAR-BAG-24-HR-SAMPLE | GC PHOTOIONIZATION DETECTOR | 0.8 | -0.8 | 3 | R | Parts per billion Carbon | ||||
| p-Xylene | 45206 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.8 | -0.8 | 2 | R | Parts per billion Carbon | ||||
| p-Xylene | 45206 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Xylene | 45206 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Xylene | 45206 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| p-Xylene | 45206 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 2 | R | Parts per billion Carbon | ||||
| p-Xylene | 45206 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| p-Xylene | 45206 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Xylene | 45206 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| p-Xylene | 45206 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Xylene | 45206 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Xylene | 45206 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Xylene | 45206 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Xylene | 45206 | 151 | Intermittent | 6L PRESSURIZED CANISTER | CAPILLARY GC-ECD/PID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| p-Xylene | 45206 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| p-Xylene | 45206 | 168 | Intermittent | 6L PRESSURIZED CANISTER | PACKED COLUMN GC - ECD/PID | 1.0 | -1.0 | 2 | R | Parts per billion Carbon | ||||
| p-Xylene | 45206 | 169 | Intermittent | TEDLAR BAG | PACKED COLUMN GC - ECD/PID | 1.0 | -1.0 | 2 | R | Parts per billion Carbon | ||||
| p-Xylene | 45206 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.16 | -0.16 | 3 | R | Parts per billion Carbon | ||||
| p-Xylene | 45206 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.83 | -0.83 | 2 | R | Parts per billion Carbon | ||||
| p-isopropyltoluene | 43397 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/MS/FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| p-tert-butyl toluene | 45230 | 908 | Intermittent | SKC Pump Charcoal Tube | GC/MS REAC SOP 1816 | 0.78 | -0.78 | 2 | R | Parts per billion Carbon | ||||
| pH (Dustfall) | 22602 | 071 | Intermittent | BUCKET | PH METER | 0.01 | 0.0 | 2 | R | pH Units | ||||
| pH (Dustfall) | 22602 | 075 | Intermittent | ANDERSON DUSTFALL BUCKET | GLASS ELECTRODE | 0.1 | 0.0 | 1 | R | pH Units | ||||
| pH (Dustfall) | 22602 | 081 | Intermittent | BUCKET | PH METER | 0.01 | 0.0 | 2 | R | pH Units | ||||
| sec-Butylbenzene | 45216 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| sec-Butylbenzene | 45216 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| tert-Butyl ethyl ether | 43396 | 101 | Intermittent | Canister Subambient Pressure | Multi Detector GC | 0.05 | -0.05 | 2 | R | Parts per billion Carbon | ||||
| tert-Butyl ethyl ether | 43396 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| tert-Butyl ethyl ether | 43396 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 1.2 | -1.2 | 2 | R | Parts per billion Carbon | ||||
| tert-Butyl ethyl ether | 43396 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| tert-Butyl ethyl ether | 43396 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.05 | -0.05 | 2 | R | Parts per billion Carbon | ||||
| tert-Butyl ethyl ether | 43396 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | Entech Precon- GC/FID/MSD | 0.05 | -0.05 | 2 | R | Parts per billion Carbon | ||||
| tert-Butyl ethyl ether | 43396 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.36 | -0.36 | 2 | R | Parts per billion Carbon | ||||
| tert-Butyl ethyl ether | 43396 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| tert-Butyl ethyl ether | 43396 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| tert-Butyl ethyl ether | 43396 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| tert-Butyl ethyl ether | 43396 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| tert-Butyl ethyl ether | 43396 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| tert-Butyl ethyl ether | 43396 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| tert-Butyl ethyl ether | 43396 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| tert-Butyl ethyl ether | 43396 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| tert-Butyl ethyl ether | 43396 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| tert-Butyl ethyl ether | 43396 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| tert-Butyl ethyl ether | 43396 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| tert-Butyl ethyl ether | 43396 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| tert-butyl alcohol | 43309 | 150 | Intermittent | SS 6-L Pressurized Canister | Cryogenic Precon: GC/MS | 0.048 | 3 | Parts per billion Carbon | ||||||
| tert-butyl alcohol | 43309 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.048 | -0.048 | 3 | Parts per billion Carbon | |||||
| trans-1,2-Dichloroethylene | 43838 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 0.018 | -0.018 | 2 | R | Parts per billion Carbon | ||||
| trans-1,2-Dichloroethylene | 43838 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| trans-1,2-Dichloroethylene | 43838 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.5 | -0.5 | 1 | R | Parts per billion Carbon | ||||
| trans-1,2-Dichloroethylene | 43838 | 105 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| trans-1,2-Dichloroethylene | 43838 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| trans-1,2-Dichloroethylene | 43838 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| trans-1,2-Dichloroethylene | 43838 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| trans-1,2-Dichloroethylene | 43838 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.01 | -0.01 | 3 | R | Parts per billion Carbon | ||||
| trans-1,2-Dichloroethylene | 43838 | 116 | Intermittent | Mixed Sorbent Cartridge | GC/MS | 0.32 | -0.32 | 1 | R | Parts per billion Carbon | ||||
| trans-1,2-Dichloroethylene | 43838 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| trans-1,2-Dichloroethylene | 43838 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| trans-1,2-Dichloroethylene | 43838 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| trans-1,2-Dichloroethylene | 43838 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| trans-1,2-Dichloroethylene | 43838 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-1,2-Dichloroethylene | 43838 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.2 | -0.2 | 2 | R | Parts per billion Carbon | ||||
| trans-1,2-Dichloroethylene | 43838 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.04 | -0.04 | 2 | R | Parts per billion Carbon | ||||
| trans-1,2-Dichloroethylene | 43838 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.04 | -0.04 | 3 | R | Parts per billion Carbon | ||||
| trans-1,2-Dichloroethylene | 43838 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.16 | -0.16 | 2 | R | Parts per billion Carbon | ||||
| trans-1,2-Dichloroethylene | 43838 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,2-Dichloroethylene | 43838 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,2-Dichloroethylene | 43838 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,2-Dichloroethylene | 43838 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,2-Dichloroethylene | 43838 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,2-Dichloroethylene | 43838 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,2-Dichloroethylene | 43838 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,2-Dichloroethylene | 43838 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,2-Dichloroethylene | 43838 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,2-Dichloroethylene | 43838 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,2-Dichloroethylene | 43838 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,2-Dichloroethylene | 43838 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,3-Dichloropropene | 43830 | 051 | Intermittent | PERSONAL-PUMPS | TENAX DESORPTION GC/MS | 6.0 | -6.0 | 0 | R | Parts per billion Carbon | ||||
| trans-1,3-Dichloropropene | 43830 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| trans-1,3-Dichloropropene | 43830 | 103 | Intermittent | TENAX/SPHEROCARB-SORBENT-TRAP | HEAT DESORPTION GC-HECD | 0.66 | -0.66 | 1 | R | Parts per billion Carbon | ||||
| trans-1,3-Dichloropropene | 43830 | 105 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-ECD | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| trans-1,3-Dichloropropene | 43830 | 106 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | CARBON DISULFIDE DESORPTION GC-FID | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| trans-1,3-Dichloropropene | 43830 | 109 | Intermittent | SS-CANISTER-SUBAMBIENT-PRESURE | GAS CHROMATOGRAPH MASS SELECTIV DET | 0.3 | -0.3 | 2 | R | Parts per billion Carbon | ||||
| trans-1,3-Dichloropropene | 43830 | 110 | Intermittent | SS-CANISTER-PRESSURIZED | GAS CHROMATOGRAPH MASS SPECTRO | 0.3 | -0.3 | 2 | R | Parts per billion Carbon | ||||
| trans-1,3-Dichloropropene | 43830 | 112 | Intermittent | CHARCOAL-TUBE-PERSONAL-PUMP | HEAT DESORPTION GC-HALL | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| trans-1,3-Dichloropropene | 43830 | 113 | Intermittent | SS-CANISTER-PRESSURIZED | CAPILLARY GC ITD MASS SPECTRO | 0.06 | -0.06 | 2 | R | Parts per billion Carbon | ||||
| trans-1,3-Dichloropropene | 43830 | 116 | Intermittent | MIXED SORBENT CARTRIDGE | GC/MS | 0.32 | -0.32 | 3 | R | Parts per billion Carbon | ||||
| trans-1,3-Dichloropropene | 43830 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| trans-1,3-Dichloropropene | 43830 | 136 | Continuous | Instrumental | ENTECH 2000 W/MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-1,3-Dichloropropene | 43830 | 145 | Intermittent | 6 L SS Canister Subamb press, passive coll | GC/Mass Spectro | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| trans-1,3-Dichloropropene | 43830 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSDD | 0.6 | -0.6 | 1 | R | Parts per billion Carbon | ||||
| trans-1,3-Dichloropropene | 43830 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-1,3-Dichloropropene | 43830 | 153 | Intermittent | Pressurized Canister | GC with Multiple Detectors | 0.3 | -0.3 | 2 | R | Parts per billion Carbon | ||||
| trans-1,3-Dichloropropene | 43830 | 171 | Intermittent | 6L Pressurized Canister | Precon Saturn GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| trans-1,3-Dichloropropene | 43830 | 172 | Intermittent | 6L Pressurized Canister | Precon HP GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| trans-1,3-Dichloropropene | 43830 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| trans-1,3-Dichloropropene | 43830 | 176 | Intermittent | 6L SUBATM SS CANISTER | ENTECH PRECONCENTRATOR GC/MS | 0.18 | -0.18 | 2 | R | Parts per billion Carbon | ||||
| trans-1,3-Dichloropropene | 43830 | 210 | Intermittent | SS 6L Pressurized Canister | Cryogenic Precon GC/MS | 0.06 | -0.06 | 3 | R | Parts per billion Carbon | ||||
| trans-1,3-Dichloropropene | 43830 | 211 | Intermittent | SS Canister Subambient Pressure | Gas Chromatograph Mass Spectro | 0.27 | -0.27 | 2 | R | Parts per billion Carbon | ||||
| trans-1,3-Dichloropropene | 43830 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,3-Dichloropropene | 43830 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,3-Dichloropropene | 43830 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,3-Dichloropropene | 43830 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,3-Dichloropropene | 43830 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,3-Dichloropropene | 43830 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,3-Dichloropropene | 43830 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,3-Dichloropropene | 43830 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,3-Dichloropropene | 43830 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,3-Dichloropropene | 43830 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,3-Dichloropropene | 43830 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,3-Dichloropropene | 43830 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-1,3-Dimethylcyclopentane | 43394 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| trans-2-Butene | 43216 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Butene | 43216 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Butene | 43216 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Butene | 43216 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Butene | 43216 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Butene | 43216 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Butene | 43216 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| trans-2-Butene | 43216 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Butene | 43216 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| trans-2-Butene | 43216 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Butene | 43216 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Butene | 43216 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Butene | 43216 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| trans-2-Butene | 43216 | 141 | Continuous | IR Spectrometer | Spectra reference matching with PLS | 6.0 | -6.0 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Butene | 43216 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.55709 | -0.55709 | 4 | R | Parts per billion Carbon | ||||
| trans-2-Butene | 43216 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Butene | 43216 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| trans-2-Butene | 43216 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| trans-2-Butene | 43216 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Butene | 43216 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Butene | 43216 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Butene | 43216 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| trans-2-Butene | 43216 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Butene | 43216 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Butene | 43216 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Butene | 43216 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Butene | 43216 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Butene | 43216 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Butene | 43216 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Butene | 43216 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Butene | 43216 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Butene | 43216 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Butene | 43216 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Butene | 43216 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Butene | 43216 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Hexene | 43289 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Hexene | 43289 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Hexene | 43289 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Hexene | 43289 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Hexene | 43289 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Hexene | 43289 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Hexene | 43289 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| trans-2-Hexene | 43289 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Hexene | 43289 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| trans-2-Hexene | 43289 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Hexene | 43289 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Hexene | 43289 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Hexene | 43289 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.41 | -0.41 | 2 | R | Parts per billion Carbon | ||||
| trans-2-Hexene | 43289 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Hexene | 43289 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Hexene | 43289 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Hexene | 43289 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Hexene | 43289 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| trans-2-Hexene | 43289 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Hexene | 43289 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Hexene | 43289 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Hexene | 43289 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Hexene | 43289 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Hexene | 43289 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Hexene | 43289 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Hexene | 43289 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Hexene | 43289 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Hexene | 43289 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Hexene | 43289 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Hexene | 43289 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Pentene | 43226 | 091 | Continuous | MANUAL | FLAME IONIZATION | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Pentene | 43226 | 101 | Intermittent | CANISTER SUBAMBIENT PRESSURE | MULTI DETECTOR GC | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Pentene | 43226 | 120 | Intermittent | SORBANT TUBE-CARBOSIEVE-C-TRAP | GAS CHROMATOGRAPH W/FLAME; GC FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Pentene | 43226 | 122 | Intermittent | 6L AMBIENT CANISTER | DUAL FID - PAMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Pentene | 43226 | 123 | Intermittent | 6L PRESSURIZED CANISTER | DUAL FID - PAMS | 0.01 | -0.01 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Pentene | 43226 | 125 | Continuous | PRECONCENTRATION TRAP | CHROMPACK AUTOMATED GC- SUBAMB FID | 0.136 | -0.136 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Pentene | 43226 | 126 | Intermittent | SS CANISTER PRESSURIZED | CRYOGENIC PRECONCENTRATION GC/FID | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| trans-2-Pentene | 43226 | 127 | Intermittent | 6L SUBAMBIENT SS-CANISTER | INCOS 50XL GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Pentene | 43226 | 128 | Continuous | PRECONCENTRATION TRAP | PE 8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.01 | -0.01 | 2 | R | Parts per billion Carbon | ||||
| trans-2-Pentene | 43226 | 129 | Intermittent | 6L SUBAMBIENT SS-CANISTER | VARIAN SATURN-2 GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Pentene | 43226 | 135 | Continuous | INSTRUMENTAL | ENTECH CRYFOCUS/VARIAN GC/FINN DTMS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Pentene | 43226 | 136 | Continuous | INSTRUMENTAL | ENTECH 2000 W/ MS/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Pentene | 43226 | 137 | Continuous | Instrumental | AIRCO-VOC C6/C12 GC/FID | 0.1 | 2 | R | Parts per billion Carbon | |||||
| trans-2-Pentene | 43226 | 142 | Continuous | Preconcen trap/Thermal Desorber | Auto GC (PE Clarus 500 dual col) | 0.60675 | -0.60675 | 4 | R | Parts per billion Carbon | ||||
| trans-2-Pentene | 43226 | 146 | Intermittent | 6L PRESSURIZED CANISTER | PE8700;AUTO GC;SUBAMBIENT-DUAL FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Pentene | 43226 | 147 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - SATURN II GC/FID | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| trans-2-Pentene | 43226 | 148 | Intermittent | 6L PRESSURIZED CANISTER | ENTECH PRECON - HP GC/FTIR/MS | 0.08 | -0.08 | 2 | R | Parts per billion Carbon | ||||
| trans-2-Pentene | 43226 | 149 | Intermittent | 6L SUBATM CANISTER | Entech Precon- GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Pentene | 43226 | 150 | Intermittent | SS 6L- PRESSURIZED CANISTER | CRYOGENIC PRECON: GC/MS | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Pentene | 43226 | 152 | Intermittent | SS-CANISTER-AMBIENT | PRECONCENTRATOR GC/FID | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Pentene | 43226 | 175 | Intermittent | Passivated Canister | Cryogenic Preconcentration GC/MS | 0.1 | -0.1 | 2 | R | Parts per billion Carbon | ||||
| trans-2-Pentene | 43226 | 177 | Intermittent | SS Canister Pressurized | Preconcentrator GC/FID/MSD | 0.1 | -0.1 | 1 | R | Parts per billion Carbon | ||||
| trans-2-Pentene | 43226 | 221 | Continuous | Preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Pentene | 43226 | 222 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response - factor adjusted | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Pentene | 43226 | 223 | Continuous | preconcentrator trap/thermal desorber - no drier | CAS AirmOzone - benzene response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Pentene | 43226 | 224 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | CAS AirmOzone - butane response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Pentene | 43226 | 225 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Pentene | 43226 | 226 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Pentene | 43226 | 227 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Pentene | 43226 | 228 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - carbon response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Pentene | 43226 | 229 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | PerkinElmer auto-GC dual FID – individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Pentene | 43226 | 230 | Continuous | preconcentrator trap/thermal desorber - Nafion drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Pentene | 43226 | 231 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes Unity TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon | |||
| trans-2-Pentene | 43226 | 232 | Continuous | preconcentrator trap/thermal desorber - electronic drier | Markes CIA TD/Agilent GC dual FID - individual compound response | 0.5 | -1.0 | 1000.0 | 4 | R | Parts per billion Carbon |